diff --git a/CHANGES-splitCyclic b/CHANGES-splitCyclic new file mode 100644 index 0000000000000000000000000000000000000000..fc0ff4880f6ffa3c0ec73d62c35b4e412e56ec8b --- /dev/null +++ b/CHANGES-splitCyclic @@ -0,0 +1,113 @@ +Short overview of the changes to have cyclics split into two halves. + +Cyclics +------- +The two cyclic halves are now split like processor patches. There should be no +difference in running. + +Advantages: +- decomposed cyclics can now be handled properly. It just needs to preserve +the cyclic patch it originates from. +- We can now construct a table of global transformations and handle +points/edges/cells with transformations. +- face ordering after topological changes becomes much easier since we +now preserve what half the face comes from. +- cyclic handling becomes more consistent with processor handling and can +quite often be handled in the same condition. +- transformation tensors now become single entry. + +The disadvantages: +- a patch-wise loop now might need to store data to go to the neighbour half +since it is no longer handled in a single patch. +- decomposed cyclics now require overlapping communications so will +only work in non-blocking mode. Hence the underlying message passing library +will require overlapping communications with message tags. +- it is quite a code-change and there might be some oversights. +- once converted (see foamUpgradeCyclics below) cases are not backwards +compatible with previous versions. + + +blockMesh +--------- +blockMeshDict now allows patch definition using the construct-from-dictionary +constructor. This helps defining patches that require additional input e.g. +directMapped and now cyclic: + +boundary +( + sides2_half0 + { + type cyclic; + neighbourPatch sides2_half1; + faces ((2 4 5 3)); + } + +The syntax is - like the polyMesh/boundary file - a list of dictionaries with +one additional entry 'faces' for the block faces. Above shows the new +required entry 'neighbourPatch' for cyclic. + +blockMesh still reads the old format. For a cyclic it will automatically +introduce two patches for the halves, with names xxx_half0 and xxx_half1. + + +foamUpgradeCyclics +------------------ +This is a tool which reads the polyMesh/boundary file and any vol/surface/point +fields and converts them. +It will check if anything needs to be converted, backup the current file to .old +and split any cyclic patchFields into two entries. + + +decomposePar +------------ +Decomposes cyclics into processorCyclic: + + procBoundary0to1throughsides1_half0 + { + type processorCyclic; + nFaces 1000; + startFace 91350; + myProcNo 0; + neighbProcNo 1; + referPatch sides1_half0; + } + +They have an additional 'referPatch' entry which gives the (cyclic) patch +to use for any transformation. + + +Details +------- +- the cyclic patch dictionary has an entry neighbourPatch. The +patch has new member functions: + + //- Get neighbouring patchID + label neighbPatchID() const + + //- Get neighbouring patch + const cyclicPolyPatch& neighbPatch() + + //- Am I the owner half + bool owner() + +The cyclic still has forward() and reverse() transformations (with +the reverse() equal to the neighbPatch().forward()). + +There is no transformLocalFace anymore - the ordering is the same for +both halves. + + +- 'pure' processor patches now are always coincident - they (should) have no +transformation. As said above cyclics are decomposed into a derived +type 'processorCyclic'. + + +- processor patches use overlapping communication using a different message +tag. This maps straight through into the MPI message tag. + + +- when constructing a GeometricField from a dictionary it will explicitly +check for non-existing entries for cyclic patches and exit with an error message +warning to run foamUpgradeCyclics. + + diff --git a/TODO b/TODO new file mode 100644 index 0000000000000000000000000000000000000000..de142d2889f8a5c53a0207d5d35239752ca6b2f8 --- /dev/null +++ b/TODO @@ -0,0 +1,100 @@ +- allocate/free tags. +Not tested. + +OK - test blockMesh with cyclics +unitTestCases/singleCyclic/ + +OK - test cyclics sequential running. +unitTestCases/singleCyclic/ + +OK - test decomposePar +tested channel395 + +OK - FaceCellWave + unitTestCases/twoCavityCyclicForWallDistance/ + +OK - non-parallel finite volume : channelFoam + unitTestCases/channel395-splitCyclic vs. channel395-dev + +OK - parallel finite volume with processorCyclic: channelFoam + unitTestCases/channel395-splitCyclic vs. channel395-dev + +OK - preProcessing/foamUpgradeCyclics + +OK - gamg - sequential. +Tested on channel395-splitCyclic with GAMG. +OK - gamg parallel. +Tested on channel395-splitCyclic with GAMG. + +- initTransfer in GAMGprocessorInterfaces using nonblocking+tags +untested. + +OK - cyclic baffles. +Tested on t-junction-with-fan + +OK. - jumpCyclics/fanFvPatchField. All usages of jump() now need to account +for being owner() or not. +Tested on t-junction-with-fan. + +OK - regionSplit +tested on singleCyclic + +OK - pointFields on cyclics. volPointInterpolation. +tested on channel395-splitCyclic + +OK - fvMeshSubset +tested on singleCyclic + +OK - pointEdgeWave (maybe test through inversePointDistanceDiffusivity?) +tested on twoCavityCyclicForWallDistance + +OK - scotchDecomp +tested with testCalcCSR on twoCavityCyclicForWallDistance + +NOT WORKING - fvMeshDistribute to split cyclic patches into ones + with different separation. +tested on singleCyclic + +OK - test createPatch pointSync +note: only works if face-centre position of 0th faces is ok since uses +this for separation. Should in fact make cyclic planar using patch centre and +normal? +test on twoCavityCyclicForWallDistance with point (0 1 0) set to (0 1.001 0) + +NO PROBLEM - renumberMesh +It doesn't do renumbering through cyclics. + +OK - rotational cyclics. +Tested on movingCone-with-cyclics + +OK - LUscalarMatrix::convert still expects interfaces to be cyclic +tested on channel395 with 'directSolveCoarsest true;' + +OK - grep for size()/2 + +- all tutorials with cyclics: + OK - incompressible/DNS/dnsFoam/boxTurb16 + OK - incompressible/channelFoam/channel395 + slight differences due to divergence. combustion/XiFoam/les/pitzDaily3D + OK - no cyclics. combustion/fireFoam/les/smallPoolFire2D + discreteMethods/dsmcFoam/freeSpacePeriodic + discreteMethods/dsmcFoam/wedge15Ma5 + discreteMethods/molecularDynamics/mdEquilibrationFoam/periodicCubeArgon + OK - incompressible/boundaryFoam/boundaryLaunderSharma + OK - incompressible/boundaryFoam/boundaryWallFunctions + OK - incompressible/boundaryFoam/boundaryWallFunctionsProfile + OK - needs createBaffles. incompressible/pimpleFoam/t-junction-with-fan + OK - incompressible/simpleSRFFoam/mixer + OK - needs createBaffles. lagrangian/porousExplicitSourceReactingParcelFoam/filter + needs special coupledbcs. lagrangian/reactingParcelFilmFoam/multipleBoxes + + +OK - createBaffles + +- have foamUpgradeCyclics split 'value' field +- activeBaffleVelocity +- kivaToFoam/readKivaGrid.H sorts cyclics (but in incorrect order?) +- isoSurface.C +- referredCellList.C +- work out scheduled communication? +OK - add neighbourPatch checking to 16x. diff --git a/applications/solvers/lagrangian/incompressibleUncoupledKinematicParcelFoam/createFields.H b/applications/solvers/lagrangian/incompressibleUncoupledKinematicParcelFoam/createFields.H index d98e9369b8a87828a16dc020e59c12be469ba769..179ac149badfef1c97ec876a581d746f4195ce69 100644 --- a/applications/solvers/lagrangian/incompressibleUncoupledKinematicParcelFoam/createFields.H +++ b/applications/solvers/lagrangian/incompressibleUncoupledKinematicParcelFoam/createFields.H @@ -1,4 +1,4 @@ - Info<< "Reading transportProperties\n" << endl; + Info<< "\nReading transportProperties\n" << endl; IOdictionary transportProperties ( @@ -31,7 +31,7 @@ rhoInfValue ); - Info<< "\nReading field U\n" << endl; + Info<< "Reading field U\n" << endl; volVectorField U ( IOobject @@ -127,7 +127,7 @@ if (HdotGradHheader.headerOk()) { - Info<< "\nReading field HdotGradH\n" << endl; + Info<< "Reading field HdotGradH" << endl; HdotGradHPtr_.reset ( diff --git a/applications/utilities/mesh/advanced/combinePatchFaces/combinePatchFaces.C b/applications/utilities/mesh/advanced/combinePatchFaces/combinePatchFaces.C index 56ea5e124f47d1d4ea52c414e2ad93e76c357e33..0b09b7859d730cb90cbb079deaef88d690eee64b 100644 --- a/applications/utilities/mesh/advanced/combinePatchFaces/combinePatchFaces.C +++ b/applications/utilities/mesh/advanced/combinePatchFaces/combinePatchFaces.C @@ -295,8 +295,7 @@ label mergePatchFaces const faceZone& fZone = mesh.faceZones()[zoneID]; zoneFlip = fZone.flipMap()[fZone.whichFace(newMasterI)]; } - label patchI = mesh.boundaryMesh().whichPatch(newMasterI); - + label patchID = mesh.boundaryMesh().whichPatch(newMasterI); Pout<< "Restoring new master face " << newMasterI << " to vertices " << setFaceVerts[0] << endl; @@ -311,7 +310,7 @@ label mergePatchFaces own, // owner -1, // neighbour false, // face flip - patchI, // patch for face + patchID, // patch for face false, // remove from zone zoneID, // zone for face zoneFlip // face flip in zone @@ -336,7 +335,7 @@ label mergePatchFaces -1, // masterEdgeID, newMasterI, // masterFaceID, false, // flipFaceFlux, - patchI, // patchID, + patchID, // patchID, zoneID, // zoneID, zoneFlip // zoneFlip ) diff --git a/applications/utilities/mesh/generation/blockMesh/blockMeshApp.C b/applications/utilities/mesh/generation/blockMesh/blockMeshApp.C index b896cb30335bab051d94cf45343c7a1013794ca5..3f8086bb8038dd03236912dec6721cd43e19c73b 100644 --- a/applications/utilities/mesh/generation/blockMesh/blockMeshApp.C +++ b/applications/utilities/mesh/generation/blockMesh/blockMeshApp.C @@ -206,25 +206,8 @@ int main(int argc, char *argv[]) Info<< nl << "Creating polyMesh from blockMesh" << endl; - wordList patchNames = blocks.patchNames(); - wordList patchTypes = blocks.patchTypes(); word defaultFacesName = "defaultFaces"; word defaultFacesType = emptyPolyPatch::typeName; - wordList patchPhysicalTypes = blocks.patchPhysicalTypes(); - - - preservePatchTypes - ( - runTime, - runTime.constant(), - polyMeshDir, - patchNames, - patchTypes, - defaultFacesName, - defaultFacesType, - patchPhysicalTypes - ); - polyMesh mesh ( IOobject @@ -236,11 +219,9 @@ int main(int argc, char *argv[]) xferCopy(blocks.points()), // could we re-use space? blocks.cells(), blocks.patches(), - patchNames, - patchTypes, + blocks.patchDicts(), defaultFacesName, - defaultFacesType, - patchPhysicalTypes + defaultFacesType ); diff --git a/applications/utilities/mesh/generation/extrudeToRegionMesh/createShellMesh.C b/applications/utilities/mesh/generation/extrudeToRegionMesh/createShellMesh.C index 944ff9cb48726bf01fd57bc17cc9c1106989898d..ffea6709521b973551b9b52ddea76dbebb4d622e 100644 --- a/applications/utilities/mesh/generation/extrudeToRegionMesh/createShellMesh.C +++ b/applications/utilities/mesh/generation/extrudeToRegionMesh/createShellMesh.C @@ -158,7 +158,6 @@ void Foam::createShellMesh::calcPointRegions } - // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // Foam::createShellMesh::createShellMesh @@ -184,7 +183,6 @@ Foam::createShellMesh::createShellMesh // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // - void Foam::createShellMesh::setRefinement ( const pointField& thickness, diff --git a/applications/utilities/mesh/generation/extrudeToRegionMesh/extrudeToRegionMesh.C b/applications/utilities/mesh/generation/extrudeToRegionMesh/extrudeToRegionMesh.C index 6a3b7dd7eadd0a926c8dabc1b9823be7d101caeb..4cf3c67ff998f2f1f6b9f8146ef03dc0c59f6242 100644 --- a/applications/utilities/mesh/generation/extrudeToRegionMesh/extrudeToRegionMesh.C +++ b/applications/utilities/mesh/generation/extrudeToRegionMesh/extrudeToRegionMesh.C @@ -130,6 +130,7 @@ Usage #include "volFields.H" #include "surfaceFields.H" #include "cyclicPolyPatch.H" +#include "syncTools.H" using namespace Foam; @@ -595,6 +596,237 @@ void createDummyFvMeshFiles(const polyMesh& mesh, const word& regionName) } +//XXXXXXXXX +label findUncoveredPatchFace +( + const fvMesh& mesh, + const UIndirectList<label>& extrudeMeshFaces,// mesh faces that are extruded + const label meshEdgeI // mesh edge +) +{ + // Make set of extruded faces. + labelHashSet extrudeFaceSet(extrudeMeshFaces.size()); + forAll(extrudeMeshFaces, i) + { + extrudeFaceSet.insert(extrudeMeshFaces[i]); + } + + label patchI = -1; + + const labelList& eFaces = mesh.edgeFaces()[meshEdgeI]; + forAll(eFaces, i) + { + label faceI = eFaces[i]; + if (!mesh.isInternalFace(faceI) && !extrudeFaceSet.found(faceI)) + { + patchI = mesh.boundaryMesh().whichPatch(faceI); + break; + } + } + return patchI; +} +// Count the number of faces in patches that need to be created +void countExtrudePatches +( + const fvMesh& mesh, + const primitiveFacePatch& extrudePatch, + const label nZones, + const labelList& zoneID, + const labelList& extrudeMeshFaces, + const labelList& extrudeMeshEdges, + + labelList& zoneSidePatch, + labelList& zoneZonePatch +) +{ + const labelListList& edgeFaces = extrudePatch.edgeFaces(); + + forAll(edgeFaces, edgeI) + { + const labelList& eFaces = edgeFaces[edgeI]; + if (eFaces.size() == 2) + { + label zone0 = zoneID[eFaces[0]]; + label zone1 = zoneID[eFaces[1]]; + + if (zone0 != zone1) + { + label minZone = min(zone0,zone1); + label maxZone = max(zone0,zone1); + zoneZonePatch[minZone*nZones+maxZone]++; + } + } + else + { + // Check whether we are on a mesh edge with external patches. If + // so choose any uncovered one. If none found put face in + // undetermined zone 'side' patch + + label patchI = findUncoveredPatchFace + ( + mesh, + UIndirectList<label>(extrudeMeshFaces, eFaces), + extrudeMeshEdges[edgeI] + ); + + if (patchI == -1) + { + // Determine the min zone of all connected zones. + label minZone = zoneID[eFaces[0]]; + for (label i = 1; i < eFaces.size(); i++) + { + minZone = min(minZone, zoneID[eFaces[i]]); + } + zoneSidePatch[minZone]++; + } + } + } + Pstream::listCombineGather(zoneSidePatch, plusEqOp<label>()); + Pstream::listCombineScatter(zoneSidePatch); + Pstream::listCombineGather(zoneZonePatch, plusEqOp<label>()); + Pstream::listCombineScatter(zoneZonePatch); +} +bool lessThan(const point& x, const point& y) +{ + for (direction dir = 0; dir < point::nComponents; dir++) + { + if (x[dir] < y[dir]) return true; + if (x[dir] > y[dir]) return false; + } + return false; +} + +class minEqVectorListOp +{ + public: + void operator()(List<vector>& x, const List<vector>& y) const + { + if (y.size()) + { + if (x.size()) + { + forAll(x, i) + { + if (lessThan(y[i], x[i])) + { + x[i] = y[i]; + } + } + } + else + { + x = y; + } + } + } +}; +// Constrain&sync normals on points that are on coupled patches. +void constrainCoupledNormals +( + const fvMesh& mesh, + const primitiveFacePatch& extrudePatch, + const labelList& regionToPoint, + + vectorField& regionNormals +) +{ + // Invert regionToPoint to create pointToRegions. + labelListList pointToRegions + ( + invertOneToMany + ( + extrudePatch.nPoints(), + regionToPoint + ) + ); + // Sort acc. to region so (hopefully) coupled points will do the same. + forAll(pointToRegions, pointI) + { + sort(pointToRegions[pointI]); + } + + + const polyBoundaryMesh& patches = mesh.boundaryMesh(); + + // Constrain displacement on cyclic patches + // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + // Note: bit contentious to always do this on cyclic - should user use + // different patch type, e.g. 'cyclicSlip' instead? + + forAll(patches, patchI) + { + const polyPatch& pp = patches[patchI]; + + if (isA<cyclicPolyPatch>(pp)) + { + forAll(pp.meshPoints(), pointI) + { + Map<label>::const_iterator fnd = + extrudePatch.meshPointMap().find + ( + pp.meshPoints()[pointI] + ); + if (fnd != extrudePatch.meshPointMap().end()) + { + // fnd() is a point on this cyclic. + const vector& cycNormal = pp.pointNormals()[pointI]; + const labelList& pRegions = pointToRegions[fnd()]; + forAll(pRegions, i) + { + // Remove cyclic normal component. + vector& regionNormal = regionNormals[pRegions[i]]; + regionNormal -= (regionNormal&cycNormal)*cycNormal; + } + } + } + } + } + + + // Synchronise regionNormals + // ~~~~~~~~~~~~~~~~~~~~~~~~~ + + // Re-work regionNormals into multiple normals per point + List<List<vector> > pointNormals(mesh.nPoints()); + forAll(pointToRegions, pointI) + { + const labelList& pRegions = pointToRegions[pointI]; + + label meshPointI = extrudePatch.meshPoints()[pointI]; + List<vector>& pNormals = pointNormals[meshPointI]; + pNormals.setSize(pRegions.size()); + forAll(pRegions, i) + { + pNormals[i] = regionNormals[pRegions[i]]; + } + } + + // Synchronise + syncTools::syncPointList + ( + mesh, + pointNormals, + minEqVectorListOp(), + List<vector>(), // nullValue + false // applySeparation + ); + + // Re-work back into regionNormals + forAll(pointToRegions, pointI) + { + const labelList& pRegions = pointToRegions[pointI]; + + label meshPointI = extrudePatch.meshPoints()[pointI]; + const List<vector>& pNormals = pointNormals[meshPointI]; + forAll(pRegions, i) + { + regionNormals[pRegions[i]] = pNormals[i]; + } + } +} +//XXXXXXXXX + + tmp<pointField> calcOffset ( const primitiveFacePatch& extrudePatch, @@ -739,6 +971,16 @@ int main(int argc, char *argv[]) << endl; + // Determine corresponding mesh edges + const labelList extrudeMeshEdges + ( + extrudePatch.meshEdges + ( + mesh.edges(), + mesh.pointEdges() + ) + ); + // Check whether the zone is internal or external faces to determine @@ -772,7 +1014,7 @@ int main(int argc, char *argv[]) Info<< "FaceZone " << fz.name() << " has boundary faces" << endl; } } - + Info<< endl; @@ -866,36 +1108,18 @@ int main(int argc, char *argv[]) labelList zoneSidePatch(faceZones.size(), 0); labelList zoneZonePatch(faceZones.size()*faceZones.size(), 0); - forAll(edgeFaces, edgeI) - { - const labelList& eFaces = edgeFaces[edgeI]; - if (eFaces.size() == 2) - { - label zone0 = zoneID[eFaces[0]]; - label zone1 = zoneID[eFaces[1]]; + countExtrudePatches + ( + mesh, + extrudePatch, + faceZones.size(), + zoneID, + extrudeMeshFaces, + extrudeMeshEdges, - if (zone0 != zone1) - { - label minZone = min(zone0,zone1); - label maxZone = max(zone0,zone1); - zoneZonePatch[minZone*faceZones.size()+maxZone]++; - } - } - else - { - // Determine the min zone of all connected zones. - label minZone = zoneID[eFaces[0]]; - for (label i = 1; i < eFaces.size(); i++) - { - minZone = min(minZone, zoneID[eFaces[i]]); - } - zoneSidePatch[minZone]++; - } - } - Pstream::listCombineGather(zoneSidePatch, plusEqOp<label>()); - Pstream::listCombineScatter(zoneSidePatch); - Pstream::listCombineGather(zoneZonePatch, plusEqOp<label>()); - Pstream::listCombineScatter(zoneZonePatch); + zoneSidePatch, + zoneZonePatch + ); // Now check which patches to add. Info<< "Adding patches for edges on zones:" << nl << nl @@ -980,6 +1204,7 @@ int main(int argc, char *argv[]) // Is edge an non-manifold edge PackedBoolList nonManifoldEdge(extrudePatch.nEdges()); + // Note: logic has to be same as in countExtrudePatches. forAll(edgeFaces, edgeI) { const labelList& eFaces = edgeFaces[edgeI]; @@ -1004,65 +1229,31 @@ int main(int argc, char *argv[]) } else { - ePatches.setSize(eFaces.size()); - forAll(eFaces, i) - { - ePatches[i] = zoneSidePatch[zoneID[eFaces[i]]]; - } - nonManifoldEdge[edgeI] = 1; - } - } - - // Override constraint types - { - const edgeList& extrudeEdges = extrudePatch.edges(); - const labelList& extrudeMeshPts = extrudePatch.meshPoints(); - - // Map from mesh edge to local patch edge index - EdgeMap<label> extrudeMeshEdges(extrudePatch.nEdges()); + label patchI = findUncoveredPatchFace + ( + mesh, + UIndirectList<label>(extrudeMeshFaces, eFaces), + extrudeMeshEdges[edgeI] + ); - forAll(extrudeEdges, edgeI) - { - if (edgeFaces[edgeI].size() == 1) + if (patchI != -1) { - const edge& e = extrudeEdges[edgeI]; - const edge meshE(extrudeMeshPts[e[0]], extrudeMeshPts[e[1]]); - extrudeMeshEdges.insert(meshE, edgeI); + ePatches.setSize(eFaces.size(), patchI); } - } - forAll(patches, patchI) - { - const polyPatch& pp = patches[patchI]; - - if (polyPatch::constraintType(pp.type())) + else { - const edgeList& edges = pp.edges(); - - forAll(edges, ppEdgeI) + ePatches.setSize(eFaces.size()); + forAll(eFaces, i) { - const edge& e = edges[ppEdgeI]; - edge meshE(pp.meshPoints()[e[0]], pp.meshPoints()[e[1]]); - EdgeMap<label>::const_iterator iter = extrudeMeshEdges.find - ( - meshE - ); - if (iter != extrudeMeshEdges.end()) - { - label extrudeEdgeI = iter(); - extrudeEdgePatches[extrudeEdgeI] = labelList - ( - edgeFaces[extrudeEdgeI].size(), - patchI - ); - } + ePatches[i] = zoneSidePatch[zoneID[eFaces[i]]]; } } + nonManifoldEdge[edgeI] = 1; } } - // Assign point regions // ~~~~~~~~~~~~~~~~~~~~ @@ -1075,6 +1266,7 @@ int main(int argc, char *argv[]) ( extrudePatch, nonManifoldEdge, + pointRegions, regionPoints ); @@ -1096,6 +1288,18 @@ int main(int argc, char *argv[]) } regionNormals /= mag(regionNormals); + + // Constrain&sync normals on points that are on coupled patches. + constrainCoupledNormals + ( + mesh, + extrudePatch, + regionPoints, + + regionNormals + ); + + // For debugging: dump hedgehog plot of normals { OFstream str(runTime.path()/"regionNormals.obj"); @@ -1112,7 +1316,7 @@ int main(int argc, char *argv[]) meshTools::writeOBJ(str, pt); vertI++; - meshTools::writeOBJ(str, pt+0.01*regionNormals[region]); + meshTools::writeOBJ(str, pt+thickness*regionNormals[region]); vertI++; str << "l " << vertI-1 << ' ' << vertI << nl; } diff --git a/applications/utilities/mesh/manipulation/createBaffles/createBaffles.C b/applications/utilities/mesh/manipulation/createBaffles/createBaffles.C index 22720cbf65a0b20b8e71c7edc43f89ab7a84ac34..b3c4ca35e764f61faa606dbab7c3b6c1c5b005ff 100644 --- a/applications/utilities/mesh/manipulation/createBaffles/createBaffles.C +++ b/applications/utilities/mesh/manipulation/createBaffles/createBaffles.C @@ -134,7 +134,13 @@ int main(int argc, char *argv[]) #include "addRegionOption.H" argList::validArgs.append("faceZone"); - argList::validArgs.append("patch"); + argList::validArgs.append("(masterPatch slavePatch)"); + argList::addOption + ( + "additionalPatches", + "((master2 slave2) .. (masterN slaveN))" + ); + argList::addBoolOption("internalFacesOnly"); argList::addOption ( @@ -159,7 +165,7 @@ int main(int argc, char *argv[]) const faceZoneMesh& faceZones = mesh.faceZones(); // Faces to baffle - faceZoneID zoneID(args[1], faceZones); + faceZoneID zoneID(args.additionalArgs()[0], faceZones); Info<< "Converting faces on zone " << zoneID.name() << " into baffles." << nl << endl; @@ -182,28 +188,36 @@ int main(int argc, char *argv[]) fZone.checkParallelSync(true); // Patches to put baffles into - DynamicList<label> newPatches(1); + DynamicList<label> newMasterPatches(1); + DynamicList<label> newSlavePatches(1); - const word patchName = args[2]; - newPatches.append(findPatchID(mesh, patchName)); - Info<< "Using patch " << patchName - << " at index " << newPatches[0] << endl; + const Pair<word> patchNames(IStringStream(args.additionalArgs()[1])()); + newMasterPatches.append(findPatchID(mesh, patchNames[0])); + newSlavePatches.append(findPatchID(mesh, patchNames[1])); + Info<< "Using master patch " << patchNames[0] + << " at index " << newMasterPatches[0] << endl; + Info<< "Using slave patch " << patchNames[1] + << " at index " << newSlavePatches[0] << endl; // Additional patches if (args.optionFound("additionalPatches")) { - const wordList patchNames + const List<Pair<word> > patchNames ( args.optionLookup("additionalPatches")() ); - newPatches.reserve(patchNames.size() + 1); + newMasterPatches.reserve(patchNames.size() + 1); + newSlavePatches.reserve(patchNames.size() + 1); forAll(patchNames, i) { - newPatches.append(findPatchID(mesh, patchNames[i])); - Info<< "Using additional patch " << patchNames[i] - << " at index " << newPatches.last() << endl; + newMasterPatches.append(findPatchID(mesh, patchNames[i][0])); + newSlavePatches.append(findPatchID(mesh, patchNames[i][1])); + Info<< "Using additional patches " << patchNames[i] + << " at indices " << newMasterPatches.last() + << " and " << newSlavePatches.last() + << endl; } } @@ -282,10 +296,8 @@ int main(int argc, char *argv[]) } label nModified = 0; - forAll(newPatches, i) + forAll(newMasterPatches, i) { - label newPatchI = newPatches[i]; - // Pass 1. Do selected side of zone // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ @@ -305,7 +317,7 @@ int main(int argc, char *argv[]) faceI, // label of face mesh.faceOwner()[faceI],// owner false, // face flip - newPatchI, // patch for face + newMasterPatches[i], // patch for face zoneID.index(), // zone for face false, // face flip in zone modifiedFace // modify or add status @@ -321,7 +333,7 @@ int main(int argc, char *argv[]) faceI, // label of face mesh.faceNeighbour()[faceI],// owner true, // face flip - newPatchI, // patch for face + newMasterPatches[i], // patch for face zoneID.index(), // zone for face true, // face flip in zone modifiedFace // modify or add status @@ -352,7 +364,7 @@ int main(int argc, char *argv[]) faceI, // label of face mesh.faceNeighbour()[faceI], // owner true, // face flip - newPatchI, // patch for face + newSlavePatches[i], // patch for face zoneID.index(), // zone for face true, // face flip in zone modifiedFace // modify or add @@ -368,7 +380,7 @@ int main(int argc, char *argv[]) faceI, // label of face mesh.faceOwner()[faceI],// owner false, // face flip - newPatchI, // patch for face + newSlavePatches[i], // patch for face zoneID.index(), // zone for face false, // face flip in zone modifiedFace // modify or add status @@ -396,6 +408,8 @@ int main(int argc, char *argv[]) { const polyPatch& pp = patches[patchI]; + label newPatchI = newMasterPatches[i]; + if (pp.coupled() && patches[newPatchI].coupled()) { // Do not allow coupled faces to be moved to different coupled @@ -445,7 +459,7 @@ int main(int argc, char *argv[]) Info<< "Converted " << returnReduce(nModified, sumOp<label>()) - << " faces into boundary faces on patch " << patchName << nl << endl; + << " faces into boundary faces on patches " << patchNames << nl << endl; if (!overwrite) { diff --git a/applications/utilities/mesh/manipulation/createPatch/createPatch.C b/applications/utilities/mesh/manipulation/createPatch/createPatch.C index 8ec77b011125354929c2a85703a10450b581f95b..43652bbbeaeac27c05de5134a3dc84811e6558ad 100644 --- a/applications/utilities/mesh/manipulation/createPatch/createPatch.C +++ b/applications/utilities/mesh/manipulation/createPatch/createPatch.C @@ -197,69 +197,55 @@ void dumpCyclicMatch(const fileName& prefix, const polyMesh& mesh) forAll(patches, patchI) { - if (isA<cyclicPolyPatch>(patches[patchI])) + if + ( + isA<cyclicPolyPatch>(patches[patchI]) + && refCast<const cyclicPolyPatch>(patches[patchI]).owner() + ) { const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - label halfSize = cycPatch.size()/2; - - // Dump halves + // Dump patches { - OFstream str(prefix+cycPatch.name()+"_half0.obj"); + OFstream str(prefix+cycPatch.name()+".obj"); Pout<< "Dumping " << cycPatch.name() - << " half0 faces to " << str.name() << endl; + << " faces to " << str.name() << endl; meshTools::writeOBJ ( str, - static_cast<faceList> - ( - SubList<face> - ( - cycPatch, - halfSize - ) - ), + cycPatch, cycPatch.points() ); } + + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); { - OFstream str(prefix+cycPatch.name()+"_half1.obj"); - Pout<< "Dumping " << cycPatch.name() - << " half1 faces to " << str.name() << endl; + OFstream str(prefix+nbrPatch.name()+".obj"); + Pout<< "Dumping " << nbrPatch.name() + << " faces to " << str.name() << endl; meshTools::writeOBJ ( str, - static_cast<faceList> - ( - SubList<face> - ( - cycPatch, - halfSize, - halfSize - ) - ), - cycPatch.points() + nbrPatch, + nbrPatch.points() ); } // Lines between corresponding face centres - OFstream str(prefix+cycPatch.name()+"_match.obj"); + OFstream str(prefix+cycPatch.name()+nbrPatch.name()+"_match.obj"); label vertI = 0; Pout<< "Dumping cyclic match as lines between face centres to " << str.name() << endl; - for (label faceI = 0; faceI < halfSize; faceI++) + forAll(cycPatch, faceI) { const point& fc0 = mesh.faceCentres()[cycPatch.start()+faceI]; meshTools::writeOBJ(str, fc0); vertI++; - - label nbrFaceI = halfSize + faceI; - const point& fc1 = - mesh.faceCentres()[cycPatch.start()+nbrFaceI]; + const point& fc1 = mesh.faceCentres()[nbrPatch.start()+faceI]; meshTools::writeOBJ(str, fc1); vertI++; @@ -426,13 +412,19 @@ void syncPoints { const polyPatch& pp = patches[patchI]; - if (isA<cyclicPolyPatch>(pp)) + if + ( + isA<cyclicPolyPatch>(pp) + && refCast<const cyclicPolyPatch>(pp).owner() + ) { const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(pp); const edgeList& coupledPoints = cycPatch.coupledPoints(); const labelList& meshPts = cycPatch.meshPoints(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshPts = nbrPatch.meshPoints(); pointField half0Values(coupledPoints.size()); @@ -451,14 +443,13 @@ void syncPoints else if (cycPatch.separated()) { hasTransformation = true; - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); + separateList(cycPatch.separation(), half0Values); } forAll(coupledPoints, i) { const edge& e = coupledPoints[i]; - label point1 = meshPts[e[1]]; + label point1 = nbrMeshPts[e[1]]; points[point1] = half0Values[i]; } } @@ -785,13 +776,8 @@ int main(int argc, char *argv[]) // current separation also includes the normal // ( separation_ = (nf&(Cr - Cf))*nf ). - // For processor patches: - // - disallow multiple separation/transformation. This basically - // excludes decomposed cyclics. Use the (probably 0) separation - // to align the points. // For cyclic patches: - // - for separated ones use our own recalculated offset vector - // - for rotational ones use current one. + // - for separated ones use user specified offset vector forAll(mesh.boundaryMesh(), patchI) { @@ -808,13 +794,14 @@ int main(int argc, char *argv[]) << " separation[0] was " << cpp.separation()[0] << endl; - if (isA<cyclicPolyPatch>(pp)) + if (isA<cyclicPolyPatch>(pp) && pp.size()) { const cyclicPolyPatch& cycpp = refCast<const cyclicPolyPatch>(pp); if (cycpp.transform() == cyclicPolyPatch::TRANSLATIONAL) { + // Force to wanted separation Info<< "On cyclic translation patch " << pp.name() << " forcing uniform separation of " << cycpp.separationVector() << endl; @@ -823,20 +810,16 @@ int main(int argc, char *argv[]) } else { + const cyclicPolyPatch& nbr = cycpp.neighbPatch(); const_cast<vectorField&>(cpp.separation()) = pointField ( 1, - pp[pp.size()/2].centre(mesh.points()) - - pp[0].centre(mesh.points()) + nbr[0].centre(mesh.points()) + - cycpp[0].centre(mesh.points()) ); } } - else - { - const_cast<vectorField&>(cpp.separation()) - .setSize(1); - } Info<< "On coupled patch " << pp.name() << " forcing uniform separation of " << cpp.separation() << endl; diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C index 80f9b6f93a5c40352f20ad8e058ed9e73413bce9..495e07f2901be7a3aa329a2b83021b7a3cf2cfea 100644 --- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C +++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C @@ -305,6 +305,7 @@ autoPtr<mapPolyMesh> reorderMesh labelList patchStarts(patches.size()); labelList oldPatchNMeshPoints(patches.size()); labelListList patchPointMap(patches.size()); + forAll(patches, patchI) { patchSizes[patchI] = patches[patchI].size(); @@ -320,7 +321,8 @@ autoPtr<mapPolyMesh> reorderMesh xferMove(newOwner), xferMove(newNeighbour), patchSizes, - patchStarts + patchStarts, + true ); return autoPtr<mapPolyMesh> diff --git a/applications/utilities/mesh/manipulation/splitMeshRegions/splitMeshRegions.C b/applications/utilities/mesh/manipulation/splitMeshRegions/splitMeshRegions.C index 1b38f6b23973cb9db83a65aa9367d496831b4037..e9c20f1afbf34e6d1c31b84f02616e63a69e7727 100644 --- a/applications/utilities/mesh/manipulation/splitMeshRegions/splitMeshRegions.C +++ b/applications/utilities/mesh/manipulation/splitMeshRegions/splitMeshRegions.C @@ -560,7 +560,7 @@ void getInterfaceSizes label cellI = mesh.faceOwner()[i+mesh.nInternalFaces()]; coupledRegion[i] = cellRegion[cellI]; } - syncTools::swapBoundaryFaceList(mesh, coupledRegion, false); + syncTools::swapBoundaryFaceList(mesh, coupledRegion); forAll(coupledRegion, i) { @@ -730,7 +730,7 @@ autoPtr<mapPolyMesh> createRegionMesh label cellI = mesh.faceOwner()[i+mesh.nInternalFaces()]; coupledRegion[i] = cellRegion[cellI]; } - syncTools::swapBoundaryFaceList(mesh, coupledRegion, false); + syncTools::swapBoundaryFaceList(mesh, coupledRegion); // Topology change container. Start off from existing mesh. @@ -1300,7 +1300,7 @@ void getZoneID { neiZoneID[i] = zoneID[mesh.faceOwner()[i+mesh.nInternalFaces()]]; } - syncTools::swapBoundaryFaceList(mesh, neiZoneID, false); + syncTools::swapBoundaryFaceList(mesh, neiZoneID); } diff --git a/applications/utilities/parallelProcessing/decomposePar/decomposePar.C b/applications/utilities/parallelProcessing/decomposePar/decomposePar.C index c465aa3c3befb513ed63f035b90c817a04840425..b50db4a76ccccb0191a0b4f42898bd6f57d0080d 100644 --- a/applications/utilities/parallelProcessing/decomposePar/decomposePar.C +++ b/applications/utilities/parallelProcessing/decomposePar/decomposePar.C @@ -62,7 +62,6 @@ Usage #include "OSspecific.H" #include "fvCFD.H" #include "IOobjectList.H" -#include "processorFvPatchFields.H" #include "domainDecomposition.H" #include "labelIOField.H" #include "scalarIOField.H" diff --git a/applications/utilities/parallelProcessing/decomposePar/decomposeParDict b/applications/utilities/parallelProcessing/decomposePar/decomposeParDict index 292421855c9fa2e81d016fed3adef16c887436e8..a183ebd0cb405f1a2af5ec8ae1cbe66366cc4dc1 100644 --- a/applications/utilities/parallelProcessing/decomposePar/decomposeParDict +++ b/applications/utilities/parallelProcessing/decomposePar/decomposeParDict @@ -25,7 +25,7 @@ numberOfSubdomains 4; //- Keep owner and neighbour on same processor for faces in patches: // (makes sense only for cyclic patches) -//preservePatches (cyclic_left_right); +//preservePatches (cyclic_half0 cyclic_half1); method scotch; diff --git a/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.C b/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.C index b144e757583409c559607482288d43e783f50a47..6575c31dd3eb4a3095051b00b3ce4ec23e59170e 100644 --- a/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.C +++ b/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.C @@ -28,6 +28,7 @@ License #include "dictionary.H" #include "labelIOList.H" #include "processorPolyPatch.H" +#include "processorCyclicPolyPatch.H" #include "fvMesh.H" #include "OSspecific.H" #include "Map.H" @@ -108,7 +109,8 @@ Foam::domainDecomposition::domainDecomposition(const IOobject& io) procNeighbourProcessors_(nProcs_), procProcessorPatchSize_(nProcs_), procProcessorPatchStartIndex_(nProcs_), - cyclicParallel_(false) + procProcessorPatchSubPatchIDs_(nProcs_), + procProcessorPatchSubPatchStarts_(nProcs_) { if (decompositionDict_.found("distributed")) { @@ -343,12 +345,42 @@ bool Foam::domainDecomposition::writeDecomposition() const labelList& curProcessorPatchStarts = procProcessorPatchStartIndex_[procI]; + const labelListList& curSubPatchIDs = + procProcessorPatchSubPatchIDs_[procI]; + + const labelListList& curSubStarts = + procProcessorPatchSubPatchStarts_[procI]; + const polyPatchList& meshPatches = boundaryMesh(); + + // Count the number of inter-proc patches + label nInterProcPatches = 0; + forAll(curSubPatchIDs, procPatchI) + { + //Info<< "For processor " << procI + // << " have to destination processor " + // << curNeighbourProcessors[procPatchI] << endl; + // + //forAll(curSubPatchIDs[procPatchI], i) + //{ + // Info<< " from patch:" << curSubPatchIDs[procPatchI][i] + // << " starting at:" << curSubStarts[procPatchI][i] + // << endl; + //} + + nInterProcPatches += curSubPatchIDs[procPatchI].size(); + } + + //Info<< "For processor " << procI + // << " have " << nInterProcPatches + // << " patches to neighbouring processors" << endl; + + List<polyPatch*> procPatches ( curPatchSizes.size() - + curProcessorPatchSizes.size(), + + nInterProcPatches, //curProcessorPatchSizes.size(), reinterpret_cast<polyPatch*>(0) ); @@ -385,23 +417,84 @@ bool Foam::domainDecomposition::writeDecomposition() forAll(curProcessorPatchSizes, procPatchI) { - procPatches[nPatches] = - new processorPolyPatch + const labelList& subPatchID = curSubPatchIDs[procPatchI]; + const labelList& subStarts = curSubStarts[procPatchI]; + + label curStart = curProcessorPatchStarts[procPatchI]; + + forAll(subPatchID, i) + { + label size = ( - word("procBoundary") + Foam::name(procI) - + word("to") - + Foam::name(curNeighbourProcessors[procPatchI]), - curProcessorPatchSizes[procPatchI], - curProcessorPatchStarts[procPatchI], - nPatches, - procMesh.boundaryMesh(), - procI, - curNeighbourProcessors[procPatchI] - ); + i < subPatchID.size()-1 + ? subStarts[i+1] - subStarts[i] + : curProcessorPatchSizes[procPatchI] - subStarts[i] + ); - nPatches++; + //Info<< "From processor:" << procI << endl + // << " to processor:" << curNeighbourProcessors[procPatchI] + // << endl + // << " via patch:" << subPatchID[i] << endl + // << " start :" << curStart << endl + // << " size :" << size << endl; + + if (subPatchID[i] == -1) + { + // From internal faces + procPatches[nPatches] = + new processorPolyPatch + ( + word("procBoundary") + Foam::name(procI) + + "to" + + Foam::name(curNeighbourProcessors[procPatchI]), + size, + curStart, + nPatches, + procMesh.boundaryMesh(), + procI, + curNeighbourProcessors[procPatchI] + ); + } + else + { + // From cyclic + const word& referPatch = + boundaryMesh()[subPatchID[i]].name(); + + procPatches[nPatches] = + new processorCyclicPolyPatch + ( + word("procBoundary") + Foam::name(procI) + + "to" + + Foam::name(curNeighbourProcessors[procPatchI]) + + "through" + + referPatch, + size, + curStart, + nPatches, + procMesh.boundaryMesh(), + procI, + curNeighbourProcessors[procPatchI], + referPatch + ); + } + + curStart += size; + + nPatches++; + } } + + //forAll(procPatches, patchI) + //{ + // Pout<< " " << patchI + // << '\t' << "name:" << procPatches[patchI]->name() + // << '\t' << "type:" << procPatches[patchI]->type() + // << '\t' << "size:" << procPatches[patchI]->size() + // << endl; + //} + // Add boundary patches procMesh.addPatches(procPatches); @@ -667,11 +760,7 @@ bool Foam::domainDecomposition::writeDecomposition() forAll(procMesh.boundaryMesh(), patchi) { - if - ( - procMesh.boundaryMesh()[patchi].type() - == processorPolyPatch::typeName - ) + if (isA<processorPolyPatch>(procMesh.boundaryMesh()[patchi])) { const processorPolyPatch& ppp = refCast<const processorPolyPatch> @@ -749,11 +838,7 @@ bool Foam::domainDecomposition::writeDecomposition() // (= identity map for original patches, -1 for processor patches) label nMeshPatches = curPatchSizes.size(); labelList procBoundaryAddressing(identity(nMeshPatches)); - procBoundaryAddressing.setSize - ( - nMeshPatches+curProcessorPatchSizes.size(), - -1 - ); + procBoundaryAddressing.setSize(nMeshPatches+nProcPatches, -1); labelIOList boundaryProcAddressing ( diff --git a/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.H b/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.H index b9dbb74c6fbff5deac8ec0e07fd837c140c22148..d662db75a5096e5fa570f433c964fc0bbeea92b4 100644 --- a/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.H +++ b/applications/utilities/parallelProcessing/decomposePar/domainDecomposition.H @@ -29,6 +29,7 @@ Description SourceFiles domainDecomposition.C + decomposeMesh.C \*---------------------------------------------------------------------------*/ @@ -78,9 +79,9 @@ class domainDecomposition // index is negative, the processor face is the reverse of the // original face. In order to do this properly, all face // indices will be incremented by 1 and the decremented as - // necessary t avoid the problem of face number zero having no - // sign. - labelListList procFaceAddressing_; + // necessary to avoid the problem of face number zero having no + // sign. + List<DynamicList<label> > procFaceAddressing_; //- Labels of cells for each processor labelListList procCellAddressing_; @@ -93,18 +94,23 @@ class domainDecomposition // Excludes inter-processor boundaries labelListList procPatchStartIndex_; + + // Per inter-processor patch information + //- Neighbour processor ID for inter-processor boundaries labelListList procNeighbourProcessors_; //- Sizes for inter-processor patches labelListList procProcessorPatchSize_; - //- Start indices for inter-processor patches + //- Start indices (in procFaceAddressing_) for inter-processor patches labelListList procProcessorPatchStartIndex_; - //- Are there cyclic-parallel faces - bool cyclicParallel_; + //- Sub patch IDs for inter-processor patches + List<labelListList> procProcessorPatchSubPatchIDs_; + //- Sub patch sizes for inter-processor patches + List<labelListList> procProcessorPatchSubPatchStarts_; // Private Member Functions @@ -118,6 +124,21 @@ class domainDecomposition labelList& elementToZone ); + //- Append single element to list + static void append(labelList&, const label); + + //- Add face to interProcessor patch. + void addInterProcFace + ( + const label facei, + const label ownerProc, + const label nbrProc, + + List<Map<label> >&, + List<DynamicList<DynamicList<label> > >& + ) const; + + public: // Constructors diff --git a/applications/utilities/parallelProcessing/decomposePar/domainDecompositionDistribute.C b/applications/utilities/parallelProcessing/decomposePar/domainDecompositionDistribute.C index 36ce46e454db12d95b1d108269d1d931b6d4f23b..6adf0639626bd08a62370060d192ae6e33a1de0d 100644 --- a/applications/utilities/parallelProcessing/decomposePar/domainDecompositionDistribute.C +++ b/applications/utilities/parallelProcessing/decomposePar/domainDecompositionDistribute.C @@ -26,7 +26,6 @@ License #include "domainDecomposition.H" #include "decompositionMethod.H" #include "cpuTime.H" -#include "cyclicPolyPatch.H" #include "cellSet.H" #include "regionSplit.H" diff --git a/applications/utilities/parallelProcessing/decomposePar/domainDecompositionMesh.C b/applications/utilities/parallelProcessing/decomposePar/domainDecompositionMesh.C index d7487dc58e6ee6cb3b94091a88577638f3aba1fc..46febf2b44defbf5bddadfe25864065554106bc8 100644 --- a/applications/utilities/parallelProcessing/decomposePar/domainDecompositionMesh.C +++ b/applications/utilities/parallelProcessing/decomposePar/domainDecompositionMesh.C @@ -39,6 +39,63 @@ Description // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // +void Foam::domainDecomposition::append(labelList& lst, const label elem) +{ + label sz = lst.size(); + lst.setSize(sz+1); + lst[sz] = elem; +} + + +void Foam::domainDecomposition::addInterProcFace +( + const label facei, + const label ownerProc, + const label nbrProc, + + List<Map<label> >& nbrToInterPatch, + List<DynamicList<DynamicList<label> > >& interPatchFaces +) const +{ + Map<label>::iterator patchIter = nbrToInterPatch[ownerProc].find(nbrProc); + + // Introduce turning index only for internal faces (are duplicated). + label ownerIndex = facei+1; + label nbrIndex = -(facei+1); + + if (patchIter != nbrToInterPatch[ownerProc].end()) + { + // Existing interproc patch. Add to both sides. + label toNbrProcPatchI = patchIter(); + interPatchFaces[ownerProc][toNbrProcPatchI].append(ownerIndex); + + if (isInternalFace(facei)) + { + label toOwnerProcPatchI = nbrToInterPatch[nbrProc][ownerProc]; + interPatchFaces[nbrProc][toOwnerProcPatchI].append(nbrIndex); + } + } + else + { + // Create new interproc patches. + label toNbrProcPatchI = nbrToInterPatch[ownerProc].size(); + nbrToInterPatch[ownerProc].insert(nbrProc, toNbrProcPatchI); + DynamicList<label> oneFace; + oneFace.append(ownerIndex); + interPatchFaces[ownerProc].append(oneFace); + + if (isInternalFace(facei)) + { + label toOwnerProcPatchI = nbrToInterPatch[nbrProc].size(); + nbrToInterPatch[nbrProc].insert(ownerProc, toOwnerProcPatchI); + oneFace.clear(); + oneFace.append(nbrIndex); + interPatchFaces[nbrProc].append(oneFace); + } + } +} + + void Foam::domainDecomposition::decomposeMesh() { // Decide which cell goes to which processor @@ -60,31 +117,8 @@ void Foam::domainDecomposition::decomposeMesh() Info<< "\nDistributing cells to processors" << endl; - // Memory management - { - List<SLList<label> > procCellList(nProcs_); - - forAll(cellToProc_, celli) - { - if (cellToProc_[celli] >= nProcs_) - { - FatalErrorIn("domainDecomposition::decomposeMesh()") - << "Impossible processor label " << cellToProc_[celli] - << "for cell " << celli - << abort(FatalError); - } - else - { - procCellList[cellToProc_[celli]].append(celli); - } - } - - // Convert linked lists into normal lists - forAll(procCellList, procI) - { - procCellAddressing_[procI] = procCellList[procI]; - } - } + // Cells per processor + procCellAddressing_ = invertOneToMany(nProcs_, cellToProc_); Info<< "\nDistributing faces to processors" << endl; @@ -93,503 +127,335 @@ void Foam::domainDecomposition::decomposeMesh() // same processor, the face is an internal face. If they are different, // it belongs to both processors. - // Memory management - { - List<SLList<label> > procFaceList(nProcs_); + procFaceAddressing_.setSize(nProcs_); - forAll(neighbour, facei) + // Internal faces + forAll (neighbour, facei) + { + if (cellToProc_[owner[facei]] == cellToProc_[neighbour[facei]]) { - if (cellToProc_[owner[facei]] == cellToProc_[neighbour[facei]]) - { - // Face internal to processor - procFaceList[cellToProc_[owner[facei]]].append(facei); - } + // Face internal to processor. Notice no turning index. + procFaceAddressing_[cellToProc_[owner[facei]]].append(facei+1); } + } - // Detect inter-processor boundaries - - // Neighbour processor for each subdomain - List<SLList<label> > interProcBoundaries(nProcs_); + // for all processors, set the size of start index and patch size + // lists to the number of patches in the mesh + forAll (procPatchSize_, procI) + { + procPatchSize_[procI].setSize(patches.size()); + procPatchStartIndex_[procI].setSize(patches.size()); + } - // Face labels belonging to each inter-processor boundary - List<SLList<SLList<label> > > interProcBFaces(nProcs_); + forAll (patches, patchi) + { + // Reset size and start index for all processors + forAll (procPatchSize_, procI) + { + procPatchSize_[procI][patchi] = 0; + procPatchStartIndex_[procI][patchi] = + procFaceAddressing_[procI].size(); + } - List<SLList<label> > procPatchIndex(nProcs_); + const label patchStart = patches[patchi].start(); - forAll(neighbour, facei) + if (!isA<cyclicPolyPatch>(patches[patchi])) { - if (cellToProc_[owner[facei]] != cellToProc_[neighbour[facei]]) - { - // inter - processor patch face found. Go through the list of - // inside boundaries for the owner processor and try to find - // this inter-processor patch. + // Normal patch. Add faces to processor where the cell + // next to the face lives - label ownerProc = cellToProc_[owner[facei]]; - label neighbourProc = cellToProc_[neighbour[facei]]; + const unallocLabelList& patchFaceCells = + patches[patchi].faceCells(); - SLList<label>::iterator curInterProcBdrsOwnIter = - interProcBoundaries[ownerProc].begin(); + forAll (patchFaceCells, facei) + { + const label curProc = cellToProc_[patchFaceCells[facei]]; - SLList<SLList<label> >::iterator curInterProcBFacesOwnIter = - interProcBFaces[ownerProc].begin(); + // add the face without turning index + procFaceAddressing_[curProc].append(patchStart+facei+1); - bool interProcBouFound = false; + // increment the number of faces for this patch + procPatchSize_[curProc][patchi]++; + } + } + else + { + const cyclicPolyPatch& pp = refCast<const cyclicPolyPatch> + ( + patches[patchi] + ); + // cyclic: check opposite side on this processor + const unallocLabelList& patchFaceCells = pp.faceCells(); - // WARNING: Synchronous SLList iterators + const unallocLabelList& nbrPatchFaceCells = + pp.neighbPatch().faceCells(); - for - ( - ; - curInterProcBdrsOwnIter - != interProcBoundaries[ownerProc].end() - && curInterProcBFacesOwnIter - != interProcBFaces[ownerProc].end(); - ++curInterProcBdrsOwnIter, ++curInterProcBFacesOwnIter - ) + forAll (patchFaceCells, facei) + { + const label curProc = cellToProc_[patchFaceCells[facei]]; + const label nbrProc = cellToProc_[nbrPatchFaceCells[facei]]; + if (curProc == nbrProc) { - if (curInterProcBdrsOwnIter() == neighbourProc) - { - // the inter - processor boundary exists. Add the face - interProcBouFound = true; - - curInterProcBFacesOwnIter().append(facei); - - SLList<label>::iterator curInterProcBdrsNeiIter = - interProcBoundaries[neighbourProc].begin(); - - SLList<SLList<label> >::iterator - curInterProcBFacesNeiIter = - interProcBFaces[neighbourProc].begin(); - - bool neighbourFound = false; - - // WARNING: Synchronous SLList iterators - - for - ( - ; - curInterProcBdrsNeiIter != - interProcBoundaries[neighbourProc].end() - && curInterProcBFacesNeiIter != - interProcBFaces[neighbourProc].end(); - ++curInterProcBdrsNeiIter, - ++curInterProcBFacesNeiIter - ) - { - if (curInterProcBdrsNeiIter() == ownerProc) - { - // boundary found. Add the face - neighbourFound = true; - - curInterProcBFacesNeiIter().append(facei); - } - - if (neighbourFound) break; - } - - if (interProcBouFound && !neighbourFound) - { - FatalErrorIn("domainDecomposition::decomposeMesh()") - << "Inconsistency in inter - " - << "processor boundary lists for processors " - << ownerProc << " and " << neighbourProc - << abort(FatalError); - } - } - - if (interProcBouFound) break; + // add the face without turning index + procFaceAddressing_[curProc].append(patchStart+facei+1); + // increment the number of faces for this patch + procPatchSize_[curProc][patchi]++; } + } + } + } - if (!interProcBouFound) - { - // inter - processor boundaries do not exist and need to - // be created - // set the new addressing information + // Done internal bits of the new mesh and the ordinary patches. - // owner - interProcBoundaries[ownerProc].append(neighbourProc); - interProcBFaces[ownerProc].append(SLList<label>(facei)); - // neighbour - interProcBoundaries[neighbourProc].append(ownerProc); - interProcBFaces[neighbourProc].append(SLList<label>(facei)); - } - } - } + // Per processor, from neighbour processor to the interprocessorpatch that + // communicates with that neighbour. + List<Map<label> > procNbrToInterPatch(nProcs_); + // Per processor the faces per interprocessorpatch. + List<DynamicList<DynamicList<label> > > interPatchFaces(nProcs_); - // Loop through patches. For cyclic boundaries detect inter-processor - // faces; for all other, add faces to the face list and remember start - // and size of all patches. + // Processor boundaries from internal faces + forAll (neighbour, facei) + { + label ownerProc = cellToProc_[owner[facei]]; + label nbrProc = cellToProc_[neighbour[facei]]; - // for all processors, set the size of start index and patch size - // lists to the number of patches in the mesh - forAll(procPatchSize_, procI) + if (ownerProc != nbrProc) { - procPatchSize_[procI].setSize(patches.size()); - procPatchStartIndex_[procI].setSize(patches.size()); + // inter - processor patch face found. + addInterProcFace + ( + facei, + ownerProc, + nbrProc, + + procNbrToInterPatch, + interPatchFaces + ); } + } + + // Add the proper processor faces to the sub information. For faces + // originating from internal faces this is always -1. + List<labelListList> subPatchIDs(nProcs_); + List<labelListList> subPatchStarts(nProcs_); + forAll(interPatchFaces, procI) + { + label nInterfaces = interPatchFaces[procI].size(); + + subPatchIDs[procI].setSize(nInterfaces, labelList(1, -1)); + subPatchStarts[procI].setSize(nInterfaces, labelList(1, 0)); + } - forAll(patches, patchi) + // Processor boundaries from split cyclics + forAll (patches, patchi) + { + if (isA<cyclicPolyPatch>(patches[patchi])) { - // Reset size and start index for all processors - forAll(procPatchSize_, procI) - { - procPatchSize_[procI][patchi] = 0; - procPatchStartIndex_[procI][patchi] = - procFaceList[procI].size(); - } + const cyclicPolyPatch& pp = refCast<const cyclicPolyPatch> + ( + patches[patchi] + ); - const label patchStart = patches[patchi].start(); + // cyclic: check opposite side on this processor + const unallocLabelList& patchFaceCells = pp.faceCells(); + const unallocLabelList& nbrPatchFaceCells = + pp.neighbPatch().faceCells(); - if (!isA<cyclicPolyPatch>(patches[patchi])) + // Store old sizes. Used to detect which inter-proc patches + // have been added to. + labelListList oldInterfaceSizes(nProcs_); + forAll(oldInterfaceSizes, procI) { - // Normal patch. Add faces to processor where the cell - // next to the face lives + labelList& curOldSizes = oldInterfaceSizes[procI]; - const unallocLabelList& patchFaceCells = - patches[patchi].faceCells(); - - forAll(patchFaceCells, facei) + curOldSizes.setSize(interPatchFaces[procI].size()); + forAll(curOldSizes, interI) { - const label curProc = cellToProc_[patchFaceCells[facei]]; - - // add the face - procFaceList[curProc].append(patchStart + facei); - - // increment the number of faces for this patch - procPatchSize_[curProc][patchi]++; + curOldSizes[interI] = + interPatchFaces[procI][interI].size(); } } - else - { - // Cyclic patch special treatment - - const polyPatch& cPatch = patches[patchi]; - - const label cycOffset = cPatch.size()/2; - - // Set reference to faceCells for both patches - const labelList::subList firstFaceCells - ( - cPatch.faceCells(), - cycOffset - ); - const labelList::subList secondFaceCells - ( - cPatch.faceCells(), - cycOffset, - cycOffset - ); - - forAll(firstFaceCells, facei) + // Add faces with different owner and neighbour processors + forAll (patchFaceCells, facei) + { + const label ownerProc = cellToProc_[patchFaceCells[facei]]; + const label nbrProc = cellToProc_[nbrPatchFaceCells[facei]]; + if (ownerProc != nbrProc) { - if + // inter - processor patch face found. + addInterProcFace ( - cellToProc_[firstFaceCells[facei]] - != cellToProc_[secondFaceCells[facei]] - ) - { - // This face becomes an inter-processor boundary face - // inter - processor patch face found. Go through - // the list of inside boundaries for the owner - // processor and try to find this inter-processor - // patch. - - cyclicParallel_ = true; - - label ownerProc = cellToProc_[firstFaceCells[facei]]; - label neighbourProc = - cellToProc_[secondFaceCells[facei]]; - - SLList<label>::iterator curInterProcBdrsOwnIter = - interProcBoundaries[ownerProc].begin(); - - SLList<SLList<label> >::iterator - curInterProcBFacesOwnIter = - interProcBFaces[ownerProc].begin(); - - bool interProcBouFound = false; - - // WARNING: Synchronous SLList iterators - - for - ( - ; - curInterProcBdrsOwnIter != - interProcBoundaries[ownerProc].end() - && curInterProcBFacesOwnIter != - interProcBFaces[ownerProc].end(); - ++curInterProcBdrsOwnIter, - ++curInterProcBFacesOwnIter - ) - { - if (curInterProcBdrsOwnIter() == neighbourProc) - { - // the inter - processor boundary exists. - // Add the face - interProcBouFound = true; - - curInterProcBFacesOwnIter().append - (patchStart + facei); - - SLList<label>::iterator curInterProcBdrsNeiIter - = interProcBoundaries[neighbourProc].begin(); - - SLList<SLList<label> >::iterator - curInterProcBFacesNeiIter = - interProcBFaces[neighbourProc].begin(); - - bool neighbourFound = false; - - // WARNING: Synchronous SLList iterators - - for - ( - ; - curInterProcBdrsNeiIter - != interProcBoundaries[neighbourProc].end() - && curInterProcBFacesNeiIter - != interProcBFaces[neighbourProc].end(); - ++curInterProcBdrsNeiIter, - ++curInterProcBFacesNeiIter - ) - { - if (curInterProcBdrsNeiIter() == ownerProc) - { - // boundary found. Add the face - neighbourFound = true; - - curInterProcBFacesNeiIter() - .append - ( - patchStart - + cycOffset - + facei - ); - } - - if (neighbourFound) break; - } - - if (interProcBouFound && !neighbourFound) - { - FatalErrorIn - ( - "domainDecomposition::decomposeMesh()" - ) << "Inconsistency in inter-processor " - << "boundary lists for processors " - << ownerProc << " and " << neighbourProc - << " in cyclic boundary matching" - << abort(FatalError); - } - } - - if (interProcBouFound) break; - } - - if (!interProcBouFound) - { - // inter - processor boundaries do not exist - // and need to be created - - // set the new addressing information - - // owner - interProcBoundaries[ownerProc] - .append(neighbourProc); - interProcBFaces[ownerProc] - .append(SLList<label>(patchStart + facei)); - - // neighbour - interProcBoundaries[neighbourProc] - .append(ownerProc); - interProcBFaces[neighbourProc] - .append - ( - SLList<label> - ( - patchStart - + cycOffset - + facei - ) - ); - } - } - else - { - // This cyclic face remains on the processor - label ownerProc = cellToProc_[firstFaceCells[facei]]; - - // add the face - procFaceList[ownerProc].append(patchStart + facei); - - // increment the number of faces for this patch - procPatchSize_[ownerProc][patchi]++; - - // Note: I cannot add the other side of the cyclic - // boundary here because this would violate the order. - // They will be added in a separate loop below - // - } + pp.start()+facei, + ownerProc, + nbrProc, + procNbrToInterPatch, + interPatchFaces + ); } + } + + // 1. Check if any faces added to existing interfaces + forAll(oldInterfaceSizes, procI) + { + const labelList& curOldSizes = oldInterfaceSizes[procI]; - // Ordering in cyclic boundaries is important. - // Add the other half of cyclic faces for cyclic boundaries - // that remain on the processor - forAll(secondFaceCells, facei) + forAll(curOldSizes, interI) { - if - ( - cellToProc_[firstFaceCells[facei]] - == cellToProc_[secondFaceCells[facei]] - ) + label oldSz = curOldSizes[interI]; + if (interPatchFaces[procI][interI].size() > oldSz) { - // This cyclic face remains on the processor - label ownerProc = cellToProc_[firstFaceCells[facei]]; - - // add the second face - procFaceList[ownerProc].append - (patchStart + cycOffset + facei); - - // increment the number of faces for this patch - procPatchSize_[ownerProc][patchi]++; + // Added faces to this interface. Add an entry + append(subPatchIDs[procI][interI], patchi); + append(subPatchStarts[procI][interI], oldSz); } } } - } - - // Convert linked lists into normal lists - // Add inter-processor boundaries and remember start indices - forAll(procFaceList, procI) - { - // Get internal and regular boundary processor faces - SLList<label>& curProcFaces = procFaceList[procI]; - // Get reference to processor face addressing - labelList& curProcFaceAddressing = procFaceAddressing_[procI]; - - labelList& curProcNeighbourProcessors = - procNeighbourProcessors_[procI]; + // 2. Any new interfaces + forAll(subPatchIDs, procI) + { + label nIntfcs = interPatchFaces[procI].size(); + subPatchIDs[procI].setSize(nIntfcs, labelList(1, patchi)); + subPatchStarts[procI].setSize(nIntfcs, labelList(1, 0)); + } + } + } - labelList& curProcProcessorPatchSize = - procProcessorPatchSize_[procI]; - labelList& curProcProcessorPatchStartIndex = - procProcessorPatchStartIndex_[procI]; + // Shrink processor patch face addressing + forAll(interPatchFaces, procI) + { + DynamicList<DynamicList<label> >& curInterPatchFaces = + interPatchFaces[procI]; - // calculate the size - label nFacesOnProcessor = curProcFaces.size(); + forAll(curInterPatchFaces, i) + { + curInterPatchFaces[i].shrink(); + } + curInterPatchFaces.shrink(); + } - for - ( - SLList<SLList<label> >::iterator curInterProcBFacesIter = - interProcBFaces[procI].begin(); - curInterProcBFacesIter != interProcBFaces[procI].end(); - ++curInterProcBFacesIter - ) - { - nFacesOnProcessor += curInterProcBFacesIter().size(); - } - curProcFaceAddressing.setSize(nFacesOnProcessor); + // Sort inter-proc patch by neighbour + labelList order; + forAll(procNbrToInterPatch, procI) + { + label nInterfaces = procNbrToInterPatch[procI].size(); - // Fill in the list. Calculate turning index. - // Turning index will be -1 only for some faces on processor - // boundaries, i.e. the ones where the current processor ID - // is in the cell which is a face neighbour. - // Turning index is stored as the sign of the face addressing list + procNeighbourProcessors_[procI].setSize(nInterfaces); + procProcessorPatchSize_[procI].setSize(nInterfaces); + procProcessorPatchStartIndex_[procI].setSize(nInterfaces); + procProcessorPatchSubPatchIDs_[procI].setSize(nInterfaces); + procProcessorPatchSubPatchStarts_[procI].setSize(nInterfaces); - label nFaces = 0; + //Info<< "Processor " << procI << endl; - // Add internal and boundary faces - // Remember to increment the index by one such that the - // turning index works properly. - forAllConstIter(SLList<label>, curProcFaces, curProcFacesIter) - { - curProcFaceAddressing[nFaces] = curProcFacesIter() + 1; - nFaces++; - } + // Get sorted neighbour processors + const Map<label>& curNbrToInterPatch = procNbrToInterPatch[procI]; + labelList nbrs = curNbrToInterPatch.toc(); + sortedOrder(nbrs, order); - // Add inter-processor boundary faces. At the beginning of each - // patch, grab the patch start index and size + DynamicList<DynamicList<label> >& curInterPatchFaces = + interPatchFaces[procI]; - curProcNeighbourProcessors.setSize + forAll(order, i) + { + const label nbrProc = nbrs[i]; + const label interPatch = curNbrToInterPatch[nbrProc]; + + procNeighbourProcessors_[procI][i] = + nbrProc; + procProcessorPatchSize_[procI][i] = + curInterPatchFaces[interPatch].size(); + procProcessorPatchStartIndex_[procI][i] = + procFaceAddressing_[procI].size(); + + // Add size as last element to substarts and transfer + append ( - interProcBoundaries[procI].size() + subPatchStarts[procI][interPatch], + curInterPatchFaces[interPatch].size() ); - - curProcProcessorPatchSize.setSize + procProcessorPatchSubPatchIDs_[procI][i].transfer ( - interProcBoundaries[procI].size() + subPatchIDs[procI][interPatch] ); - - curProcProcessorPatchStartIndex.setSize + procProcessorPatchSubPatchStarts_[procI][i].transfer ( - interProcBoundaries[procI].size() + subPatchStarts[procI][interPatch] ); - label nProcPatches = 0; - - SLList<label>::iterator curInterProcBdrsIter = - interProcBoundaries[procI].begin(); - - SLList<SLList<label> >::iterator curInterProcBFacesIter = - interProcBFaces[procI].begin(); - - for - ( - ; - curInterProcBdrsIter != interProcBoundaries[procI].end() - && curInterProcBFacesIter != interProcBFaces[procI].end(); - ++curInterProcBdrsIter, ++curInterProcBFacesIter - ) + //Info<< " nbr:" << nbrProc << endl; + //Info<< " interpatch:" << interPatch << endl; + //Info<< " size:" << procProcessorPatchSize_[procI][i] << endl; + //Info<< " start:" << procProcessorPatchStartIndex_[procI][i] + // << endl; + //Info<< " subPatches:" << procProcessorPatchSubPatchIDs_[procI][i] + // << endl; + //Info<< " subStarts:" + // << procProcessorPatchSubPatchStarts_[procI][i] << endl; + + // And add all the face labels for interPatch + DynamicList<label>& interPatchFaces = + curInterPatchFaces[interPatch]; + + forAll(interPatchFaces, j) { - curProcNeighbourProcessors[nProcPatches] = - curInterProcBdrsIter(); - - // Get start index for processor patch - curProcProcessorPatchStartIndex[nProcPatches] = nFaces; + procFaceAddressing_[procI].append(interPatchFaces[j]); + } + interPatchFaces.clearStorage(); + } + curInterPatchFaces.clearStorage(); + procFaceAddressing_[procI].shrink(); + } - label& curSize = - curProcProcessorPatchSize[nProcPatches]; - curSize = 0; +////XXXXXXX +//// Print a bit +// forAll(procPatchStartIndex_, procI) +// { +// Info<< "Processor:" << procI << endl; +// +// Info<< " total faces:" << procFaceAddressing_[procI].size() +// << endl; +// +// const labelList& curProcPatchStartIndex = procPatchStartIndex_[procI]; +// +// forAll(curProcPatchStartIndex, patchI) +// { +// Info<< " patch:" << patchI +// << "\tstart:" << curProcPatchStartIndex[patchI] +// << "\tsize:" << procPatchSize_[procI][patchI] +// << endl; +// } +// } +// Info<< endl; +// +// forAll(procNeighbourProcessors_, procI) +// { +// Info<< "Processor " << procI << endl; +// +// forAll(procNeighbourProcessors_[procI], i) +// { +// Info<< " nbr:" << procNeighbourProcessors_[procI][i] << endl; +// Info<< " size:" << procProcessorPatchSize_[procI][i] << endl; +// Info<< " start:" << procProcessorPatchStartIndex_[procI][i] +// << endl; +// } +// } +// Info<< endl; +// +// forAll(procFaceAddressing_, procI) +// { +// Info<< "Processor:" << procI << endl; +// +// Info<< " faces:" << procFaceAddressing_[procI] << endl; +// } - // add faces for this processor boundary - forAllConstIter - ( - SLList<label>, - curInterProcBFacesIter(), - curFacesIter - ) - { - // add the face - - // Remember to increment the index by one such that the - // turning index works properly. - if (cellToProc_[owner[curFacesIter()]] == procI) - { - curProcFaceAddressing[nFaces] = curFacesIter() + 1; - } - else - { - // turning face - curProcFaceAddressing[nFaces] = -(curFacesIter() + 1); - } - - // increment the size - curSize++; - - nFaces++; - } - - nProcPatches++; - } - } - } Info<< "\nDistributing points to processors" << endl; // For every processor, loop through the list of faces for the processor. diff --git a/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposer.C b/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposer.C index 25bcd3495fe38be562d223dd3c2f5a29a1cdbe7c..52582832cf650f76fc44469ca9f18671a0edf678 100644 --- a/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposer.C +++ b/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposer.C @@ -144,7 +144,11 @@ Foam::fvFieldDecomposer::fvFieldDecomposer { forAll(boundaryAddressing_, patchi) { - if (boundaryAddressing_[patchi] >= 0) + if + ( + boundaryAddressing_[patchi] >= 0 + && !isA<processorLduInterface>(procMesh.boundary()[patchi]) + ) { patchFieldDecomposerPtrs_[patchi] = new patchFieldDecomposer ( diff --git a/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposerDecomposeFields.C b/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposerDecomposeFields.C index c70f724221ecaebbefb64bf19054426f68831b07..190e7f8e1cf35a1d81f1a60cc52b7a57dc976cc9 100644 --- a/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposerDecomposeFields.C +++ b/applications/utilities/parallelProcessing/decomposePar/fvFieldDecomposerDecomposeFields.C @@ -26,6 +26,8 @@ License #include "fvFieldDecomposer.H" #include "processorFvPatchField.H" #include "processorFvsPatchField.H" +#include "processorCyclicFvPatchField.H" +#include "processorCyclicFvsPatchField.H" // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // @@ -44,7 +46,7 @@ Foam::fvFieldDecomposer::decomposeField forAll(boundaryAddressing_, patchi) { - if (boundaryAddressing_[patchi] >= 0) + if (patchFieldDecomposerPtrs_[patchi]) { patchFields.set ( @@ -58,7 +60,24 @@ Foam::fvFieldDecomposer::decomposeField ) ); } - else + else if (isA<processorCyclicFvPatch>(procMesh_.boundary()[patchi])) + { + patchFields.set + ( + patchi, + new processorCyclicFvPatchField<Type> + ( + procMesh_.boundary()[patchi], + DimensionedField<Type, volMesh>::null(), + Field<Type> + ( + field.internalField(), + *processorVolPatchFieldDecomposerPtrs_[patchi] + ) + ) + ); + } + else if (isA<processorFvPatch>(procMesh_.boundary()[patchi])) { patchFields.set ( @@ -75,6 +94,11 @@ Foam::fvFieldDecomposer::decomposeField ) ); } + else + { + FatalErrorIn("fvFieldDecomposer::decomposeField()") + << "Unknown type." << abort(FatalError); + } } // Create the field for the processor @@ -155,7 +179,7 @@ Foam::fvFieldDecomposer::decomposeField forAll(boundaryAddressing_, patchi) { - if (boundaryAddressing_[patchi] >= 0) + if (patchFieldDecomposerPtrs_[patchi]) { patchFields.set ( @@ -169,7 +193,24 @@ Foam::fvFieldDecomposer::decomposeField ) ); } - else + else if (isA<processorCyclicFvPatch>(procMesh_.boundary()[patchi])) + { + patchFields.set + ( + patchi, + new processorCyclicFvsPatchField<Type> + ( + procMesh_.boundary()[patchi], + DimensionedField<Type, surfaceMesh>::null(), + Field<Type> + ( + allFaceField, + *processorSurfacePatchFieldDecomposerPtrs_[patchi] + ) + ) + ); + } + else if (isA<processorFvPatch>(procMesh_.boundary()[patchi])) { patchFields.set ( @@ -186,6 +227,11 @@ Foam::fvFieldDecomposer::decomposeField ) ); } + else + { + FatalErrorIn("fvFieldDecomposer::decomposeField()") + << "Unknown type." << abort(FatalError); + } } // Create the field for the processor diff --git a/applications/utilities/postProcessing/graphics/PV3Readers/PV3FoamReader/vtkPV3Foam/vtkPV3Foam.C b/applications/utilities/postProcessing/graphics/PV3Readers/PV3FoamReader/vtkPV3Foam/vtkPV3Foam.C index 1a01cb6564099d38da952036d7a7e1816cc01452..a73b46621edc7ef4000d50df881d03f2e4a22d99 100644 --- a/applications/utilities/postProcessing/graphics/PV3Readers/PV3FoamReader/vtkPV3Foam/vtkPV3Foam.C +++ b/applications/utilities/postProcessing/graphics/PV3Readers/PV3FoamReader/vtkPV3Foam/vtkPV3Foam.C @@ -651,7 +651,7 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) labelList nZones(pbMesh.size(), 0); // Per global zone number the average face centre position - DynamicList<point> zoneCentre(pbMesh.size()); + List<DynamicList<point> > zoneCentre(pbMesh.size()); // Loop through all patches to determine zones, and centre of each zone @@ -693,31 +693,28 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) labelList zoneNFaces(pZones.nZones(), 0); - // Save start of information for current patch - label patchStart = zoneCentre.size(); - // Create storage for additional zone centres forAll(zoneNFaces, zoneI) { - zoneCentre.append(vector::zero); + zoneCentre[patchI].append(vector::zero); } // Do averaging per individual zone forAll(pp, faceI) { label zoneI = pZones[faceI]; - zoneCentre[patchStart+zoneI] += pp[faceI].centre(pp.points()); + zoneCentre[patchI][zoneI] += pp[faceI].centre(pp.points()); zoneNFaces[zoneI]++; } - for (label i=0; i<nZones[patchI]; i++) + forAll(zoneCentre[patchI], zoneI) { - zoneCentre[patchStart + i] /= zoneNFaces[i]; + zoneCentre[patchI][zoneI] /= zoneNFaces[zoneI]; } } - // Count number of zones we're actually going to display. This is truncated - // to a max per patch + // Count number of zones we're actually going to display. + // This is truncated to a max per patch const label MAXPATCHZONES = 20; @@ -728,13 +725,9 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) displayZoneI += min(MAXPATCHZONES, nZones[patchI]); } - - zoneCentre.shrink(); - if (debug) { - Info<< "patch zone centres = " << zoneCentre << nl - << "displayed zone centres = " << displayZoneI << nl + Info<< "displayed zone centres = " << displayZoneI << nl << "zones per patch = " << nZones << endl; } @@ -749,13 +742,12 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) // Actor index displayZoneI = 0; - // Index in zone centres - label globalZoneI = 0; - forAll(pbMesh, patchI) { const polyPatch& pp = pbMesh[patchI]; + label globalZoneI = 0; + // Only selected patches will have a non-zero number of zones label nDisplayZones = min(MAXPATCHZONES, nZones[patchI]); label increment = 1; @@ -769,7 +761,7 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) if (debug) { Info<< "patch name = " << pp.name() << nl - << "anchor = " << zoneCentre[globalZoneI] << nl + << "anchor = " << zoneCentre[patchI][globalZoneI] << nl << "globalZoneI = " << globalZoneI << endl; } @@ -792,9 +784,9 @@ void Foam::vtkPV3Foam::renderPatchNames(vtkRenderer* renderer, const bool show) txt->GetPositionCoordinate()->SetValue ( - zoneCentre[globalZoneI].x(), - zoneCentre[globalZoneI].y(), - zoneCentre[globalZoneI].z() + zoneCentre[patchI][globalZoneI].x(), + zoneCentre[patchI][globalZoneI].y(), + zoneCentre[patchI][globalZoneI].z() ); // Add text to each renderer diff --git a/applications/utilities/postProcessing/miscellaneous/postChannel/channelIndex.C b/applications/utilities/postProcessing/miscellaneous/postChannel/channelIndex.C index 009e28329e39fb75517a2ba1c204285b44955904..26c8f4ed8af3922404b542abc9ca7d6e7910b862 100644 --- a/applications/utilities/postProcessing/miscellaneous/postChannel/channelIndex.C +++ b/applications/utilities/postProcessing/miscellaneous/postChannel/channelIndex.C @@ -79,7 +79,7 @@ void Foam::channelIndex::walkOppositeFaces isFrontBndFace[faceI-mesh.nInternalFaces()] = true; } } - syncTools::swapBoundaryFaceList(mesh, isFrontBndFace, false); + syncTools::swapBoundaryFaceList(mesh, isFrontBndFace); // Add forAll(isFrontBndFace, i) diff --git a/applications/utilities/postProcessing/patch/patchIntegrate/patchIntegrate.C b/applications/utilities/postProcessing/patch/patchIntegrate/patchIntegrate.C index 9dbe43a8b3ec07e5069e92c26776908fa74a1081..5c735492c7aec989602d2e2bbd6844e91ebbcb6b 100644 --- a/applications/utilities/postProcessing/patch/patchIntegrate/patchIntegrate.C +++ b/applications/utilities/postProcessing/patch/patchIntegrate/patchIntegrate.C @@ -30,7 +30,6 @@ Description \*---------------------------------------------------------------------------*/ #include "fvCFD.H" -#include "cyclicPolyPatch.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // // Main program: @@ -76,35 +75,12 @@ int main(int argc, char *argv[]) } // Give patch area - if (isA<cyclicPolyPatch>(mesh.boundaryMesh()[patchI])) - { - Info<< " Cyclic patch vector area: " << nl; - label nFaces = mesh.boundaryMesh()[patchI].size(); - vector sum1 = vector::zero; - vector sum2 = vector::zero; - for (label i=0; i<nFaces/2; i++) - { - sum1 += mesh.Sf().boundaryField()[patchI][i]; - sum2 += mesh.Sf().boundaryField()[patchI][i+nFaces/2]; - } - reduce(sum1, sumOp<vector>()); - reduce(sum2, sumOp<vector>()); - Info<< " - half 1 = " << sum1 << ", " << mag(sum1) << nl - << " - half 2 = " << sum2 << ", " << mag(sum2) << nl - << " - total = " << (sum1 + sum2) << ", " - << mag(sum1 + sum2) << endl; - Info<< " Cyclic patch area magnitude = " - << gSum(mesh.magSf().boundaryField()[patchI])/2.0 << endl; - } - else - { - Info<< " Area vector of patch " - << patchName << '[' << patchI << ']' << " = " - << gSum(mesh.Sf().boundaryField()[patchI]) << endl; - Info<< " Area magnitude of patch " - << patchName << '[' << patchI << ']' << " = " - << gSum(mesh.magSf().boundaryField()[patchI]) << endl; - } + Info<< " Area vector of patch " + << patchName << '[' << patchI << ']' << " = " + << gSum(mesh.Sf().boundaryField()[patchI]) << endl; + Info<< " Area magnitude of patch " + << patchName << '[' << patchI << ']' << " = " + << gSum(mesh.magSf().boundaryField()[patchI]) << endl; // Read field and calc integral if (fieldHeader.headerClassName() == volScalarField::typeName) diff --git a/applications/utilities/preProcessing/foamUpgradeCyclics/Make/files b/applications/utilities/preProcessing/foamUpgradeCyclics/Make/files new file mode 100644 index 0000000000000000000000000000000000000000..9b58821d1704ff46dbe851360bbafb8840ef068c --- /dev/null +++ b/applications/utilities/preProcessing/foamUpgradeCyclics/Make/files @@ -0,0 +1,3 @@ +foamUpgradeCyclics.C + +EXE = $(FOAM_APPBIN)/foamUpgradeCyclics diff --git a/applications/utilities/preProcessing/foamUpgradeCyclics/Make/options b/applications/utilities/preProcessing/foamUpgradeCyclics/Make/options new file mode 100644 index 0000000000000000000000000000000000000000..93ae287538b0547faa2570f8f832561d6e06c149 --- /dev/null +++ b/applications/utilities/preProcessing/foamUpgradeCyclics/Make/options @@ -0,0 +1,6 @@ +EXE_INC = \ + -I$(LIB_SRC)/finiteVolume/lnInclude + +EXE_LIBS = \ + -lfiniteVolume \ + -lgenericPatchFields diff --git a/applications/utilities/preProcessing/foamUpgradeCyclics/foamUpgradeCyclics.C b/applications/utilities/preProcessing/foamUpgradeCyclics/foamUpgradeCyclics.C new file mode 100644 index 0000000000000000000000000000000000000000..cce68316c0c3870b2831dd38cd8a3063ee0ad8b4 --- /dev/null +++ b/applications/utilities/preProcessing/foamUpgradeCyclics/foamUpgradeCyclics.C @@ -0,0 +1,620 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Application + foamUpgradeCyclics + +Description + Tool to upgrade mesh and fields for split cyclics + +Usage + + - foamUpgradeCyclics [OPTION] + + @param -test \n + Suppress writing the updated files with split cyclics + +\*---------------------------------------------------------------------------*/ + +#include "argList.H" +#include "Time.H" +#include "timeSelector.H" +#include "IOdictionary.H" +#include "polyMesh.H" +#include "entry.H" +#include "IOPtrList.H" +#include "cyclicPolyPatch.H" +#include "dictionaryEntry.H" +#include "IOobjectList.H" +#include "volFields.H" +#include "pointFields.H" +#include "surfaceFields.H" +#include "string.H" + +using namespace Foam; + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + defineTemplateTypeNameAndDebug(IOPtrList<entry>, 0); +} + + +// Read boundary file without reading mesh +void rewriteBoundary +( + const bool isTestRun, + const IOobject& io, + const fileName& regionPrefix, + HashTable<word>& thisNames, + HashTable<word>& nbrNames +) +{ + Info<< "Reading boundary from " << io.filePath() << endl; + + // Read PtrList of dictionary. + const word oldTypeName = IOPtrList<entry>::typeName; + const_cast<word&>(IOPtrList<entry>::typeName) = word::null; + IOPtrList<entry> patches(io); + const_cast<word&>(IOPtrList<entry>::typeName) = oldTypeName; + // Fake type back to what was in field + const_cast<word&>(patches.type()) = patches.headerClassName(); + + + // Replace any 'cyclic' + label nOldCyclics = 0; + forAll(patches, patchI) + { + const dictionary& patchDict = patches[patchI].dict(); + + if (word(patchDict["type"]) == cyclicPolyPatch::typeName) + { + if (!patchDict.found("neighbourPatch")) + { + Info<< "Patch " << patches[patchI].keyword() + << " does not have 'neighbourPatch' entry; assuming it" + << " is of the old type." << endl; + nOldCyclics++; + } + } + } + + Info<< "Detected " << nOldCyclics << " old cyclics." << nl << endl; + + + // Save old patches. + PtrList<entry> oldPatches(patches); + + // Extend + label nOldPatches = patches.size(); + patches.setSize(nOldPatches+nOldCyclics); + + // Create reordering map + labelList oldToNew(patches.size()); + + + // Add new entries + label addedPatchI = nOldPatches; + label newPatchI = 0; + forAll(oldPatches, patchI) + { + const dictionary& patchDict = oldPatches[patchI].dict(); + + if + ( + word(patchDict["type"]) == cyclicPolyPatch::typeName + ) + { + const word& name = oldPatches[patchI].keyword(); + + if (patchDict.found("neighbourPatch")) + { + patches.set(patchI, oldPatches.set(patchI, NULL)); + oldToNew[patchI] = newPatchI++; + + // Check if patches come from automatic conversion + word oldName; + + string::size_type i = name.rfind("_half0"); + if (i != string::npos) + { + oldName = name.substr(0, i); + thisNames.insert(oldName, name); + Info<< "Detected converted cyclic patch " << name + << " ; assuming it originates from " << oldName + << endl; + } + else + { + i = name.rfind("_half1"); + if (i != string::npos) + { + oldName = name.substr(0, i); + nbrNames.insert(oldName, name); + Info<< "Detected converted cyclic patch " << name + << " ; assuming it originates from " << oldName + << endl; + } + } + } + else + { + label nFaces = readLabel(patchDict["nFaces"]); + label startFace = readLabel(patchDict["startFace"]); + + Info<< "Detected old style " << word(patchDict["type"]) + << " patch " << name << " with" << nl + << " nFaces : " << nFaces << nl + << " startFace : " << startFace << endl; + + word thisName = name + "_half0"; + word nbrName = name + "_half1"; + + thisNames.insert(name, thisName); + nbrNames.insert(name, nbrName); + + // Save current dictionary + const dictionary patchDict(patches[patchI].dict()); + + // Change entry on this side + patches.set(patchI, oldPatches.set(patchI, NULL)); + oldToNew[patchI] = newPatchI++; + dictionary& thisPatchDict = patches[patchI].dict(); + thisPatchDict.add("neighbourPatch", nbrName); + thisPatchDict.set("nFaces", nFaces/2); + patches[patchI].keyword() = thisName; + + // Add entry on other side + patches.set + ( + addedPatchI, + new dictionaryEntry + ( + nbrName, + dictionary::null, + patchDict + ) + ); + oldToNew[addedPatchI] = newPatchI++; + dictionary& nbrPatchDict = patches[addedPatchI].dict(); + nbrPatchDict.set("neighbourPatch", thisName); + nbrPatchDict.set("nFaces", nFaces/2); + nbrPatchDict.set("startFace", startFace+nFaces/2); + patches[addedPatchI].keyword() = nbrName; + + Info<< "Replaced with patches" << nl + << patches[patchI].keyword() << " with" << nl + << " nFaces : " + << readLabel(thisPatchDict.lookup("nFaces")) + << nl + << " startFace : " + << readLabel(thisPatchDict.lookup("startFace")) << nl + << patches[addedPatchI].keyword() << " with" << nl + << " nFaces : " + << readLabel(nbrPatchDict.lookup("nFaces")) + << nl + << " startFace : " + << readLabel(nbrPatchDict.lookup("startFace")) + << nl << endl; + + addedPatchI++; + } + } + else + { + patches.set(patchI, oldPatches.set(patchI, NULL)); + oldToNew[patchI] = newPatchI++; + } + } + + patches.reorder(oldToNew); + + if (returnReduce(nOldCyclics, sumOp<label>()) > 0) + { + if (isTestRun) + { + //Info<< "-test option: no changes made" << nl << endl; + } + else + { + if (mvBak(patches.objectPath(), "old")) + { + Info<< "Backup to " + << (patches.objectPath() + ".old") << nl; + } + + Info<< "Write to " + << patches.objectPath() << nl << endl; + patches.write(); + } + } + else + { + Info<< "No changes made to boundary file." << nl << endl; + } +} + + +void rewriteField +( + const bool isTestRun, + const Time& runTime, + const word& fieldName, + const HashTable<word>& thisNames, + const HashTable<word>& nbrNames +) +{ + // Read dictionary. (disable class type checking so we can load + // field) + Info<< "Loading field " << fieldName << endl; + const word oldTypeName = IOdictionary::typeName; + const_cast<word&>(IOdictionary::typeName) = word::null; + + IOdictionary fieldDict + ( + IOobject + ( + fieldName, + runTime.timeName(), + runTime, + IOobject::MUST_READ, + IOobject::NO_WRITE, + false + ) + ); + const_cast<word&>(IOdictionary::typeName) = oldTypeName; + // Fake type back to what was in field + const_cast<word&>(fieldDict.type()) = fieldDict.headerClassName(); + + + + dictionary& boundaryField = fieldDict.subDict("boundaryField"); + + label nChanged = 0; + + forAllConstIter(HashTable<word>, thisNames, iter) + { + const word& patchName = iter.key(); + const word& newName = iter(); + + Info<< "Looking for entry for patch " << patchName << endl; + + if (boundaryField.found(patchName) && !boundaryField.found(newName)) + { + Info<< " Changing entry " << patchName << " to " << newName + << endl; + + dictionary patchDict(boundaryField.subDict(patchName)); + + if (patchDict.found("value")) + { + IOWarningIn("rewriteField(..)", patchDict) + << "Cyclic patch " << patchName + << " has value entry. Please removed this and rerun." + << endl; + } + + + boundaryField.changeKeyword(patchName, newName); + boundaryField.add + ( + nbrNames[patchName], + patchDict + ); + Info<< " Adding entry " << nbrNames[patchName] << endl; + + nChanged++; + } + } + + //Info<< "New boundaryField:" << boundaryField << endl; + + if (returnReduce(nChanged, sumOp<label>()) > 0) + { + if (isTestRun) + { + //Info<< "-test option: no changes made" << endl; + } + else + { + if (mvBak(fieldDict.objectPath(), "old")) + { + Info<< "Backup to " + << (fieldDict.objectPath() + ".old") << nl; + } + + Info<< "Write to " + << fieldDict.objectPath() << endl; + fieldDict.regIOobject::write(); + } + } + else + { + Info<< "No changes made to field " << fieldName << endl; + } + Info<< endl; +} + + +void rewriteFields +( + const bool isTestRun, + const Time& runTime, + const wordList& fieldNames, + const HashTable<word>& thisNames, + const HashTable<word>& nbrNames +) +{ + forAll(fieldNames, i) + { + rewriteField + ( + isTestRun, + runTime, + fieldNames[i], + thisNames, + nbrNames + ); + } +} + + +// Main program: + +int main(int argc, char *argv[]) +{ + timeSelector::addOptions(); + + argList::addBoolOption("test"); +# include "addRegionOption.H" + +# include "setRootCase.H" +# include "createTime.H" + + instantList timeDirs = timeSelector::select0(runTime, args); + + const bool isTestRun = args.optionFound("test"); + if (isTestRun) + { + Info<< "-test option: no changes made" << nl << endl; + } + + + Foam::word regionName = polyMesh::defaultRegion; + args.optionReadIfPresent("region", regionName); + + fileName regionPrefix = ""; + if (regionName != polyMesh::defaultRegion) + { + regionPrefix = regionName; + } + + + // Per cyclic patch the new name for this side and the other side + HashTable<word> thisNames; + HashTable<word> nbrNames; + + // Rewrite constant boundary file. Return any patches that have been split. + IOobject io + ( + "boundary", + runTime.constant(), + polyMesh::meshSubDir, + runTime, + IOobject::MUST_READ, + IOobject::NO_WRITE, + false + ); + + if (io.headerOk()) + { + rewriteBoundary + ( + isTestRun, + io, + regionPrefix, + thisNames, + nbrNames + ); + } + + + + // Convert any fields + + forAll(timeDirs, timeI) + { + runTime.setTime(timeDirs[timeI], timeI); + + Info<< "Time: " << runTime.timeName() << endl; + + // See if mesh in time directory + IOobject io + ( + "boundary", + runTime.timeName(), + polyMesh::meshSubDir, + runTime, + IOobject::MUST_READ, + IOobject::NO_WRITE, + false + ); + + if (io.headerOk()) + { + rewriteBoundary + ( + isTestRun, + io, + regionPrefix, + thisNames, + nbrNames + ); + } + + + IOobjectList objects(runTime, runTime.timeName()); + + + // volFields + // ~~~~~~~~~ + + rewriteFields + ( + isTestRun, + runTime, + objects.names(volScalarField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(volVectorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(volSphericalTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(volSymmTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(volTensorField::typeName), + thisNames, + nbrNames + ); + + + // pointFields + // ~~~~~~~~~~~ + + rewriteFields + ( + isTestRun, + runTime, + objects.names(pointScalarField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(pointVectorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(pointSphericalTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(pointSymmTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(pointTensorField::typeName), + thisNames, + nbrNames + ); + + + // surfaceFields + // ~~~~~~~~~~~ + + rewriteFields + ( + isTestRun, + runTime, + objects.names(surfaceScalarField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(surfaceVectorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(surfaceSphericalTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(surfaceSymmTensorField::typeName), + thisNames, + nbrNames + ); + rewriteFields + ( + isTestRun, + runTime, + objects.names(surfaceTensorField::typeName), + thisNames, + nbrNames + ); + } + + return 0; +} + + +// ************************************************************************* // diff --git a/src/OpenFOAM/Make/files b/src/OpenFOAM/Make/files index aebfd27178b3199e1320a10f0d7cd815c5aa7457..bf28d148ddd2221be5ed0b8678c973824bd8ebf9 100644 --- a/src/OpenFOAM/Make/files +++ b/src/OpenFOAM/Make/files @@ -260,12 +260,14 @@ GAMGInterfaces = $(GAMG)/interfaces $(GAMGInterfaces)/GAMGInterface/GAMGInterface.C $(GAMGInterfaces)/GAMGInterface/GAMGInterfaceNew.C $(GAMGInterfaces)/processorGAMGInterface/processorGAMGInterface.C +$(GAMGInterfaces)/processorCyclicGAMGInterface/processorCyclicGAMGInterface.C $(GAMGInterfaces)/cyclicGAMGInterface/cyclicGAMGInterface.C GAMGInterfaceFields = $(GAMG)/interfaceFields $(GAMGInterfaceFields)/GAMGInterfaceField/GAMGInterfaceField.C $(GAMGInterfaceFields)/GAMGInterfaceField/GAMGInterfaceFieldNew.C $(GAMGInterfaceFields)/processorGAMGInterfaceField/processorGAMGInterfaceField.C +$(GAMGInterfaceFields)/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.C $(GAMGInterfaceFields)/cyclicGAMGInterfaceField/cyclicGAMGInterfaceField.C GAMGAgglomerations = $(GAMG)/GAMGAgglomerations @@ -339,6 +341,7 @@ $(constraintPolyPatches)/empty/emptyPolyPatch.C $(constraintPolyPatches)/symmetry/symmetryPolyPatch.C $(constraintPolyPatches)/wedge/wedgePolyPatch.C $(constraintPolyPatches)/cyclic/cyclicPolyPatch.C +$(constraintPolyPatches)/processorCyclic/processorCyclicPolyPatch.C $(constraintPolyPatches)/processor/processorPolyPatch.C derivedPolyPatches = $(polyPatches)/derived @@ -450,6 +453,7 @@ $(constraintPointPatches)/symmetry/symmetryPointPatch.C $(constraintPointPatches)/wedge/wedgePointPatch.C $(constraintPointPatches)/cyclic/cyclicPointPatch.C $(constraintPointPatches)/processor/processorPointPatch.C +$(constraintPointPatches)/processorCyclic/processorCyclicPointPatch.C derivedPointPatches = $(pointPatches)/derived $(derivedPointPatches)/coupled/coupledFacePointPatch.C @@ -508,6 +512,7 @@ $(constraintPointPatchFields)/wedge/wedgePointPatchFields.C $(constraintPointPatchFields)/cyclic/cyclicPointPatchFields.C $(constraintPointPatchFields)/cyclicSlip/cyclicSlipPointPatchFields.C $(constraintPointPatchFields)/processor/processorPointPatchFields.C +$(constraintPointPatchFields)/processorCyclic/processorCyclicPointPatchFields.C derivedPointPatchFields = $(pointPatchFields)/derived $(derivedPointPatchFields)/slip/slipPointPatchFields.C diff --git a/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.C b/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.C index 1d1ff5eec85dd741938c1f5f52e7b1752efe0cd2..a6a6afd430ea818e3d005c7bfd939d09e7640669 100644 --- a/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.C +++ b/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.C @@ -251,12 +251,13 @@ bool Foam::FaceCellWave<Type>::updateFace template <class Type> void Foam::FaceCellWave<Type>::checkCyclic(const polyPatch& patch) const { - label cycOffset = patch.size()/2; + const cyclicPolyPatch& nbrPatch = + refCast<const cyclicPolyPatch>(patch).neighbPatch(); - for (label patchFaceI = 0; patchFaceI < cycOffset; patchFaceI++) + forAll(patch, patchFaceI) { label i1 = patch.start() + patchFaceI; - label i2 = i1 + cycOffset; + label i2 = nbrPatch.start() + patchFaceI; if (!allFaceInfo_[i1].sameGeometry(mesh_, allFaceInfo_[i2], geomTol_)) { @@ -334,8 +335,7 @@ void Foam::FaceCellWave<Type>::mergeFaceInfo const polyPatch& patch, const label nFaces, const labelList& changedFaces, - const List<Type>& changedFacesInfo, - const bool + const List<Type>& changedFacesInfo ) { for (label changedFaceI = 0; changedFaceI < nFaces; changedFaceI++) @@ -599,8 +599,7 @@ void Foam::FaceCellWave<Type>::handleProcPatches() patch, nReceiveFaces, receiveFaces, - receiveFacesInfo, - procPatch.parallel() + receiveFacesInfo ); } } @@ -619,87 +618,42 @@ void Foam::FaceCellWave<Type>::handleCyclicPatches() if (isA<cyclicPolyPatch>(patch)) { - label halfSize = patch.size()/2; + const cyclicPolyPatch& nbrPatch = + refCast<const cyclicPolyPatch>(patch).neighbPatch(); // Allocate buffers - label nSendFaces; - labelList sendFaces(halfSize); - List<Type> sendFacesInfo(halfSize); - label nReceiveFaces; - labelList receiveFaces(halfSize); - List<Type> receiveFacesInfo(halfSize); - - // Half1: Determine which faces changed. Use sendFaces for storage - nSendFaces = getChangedPatchFaces - ( - patch, - 0, - halfSize, - sendFaces, - sendFacesInfo - ); + labelList receiveFaces(patch.size()); + List<Type> receiveFacesInfo(patch.size()); - // Half2: Determine which faces changed. Use receiveFaces_ ,, + // Determine which faces changed nReceiveFaces = getChangedPatchFaces ( - patch, - halfSize, - halfSize, + nbrPatch, + 0, + nbrPatch.size(), receiveFaces, receiveFacesInfo ); - //Info<< "Half1:" << endl; - //writeFaces(nSendFaces, sendFaces, sendFacesInfo, Info); - //Info<< endl; - // - //Info<< "Half2:" << endl; - //writeFaces(nReceiveFaces, receiveFaces, receiveFacesInfo, Info); - //Info<< endl; - - - // Half1: Adapt wallInfo for leaving domain - leaveDomain - ( - patch, - nSendFaces, - sendFaces, - sendFacesInfo - ); - // Half2: Adapt wallInfo for leaving domain + // Adapt wallInfo for leaving domain leaveDomain ( - patch, + nbrPatch, nReceiveFaces, receiveFaces, receiveFacesInfo ); - // Half1: 'transfer' to other side by offsetting patchFaceI - offset(patch, halfSize, nSendFaces, sendFaces); - - // Half2: 'transfer' to other side - offset(patch, -halfSize, nReceiveFaces, receiveFaces); - - // Apply rotation for non-parallel planes const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patch); if (!cycPatch.parallel()) { - // sendFaces = received data from half1 + // received data from other half transform ( cycPatch.forwardT(), - nSendFaces, - sendFacesInfo - ); - - // receiveFaces = received data from half2 - transform - ( - cycPatch.reverseT(), nReceiveFaces, receiveFacesInfo ); @@ -707,25 +661,15 @@ void Foam::FaceCellWave<Type>::handleCyclicPatches() if (debug) { - Pout<< " Cyclic patch " << patchI << ' ' << patch.name() - << " Changed on first half : " << nSendFaces - << " Changed on second half : " << nReceiveFaces + Pout<< " Cyclic patch " << patchI << ' ' << cycPatch.name() + << " Changed : " << nReceiveFaces << endl; } - // Half1: Adapt wallInfo for entering domain - enterDomain - ( - patch, - nSendFaces, - sendFaces, - sendFacesInfo - ); - // Half2: Adapt wallInfo for entering domain enterDomain ( - patch, + cycPatch, nReceiveFaces, receiveFaces, receiveFacesInfo @@ -734,25 +678,15 @@ void Foam::FaceCellWave<Type>::handleCyclicPatches() // Merge into global storage mergeFaceInfo ( - patch, - nSendFaces, - sendFaces, - sendFacesInfo, - cycPatch.parallel() - ); - // Merge into global storage - mergeFaceInfo - ( - patch, + cycPatch, nReceiveFaces, receiveFaces, - receiveFacesInfo, - cycPatch.parallel() + receiveFacesInfo ); if (debug) { - checkCyclic(patch); + checkCyclic(cycPatch); } } } diff --git a/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.H b/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.H index 9361c10f23f6f3f681908593b9c7084d2c852dd7..149f0badc4214bcfeb100e4fc8237d1eca3677e8 100644 --- a/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.H +++ b/src/OpenFOAM/algorithms/MeshWave/FaceCellWave.H @@ -192,8 +192,7 @@ class FaceCellWave const polyPatch& patch, const label nFaces, const labelList&, - const List<Type>&, - const bool isParallel + const List<Type>& ); //- Extract info for single patch only diff --git a/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.C b/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.C index fbe757576341de9c2a69adce0dc7dcb7b1562dc1..e0ef1bf8eb0f23b920d2253713e150e10fa36599 100644 --- a/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.C +++ b/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.C @@ -219,6 +219,30 @@ Foam::List<int> Foam::UPstream::procIDs_(1, 0); // Standard transfer message type int Foam::UPstream::msgType_(1); +// New message type +int Foam::UPstream::freeTag_(msgType()+1); + +// Free'd message types +Foam::LIFOStack<int> Foam::UPstream::freedTags_; + +int Foam::UPstream::allocateTag() +{ + if (freedTags_.empty()) + { + return freeTag_++; + } + else + { + return freedTags_.pop(); + } +} + +void Foam::UPstream::freeTag(const int tag) +{ + freedTags_.push(tag); +} + + // Linear communication schedule Foam::List<Foam::UPstream::commsStruct> Foam::UPstream::linearCommunication_(0); diff --git a/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.H b/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.H index a0b0e44b8798198645bafe3d9d8acf25e815737f..57f6c263bc82e88170355cfef49d59287c8b393b 100644 --- a/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.H +++ b/src/OpenFOAM/db/IOstreams/Pstreams/UPstream.H @@ -45,6 +45,7 @@ SourceFiles #include "HashTable.H" #include "string.H" #include "NamedEnum.H" +#include "LIFOStack.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -190,6 +191,12 @@ private: static List<commsStruct> treeCommunication_; + //- Current free tag + static int freeTag_; + + //- Freed tags + static LIFOStack<int> freedTags_; + // Private Member Functions //- Set data for parallel running @@ -339,6 +346,11 @@ public: { return msgType_; } + //- Allocate new tag + static int allocateTag(); + + //- Release allocated tag + static void freeTag(const int tag); //- Get the communications type of the stream diff --git a/src/OpenFOAM/fields/GeometricFields/GeometricField/GeometricBoundaryField.C b/src/OpenFOAM/fields/GeometricFields/GeometricField/GeometricBoundaryField.C index 7fa8d4b8bc19ed7586dcbaae22ea111cfaf075ff..ea652841b00090da0c126b69913a49f506390058 100644 --- a/src/OpenFOAM/fields/GeometricFields/GeometricField/GeometricBoundaryField.C +++ b/src/OpenFOAM/fields/GeometricFields/GeometricField/GeometricBoundaryField.C @@ -26,6 +26,7 @@ License #include "emptyPolyPatch.H" #include "commSchedule.H" #include "globalMeshData.H" +#include "cyclicPolyPatch.H" // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // @@ -251,6 +252,29 @@ GeometricBoundaryField { if (bmesh_[patchi].type() != emptyPolyPatch::typeName) { + if + ( + bmesh_[patchi].type() == cyclicPolyPatch::typeName + && !dict.found(bmesh_[patchi].name()) + ) + { + FatalIOErrorIn + ( + "GeometricField<Type, PatchField, GeoMesh>::\n" + "GeometricBoundaryField::GeometricBoundaryField\n" + "(\n" + " const BoundaryMesh&,\n" + " const DimensionedField<Type, GeoMesh>&,\n" + " const dictionary&\n" + ")", + dict + ) << "Cannot find patchField entry for cyclic " + << bmesh_[patchi].name() << endl + << "Is your field uptodate with split cyclics?" << endl + << "Run foamUpgradeCyclics to convert mesh and fields" + << " to split cyclics." << exit(FatalIOError); + } + set ( patchi, @@ -322,7 +346,11 @@ evaluate() } // Block for any outstanding requests - if (Pstream::defaultCommsType == Pstream::nonBlocking) + if + ( + Pstream::parRun() + && Pstream::defaultCommsType == Pstream::nonBlocking + ) { Pstream::waitRequests(); } diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/cyclic/cyclicPointPatchField.C b/src/OpenFOAM/fields/pointPatchFields/constraint/cyclic/cyclicPointPatchField.C index a5f1b4a761b049b1e75dd7c539734fb9f8837f09..e23e5a8948b5362c01f9ec98dc70647b03ef4b22 100644 --- a/src/OpenFOAM/fields/pointPatchFields/constraint/cyclic/cyclicPointPatchField.C +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/cyclic/cyclicPointPatchField.C @@ -25,6 +25,8 @@ License #include "cyclicPointPatchField.H" #include "Swap.H" +#include "transformField.H" +#include "pointFields.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -127,28 +129,57 @@ void cyclicPointPatchField<Type>::swapAddSeparated Field<Type>& pField ) const { - Field<Type> pf(this->patchInternalField(pField)); + // Get neighbouring pointPatch + const cyclicPointPatch& nbrPatch = cyclicPatch_.neighbPatch(); - const edgeList& pairs = cyclicPatch_.transformPairs(); - - if (doTransform()) + if (cyclicPatch_.cyclicPatch().owner()) { - forAll(pairs, pairi) + // We inplace modify pField. To prevent the other side (which gets + // evaluated at a later date) using already changed values we do + // all swaps on the side that gets evaluated first. + + // Get neighbouring pointPatchField + const GeometricField<Type, pointPatchField, pointMesh>& fld = + refCast<const GeometricField<Type, pointPatchField, pointMesh> > + ( + this->dimensionedInternalField() + ); + + const cyclicPointPatchField<Type>& nbr = + refCast<const cyclicPointPatchField<Type> > + ( + fld.boundaryField()[nbrPatch.index()] + ); + + + Field<Type> pf(this->patchInternalField(pField)); + Field<Type> nbrPf(nbr.patchInternalField(pField)); + + const edgeList& pairs = cyclicPatch_.transformPairs(); + + if (doTransform()) { - Type tmp = pf[pairs[pairi][0]]; - pf[pairs[pairi][0]] = transform(forwardT()[0], pf[pairs[pairi][1]]); - pf[pairs[pairi][1]] = transform(reverseT()[0], tmp); + // Transform both sides. + forAll(pairs, pairi) + { + label pointi = pairs[pairi][0]; + label nbrPointi = pairs[pairi][1]; + + Type tmp = pf[pointi]; + pf[pointi] = transform(forwardT()[0], nbrPf[nbrPointi]); + nbrPf[nbrPointi] = transform(reverseT()[0], tmp); + } } - } - else - { - forAll(pairs, pairi) + else { - Swap(pf[pairs[pairi][0]], pf[pairs[pairi][1]]); + forAll(pairs, pairi) + { + Swap(pf[pairs[pairi][0]], nbrPf[pairs[pairi][1]]); + } } + addToInternalField(pField, pf); + nbr.addToInternalField(pField, nbrPf); } - - addToInternalField(pField, pf, cyclicPatch_.separatedPoints()); } diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.C b/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.C index 876c27723f53f6501ba3a100cd28429604c87285..11753c397e012a88aed360ebec64ac5a761784d3 100644 --- a/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.C +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.C @@ -24,7 +24,7 @@ License \*---------------------------------------------------------------------------*/ #include "processorPointPatchField.H" -#include "transformField.H" +//#include "transformField.H" #include "processorPolyPatch.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -102,26 +102,27 @@ void processorPointPatchField<Type>::initSwapAddSeparated ) const { - if (Pstream::parRun()) - { - // Get internal field into correct order for opposite side - Field<Type> pf - ( - this->patchInternalField - ( - pField, - procPatch_.reverseMeshPoints() - ) - ); - - OPstream::write - ( - commsType, - procPatch_.neighbProcNo(), - reinterpret_cast<const char*>(pf.begin()), - pf.byteSize() - ); - } +// if (Pstream::parRun()) +// { +// // Get internal field into correct order for opposite side +// Field<Type> pf +// ( +// this->patchInternalField +// ( +// pField, +// procPatch_.reverseMeshPoints() +// ) +// ); +// +// OPstream::write +// ( +// commsType, +// procPatch_.neighbProcNo(), +// reinterpret_cast<const char*>(pf.begin()), +// pf.byteSize(), +// procPatch_.tag() +// ); +// } } @@ -132,44 +133,29 @@ void processorPointPatchField<Type>::swapAddSeparated Field<Type>& pField ) const { - if (Pstream::parRun()) - { - Field<Type> pnf(this->size()); - - IPstream::read - ( - commsType, - procPatch_.neighbProcNo(), - reinterpret_cast<char*>(pnf.begin()), - pnf.byteSize() - ); - - if (doTransform()) - { - const processorPolyPatch& ppp = procPatch_.procPolyPatch(); - const tensorField& forwardT = ppp.forwardT(); - - if (forwardT.size() == 1) - { - transform(pnf, forwardT[0], pnf); - } - else - { - const labelListList& pointFaces = ppp.pointFaces(); - - forAll(pointFaces, pfi) - { - pnf[pfi] = transform - ( - forwardT[pointFaces[pfi][0]], - pnf[pfi] - ); - } - } - } - - addToInternalField(pField, pnf, procPatch_.separatedPoints()); - } +// if (Pstream::parRun()) +// { +// Field<Type> pnf(this->size()); +// +// IPstream::read +// ( +// commsType, +// procPatch_.neighbProcNo(), +// reinterpret_cast<char*>(pnf.begin()), +// pnf.byteSize(), +// procPatch_.tag() +// ); +// +// if (doTransform()) +// { +// const processorPolyPatch& ppp = procPatch_.procPolyPatch(); +// const tensor& forwardT = ppp.forwardT(); +// +// transform(pnf, forwardT, pnf); +// } +// +// addToInternalField(pField, pnf, procPatch_.separatedPoints()); +// } } diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.H b/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.H index cc1760a7b2b1d3c2cd1540670d796e48425b2a8b..4aeda6700b4ccb2fbe66a5f7c5931657512b5488 100644 --- a/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.H +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processor/processorPointPatchField.H @@ -147,7 +147,7 @@ public: } } - //- Does the patch field perform the transfromation + //- Does the patch field perform the transformation virtual bool doTransform() const { return diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.C b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.C new file mode 100644 index 0000000000000000000000000000000000000000..3fd5606453b26f80508b2d8bd7266e87b91ab608 --- /dev/null +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.C @@ -0,0 +1,168 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicPointPatchField.H" +#include "transformField.H" +#include "processorPolyPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicPointPatchField<Type>::processorCyclicPointPatchField +( + const pointPatch& p, + const DimensionedField<Type, pointMesh>& iF +) +: + coupledPointPatchField<Type>(p, iF), + procPatch_(refCast<const processorCyclicPointPatch>(p)) +{} + + +template<class Type> +processorCyclicPointPatchField<Type>::processorCyclicPointPatchField +( + const pointPatch& p, + const DimensionedField<Type, pointMesh>& iF, + const dictionary& dict +) +: + coupledPointPatchField<Type>(p, iF, dict), + procPatch_(refCast<const processorCyclicPointPatch>(p)) +{} + + +template<class Type> +processorCyclicPointPatchField<Type>::processorCyclicPointPatchField +( + const processorCyclicPointPatchField<Type>& ptf, + const pointPatch& p, + const DimensionedField<Type, pointMesh>& iF, + const pointPatchFieldMapper& mapper +) +: + coupledPointPatchField<Type>(ptf, p, iF, mapper), + procPatch_(refCast<const processorCyclicPointPatch>(ptf.patch())) +{} + + +template<class Type> +processorCyclicPointPatchField<Type>::processorCyclicPointPatchField +( + const processorCyclicPointPatchField<Type>& ptf, + const DimensionedField<Type, pointMesh>& iF +) +: + coupledPointPatchField<Type>(ptf, iF), + procPatch_(refCast<const processorCyclicPointPatch>(ptf.patch())) +{} + + +// * * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicPointPatchField<Type>::~processorCyclicPointPatchField() +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +template<class Type> +void processorCyclicPointPatchField<Type>::initSwapAddSeparated +( + const Pstream::commsTypes commsType, + Field<Type>& pField +) const +{ + if (Pstream::parRun()) + { + // Get internal field into correct order for opposite side + Field<Type> pf + ( + this->patchInternalField + ( + pField, + procPatch_.reverseMeshPoints() + ) + ); + + OPstream::write + ( + commsType, + procPatch_.neighbProcNo(), + reinterpret_cast<const char*>(pf.begin()), + pf.byteSize(), + procPatch_.tag() + ); + } +} + + +template<class Type> +void processorCyclicPointPatchField<Type>::swapAddSeparated +( + const Pstream::commsTypes commsType, + Field<Type>& pField +) const +{ + if (Pstream::parRun()) + { + Field<Type> pnf(this->size()); + + IPstream::read + ( + commsType, + procPatch_.neighbProcNo(), + reinterpret_cast<char*>(pnf.begin()), + pnf.byteSize(), + procPatch_.tag() + ); + + if (doTransform()) + { + const processorCyclicPolyPatch& ppp = + procPatch_.procCyclicPolyPatch(); + const tensor& forwardT = ppp.forwardT()[0]; + + transform(pnf, forwardT, pnf); + } + + // All points are separated + addToInternalField(pField, pnf); + } +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.H b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.H new file mode 100644 index 0000000000000000000000000000000000000000..6b5f9b3377f49f84d72ef440198b87397944ed36 --- /dev/null +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchField.H @@ -0,0 +1,202 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicPointPatchField + +Description + Foam::processorCyclicPointPatchField + +SourceFiles + processorCyclicPointPatchField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicPointPatchField_H +#define processorCyclicPointPatchField_H + +#include "coupledPointPatchField.H" +#include "processorCyclicPointPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicPointPatchField Declaration +\*---------------------------------------------------------------------------*/ + +template<class Type> +class processorCyclicPointPatchField +: + public coupledPointPatchField<Type> +{ + // Private data + + //- Local reference to processor patch + const processorCyclicPointPatch& procPatch_; + + +public: + + //- Runtime type information + TypeName(processorCyclicPointPatch::typeName_()); + + + // Constructors + + //- Construct from patch and internal field + processorCyclicPointPatchField + ( + const pointPatch&, + const DimensionedField<Type, pointMesh>& + ); + + //- Construct from patch, internal field and dictionary + processorCyclicPointPatchField + ( + const pointPatch&, + const DimensionedField<Type, pointMesh>&, + const dictionary& + ); + + //- Construct by mapping given patchField<Type> onto a new patch + processorCyclicPointPatchField + ( + const processorCyclicPointPatchField<Type>&, + const pointPatch&, + const DimensionedField<Type, pointMesh>&, + const pointPatchFieldMapper& + ); + + //- Construct and return a clone + virtual autoPtr<pointPatchField<Type> > clone() const + { + return autoPtr<pointPatchField<Type> > + ( + new processorCyclicPointPatchField<Type> + ( + *this + ) + ); + } + + //- Construct as copy setting internal field reference + processorCyclicPointPatchField + ( + const processorCyclicPointPatchField<Type>&, + const DimensionedField<Type, pointMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual autoPtr<pointPatchField<Type> > clone + ( + const DimensionedField<Type, pointMesh>& iF + ) const + { + return autoPtr<pointPatchField<Type> > + ( + new processorCyclicPointPatchField<Type> + ( + *this, + iF + ) + ); + } + + + // Destructor + + ~processorCyclicPointPatchField(); + + + // Member functions + + // Access + + //- Return true if running parallel + virtual bool coupled() const + { + if (Pstream::parRun()) + { + return true; + } + else + { + return false; + } + } + + //- Does the patch field perform the transfromation + virtual bool doTransform() const + { + return + !( + pTraits<Type>::rank == 0 + || procPatch_.procPolyPatch().parallel() + ); + } + + + // Evaluation functions + + //- Evaluate the patch field + virtual void evaluate + ( + const Pstream::commsTypes commsType=Pstream::blocking + ) + {} + + //- Initialise swap of non-collocated patch point values + virtual void initSwapAddSeparated + ( + const Pstream::commsTypes commsType, + Field<Type>& + ) const; + + //- Complete swap of patch point values and add to local values + virtual void swapAddSeparated + ( + const Pstream::commsTypes commsType, + Field<Type>& + ) const; +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#ifdef NoRepository +# include "processorCyclicPointPatchField.C" +#endif + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.C b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.C new file mode 100644 index 0000000000000000000000000000000000000000..5708849d87ddc8722340b34ecfda42bf900ab130 --- /dev/null +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.C @@ -0,0 +1,44 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicPointPatchFields.H" +#include "pointPatchFields.H" +#include "addToRunTimeSelectionTable.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +makePointPatchFields(processorCyclic); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.H b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.H new file mode 100644 index 0000000000000000000000000000000000000000..697cf9adff9a6f6d6bacfc0e4c3ef0ccc75a4dcc --- /dev/null +++ b/src/OpenFOAM/fields/pointPatchFields/constraint/processorCyclic/processorCyclicPointPatchFields.H @@ -0,0 +1,50 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicPointPatchFields_H +#define processorCyclicPointPatchFields_H + +#include "processorCyclicPointPatchField.H" +#include "fieldTypes.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makePointPatchFieldTypedefs(processorCyclic); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/fields/pointPatchFields/pointPatchField/pointPatchField.C b/src/OpenFOAM/fields/pointPatchFields/pointPatchField/pointPatchField.C index 764fa5b31b319c84bec901167bcda4037bd0171d..03dbf43fd431628d7f9541236e2f7ed20de6148d 100644 --- a/src/OpenFOAM/fields/pointPatchFields/pointPatchField/pointPatchField.C +++ b/src/OpenFOAM/fields/pointPatchFields/pointPatchField/pointPatchField.C @@ -141,15 +141,7 @@ tmp<Field<Type1> > pointPatchField<Type>::patchInternalField << abort(FatalError); } - tmp<Field<Type1> > tvalues(new Field<Type1>(meshPoints.size())); - Field<Type1>& values = tvalues(); - - forAll(meshPoints, pointI) - { - values[pointI] = iF[meshPoints[pointI]]; - } - - return tvalues; + return tmp<Field<Type1> >(new Field<Type1>(iF, meshPoints)); } diff --git a/src/OpenFOAM/global/argList/parRun.H b/src/OpenFOAM/global/argList/parRun.H index 6ec30f2249c3813ce8c976dae3b04a05d79ecc94..23db4ee9bc4d5ccfd03392a27f38749af66f9197 100644 --- a/src/OpenFOAM/global/argList/parRun.H +++ b/src/OpenFOAM/global/argList/parRun.H @@ -32,8 +32,7 @@ Description #ifndef parRun_H #define parRun_H -#include "OPstream.H" -#include "IPstream.H" +#include "Pstream.H" #include "IOstreams.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // diff --git a/src/OpenFOAM/matrices/LUscalarMatrix/LUscalarMatrix.C b/src/OpenFOAM/matrices/LUscalarMatrix/LUscalarMatrix.C index 05b26179b47d405b084d1047e45b14cfbec81c2b..30a632ae36c967e41edf47c14922a96f11eac661 100644 --- a/src/OpenFOAM/matrices/LUscalarMatrix/LUscalarMatrix.C +++ b/src/OpenFOAM/matrices/LUscalarMatrix/LUscalarMatrix.C @@ -27,6 +27,7 @@ License #include "lduMatrix.H" #include "procLduMatrix.H" #include "procLduInterface.H" +#include "cyclicLduInterface.H" // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // @@ -160,19 +161,27 @@ void Foam::LUscalarMatrix::convert { const lduInterface& interface = interfaces[inti].interface(); - const label* __restrict__ ulPtr = interface.faceCells().begin(); - const scalar* __restrict__ upperLowerPtr = - interfaceCoeffs[inti].begin(); + // Assume any interfaces are cyclic ones - register label inFaces = interface.faceCells().size()/2; + const label* __restrict__ lPtr = interface.faceCells().begin(); + + const cyclicLduInterface& cycInterface = + refCast<const cyclicLduInterface>(interface); + label nbrInt = cycInterface.neighbPatchID(); + const label* __restrict__ uPtr = + interfaces[nbrInt].interface().faceCells().begin(); + + const scalar* __restrict__ nbrUpperLowerPtr = + interfaceCoeffs[nbrInt].begin(); + + register label inFaces = interface.faceCells().size(); for (register label face=0; face<inFaces; face++) { - label uCell = ulPtr[face]; - label lCell = ulPtr[face + inFaces]; + label uCell = lPtr[face]; + label lCell = uPtr[face]; - operator[](uCell)[lCell] -= upperLowerPtr[face + inFaces]; - operator[](lCell)[uCell] -= upperLowerPtr[face]; + operator[](uCell)[lCell] -= nbrUpperLowerPtr[face]; } } } diff --git a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/cyclicLduInterface.H b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/cyclicLduInterface.H index 1010c17f9822d969fdd3b0844d3f8f19f6a152f2..7d7cbff30954edc721b9a18abaf1a93ed4f4bc44 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/cyclicLduInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/cyclicLduInterface.H @@ -65,6 +65,14 @@ public: // Access + //- Return neighbour + virtual label neighbPatchID() const = 0; + + virtual bool owner() const = 0; + + //- Return processor number + virtual const cyclicLduInterface& neighbPatch() const = 0; + //- Return face transformation tensor virtual const tensorField& forwardT() const = 0; diff --git a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/lduInterface.H b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/lduInterface.H index 2b65bedf8d772e52191c55293a6895aa69f385fc..60ca7372d01aeb3abd7aaecaf3323cc3e0d6b52a 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/lduInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/lduInterface.H @@ -96,21 +96,6 @@ public: const unallocLabelList& internalData ) const = 0; - //- Initialise interface data transfer - virtual void initTransfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const - {} - - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const = 0; - //- Initialise transfer of internal field adjacent to the interface virtual void initInternalFieldTransfer ( diff --git a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterface.H b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterface.H index be3d050d7ada66367b2f24a85d2834ca13e215e2..324ccc1ad4cff433ee288b48f2a4c8d0b2f2581b 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterface.H @@ -93,6 +93,8 @@ public: //- Return face transformation tensor virtual const tensorField& forwardT() const = 0; + //- Return message tag used for sending + virtual int tag() const = 0; // Transfer functions diff --git a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterfaceTemplates.C b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterfaceTemplates.C index cd42ba976722b9355436c98d8ddcd303746bcc0e..450c30f884693e02e8c8461bd9d7e171aebeef3f 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterfaceTemplates.C +++ b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterface/processorLduInterfaceTemplates.C @@ -43,7 +43,8 @@ void Foam::processorLduInterface::send commsType, neighbProcNo(), reinterpret_cast<const char*>(f.begin()), - f.byteSize() + f.byteSize(), + tag() ); } else if (commsType == Pstream::nonBlocking) @@ -55,7 +56,8 @@ void Foam::processorLduInterface::send commsType, neighbProcNo(), receiveBuf_.begin(), - receiveBuf_.size() + receiveBuf_.size(), + tag() ); resizeBuf(sendBuf_, f.byteSize()); @@ -66,7 +68,8 @@ void Foam::processorLduInterface::send commsType, neighbProcNo(), sendBuf_.begin(), - f.byteSize() + f.byteSize(), + tag() ); } else @@ -92,7 +95,8 @@ void Foam::processorLduInterface::receive commsType, neighbProcNo(), reinterpret_cast<char*>(f.begin()), - f.byteSize() + f.byteSize(), + tag() ); } else if (commsType == Pstream::nonBlocking) @@ -155,7 +159,8 @@ void Foam::processorLduInterface::compressedSend commsType, neighbProcNo(), sendBuf_.begin(), - nBytes + nBytes, + tag() ); } else if (commsType == Pstream::nonBlocking) @@ -167,7 +172,8 @@ void Foam::processorLduInterface::compressedSend commsType, neighbProcNo(), receiveBuf_.begin(), - receiveBuf_.size() + receiveBuf_.size(), + tag() ); OPstream::write @@ -175,7 +181,8 @@ void Foam::processorLduInterface::compressedSend commsType, neighbProcNo(), sendBuf_.begin(), - nBytes + nBytes, + tag() ); } else @@ -215,7 +222,8 @@ void Foam::processorLduInterface::compressedReceive commsType, neighbProcNo(), receiveBuf_.begin(), - nBytes + nBytes, + tag() ); } else if (commsType != Pstream::nonBlocking) diff --git a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterfaceFields/cyclicLduInterfaceField/cyclicLduInterfaceField.C b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterfaceFields/cyclicLduInterfaceField/cyclicLduInterfaceField.C index 472cec83f231156373e7073ec82e2e947632dbfd..460a9fa06d2619e7dae25e1891729d9f9cab6397 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterfaceFields/cyclicLduInterfaceField/cyclicLduInterfaceField.C +++ b/src/OpenFOAM/matrices/lduMatrix/lduAddressing/lduInterfaceFields/cyclicLduInterfaceField/cyclicLduInterfaceField.C @@ -47,19 +47,10 @@ void Foam::cyclicLduInterfaceField::transformCoupleField { if (doTransform()) { - label sizeby2 = pnf.size()/2; - scalar forwardScale = pow(diag(forwardT()[0]).component(cmpt), rank()); - scalar reverseScale = - pow(diag(reverseT()[0]).component(cmpt), rank()); - - for (label facei=0; facei<sizeby2; facei++) - { - pnf[facei] *= forwardScale; - pnf[facei + sizeby2] *= reverseScale; - } + pnf *= forwardScale; } } diff --git a/src/OpenFOAM/matrices/lduMatrix/lduMatrix/lduMatrixUpdateMatrixInterfaces.C b/src/OpenFOAM/matrices/lduMatrix/lduMatrix/lduMatrixUpdateMatrixInterfaces.C index 2d1ff23a596ac7b91e9a52a57ee1e885bc022537..2e7ebe16f179f8c02c929af42c3b46506cf59156 100644 --- a/src/OpenFOAM/matrices/lduMatrix/lduMatrix/lduMatrixUpdateMatrixInterfaces.C +++ b/src/OpenFOAM/matrices/lduMatrix/lduMatrix/lduMatrixUpdateMatrixInterfaces.C @@ -111,10 +111,13 @@ void Foam::lduMatrix::updateMatrixInterfaces ) { // Block until all sends/receives have been finished - if (Pstream::defaultCommsType == Pstream::nonBlocking) + if + ( + Pstream::parRun() + && Pstream::defaultCommsType == Pstream::nonBlocking + ) { - IPstream::waitRequests(); - OPstream::waitRequests(); + UPstream::waitRequests(); } forAll(interfaces, interfaceI) diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/GAMGAgglomerations/GAMGAgglomeration/GAMGAgglomerateLduAddressing.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/GAMGAgglomerations/GAMGAgglomeration/GAMGAgglomerateLduAddressing.C index e39bb19b5a23edd683d1c77be2f44f3f3fd727b7..a71bb298f5ee343a74cee3eda014afda8d839ebc 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/GAMGAgglomerations/GAMGAgglomeration/GAMGAgglomerateLduAddressing.C +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/GAMGAgglomerations/GAMGAgglomeration/GAMGAgglomerateLduAddressing.C @@ -229,12 +229,17 @@ void Foam::GAMGAgglomeration::agglomerateLduAddressing { fineInterfaces[inti].initInternalFieldTransfer ( - Pstream::blocking, + Pstream::nonBlocking, restrictMap ); } } + if (Pstream::parRun()) + { + Pstream::waitRequests(); + } + // Add the coarse level forAll(fineInterfaces, inti) { @@ -245,11 +250,13 @@ void Foam::GAMGAgglomeration::agglomerateLduAddressing inti, GAMGInterface::New ( + inti, + coarseInterfaces, fineInterfaces[inti], fineInterfaces[inti].interfaceInternalField(restrictMap), fineInterfaces[inti].internalFieldTransfer ( - Pstream::blocking, + Pstream::nonBlocking, restrictMap ) ).ptr() diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/cyclicGAMGInterfaceField/cyclicGAMGInterfaceField.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/cyclicGAMGInterfaceField/cyclicGAMGInterfaceField.C index 4d67b7fa60a9ffed9d3a8a0d65abad642c1bbe17..45b5ce97bbba521f4bafb0952563ceb10a0a932e 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/cyclicGAMGInterfaceField/cyclicGAMGInterfaceField.C +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/cyclicGAMGInterfaceField/cyclicGAMGInterfaceField.C @@ -80,20 +80,16 @@ void Foam::cyclicGAMGInterfaceField::updateInterfaceMatrix const Pstream::commsTypes ) const { - scalarField pnf(size()); + // Get neighbouring field + scalarField pnf + ( + cyclicInterface_.neighbPatch().interfaceInternalField(psiInternal) + ); - label sizeby2 = size()/2; + transformCoupleField(pnf, cmpt); const unallocLabelList& faceCells = cyclicInterface_.faceCells(); - for (label facei=0; facei<sizeby2; facei++) - { - pnf[facei] = psiInternal[faceCells[facei + sizeby2]]; - pnf[facei + sizeby2] = psiInternal[faceCells[facei]]; - } - - transformCoupleField(pnf, cmpt); - forAll(faceCells, elemI) { result[faceCells[elemI]] -= coeffs[elemI]*pnf[elemI]; diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.C new file mode 100644 index 0000000000000000000000000000000000000000..c5bd1bb04d201edeb2a049ff1b844a9176bf06e0 --- /dev/null +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.C @@ -0,0 +1,108 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicGAMGInterfaceField.H" +#include "addToRunTimeSelectionTable.H" +#include "lduMatrix.H" + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +namespace Foam +{ + defineTypeNameAndDebug(processorCyclicGAMGInterfaceField, 0); + addToRunTimeSelectionTable + ( + GAMGInterfaceField, + processorCyclicGAMGInterfaceField, + lduInterface + ); +} + + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +Foam::processorCyclicGAMGInterfaceField::processorCyclicGAMGInterfaceField +( + const GAMGInterface& GAMGCp, + const lduInterfaceField& fineInterface +) +: + processorGAMGInterfaceField(GAMGCp, fineInterface) +{} + + +// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * // + +Foam::processorCyclicGAMGInterfaceField::~processorCyclicGAMGInterfaceField() +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +//void Foam::processorCyclicGAMGInterfaceField::initInterfaceMatrixUpdate +//( +// const scalarField& psiInternal, +// scalarField&, +// const lduMatrix&, +// const scalarField&, +// const direction, +// const Pstream::commsTypes commsType +//) const +//{ +// procInterface_.compressedSend +// ( +// commsType, +// procInterface_.interfaceInternalField(psiInternal)() +// ); +//} +// +// +//void Foam::processorCyclicGAMGInterfaceField::updateInterfaceMatrix +//( +// const scalarField&, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +//) const +//{ +// scalarField pnf +// ( +// procInterface_.compressedReceive<scalar>(commsType, coeffs.size()) +// ); +// transformCoupleField(pnf, cmpt); +// +// const unallocLabelList& faceCells = procInterface_.faceCells(); +// +// forAll(faceCells, elemI) +// { +// result[faceCells[elemI]] -= coeffs[elemI]*pnf[elemI]; +// } +//} + + +// ************************************************************************* // diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.H b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.H new file mode 100644 index 0000000000000000000000000000000000000000..b47d9699bc5a9fc6c307834fa713e7ba35c09e3f --- /dev/null +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaceFields/processorCyclicGAMGInterfaceField/processorCyclicGAMGInterfaceField.H @@ -0,0 +1,174 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicGAMGInterfaceField + +Description + GAMG agglomerated processor interface field. + +SourceFiles + processorCyclicGAMGInterfaceField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicGAMGInterfaceField_H +#define processorCyclicGAMGInterfaceField_H + +#include "processorGAMGInterfaceField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicGAMGInterfaceField Declaration +\*---------------------------------------------------------------------------*/ + +class processorCyclicGAMGInterfaceField +: + public processorGAMGInterfaceField +{ + // Private data + +// //- Local reference cast into the processor interface +// const processorCyclicGAMGInterface& procInterface_; +// +// //- Is the transform required +// bool doTransform_; +// +// //- Rank of component for transformation +// int rank_; +// + + // Private Member Functions + + //- Disallow default bitwise copy construct + processorCyclicGAMGInterfaceField(const processorCyclicGAMGInterfaceField&); + + //- Disallow default bitwise assignment + void operator=(const processorCyclicGAMGInterfaceField&); + + +public: + + //- Runtime type information + TypeName("processorCyclic"); + + + // Constructors + + //- Construct from GAMG interface and fine level interface field + processorCyclicGAMGInterfaceField + ( + const GAMGInterface& GAMGCp, + const lduInterfaceField& fineInterface + ); + + + // Destructor + + virtual ~processorCyclicGAMGInterfaceField(); + + + // Member Functions + +// // Access +// +// //- Return size +// label size() const +// { +// return procInterface_.size(); +// } +// +// +// // Interface matrix update +// +// //- Initialise neighbour matrix update +// virtual void initInterfaceMatrixUpdate +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix& m, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +// ) const; +// +// //- Update result field based on interface functionality +// virtual void updateInterfaceMatrix +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +// ) const; +// +// +// //- Processor interface functions +// +// //- Return processor number +// virtual int myProcNo() const +// { +// return procInterface_.myProcNo(); +// } +// +// //- Return neigbour processor number +// virtual int neighbProcNo() const +// { +// return procInterface_.neighbProcNo(); +// } +// +// //- Does the interface field perform the transfromation +// virtual bool doTransform() const +// { +// return doTransform_; +// } +// +// //- Return face transformation tensor +// virtual const tensorField& forwardT() const +// { +// return procInterface_.forwardT(); +// } +// +// //- Return rank of component for transform +// virtual int rank() const +// { +// return rank_; +// } +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterface.H b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterface.H index 7a156edc383fdb6d39d34654b5641bf7aa64ed73..baad87d6d83eb9fd3c46e6ae3858c83abe3810da 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterface.H @@ -36,8 +36,8 @@ SourceFiles #ifndef GAMGInterface_H #define GAMGInterface_H -#include "lduInterface.H" #include "autoPtr.H" +#include "lduInterfacePtrsList.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -57,6 +57,12 @@ protected: // Protected data + //- My index in coarseInterfaces + const label index_; + + //- All interfaces + const lduInterfacePtrsList& coarseInterfaces_; + //- Face-cell addressing labelField faceCells_; @@ -89,11 +95,15 @@ public: GAMGInterface, lduInterface, ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& localRestrictAddressing, const labelField& neighbourRestrictAddressing ), ( + index, + coarseInterfaces, fineInterface, localRestrictAddressing, neighbourRestrictAddressing @@ -107,6 +117,8 @@ public: // the fine interface static autoPtr<GAMGInterface> New ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& localRestrictAddressing, const labelField& neighbourRestrictAddressing @@ -119,10 +131,15 @@ public: // local and neighbour restrict addressing GAMGInterface ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface&, const labelField&, const labelField& ) + : + index_(index), + coarseInterfaces_(coarseInterfaces) {} @@ -136,6 +153,16 @@ public: return faceCells_.size(); } + virtual label index() const + { + return index_; + } + + virtual const lduInterfacePtrsList& coarseInterfaces() const + { + return coarseInterfaces_; + } + //- Return faceCell addressing virtual const unallocLabelList& faceCells() const { diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterfaceNew.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterfaceNew.C index 6c4bed75238f752851edfd53bfee87d1d867dd8a..28f6e0481afbfa8be14fc085fc1160df63204822 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterfaceNew.C +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/GAMGInterface/GAMGInterfaceNew.C @@ -31,6 +31,8 @@ License Foam::autoPtr<Foam::GAMGInterface> Foam::GAMGInterface::New ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& localRestrictAddressing, const labelField& neighbourRestrictAddressing @@ -59,6 +61,8 @@ Foam::autoPtr<Foam::GAMGInterface> Foam::GAMGInterface::New ( cstrIter() ( + index, + coarseInterfaces, fineInterface, localRestrictAddressing, neighbourRestrictAddressing diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.C index fa55f71e7289a85dcd4fa40f4f0df065dc345c9f..2aac532ce1665084f5c9d0d44a9a28447874ce7c 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.C +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.C @@ -25,6 +25,7 @@ License #include "cyclicGAMGInterface.H" #include "addToRunTimeSelectionTable.H" +#include "Map.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -44,6 +45,8 @@ namespace Foam Foam::cyclicGAMGInterface::cyclicGAMGInterface ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& localRestrictAddressing, const labelField& neighbourRestrictAddressing @@ -51,6 +54,8 @@ Foam::cyclicGAMGInterface::cyclicGAMGInterface : GAMGInterface ( + index, + coarseInterfaces, fineInterface, localRestrictAddressing, neighbourRestrictAddressing @@ -58,33 +63,45 @@ Foam::cyclicGAMGInterface::cyclicGAMGInterface fineCyclicInterface_(refCast<const cyclicLduInterface>(fineInterface)) { // Make a lookup table of entries for owner/neighbour - HashTable<SLList<label>, label, Hash<label> > neighboursTable + Map<SLList<label> > neighboursTable ( localRestrictAddressing.size() ); // Table of face-sets to be agglomerated - HashTable<SLList<SLList<label> >, label, Hash<label> > faceFaceTable + Map<SLList<SLList<label> > > faceFaceTable ( localRestrictAddressing.size() ); label nCoarseFaces = 0; - label sizeBy2 = localRestrictAddressing.size()/2; - - for (label ffi=0; ffi<sizeBy2; ffi++) + forAll (localRestrictAddressing, ffi) { - label curMaster = localRestrictAddressing[ffi]; - label curSlave = localRestrictAddressing[ffi + sizeBy2]; + label curMaster = -1; + label curSlave = -1; + + // Do switching on master/slave indexes based on the owner/neighbour of + // the processor index such that both sides get the same answer. + if (owner()) + { + // Master side + curMaster = localRestrictAddressing[ffi]; + curSlave = neighbourRestrictAddressing[ffi]; + } + else + { + // Slave side + curMaster = neighbourRestrictAddressing[ffi]; + curSlave = localRestrictAddressing[ffi]; + } // Look for the master cell. If it has already got a face, - // add the coefficient to the face. If not, create a new - // face. + // add the coefficient to the face. If not, create a new face. if (neighboursTable.found(curMaster)) { - // Check all current neighbours to see if the current - // slave already exists. If so, add the coefficient. + // Check all current neighbours to see if the current slave already + // exists and if so, add the fine face to the agglomeration. SLList<label>& curNbrs = neighboursTable.find(curMaster)(); @@ -135,69 +152,86 @@ Foam::cyclicGAMGInterface::cyclicGAMGInterface } // end for all fine faces - faceCells_.setSize(2*nCoarseFaces, -1); - faceRestrictAddressing_.setSize(localRestrictAddressing.size(), -1); + + faceCells_.setSize(nCoarseFaces, -1); + faceRestrictAddressing_.setSize(localRestrictAddressing.size()); labelList contents = neighboursTable.toc(); // Reset face counter for re-use nCoarseFaces = 0; - // On master side, the owner addressing is stored in table of contents - forAll(contents, masterI) + if (owner()) { - SLList<label>& curNbrs = neighboursTable.find(contents[masterI])(); - - SLList<SLList<label> >& curFaceFaces = - faceFaceTable.find(contents[masterI])(); + // On master side, the owner addressing is stored in table of contents + forAll (contents, masterI) + { + SLList<label>& curNbrs = neighboursTable.find(contents[masterI])(); - SLList<label>::iterator nbrsIter = curNbrs.begin(); - SLList<SLList<label> >::iterator faceFacesIter = curFaceFaces.begin(); + SLList<SLList<label> >& curFaceFaces = + faceFaceTable.find(contents[masterI])(); - for - ( - ; - nbrsIter != curNbrs.end(), faceFacesIter != curFaceFaces.end(); - ++nbrsIter, ++faceFacesIter - ) - { - faceCells_[nCoarseFaces] = contents[masterI]; + SLList<label>::iterator nbrsIter = curNbrs.begin(); + SLList<SLList<label> >::iterator faceFacesIter = curFaceFaces.begin(); - forAllConstIter(SLList<label>, faceFacesIter(), facesIter) + for + ( + ; + nbrsIter != curNbrs.end(), faceFacesIter != curFaceFaces.end(); + ++nbrsIter, ++faceFacesIter + ) { - faceRestrictAddressing_[facesIter()] = nCoarseFaces; - } + faceCells_[nCoarseFaces] = contents[masterI]; + + for + ( + SLList<label>::iterator facesIter = faceFacesIter().begin(); + facesIter != faceFacesIter().end(); + ++facesIter + ) + { + faceRestrictAddressing_[facesIter()] = nCoarseFaces; + } - nCoarseFaces++; + nCoarseFaces++; + } } } - - // On slave side, the owner addressing is stored in linked lists - forAll(contents, masterI) + else { - SLList<label>& curNbrs = neighboursTable.find(contents[masterI])(); + // On slave side, the owner addressing is stored in linked lists + forAll (contents, masterI) + { + SLList<label>& curNbrs = neighboursTable.find(contents[masterI])(); - SLList<SLList<label> >& curFaceFaces = - faceFaceTable.find(contents[masterI])(); + SLList<SLList<label> >& curFaceFaces = + faceFaceTable.find(contents[masterI])(); - SLList<label>::iterator nbrsIter = curNbrs.begin(); - SLList<SLList<label> >::iterator faceFacesIter = curFaceFaces.begin(); + SLList<label>::iterator nbrsIter = curNbrs.begin(); - for - ( - ; - nbrsIter != curNbrs.end(), faceFacesIter != curFaceFaces.end(); - ++nbrsIter, ++faceFacesIter - ) - { - faceCells_[nCoarseFaces] = nbrsIter(); + SLList<SLList<label> >::iterator faceFacesIter = curFaceFaces.begin(); - forAllConstIter(SLList<label>, faceFacesIter(), facesIter) + for + ( + ; + nbrsIter != curNbrs.end(), faceFacesIter != curFaceFaces.end(); + ++nbrsIter, ++faceFacesIter + ) { - faceRestrictAddressing_[facesIter() + sizeBy2] = nCoarseFaces; - } + faceCells_[nCoarseFaces] = nbrsIter(); + + for + ( + SLList<label>::iterator facesIter = faceFacesIter().begin(); + facesIter != faceFacesIter().end(); + ++facesIter + ) + { + faceRestrictAddressing_[facesIter()] = nCoarseFaces; + } - nCoarseFaces++; + nCoarseFaces++; + } } } } @@ -211,42 +245,24 @@ Foam::cyclicGAMGInterface::~cyclicGAMGInterface() // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // -Foam::tmp<Foam::labelField> Foam::cyclicGAMGInterface::transfer -( - const Pstream::commsTypes, - const unallocLabelList& interfaceData -) const -{ - tmp<labelField> tpnf(new labelField(size())); - labelField& pnf = tpnf(); - - label sizeby2 = size()/2; - - for (label facei=0; facei<sizeby2; facei++) - { - pnf[facei] = interfaceData[facei + sizeby2]; - pnf[facei + sizeby2] = interfaceData[facei]; - } - - return tpnf; -} - - Foam::tmp<Foam::labelField> Foam::cyclicGAMGInterface::internalFieldTransfer ( const Pstream::commsTypes, const unallocLabelList& iF ) const { + const cyclicGAMGInterface& nbr = dynamic_cast<const cyclicGAMGInterface&> + ( + neighbPatch() + ); + const unallocLabelList& nbrFaceCells = nbr.faceCells(); + tmp<labelField> tpnf(new labelField(size())); labelField& pnf = tpnf(); - label sizeby2 = size()/2; - - for (label facei=0; facei<sizeby2; facei++) + forAll(pnf, facei) { - pnf[facei] = iF[faceCells_[facei + sizeby2]]; - pnf[facei + sizeby2] = iF[faceCells_[facei]]; + pnf[facei] = iF[nbrFaceCells[facei]]; } return tpnf; diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.H b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.H index d912cb313cf5591d3d417b59de77511b015a77c7..c24d5fdca70360b24a2001e8c526a8e63e799023 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/cyclicGAMGInterface/cyclicGAMGInterface.H @@ -80,6 +80,8 @@ public: // local and neighbour restrict addressing cyclicGAMGInterface ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& restrictAddressing, const labelField& neighbourRestrictAddressing @@ -94,13 +96,6 @@ public: // Interface transfer functions - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - //- Transfer and return internal field adjacent to the interface virtual tmp<labelField> internalFieldTransfer ( @@ -111,6 +106,25 @@ public: //- Cyclic interface functions + //- Return neigbour processor number + virtual label neighbPatchID() const + { + return fineCyclicInterface_.neighbPatchID(); + } + + virtual bool owner() const + { + return fineCyclicInterface_.owner(); + } + + virtual const cyclicGAMGInterface& neighbPatch() const + { + return dynamic_cast<const cyclicGAMGInterface&> + ( + coarseInterfaces_[neighbPatchID()] + ); + } + //- Return face transformation tensor virtual const tensorField& forwardT() const { diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.C new file mode 100644 index 0000000000000000000000000000000000000000..04559980585acdb4b9d1004ac015a111d52d25c4 --- /dev/null +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.C @@ -0,0 +1,73 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicGAMGInterface.H" +#include "addToRunTimeSelectionTable.H" +#include "Map.H" + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +namespace Foam +{ + defineTypeNameAndDebug(processorCyclicGAMGInterface, 0); + addToRunTimeSelectionTable + ( + GAMGInterface, + processorCyclicGAMGInterface, + lduInterface + ); +} + + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +Foam::processorCyclicGAMGInterface::processorCyclicGAMGInterface +( + const label index, + const lduInterfacePtrsList& coarseInterfaces, + const lduInterface& fineInterface, + const labelField& localRestrictAddressing, + const labelField& neighbourRestrictAddressing +) +: + processorGAMGInterface + ( + index, + coarseInterfaces, + fineInterface, + localRestrictAddressing, + neighbourRestrictAddressing + ) +{} + + +// * * * * * * * * * * * * * * * * Desstructor * * * * * * * * * * * * * * * // + +Foam::processorCyclicGAMGInterface::~processorCyclicGAMGInterface() +{} + + +// ************************************************************************* // diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.H b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.H new file mode 100644 index 0000000000000000000000000000000000000000..59d5b99c0e02f82bc2751ef0f0f2430180d467b9 --- /dev/null +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorCyclicGAMGInterface/processorCyclicGAMGInterface.H @@ -0,0 +1,98 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicGAMGInterface + +Description + GAMG agglomerated processor interface. + +SourceFiles + processorCyclicGAMGInterface.C + processorCyclicGAMGInterfaceTemplates.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicGAMGInterface_H +#define processorCyclicGAMGInterface_H + +#include "processorGAMGInterface.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicGAMGInterface Declaration +\*---------------------------------------------------------------------------*/ + +class processorCyclicGAMGInterface +: + public processorGAMGInterface +{ + // Private Member Functions + + //- Disallow default bitwise copy construct + processorCyclicGAMGInterface(const processorCyclicGAMGInterface&); + + //- Disallow default bitwise assignment + void operator=(const processorCyclicGAMGInterface&); + + +public: + + //- Runtime type information + TypeName("processorCyclic"); + + // Constructors + + //- Construct from fine-level interface, + // local and neighbour restrict addressing + processorCyclicGAMGInterface + ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, + const lduInterface& fineInterface, + const labelField& restrictAddressing, + const labelField& neighbourRestrictAddressing + ); + + + // Destructor + + virtual ~processorCyclicGAMGInterface(); + +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.C b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.C index 1d79ac018efaabb66ca822a1135cbe91b95da472..dc6aaed58920c15d18c6469a15f8b5ec8aa40996 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.C +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.C @@ -25,6 +25,7 @@ License #include "processorGAMGInterface.H" #include "addToRunTimeSelectionTable.H" +#include "Map.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -44,6 +45,8 @@ namespace Foam Foam::processorGAMGInterface::processorGAMGInterface ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& localRestrictAddressing, const labelField& neighbourRestrictAddressing @@ -51,6 +54,8 @@ Foam::processorGAMGInterface::processorGAMGInterface : GAMGInterface ( + index, + coarseInterfaces, fineInterface, localRestrictAddressing, neighbourRestrictAddressing @@ -58,13 +63,13 @@ Foam::processorGAMGInterface::processorGAMGInterface fineProcInterface_(refCast<const processorLduInterface>(fineInterface)) { // Make a lookup table of entries for owner/neighbour - HashTable<SLList<label>, label, Hash<label> > neighboursTable + Map<SLList<label> > neighboursTable ( localRestrictAddressing.size() ); // Table of face-sets to be agglomerated - HashTable<SLList<SLList<label> >, label, Hash<label> > faceFaceTable + Map<SLList<SLList<label> > > faceFaceTable ( localRestrictAddressing.size() ); @@ -233,26 +238,6 @@ Foam::processorGAMGInterface::~processorGAMGInterface() // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // -void Foam::processorGAMGInterface::initTransfer -( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData -) const -{ - send(commsType, interfaceData); -} - - -Foam::tmp<Foam::labelField> Foam::processorGAMGInterface::transfer -( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData -) const -{ - return receive<label>(commsType, this->size()); -} - - void Foam::processorGAMGInterface::initInternalFieldTransfer ( const Pstream::commsTypes commsType, diff --git a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.H b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.H index 6d24e82db0da11d57d8438ae5cd345fd7a7aa1ae..be738700e6ea89bdce98d5548ba1e898ffb9f9e5 100644 --- a/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.H +++ b/src/OpenFOAM/matrices/lduMatrix/solvers/GAMG/interfaces/processorGAMGInterface/processorGAMGInterface.H @@ -80,6 +80,8 @@ public: // local and neighbour restrict addressing processorGAMGInterface ( + const label index, + const lduInterfacePtrsList& coarseInterfaces, const lduInterface& fineInterface, const labelField& restrictAddressing, const labelField& neighbourRestrictAddressing @@ -94,20 +96,6 @@ public: // Interface transfer functions - //- Initialise interface data transfer - virtual void initTransfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - //- Initialise neighbour field transfer virtual void initInternalFieldTransfer ( @@ -142,6 +130,12 @@ public: { return fineProcInterface_.forwardT(); } + + //- Return message tag used for sending + virtual int tag() const + { + return fineProcInterface_.tag(); + } }; diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.C b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.C index 58078a615ca0c4ebf5720d415b085f34691d2de0..7a703c260762ff5cce205998023b835b92b89396 100644 --- a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.C +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.C @@ -51,28 +51,7 @@ void Foam::cyclicPointPatch::initGeometry(PstreamBuffers&) void Foam::cyclicPointPatch::calcGeometry(PstreamBuffers&) -{ - const edgeList& cp = cyclicPolyPatch_.coupledPoints(); - const labelList& mp = cyclicPolyPatch_.meshPoints(); - - DynamicList<label> separated; - forAll(cp, i) - { - const edge& coupledSet = cp[i]; - - // Assume all points are separated. - separated.append(coupledSet[0]); - separated.append(coupledSet[1]); - } - separatedPoints_.transfer(separated); - - if (debug) - { - Pout<< "cyclic:" << cyclicPolyPatch_.name() - << " separated:" << separatedPoints_.size() - << " out of points:" << mp.size() << endl; - } -} +{} void Foam::cyclicPointPatch::initMovePoints(PstreamBuffers&, const pointField&) @@ -124,10 +103,4 @@ const Foam::edgeList& Foam::cyclicPointPatch::transformPairs() const } -const Foam::labelList& Foam::cyclicPointPatch::separatedPoints() const -{ - return separatedPoints_; -} - - // ************************************************************************* // diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.H b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.H index 2682c194c8ecb921db0ba971ba5e97025435b74c..8e1849a52c01aea614a820c439f92774490aecd2 100644 --- a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.H +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/cyclic/cyclicPointPatch.H @@ -37,6 +37,7 @@ SourceFiles #include "coupledFacePointPatch.H" #include "cyclicPolyPatch.H" +#include "pointBoundaryMesh.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -56,8 +57,6 @@ class cyclicPointPatch //- Local reference cast into the cyclic patch const cyclicPolyPatch& cyclicPolyPatch_; - //- List of local points that are not collocated - mutable labelList separatedPoints_; // Private Member Functions @@ -125,6 +124,14 @@ public: return cyclicPolyPatch_; } + //- Return neighbour point patch + const cyclicPointPatch& neighbPatch() const + { + label patchI = cyclicPolyPatch_.neighbPatchID(); + const pointPatch& pp = this->boundaryMesh()[patchI]; + return refCast<const cyclicPointPatch>(pp); + } + //- Are the cyclic planes parallel bool parallel() const { @@ -147,11 +154,10 @@ public: // Access functions for demand driven data //- Return the set of pairs of points that require transformation - // and/or mapping + // and/or mapping. First index is on this patch, second on the + // neighbour patch. virtual const edgeList& transformPairs() const; - //- List of separated coupled points - virtual const labelList& separatedPoints() const; }; diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.C b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.C index 79faa898cb5dea58bd12aed855b035782486ca89..da6fa3822fcfbdca1025533fb23321ae25ae6939 100644 --- a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.C +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.C @@ -73,51 +73,7 @@ void Foam::processorPointPatch::initGeometry(PstreamBuffers& pBufs) void Foam::processorPointPatch::calcGeometry(PstreamBuffers& pBufs) -{ - if (Pstream::parRun()) - { - const boolList& collocated = procPolyPatch_.collocated(); - - if (collocated.size() == 0) - { - separatedPoints_.setSize(0); - } - else if (collocated.size() == 1) - { - // Uniformly - if (collocated[0]) - { - separatedPoints_.setSize(0); - } - else - { - separatedPoints_ = identity(size()); - } - } - else - { - // Per face collocated or not. - const labelListList& pointFaces = procPolyPatch_.pointFaces(); - - DynamicList<label> separated; - forAll(pointFaces, pfi) - { - if (!collocated[pointFaces[pfi][0]]) - { - separated.append(pfi); - } - } - separatedPoints_.transfer(separated); - } - } - - if (debug) - { - Pout<< "processor:" << name() - << " separated:" << separatedPoints_.size() - << " out of points:" << size() << endl; - } -} +{} void Foam::processorPointPatch::initMovePoints @@ -173,10 +129,4 @@ const Foam::labelList& Foam::processorPointPatch::reverseMeshPoints() const } -const Foam::labelList& Foam::processorPointPatch::separatedPoints() const -{ - return separatedPoints_; -} - - // ************************************************************************* // diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.H b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.H index 1654b58d4bf03582abfbaad1bd47aaa9cf0408a8..97faee107b18eb96787641dcc2866f2893beb227 100644 --- a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.H +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processor/processorPointPatch.H @@ -65,7 +65,6 @@ class processorPointPatch mutable labelList reverseMeshPoints_; - mutable labelList separatedPoints_; // Private Member Functions @@ -129,6 +128,12 @@ public: } } + //- Return message tag to use for communication + virtual int tag() const + { + return procPolyPatch_.tag(); + } + //- Return the constraint type this pointPatch implements. virtual const word& constraintType() const { @@ -168,9 +173,6 @@ public: //- Return mesh points in the correct order for the receiving side const labelList& reverseMeshPoints() const; - //- List of separated coupled points - virtual const labelList& separatedPoints() const; - }; diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.C b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.C new file mode 100644 index 0000000000000000000000000000000000000000..97fd1611db6579f40d2cc18d319fb58512c933b3 --- /dev/null +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.C @@ -0,0 +1,400 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicPointPatch.H" +#include "pointBoundaryMesh.H" +#include "addToRunTimeSelectionTable.H" +//#include "pointMesh.H" +//#include "globalPointPatch.H" +//#include "faceList.H" +//#include "primitiveFacePatch.H" +//#include "emptyPolyPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +defineTypeNameAndDebug(processorCyclicPointPatch, 0); + +addToRunTimeSelectionTable +( + facePointPatch, + processorCyclicPointPatch, + polyPatch +); + + +// * * * * * * * * * * * * * Protected Member Functions * * * * * * * * * * // + +//void Foam::processorCyclicPointPatch::initGeometry(PstreamBuffers& pBufs) +//{ +// // Algorithm: +// // Depending on whether the patch is a master or a slave, get the primitive +// // patch points and filter away the points from the global patch. +// +// if (isMaster()) +// { +// meshPoints_ = procPolyPatch_.meshPoints(); +// } +// else +// { +// // Slave side. Create the reversed patch and pick up its points +// // so that the order is correct +// const polyPatch& pp = patch(); +// +// faceList masterFaces(pp.size()); +// +// forAll (pp, faceI) +// { +// masterFaces[faceI] = pp[faceI].reverseFace(); +// } +// +// meshPoints_ = primitiveFacePatch +// ( +// masterFaces, +// pp.points() +// ).meshPoints(); +// } +// +// if (Pstream::parRun()) +// { +// initPatchPatchPoints(pBufs); +// } +//} +// +// +//void Foam::processorCyclicPointPatch::calcGeometry(PstreamBuffers& pBufs) +//{ +// if (Pstream::parRun()) +// { +// calcPatchPatchPoints(pBufs); +// } +// +// // If it is not runing parallel or there are no global points +// // create a 1->1 map +// if +// ( +// !Pstream::parRun() +// || !boundaryMesh().mesh().globalData().nGlobalPoints() +// ) +// { +// nonGlobalPatchPoints_.setSize(meshPoints_.size()); +// forAll(nonGlobalPatchPoints_, i) +// { +// nonGlobalPatchPoints_[i] = i; +// } +// } +// else +// { +// // Get reference to shared points +// const labelList& sharedPoints = +// boundaryMesh().globalPatch().meshPoints(); +// +// nonGlobalPatchPoints_.setSize(meshPoints_.size()); +// +// label noFiltPoints = 0; +// +// forAll (meshPoints_, pointI) +// { +// label curP = meshPoints_[pointI]; +// +// bool found = false; +// +// forAll (sharedPoints, sharedI) +// { +// if (sharedPoints[sharedI] == curP) +// { +// found = true; +// break; +// } +// } +// +// if (!found) +// { +// nonGlobalPatchPoints_[noFiltPoints] = pointI; +// meshPoints_[noFiltPoints] = curP; +// noFiltPoints++; +// } +// } +// +// nonGlobalPatchPoints_.setSize(noFiltPoints); +// meshPoints_.setSize(noFiltPoints); +// } +//} +// +// +//void processorCyclicPointPatch::initPatchPatchPoints(PstreamBuffers& pBufs) +//{ +// if (debug) +// { +// Info<< "processorCyclicPointPatch::initPatchPatchPoints(PstreamBuffers&) : " +// << "constructing patch-patch points" +// << endl; +// } +// +// const polyBoundaryMesh& bm = boundaryMesh().mesh()().boundaryMesh(); +// +// // Get the mesh points for this patch corresponding to the faces +// const labelList& ppmp = meshPoints(); +// +// // Create a HashSet of the point labels for this patch +// Map<label> patchPointSet(2*ppmp.size()); +// +// forAll (ppmp, ppi) +// { +// patchPointSet.insert(ppmp[ppi], ppi); +// } +// +// +// // Create the lists of patch-patch points +// labelListList patchPatchPoints(bm.size()); +// +// // Create the lists of patch-patch point normals +// List<List<vector> > patchPatchPointNormals(bm.size()); +// +// // Loop over all patches looking for other patches that share points +// forAll(bm, patchi) +// { +// if +// ( +// patchi != index() // Ignore self-self +// && !isA<emptyPolyPatch>(bm[patchi]) // Ignore empty +// && !bm[patchi].coupled() // Ignore other couples +// ) +// { +// // Get the meshPoints for the other patch +// const labelList& meshPoints = bm[patchi].meshPoints(); +// +// // Get the normals for the other patch +// const vectorField& normals = bm[patchi].pointNormals(); +// +// label pppi = 0; +// forAll(meshPoints, pointi) +// { +// label ppp = meshPoints[pointi]; +// +// // Check to see if the point of the other patch is shared with +// // this patch +// Map<label>::iterator iter = patchPointSet.find(ppp); +// +// if (iter != patchPointSet.end()) +// { +// // If it is shared initialise the patchPatchPoints for this +// // patch +// if (!patchPatchPoints[patchi].size()) +// { +// patchPatchPoints[patchi].setSize(ppmp.size()); +// patchPatchPointNormals[patchi].setSize(ppmp.size()); +// } +// +// // and add the entry +// patchPatchPoints[patchi][pppi] = iter(); +// patchPatchPointNormals[patchi][pppi] = normals[pointi]; +// pppi++; +// } +// } +// +// // Resise the list of shared points and normals for the patch +// // being considerd +// patchPatchPoints[patchi].setSize(pppi); +// patchPatchPointNormals[patchi].setSize(pppi); +// } +// } +// +// // Send the patchPatchPoints to the neighbouring processor +// +// UOPstream toNeighbProc(neighbProcNo(), pBufs); +// +// toNeighbProc +// << ppmp.size() // number of points for checking +// << patchPatchPoints +// << patchPatchPointNormals; +// +// if (debug) +// { +// Info<< "processorCyclicPointPatch::initPatchPatchPoints() : " +// << "constructed patch-patch points" +// << endl; +// } +//} +// +// +//void Foam::processorCyclicPointPatch::calcPatchPatchPoints(PstreamBuffers& pBufs) +//{ +// // Get the patchPatchPoints from the neighbouring processor +// UIPstream fromNeighbProc(neighbProcNo(), pBufs); +// +// label nbrNPoints(readLabel(fromNeighbProc)); +// labelListList patchPatchPoints(fromNeighbProc); +// List<List<vector> > patchPatchPointNormals(fromNeighbProc); +// +// pointBoundaryMesh& pbm = const_cast<pointBoundaryMesh&>(boundaryMesh()); +// const labelList& ppmp = meshPoints(); +// +// // Simple check for the very rare situation when not the same number +// // of points on both sides. This can happen with decomposed cyclics. +// // If on one side the cyclic shares a point with proc faces coming from +// // internal faces it will have a different number of points from +// // the situation where the cyclic and the 'normal' proc faces are fully +// // separate. +// if (nbrNPoints != ppmp.size()) +// { +// WarningIn("processorCyclicPointPatch::calcPatchPatchPoints(PstreamBuffers&)") +// << "Processor patch " << name() +// << " has " << ppmp.size() << " points; coupled patch has " +// << nbrNPoints << " points." << endl +// << " (usually due to decomposed cyclics)." +// << " This might give problems" << endl +// << " when using point fields (interpolation, mesh motion)." +// << endl; +// } +// +// +// +// // Loop over the patches looking for other patches that share points +// forAll(patchPatchPoints, patchi) +// { +// const labelList& patchPoints = patchPatchPoints[patchi]; +// const List<vector>& patchPointNormals = patchPatchPointNormals[patchi]; +// +// // If there are potentially shared points for the patch being considered +// if (patchPoints.size()) +// { +// // Get the current meshPoints list for the patch +// facePointPatch& fpp = refCast<facePointPatch>(pbm[patchi]); +// const labelList& fmp = fpp.meshPoints(); +// labelList& mp = fpp.meshPoints_; +// +// const vectorField& fnormals = fpp.pointNormals(); +// vectorField& normals = fpp.pointNormals_; +// +// // Create a HashSet of the point labels for the patch +// Map<label> patchPointSet(2*fmp.size()); +// +// forAll (fmp, ppi) +// { +// patchPointSet.insert(fmp[ppi], ppi); +// } +// +// label nPoints = mp.size(); +// label lpi = 0; +// bool resized = false; +// +// // For each potentially shared point... +// forAll(patchPoints, ppi) +// { +// // Check if it is not already in the patch, +// // i.e. not part of a face of the patch +// if (!patchPointSet.found(ppmp[patchPoints[ppi]])) +// { +// // If it isn't already in the patch check if the local +// // meshPoints is already set and if not initialise the +// // meshPoints_ and pointNormals_ +// if (!resized) +// { +// if (!mp.size() && fmp.size()) +// { +// mp = fmp; +// normals = fnormals; +// +// nPoints = mp.size(); +// } +// +// mp.setSize(nPoints + patchPoints.size()); +// loneMeshPoints_.setSize(patchPoints.size()); +// normals.setSize(nPoints + patchPoints.size()); +// resized = true; +// } +// +// // Add the new point to the patch +// mp[nPoints] = ppmp[patchPoints[ppi]]; +// loneMeshPoints_[lpi++] = ppmp[patchPoints[ppi]]; +// normals[nPoints++] = patchPointNormals[ppi]; +// } +// } +// +// // If the lists have been resized points have been added. +// // Shrink the lists to the current size. +// if (resized) +// { +// mp.setSize(nPoints); +// loneMeshPoints_.setSize(lpi); +// normals.setSize(nPoints); +// } +// } +// } +//} + + +//void processorCyclicPointPatch::initMovePoints(PstreamBuffers&, const pointField&) +//{} +// +// +//void processorCyclicPointPatch::movePoints(PstreamBuffers&, const pointField&) +//{} +// +// +//void processorCyclicPointPatch::initUpdateMesh(PstreamBuffers& pBufs) +//{ +// facePointPatch::initUpdateMesh(pBufs); +// processorCyclicPointPatch::initGeometry(pBufs); +//} +// +// +//void processorCyclicPointPatch::updateMesh(PstreamBuffers& pBufs) +//{ +// facePointPatch::updateMesh(pBufs); +// processorCyclicPointPatch::calcGeometry(pBufs); +//} + + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +processorCyclicPointPatch::processorCyclicPointPatch +( + const polyPatch& patch, + const pointBoundaryMesh& bm +) +: + processorPointPatch(patch, bm), + procCycPolyPatch_(refCast<const processorCyclicPolyPatch>(patch)) +{} + + +// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * // + +processorCyclicPointPatch::~processorCyclicPointPatch() +{} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.H b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.H new file mode 100644 index 0000000000000000000000000000000000000000..9363e5096c94406d9b00d068e276be4cb3439f38 --- /dev/null +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/constraint/processorCyclic/processorCyclicPointPatch.H @@ -0,0 +1,156 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicPointPatch + +Description + Processor patch boundary needs to be such that the ordering of + points in the patch is the same on both sides. + + Looking at the creation of the faces on both sides of the processor + patch they need to be identical on both sides with the normals pointing + in opposite directions. This is achieved by calling the reverseFace + function in the decomposition. It is therefore possible to re-create + the ordering of patch points on the slave side by reversing all the + patch faces of the owner. + +SourceFiles + processorCyclicPointPatch.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicPointPatch_H +#define processorCyclicPointPatch_H + +#include "processorPointPatch.H" +#include "processorCyclicPolyPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicPointPatch Declaration +\*---------------------------------------------------------------------------*/ + +class processorCyclicPointPatch +: + public processorPointPatch +{ + // Private data + + const processorCyclicPolyPatch& procCycPolyPatch_; + + //- Disallow default construct as copy + processorCyclicPointPatch(const processorCyclicPointPatch&); + + //- Disallow default assignment + void operator=(const processorCyclicPointPatch&); + +public: + + //- Runtime type information + TypeName(processorCyclicPolyPatch::typeName_()); + + + // Constructors + + //- Construct from components + processorCyclicPointPatch + ( + const polyPatch& patch, + const pointBoundaryMesh& bm + ); + + + // Destructor + + virtual ~processorCyclicPointPatch(); + + + // Member functions + + + //- Return message tag to use for communication + virtual int tag() const + { + return procCycPolyPatch_.tag(); + } + +// //- Return true if running parallel +// virtual bool coupled() const +// { +// if (Pstream::parRun()) +// { +// return true; +// } +// else +// { +// return false; +// } +// } +// +// //- Return processor number +// int myProcNo() const +// { +// return procPolyPatch_.myProcNo(); +// } +// +// //- Return neigbour processor number +// int neighbProcNo() const +// { +// return procPolyPatch_.neighbProcNo(); +// } +// +// //- Is this a master patch +// bool isMaster() const +// { +// return myProcNo() < neighbProcNo(); +// } +// +// //- Is this a slave patch +// bool isSlave() const +// { +// return !isMaster(); +// } +// + //- Return the underlying processorCyclicPolyPatch + const processorCyclicPolyPatch& procCyclicPolyPatch() const + { + return procCycPolyPatch_; + } +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/pointMesh/pointPatches/derived/coupled/coupledFacePointPatch.H b/src/OpenFOAM/meshes/pointMesh/pointPatches/derived/coupled/coupledFacePointPatch.H index 7237290e0409fec51dfb40d8f71aac9ed14b5a21..278b56c07711431ed24ee680f13dc75da72633b7 100644 --- a/src/OpenFOAM/meshes/pointMesh/pointPatches/derived/coupled/coupledFacePointPatch.H +++ b/src/OpenFOAM/meshes/pointMesh/pointPatches/derived/coupled/coupledFacePointPatch.H @@ -108,8 +108,6 @@ public: return true; } - //- List of separated coupled points - virtual const labelList& separatedPoints() const = 0; }; diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.C b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.C index 3931db5b6a9ce0b2619f6041271cb539df069ddb..3daa288e74cf70b59c2117373b5cec2d6e5a20e0 100644 --- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.C +++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.C @@ -77,34 +77,38 @@ void Foam::globalMeshData::initProcAddr() if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send indices of my processor patches to my neighbours forAll(processorPatches_, i) { label patchi = processorPatches_[i]; - OPstream toNeighbour + UOPstream toNeighbour ( - Pstream::blocking, refCast<const processorPolyPatch> ( mesh_.boundaryMesh()[patchi] - ).neighbProcNo() + ).neighbProcNo(), + pBufs ); toNeighbour << processorPatchIndices_[patchi]; } + pBufs.finishedSends(); + forAll(processorPatches_, i) { label patchi = processorPatches_[i]; - IPstream fromNeighbour + UIPstream fromNeighbour ( - Pstream::blocking, refCast<const processorPolyPatch> ( mesh_.boundaryMesh()[patchi] - ).neighbProcNo() + ).neighbProcNo(), + pBufs ); fromNeighbour >> processorPatchNeighbours_[patchi]; @@ -2000,24 +2004,10 @@ void Foam::globalMeshData::updateMesh() { label patchI = processorPatches_[i]; - const processorPolyPatch& procPatch = - refCast<const processorPolyPatch>(mesh_.boundaryMesh()[patchI]); - - if (Pstream::myProcNo() > procPatch.neighbProcNo()) + if (isType<processorPolyPatch>(mesh_.boundaryMesh()[patchI])) { - // Uncount my faces. Handle cyclics separately. - - if (procPatch.separated()) - { - const vectorField& separationDist = procPatch.separation(); - - nTotalFaces_ -= countCoincidentFaces(tolDim, separationDist); - } - else - { - // Normal, unseparated processor patch. Remove duplicates. - nTotalFaces_ -= procPatch.size(); - } + // Normal, unseparated processor patch. Remove duplicates. + nTotalFaces_ -= mesh_.boundaryMesh()[patchI].size(); } } reduce(nTotalFaces_, sumOp<label>()); @@ -2060,6 +2050,8 @@ void Foam::globalMeshData::updateMesh() pointStatus.set(meshPointI, SHARED); } + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send patch local points forAll(processorPatches_, i) { @@ -2068,11 +2060,13 @@ void Foam::globalMeshData::updateMesh() const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(mesh_.boundaryMesh()[patchI]); - OPstream toNeighbour(Pstream::blocking, procPatch.neighbProcNo()); + UOPstream toNeighbour(procPatch.neighbProcNo(), pBufs); toNeighbour << procPatch.localPoints(); } + pBufs.finishedSends(); + // Receive patch local points and uncount if coincident (and not shared) forAll(processorPatches_, i) { @@ -2081,7 +2075,7 @@ void Foam::globalMeshData::updateMesh() const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(mesh_.boundaryMesh()[patchI]); - IPstream fromNeighbour(Pstream::blocking, procPatch.neighbProcNo()); + UIPstream fromNeighbour(procPatch.neighbProcNo(), pBufs); pointField nbrPoints(fromNeighbour); diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C index 270be1dd77db4eee18ea8181061d1656602ac185..03070256454ae90fbeb3ae719b399b3ddb3e166e 100644 --- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C +++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C @@ -25,6 +25,7 @@ License #include "globalPoints.H" #include "processorPolyPatch.H" +#include "processorCyclicPolyPatch.H" #include "cyclicPolyPatch.H" #include "polyMesh.H" @@ -40,45 +41,6 @@ const Foam::label Foam::globalPoints::fromCollocated = labelMax/2; // Routines to handle global indices // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ -Foam::PackedBoolList Foam::globalPoints::collocatedPoints -( - const coupledPolyPatch& pp -) -{ - // Initialise to false - PackedBoolList isCollocated(pp.nPoints()); - - const boolList& collocated = pp.collocated(); - - if (collocated.size() == 0) - { - isCollocated = 1; - } - else if (collocated.size() == 1) - { - // Uniform. - if (collocated[0]) - { - isCollocated = 1; - } - } - else - { - // Per face collocated or not. - const labelListList& pointFaces = pp.pointFaces(); - - forAll(pointFaces, pfi) - { - if (collocated[pointFaces[pfi][0]]) - { - isCollocated[pfi] = 1; - } - } - } - return isCollocated; -} - - Foam::label Foam::globalPoints::toGlobal ( const label localPointI, @@ -369,16 +331,9 @@ void Foam::globalPoints::initOwnPoints || isA<cyclicPolyPatch>(pp) ) { - // Find points with transforms - - PackedBoolList isCollocatedPoint - ( - collocatedPoints - ( - refCast<const coupledPolyPatch>(pp) - ) - ); - + // Assume all processor points are collocated and all + // processorCyclic and cyclic are separated. + bool isCollocatedPoint = isType<processorPolyPatch>(pp); const labelList& meshPoints = pp.meshPoints(); @@ -396,7 +351,7 @@ void Foam::globalPoints::initOwnPoints labelList knownInfo ( 1, - toGlobal(localPointI, isCollocatedPoint[patchPointI]) + toGlobal(localPointI, isCollocatedPoint) ); // Update addressing from point to index in procPoints @@ -425,11 +380,7 @@ void Foam::globalPoints::initOwnPoints labelList knownInfo ( 1, - toGlobal - ( - localPointI, - isCollocatedPoint[boundaryPoints[i]] - ) + toGlobal(localPointI, isCollocatedPoint) ); // Update addressing from point to index in procPoints @@ -461,20 +412,21 @@ void Foam::globalPoints::sendPatchPoints { const polyPatch& pp = patches[patchI]; - if (Pstream::parRun() && isA<processorPolyPatch>(pp)) + if + ( + Pstream::parRun() + && ( + isType<processorPolyPatch>(pp) + || (mergeSeparated && isA<processorCyclicPolyPatch>(pp)) + ) + ) { + // processor cyclics are considered separated, pure processor + // always collocated. + const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); - PackedBoolList isCollocatedPoint - ( - collocatedPoints - ( - procPatch - ) - ); - - // Information to send: // patch face DynamicList<label> patchFaces(pp.nPoints()); @@ -492,34 +444,31 @@ void Foam::globalPoints::sendPatchPoints forAll(meshPoints, patchPointI) { - if (mergeSeparated || isCollocatedPoint[patchPointI]) + label meshPointI = meshPoints[patchPointI]; + label localPointI = meshToLocalPoint + ( + meshToPatchPoint, + meshPointI + ); + + if (changedPoints.found(localPointI)) { - label meshPointI = meshPoints[patchPointI]; - label localPointI = meshToLocalPoint - ( - meshToPatchPoint, - meshPointI - ); + label index = meshToProcPoint_[localPointI]; - if (changedPoints.found(localPointI)) - { - label index = meshToProcPoint_[localPointI]; + const labelList& knownInfo = procPoints_[index]; - const labelList& knownInfo = procPoints_[index]; + // Add my information about localPointI to the + // send buffers + addToSend + ( + pp, + patchPointI, + knownInfo, - // Add my information about localPointI to the - // send buffers - addToSend - ( - pp, - patchPointI, - knownInfo, - - patchFaces, - indexInFace, - allInfo - ); - } + patchFaces, + indexInFace, + allInfo + ); } } @@ -560,18 +509,20 @@ void Foam::globalPoints::receivePatchPoints { const polyPatch& pp = patches[patchI]; - if (Pstream::parRun() && isA<processorPolyPatch>(pp)) + if + ( + Pstream::parRun() + && ( + isType<processorPolyPatch>(pp) + || (mergeSeparated && isA<processorCyclicPolyPatch>(pp)) + ) + ) { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); - PackedBoolList isCollocatedPoint - ( - collocatedPoints - ( - procPatch - ) - ); + // Processor patch is always collocated, processorCyclic is not. + bool isCollocatedPoint = isType<processorPolyPatch>(pp); labelList patchFaces; labelList indexInFace; @@ -605,21 +556,13 @@ void Foam::globalPoints::receivePatchPoints meshPointI ); - if - ( - storeInfo - ( - nbrInfo[i], - localPointI, - isCollocatedPoint[pp.meshPointMap()[meshPointI]] - ) - ) + if (storeInfo(nbrInfo[i], localPointI, isCollocatedPoint)) { changedPoints.insert(localPointI); } } } - else if (isA<cyclicPolyPatch>(pp)) + else if (mergeSeparated && isA<cyclicPolyPatch>(pp)) { // Handle cyclics: send lower half to upper half and vice versa. // Or since they both are in memory just do it point by point. @@ -627,80 +570,49 @@ void Foam::globalPoints::receivePatchPoints const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(pp); - PackedBoolList isCollocatedPoint - ( - collocatedPoints - ( - cycPatch - ) - ); - const labelList& meshPoints = pp.meshPoints(); + const labelList coupledMeshPoints(reverseMeshPoints(cycPatch)); - //const edgeList& connections = cycPatch.coupledPoints(); - const edgeList connections(coupledPoints(cycPatch)); - - forAll(connections, i) + forAll(meshPoints, i) { - const edge& e = connections[i]; + label meshPointA = meshPoints[i]; + label meshPointB = coupledMeshPoints[i]; - if (mergeSeparated || isCollocatedPoint[e[0]]) - { - label meshPointA = meshPoints[e[0]]; - label meshPointB = meshPoints[e[1]]; - - label localA = meshToLocalPoint - ( - meshToPatchPoint, - meshPointA - ); - label localB = meshToLocalPoint - ( - meshToPatchPoint, - meshPointB - ); + label localA = meshToLocalPoint + ( + meshToPatchPoint, + meshPointA + ); + label localB = meshToLocalPoint + ( + meshToPatchPoint, + meshPointB + ); - // Do we have information on pointA? - Map<label>::iterator procPointA = - meshToProcPoint_.find(localA); + // Do we have information on pointA? + Map<label>::iterator procPointA = + meshToProcPoint_.find(localA); - if (procPointA != meshToProcPoint_.end()) + if (procPointA != meshToProcPoint_.end()) + { + // Store A info onto pointB + if (storeInfo(procPoints_[procPointA()], localB, false)) { - // Store A info onto pointB - if - ( - storeInfo - ( - procPoints_[procPointA()], - localB, - isCollocatedPoint[e[1]] - ) - ) - { - changedPoints.insert(localB); - } + changedPoints.insert(localB); } + } - // Same for info on pointB - Map<label>::iterator procPointB = - meshToProcPoint_.find(localB); + // Same for info on pointB + Map<label>::iterator procPointB = + meshToProcPoint_.find(localB); - if (procPointB != meshToProcPoint_.end()) + if (procPointB != meshToProcPoint_.end()) + { + // Store B info onto pointA + if (storeInfo(procPoints_[procPointB()], localA, false)) { - // Store B info onto pointA - if - ( - storeInfo - ( - procPoints_[procPointB()], - localA, - isCollocatedPoint[e[0]] - ) - ) - { - changedPoints.insert(localA); - } + changedPoints.insert(localA); } } } @@ -970,7 +882,14 @@ void Foam::globalPoints::sendSharedPoints { const polyPatch& pp = patches[patchI]; - if (Pstream::parRun() && isA<processorPolyPatch>(pp)) + if + ( + Pstream::parRun() + && ( + isType<processorPolyPatch>(pp) + || (mergeSeparated && isA<processorCyclicPolyPatch>(pp)) + ) + ) { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); @@ -1057,7 +976,14 @@ void Foam::globalPoints::receiveSharedPoints { const polyPatch& pp = patches[patchI]; - if (Pstream::parRun() && isA<processorPolyPatch>(pp)) + if + ( + Pstream::parRun() + && ( + isType<processorPolyPatch>(pp) + || (mergeSeparated && isA<processorCyclicPolyPatch>(pp)) + ) + ) { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); @@ -1128,19 +1054,11 @@ void Foam::globalPoints::receiveSharedPoints } } } - else if (isA<cyclicPolyPatch>(pp)) + else if (mergeSeparated && isA<cyclicPolyPatch>(pp)) { const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(pp); - PackedBoolList isCollocatedPoint - ( - collocatedPoints - ( - cycPatch - ) - ); - // Build map from mesh or patch point to sharedPoint. Map<label> localToSharedPoint(sharedPointAddr_.size()); forAll(sharedPointLabels_, i) @@ -1156,80 +1074,76 @@ void Foam::globalPoints::receiveSharedPoints } // Sync all info. - //const edgeList& connections = cycPatch.coupledPoints(); - const edgeList connections(coupledPoints(cycPatch)); - forAll(connections, i) - { - const edge& e = connections[i]; + const labelList& meshPoints = cycPatch.meshPoints(); + const labelList coupledMeshPoints(reverseMeshPoints(cycPatch)); - if (mergeSeparated || isCollocatedPoint[e[0]]) - { - label meshPointA = pp.meshPoints()[e[0]]; - label meshPointB = pp.meshPoints()[e[1]]; + forAll(meshPoints, i) + { + label meshPointA = meshPoints[i]; + label meshPointB = coupledMeshPoints[i]; - label localA = meshToLocalPoint - ( - meshToPatchPoint, - meshPointA - ); - label localB = meshToLocalPoint - ( - meshToPatchPoint, - meshPointB - ); + label localA = meshToLocalPoint + ( + meshToPatchPoint, + meshPointA + ); + label localB = meshToLocalPoint + ( + meshToPatchPoint, + meshPointB + ); - // Do we already have shared point for pointA? - Map<label>::iterator fndA = localToSharedPoint.find(localA); - Map<label>::iterator fndB = localToSharedPoint.find(localB); + // Do we already have shared point for pointA? + Map<label>::iterator fndA = localToSharedPoint.find(localA); + Map<label>::iterator fndB = localToSharedPoint.find(localB); - if (fndA != localToSharedPoint.end()) + if (fndA != localToSharedPoint.end()) + { + if (fndB != localToSharedPoint.end()) { - if (fndB != localToSharedPoint.end()) + if (fndA() != fndB()) { - if (fndA() != fndB()) - { - FatalErrorIn - ( - "globalPoints::receiveSharedPoints(..)" - ) << "On patch " << pp.name() - << " connected points " << meshPointA - << ' ' << mesh_.points()[meshPointA] - << " and " << meshPointB - << ' ' << mesh_.points()[meshPointB] - << " are mapped to different shared" - << " points: " - << fndA() << " and " << fndB() - << abort(FatalError); - } + FatalErrorIn + ( + "globalPoints::receiveSharedPoints(..)" + ) << "On patch " << pp.name() + << " connected points " << meshPointA + << ' ' << mesh_.points()[meshPointA] + << " and " << meshPointB + << ' ' << mesh_.points()[meshPointB] + << " are mapped to different shared" + << " points: " + << fndA() << " and " << fndB() + << abort(FatalError); } - else - { - // No shared point yet for B. - label sharedPointI = fndA(); + } + else + { + // No shared point yet for B. + label sharedPointI = fndA(); - // Store shared point for pointB - label sharedI = meshToShared[localB]; + // Store shared point for pointB + label sharedI = meshToShared[localB]; - sharedPointAddr_[sharedI] = sharedPointI; - sharedPointLabels_[sharedI] = localB; - changedIndices.append(sharedI); - } + sharedPointAddr_[sharedI] = sharedPointI; + sharedPointLabels_[sharedI] = localB; + changedIndices.append(sharedI); } - else + } + else + { + // No shared point yet for A. + if (fndB != localToSharedPoint.end()) { - // No shared point yet for A. - if (fndB != localToSharedPoint.end()) - { - label sharedPointI = fndB(); + label sharedPointI = fndB(); - // Store shared point for pointA - label sharedI = meshToShared[localA]; + // Store shared point for pointA + label sharedI = meshToShared[localA]; - sharedPointAddr_[sharedI] = sharedPointI; - sharedPointLabels_[sharedI] = localA; - changedIndices.append(sharedI); - } + sharedPointAddr_[sharedI] = sharedPointI; + sharedPointLabels_[sharedI] = localA; + changedIndices.append(sharedI); } } } @@ -1241,51 +1155,25 @@ void Foam::globalPoints::receiveSharedPoints } -Foam::edgeList Foam::globalPoints::coupledPoints(const cyclicPolyPatch& pp) +Foam::labelList Foam::globalPoints::reverseMeshPoints +( + const cyclicPolyPatch& pp +) { - // Look at cyclic patch as two halves, A and B. - // Now all we know is that relative face index in halfA is same - // as coupled face in halfB and also that the 0th vertex - // corresponds. + const cyclicPolyPatch& nbrPatch = pp.neighbPatch(); - // From halfA point to halfB or -1. - labelList coupledPoint(pp.nPoints(), -1); + faceList masterFaces(nbrPatch.size()); - for (label patchFaceA = 0; patchFaceA < pp.size()/2; patchFaceA++) + forAll (nbrPatch, faceI) { - const face& fA = pp.localFaces()[patchFaceA]; - - forAll(fA, indexA) - { - label patchPointA = fA[indexA]; - - if (coupledPoint[patchPointA] == -1) - { - const face& fB = pp.localFaces()[patchFaceA + pp.size()/2]; - - label indexB = (fB.size() - indexA) % fB.size(); - - coupledPoint[patchPointA] = fB[indexB]; - } - } - } - - edgeList connected(pp.nPoints()); - - // Extract coupled points. - label connectedI = 0; - - forAll(coupledPoint, i) - { - if (coupledPoint[i] != -1) - { - connected[connectedI++] = edge(i, coupledPoint[i]); - } + masterFaces[faceI] = nbrPatch[faceI].reverseFace(); } - connected.setSize(connectedI); - - return connected; + return primitiveFacePatch + ( + masterFaces, + nbrPatch.points() + ).meshPoints(); } diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H index fcf7144a90ee7512b0a9de0495798833badaaafd..32012334b77c3398b6706c4da3d73425f4db0b0d 100644 --- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H +++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H @@ -158,10 +158,6 @@ class globalPoints // Private Member Functions - //- Return per point collocated status - static PackedBoolList collocatedPoints(const coupledPolyPatch&); - - // Wrappers around global point numbering to add collocated bit //- Convert into globalIndices and add collocated bit @@ -300,9 +296,8 @@ class globalPoints DynamicList<label>& ); - //- Should move into cyclicPolyPatch ordering problem - // keeps on giving problems. - static edgeList coupledPoints(const cyclicPolyPatch&); + //- Return mesh points of other side in same order as my meshPoints. + static labelList reverseMeshPoints(const cyclicPolyPatch&); //- Do all calculations. void calculateSharedPoints diff --git a/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistribute.C b/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistribute.C index b0ecac822b56ebbab5e0e8601fcfe43104b6542e..fa9ad13f930806b602b22eff0bbfcfb47c000874 100644 --- a/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistribute.C +++ b/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistribute.C @@ -74,7 +74,7 @@ Foam::List<Foam::labelPair> Foam::mapDistribute::schedule slave++ ) { - IPstream fromSlave(Pstream::blocking, slave); + IPstream fromSlave(Pstream::scheduled, slave); List<labelPair> nbrData(fromSlave); forAll(nbrData, i) @@ -95,18 +95,18 @@ Foam::List<Foam::labelPair> Foam::mapDistribute::schedule slave++ ) { - OPstream toSlave(Pstream::blocking, slave); + OPstream toSlave(Pstream::scheduled, slave); toSlave << allComms; } } else { { - OPstream toMaster(Pstream::blocking, Pstream::masterNo()); + OPstream toMaster(Pstream::scheduled, Pstream::masterNo()); toMaster << allComms; } { - IPstream fromMaster(Pstream::blocking, Pstream::masterNo()); + IPstream fromMaster(Pstream::scheduled, Pstream::masterNo()); fromMaster >> allComms; } } @@ -595,6 +595,7 @@ void Foam::mapDistribute::compact(const boolList& elemIsUsed) // Send elemIsUsed field to neighbour. Use nonblocking code from // mapDistribute but in reverse order. + if (Pstream::parRun()) { List<boolList> sendFields(Pstream::nProcs()); diff --git a/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistributeTemplates.C b/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistributeTemplates.C index 8797519d4dfc239511dd3b5c5351d86e0071e543..8fb074488de78a922d4735e8f4e79ad8ffaa75ac 100644 --- a/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistributeTemplates.C +++ b/src/OpenFOAM/meshes/polyMesh/mapPolyMesh/mapDistribute/mapDistributeTemplates.C @@ -41,6 +41,30 @@ void Foam::mapDistribute::distribute List<T>& field ) { + if (!Pstream::parRun()) + { + // Do only me to me. + + const labelList& mySubMap = subMap[Pstream::myProcNo()]; + + List<T> subField(mySubMap.size()); + forAll(mySubMap, i) + { + subField[i] = field[mySubMap[i]]; + } + + // Receive sub field from myself (subField) + const labelList& map = constructMap[Pstream::myProcNo()]; + + field.setSize(constructSize); + + forAll(map, i) + { + field[map[i]] = subField[i]; + } + return; + } + if (commsType == Pstream::blocking) { // Since buffered sending can reuse the field to collect the @@ -406,6 +430,30 @@ void Foam::mapDistribute::distribute const T& nullValue ) { + if (!Pstream::parRun()) + { + // Do only me to me. + + const labelList& mySubMap = subMap[Pstream::myProcNo()]; + + List<T> subField(mySubMap.size()); + forAll(mySubMap, i) + { + subField[i] = field[mySubMap[i]]; + } + + // Receive sub field from myself (subField) + const labelList& map = constructMap[Pstream::myProcNo()]; + + field.setSize(constructSize); + + forAll(map, i) + { + field[map[i]] = subField[i]; + } + return; + } + if (commsType == Pstream::blocking) { // Since buffered sending can reuse the field to collect the diff --git a/src/OpenFOAM/meshes/polyMesh/polyMesh.C b/src/OpenFOAM/meshes/polyMesh/polyMesh.C index 9bb7f27fa5ceda97a012d7189d58c39a02a10903..d0b3a7fa6642fcbc1f765ec90814e79c56ee659e 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyMesh.C +++ b/src/OpenFOAM/meshes/polyMesh/polyMesh.C @@ -717,6 +717,7 @@ void Foam::polyMesh::resetPrimitives " const Xfer<labelList>& neighbour,\n" " const labelList& patchSizes,\n" " const labelList& patchStarts\n" + " const bool validBoundary\n" ")\n" ) << "Face " << faceI << " contains vertex labels out of range: " << curFace << " Max point index = " << points_.size() @@ -759,9 +760,9 @@ void Foam::polyMesh::resetPrimitives " const Xfer<labelList>& neighbour,\n" " const labelList& patchSizes,\n" " const labelList& patchStarts\n" + " const bool validBoundary\n" ")\n" - ) - << "no points or no cells in mesh" << endl; + ) << "no points or no cells in mesh" << endl; } } } diff --git a/src/OpenFOAM/meshes/polyMesh/polyMesh.H b/src/OpenFOAM/meshes/polyMesh/polyMesh.H index ce82d36de7487d904b5bf46a87d9f4cfc4c9336c..d82006b2df3ef42f12f63f252010c674a44c7d4b 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyMesh.H +++ b/src/OpenFOAM/meshes/polyMesh/polyMesh.H @@ -193,6 +193,19 @@ private: const label patchID ) const; + void setTopology + ( + const cellShapeList& cellsAsShapes, + const faceListList& boundaryFaces, + const wordList& boundaryPatchNames, + labelList& patchSizes, + labelList& patchStarts, + label& defaultPatchStart, + label& nFaces, + cellList& cells + ); + + public: @@ -255,6 +268,20 @@ public: const bool syncPar = true ); + //- Construct from cell shapes with patch information in dictionary + // format. + polyMesh + ( + const IOobject& io, + const Xfer<pointField>& points, + const cellShapeList& shapes, + const faceListList& boundaryFaces, + const PtrList<dictionary>& boundaryDicts, + const word& defaultBoundaryPatchName, + const word& defaultBoundaryPatchType, + const bool syncPar = true + ); + //- Destructor virtual ~polyMesh(); @@ -442,8 +469,6 @@ public: //- Reset mesh primitive data. Assumes all patch info correct // (so does e.g. parallel communication). If not use // validBoundary=false - // (still assumes patchStarts[0] = nInternalFaces and last - // patch ends at nActiveFaces) and change patches with addPatches. void resetPrimitives ( const Xfer<pointField>& points, diff --git a/src/OpenFOAM/meshes/polyMesh/polyMeshFromShapeMesh.C b/src/OpenFOAM/meshes/polyMesh/polyMeshFromShapeMesh.C index fe9b8e45a4b92e789c70ffd37aef24e0eee9f18c..3898cd43f094e243c74db795c6536c172f5f5461 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyMeshFromShapeMesh.C +++ b/src/OpenFOAM/meshes/polyMesh/polyMeshFromShapeMesh.C @@ -132,154 +132,26 @@ Foam::labelList Foam::polyMesh::facePatchFaceCells } -Foam::polyMesh::polyMesh +//- Set faces_, calculate cells and patchStarts. +void Foam::polyMesh::setTopology ( - const IOobject& io, - const Xfer<pointField>& points, const cellShapeList& cellsAsShapes, const faceListList& boundaryFaces, const wordList& boundaryPatchNames, - const wordList& boundaryPatchTypes, - const word& defaultBoundaryPatchName, - const word& defaultBoundaryPatchType, - const wordList& boundaryPatchPhysicalTypes, - const bool syncPar + labelList& patchSizes, + labelList& patchStarts, + label& defaultPatchStart, + label& nFaces, + cellList& cells ) -: - objectRegistry(io), - primitiveMesh(), - points_ - ( - IOobject - ( - "points", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::AUTO_WRITE - ), - points - ), - faces_ - ( - IOobject - ( - "faces", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::AUTO_WRITE - ), - 0 - ), - owner_ - ( - IOobject - ( - "owner", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::AUTO_WRITE - ), - 0 - ), - neighbour_ - ( - IOobject - ( - "neighbour", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::AUTO_WRITE - ), - 0 - ), - clearedPrimitives_(false), - boundary_ - ( - IOobject - ( - "boundary", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::AUTO_WRITE - ), - *this, - boundaryFaces.size() + 1 // add room for a default patch - ), - bounds_(points_, syncPar), - geometricD_(Vector<label>::zero), - solutionD_(Vector<label>::zero), - pointZones_ - ( - IOobject - ( - "pointZones", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::NO_WRITE - ), - *this, - 0 - ), - faceZones_ - ( - IOobject - ( - "faceZones", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::NO_WRITE - ), - *this, - 0 - ), - cellZones_ - ( - IOobject - ( - "cellZones", - instance(), - meshSubDir, - *this, - IOobject::NO_READ, - IOobject::NO_WRITE - ), - *this, - 0 - ), - globalMeshDataPtr_(NULL), - moving_(false), - curMotionTimeIndex_(time().timeIndex()), - oldPointsPtr_(NULL) { - if (debug) - { - Info<<"Constructing polyMesh from cell and boundary shapes." << endl; - } - - // Remove all of the old mesh files if they exist - removeFiles(instance()); - // Calculate the faces of all cells // Initialise maximum possible numer of mesh faces to 0 label maxFaces = 0; // Set up a list of face shapes for each cell faceListList cellsFaceShapes(cellsAsShapes.size()); - cellList cells(cellsAsShapes.size()); + cells.setSize(cellsAsShapes.size()); forAll(cellsFaceShapes, cellI) { @@ -298,7 +170,7 @@ Foam::polyMesh::polyMesh faces_.setSize(maxFaces); // Initialise number of faces to 0 - label nFaces = 0; + nFaces = 0; // set reference to point-cell addressing labelListList PointCells = cellShapePointCells(cellsAsShapes); @@ -412,15 +284,16 @@ Foam::polyMesh::polyMesh { FatalErrorIn ( - "polyMesh::polyMesh\n" + "polyMesh::setTopology\n" "(\n" - " const IOobject&,\n" - " const Xfer<pointField>&,\n" " const cellShapeList& cellsAsShapes,\n" " const faceListList& boundaryFaces,\n" - " const wordList& boundaryPatchTypes,\n" " const wordList& boundaryPatchNames,\n" - " const word& defaultBoundaryPatchType\n" + " labelList& patchSizes,\n" + " labelList& patchStarts,\n" + " label& defaultPatchStart,\n" + " label& nFaces,\n" + " cellList& cells\n" ")" ) << "Error in internal face insertion" << abort(FatalError); @@ -430,8 +303,8 @@ Foam::polyMesh::polyMesh // Do boundary faces - labelList patchSizes(boundaryFaces.size(), -1); - labelList patchStarts(boundaryFaces.size(), -1); + patchSizes.setSize(boundaryFaces.size(), -1); + patchStarts.setSize(boundaryFaces.size(), -1); forAll(boundaryFaces, patchI) { @@ -470,15 +343,16 @@ Foam::polyMesh::polyMesh { FatalErrorIn ( - "polyMesh::polyMesh\n" + "polyMesh::setTopology\n" "(\n" - " const IOobject&,\n" - " const Xfer<pointField>&,\n" " const cellShapeList& cellsAsShapes,\n" " const faceListList& boundaryFaces,\n" - " const wordList& boundaryPatchTypes,\n" " const wordList& boundaryPatchNames,\n" - " const word& defaultBoundaryPatchType\n" + " labelList& patchSizes,\n" + " labelList& patchStarts,\n" + " label& defaultPatchStart,\n" + " label& nFaces,\n" + " cellList& cells\n" ")" ) << "Trying to specify a boundary face " << curFace << " on the face on cell " << cellInside @@ -518,7 +392,7 @@ Foam::polyMesh::polyMesh // Grab "non-existing" faces and put them into a default patch - label defaultPatchStart = nFaces; + defaultPatchStart = nFaces; forAll(cells, cellI) { @@ -539,116 +413,550 @@ Foam::polyMesh::polyMesh // Reset the size of the face list faces_.setSize(nFaces); - // Warning: Patches can only be added once the face list is - // completed, as they hold a subList of the face list - forAll(boundaryFaces, patchI) - { - // add the patch to the list - boundary_.set - ( - patchI, - polyPatch::New - ( - boundaryPatchTypes[patchI], - boundaryPatchNames[patchI], - patchSizes[patchI], - patchStarts[patchI], - patchI, - boundary_ - ) - ); - - if - ( - boundaryPatchPhysicalTypes.size() - && boundaryPatchPhysicalTypes[patchI].size() - ) - { - boundary_[patchI].physicalType() = - boundaryPatchPhysicalTypes[patchI]; - } - } - - label nAllPatches = boundaryFaces.size(); - - if (nFaces > defaultPatchStart) - { - WarningIn("polyMesh::polyMesh(... construct from shapes...)") - << "Found " << nFaces - defaultPatchStart - << " undefined faces in mesh; adding to default patch." << endl; - - // Check if there already exists a defaultFaces patch as last patch - // and reuse it. - label patchI = findIndex(boundaryPatchNames, defaultBoundaryPatchName); - - if (patchI != -1) - { - if (patchI != boundaryFaces.size()-1 || boundary_[patchI].size()) - { - FatalErrorIn("polyMesh::polyMesh(... construct from shapes...)") - << "Default patch " << boundary_[patchI].name() - << " already has faces in it or is not" - << " last in list of patches." << exit(FatalError); - } - - WarningIn("polyMesh::polyMesh(... construct from shapes...)") - << "Reusing existing patch " << patchI - << " for undefined faces." << endl; - - boundary_.set - ( - patchI, - polyPatch::New - ( - boundaryPatchTypes[patchI], - boundaryPatchNames[patchI], - nFaces - defaultPatchStart, - defaultPatchStart, - patchI, - boundary_ - ) - ); - } - else - { - boundary_.set - ( - nAllPatches, - polyPatch::New - ( - defaultBoundaryPatchType, - defaultBoundaryPatchName, - nFaces - defaultPatchStart, - defaultPatchStart, - boundary_.size() - 1, - boundary_ - ) - ); - - nAllPatches++; - } - } - - // Reset the size of the boundary - boundary_.setSize(nAllPatches); - - // Set the primitive mesh - initMesh(cells); - - if (syncPar) - { - // Calculate topology for the patches (processor-processor comms etc.) - boundary_.updateMesh(); + return ; +} - // Calculate the geometry for the patches (transformation tensors etc.) - boundary_.calcGeometry(); - } - if (debug) - { - if (checkMesh()) - { - Info<< "Mesh OK" << endl; +Foam::polyMesh::polyMesh +( + const IOobject& io, + const Xfer<pointField>& points, + const cellShapeList& cellsAsShapes, + const faceListList& boundaryFaces, + const wordList& boundaryPatchNames, + const wordList& boundaryPatchTypes, + const word& defaultBoundaryPatchName, + const word& defaultBoundaryPatchType, + const wordList& boundaryPatchPhysicalTypes, + const bool syncPar +) +: + objectRegistry(io), + primitiveMesh(), + points_ + ( + IOobject + ( + "points", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + points + ), + faces_ + ( + IOobject + ( + "faces", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + owner_ + ( + IOobject + ( + "owner", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + neighbour_ + ( + IOobject + ( + "neighbour", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + clearedPrimitives_(false), + boundary_ + ( + IOobject + ( + "boundary", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + *this, + boundaryFaces.size() + 1 // add room for a default patch + ), + bounds_(points_, syncPar), + geometricD_(Vector<label>::zero), + solutionD_(Vector<label>::zero), + pointZones_ + ( + IOobject + ( + "pointZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + faceZones_ + ( + IOobject + ( + "faceZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + cellZones_ + ( + IOobject + ( + "cellZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + globalMeshDataPtr_(NULL), + moving_(false), + curMotionTimeIndex_(time().timeIndex()), + oldPointsPtr_(NULL) +{ + if (debug) + { + Info<<"Constructing polyMesh from cell and boundary shapes." << endl; + } + + // Remove all of the old mesh files if they exist + removeFiles(instance()); + + // Calculate faces and cells + labelList patchSizes; + labelList patchStarts; + label defaultPatchStart; + label nFaces; + cellList cells; + setTopology + ( + cellsAsShapes, + boundaryFaces, + boundaryPatchNames, + patchSizes, + patchStarts, + defaultPatchStart, + nFaces, + cells + ); + + // Warning: Patches can only be added once the face list is + // completed, as they hold a subList of the face list + forAll(boundaryFaces, patchI) + { + // add the patch to the list + boundary_.set + ( + patchI, + polyPatch::New + ( + boundaryPatchTypes[patchI], + boundaryPatchNames[patchI], + patchSizes[patchI], + patchStarts[patchI], + patchI, + boundary_ + ) + ); + + if + ( + boundaryPatchPhysicalTypes.size() + && boundaryPatchPhysicalTypes[patchI].size() + ) + { + boundary_[patchI].physicalType() = + boundaryPatchPhysicalTypes[patchI]; + } + } + + label nAllPatches = boundaryFaces.size(); + + if (nFaces > defaultPatchStart) + { + WarningIn("polyMesh::polyMesh(... construct from shapes...)") + << "Found " << nFaces - defaultPatchStart + << " undefined faces in mesh; adding to default patch." << endl; + + // Check if there already exists a defaultFaces patch as last patch + // and reuse it. + label patchI = findIndex(boundaryPatchNames, defaultBoundaryPatchName); + + if (patchI != -1) + { + if (patchI != boundaryFaces.size()-1 || boundary_[patchI].size()) + { + FatalErrorIn("polyMesh::polyMesh(... construct from shapes...)") + << "Default patch " << boundary_[patchI].name() + << " already has faces in it or is not" + << " last in list of patches." << exit(FatalError); + } + + WarningIn("polyMesh::polyMesh(... construct from shapes...)") + << "Reusing existing patch " << patchI + << " for undefined faces." << endl; + + boundary_.set + ( + patchI, + polyPatch::New + ( + boundaryPatchTypes[patchI], + boundaryPatchNames[patchI], + nFaces - defaultPatchStart, + defaultPatchStart, + patchI, + boundary_ + ) + ); + } + else + { + boundary_.set + ( + nAllPatches, + polyPatch::New + ( + defaultBoundaryPatchType, + defaultBoundaryPatchName, + nFaces - defaultPatchStart, + defaultPatchStart, + boundary_.size() - 1, + boundary_ + ) + ); + + nAllPatches++; + } + } + + // Reset the size of the boundary + boundary_.setSize(nAllPatches); + + // Set the primitive mesh + initMesh(cells); + + if (syncPar) + { + // Calculate topology for the patches (processor-processor comms etc.) + boundary_.updateMesh(); + + // Calculate the geometry for the patches (transformation tensors etc.) + boundary_.calcGeometry(); + } + + if (debug) + { + if (checkMesh()) + { + Info<< "Mesh OK" << endl; + } + } +} + + +Foam::polyMesh::polyMesh +( + const IOobject& io, + const Xfer<pointField>& points, + const cellShapeList& cellsAsShapes, + const faceListList& boundaryFaces, + const PtrList<dictionary>& boundaryDicts, + const word& defaultBoundaryPatchName, + const word& defaultBoundaryPatchType, + const bool syncPar +) +: + objectRegistry(io), + primitiveMesh(), + points_ + ( + IOobject + ( + "points", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + points + ), + faces_ + ( + IOobject + ( + "faces", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + owner_ + ( + IOobject + ( + "owner", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + neighbour_ + ( + IOobject + ( + "neighbour", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + 0 + ), + clearedPrimitives_(false), + boundary_ + ( + IOobject + ( + "boundary", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::AUTO_WRITE + ), + *this, + boundaryFaces.size() + 1 // add room for a default patch + ), + bounds_(points_, syncPar), + geometricD_(Vector<label>::zero), + solutionD_(Vector<label>::zero), + pointZones_ + ( + IOobject + ( + "pointZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + faceZones_ + ( + IOobject + ( + "faceZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + cellZones_ + ( + IOobject + ( + "cellZones", + instance(), + meshSubDir, + *this, + IOobject::NO_READ, + IOobject::NO_WRITE + ), + *this, + 0 + ), + globalMeshDataPtr_(NULL), + moving_(false), + curMotionTimeIndex_(time().timeIndex()), + oldPointsPtr_(NULL) +{ + if (debug) + { + Info<<"Constructing polyMesh from cell and boundary shapes." << endl; + } + + // Remove all of the old mesh files if they exist + removeFiles(instance()); + + wordList boundaryPatchNames(boundaryDicts.size()); + forAll(boundaryDicts, patchI) + { + boundaryDicts[patchI].lookup("name") >> boundaryPatchNames[patchI]; + } + + // Calculate faces and cells + labelList patchSizes; + labelList patchStarts; + label defaultPatchStart; + label nFaces; + cellList cells; + setTopology + ( + cellsAsShapes, + boundaryFaces, + boundaryPatchNames, + patchSizes, + patchStarts, + defaultPatchStart, + nFaces, + cells + ); + + // Warning: Patches can only be added once the face list is + // completed, as they hold a subList of the face list + forAll (boundaryFaces, patchI) + { + dictionary patchDict(boundaryDicts[patchI]); + + patchDict.set("nFaces", patchSizes[patchI]); + patchDict.set("startFace", patchStarts[patchI]); + + // add the patch to the list + boundary_.set + ( + patchI, + polyPatch::New + ( + boundaryPatchNames[patchI], + patchDict, + patchI, + boundary_ + ) + ); + } + + label nAllPatches = boundaryFaces.size(); + + if (nFaces > defaultPatchStart) + { + WarningIn("polyMesh::polyMesh(... construct from shapes...)") + << "Found " << nFaces - defaultPatchStart + << " undefined faces in mesh; adding to default patch." << endl; + + // Check if there already exists a defaultFaces patch as last patch + // and reuse it. + label patchI = findIndex(boundaryPatchNames, defaultBoundaryPatchName); + + if (patchI != -1) + { + if (patchI != boundaryFaces.size()-1 || boundary_[patchI].size()) + { + FatalErrorIn("polyMesh::polyMesh(... construct from shapes...)") + << "Default patch " << boundary_[patchI].name() + << " already has faces in it or is not" + << " last in list of patches." << exit(FatalError); + } + + WarningIn("polyMesh::polyMesh(... construct from shapes...)") + << "Reusing existing patch " << patchI + << " for undefined faces." << endl; + + boundary_.set + ( + patchI, + polyPatch::New + ( + boundary_[patchI].type(), + boundary_[patchI].name(), + nFaces - defaultPatchStart, + defaultPatchStart, + patchI, + boundary_ + ) + ); + } + else + { + boundary_.set + ( + nAllPatches, + polyPatch::New + ( + defaultBoundaryPatchType, + defaultBoundaryPatchName, + nFaces - defaultPatchStart, + defaultPatchStart, + boundary_.size() - 1, + boundary_ + ) + ); + + nAllPatches++; + } + } + + // Reset the size of the boundary + boundary_.setSize(nAllPatches); + + // Set the primitive mesh + initMesh(cells); + + if (syncPar) + { + // Calculate topology for the patches (processor-processor comms etc.) + boundary_.updateMesh(); + + // Calculate the geometry for the patches (transformation tensors etc.) + boundary_.calcGeometry(); + } + + if (debug) + { + if (checkMesh()) + { + Info << "Mesh OK" << endl; } } } diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.C index a18ec94f5cac5398c4dfe43d392eb753f97543ec..ea44ec07d1a20ac73c62647318ec67799ce2ee8e 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.C +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.C @@ -111,23 +111,6 @@ void Foam::coupledPolyPatch::writeOBJ } -Foam::pointField Foam::coupledPolyPatch::calcFaceCentres -( - const UList<face>& faces, - const pointField& points -) -{ - pointField ctrs(faces.size()); - - forAll(faces, faceI) - { - ctrs[faceI] = faces[faceI].centre(points); - } - - return ctrs; -} - - Foam::pointField Foam::coupledPolyPatch::getAnchorPoints ( const UList<face>& faces, @@ -145,43 +128,6 @@ Foam::pointField Foam::coupledPolyPatch::getAnchorPoints } -bool Foam::coupledPolyPatch::inPatch -( - const labelList& oldToNew, - const label oldFaceI -) const -{ - label faceI = oldToNew[oldFaceI]; - - return faceI >= start() && faceI < start()+size(); -} - - -Foam::label Foam::coupledPolyPatch::whichPatch -( - const labelList& patchStarts, - const label faceI -) -{ - forAll(patchStarts, patchI) - { - if (patchStarts[patchI] <= faceI) - { - if (patchI == patchStarts.size()-1) - { - return patchI; - } - else if (patchStarts[patchI+1] > faceI) - { - return patchI; - } - } - } - - return -1; -} - - Foam::scalarField Foam::coupledPolyPatch::calcFaceTol ( const UList<face>& faces, @@ -266,7 +212,8 @@ void Foam::coupledPolyPatch::calcTransformTensors Pout<< "coupledPolyPatch::calcTransformTensors : " << name() << endl << " (half)size:" << Cf.size() << nl << " absTol:" << absTol << nl - //<< " smallDist:" << smallDist << nl + << " smallDist min:" << min(smallDist) << nl + << " smallDist max:" << max(smallDist) << nl << " sum(mag(nf & nr)):" << sum(mag(nf & nr)) << endl; } @@ -278,7 +225,7 @@ void Foam::coupledPolyPatch::calcTransformTensors // Then the overall error of summing the normals is sqrt(size())*absTol // - separation calculation: pass in from the outside an allowable error. - if (size() == 0) + if (Cf.size() == 0) { // Dummy geometry. separation_.setSize(0); diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.H b/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.H index 423a94ccb7dbc6276120039c036ece0e938a7f4c..92fcdc821cf64655141edb6e2c15454bcfb8e1b1 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.H +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/basic/coupled/coupledPolyPatch.H @@ -38,6 +38,7 @@ SourceFiles #define coupledPolyPatch_H #include "polyPatch.H" +#include "diagTensorField.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -133,13 +134,6 @@ protected: label& vertI ); - //- Calculate face centres - static pointField calcFaceCentres - ( - const UList<face>&, - const pointField& - ); - //- Get f[0] for all faces static pointField getAnchorPoints ( @@ -147,21 +141,6 @@ protected: const pointField& ); - //- Is face (in old face labels) in current patch? - bool inPatch - ( - const labelList& oldToNew, - const label oldFaceI - ) const; - - //- Given list of starts of patches and a face label determine - // the patch. - static label whichPatch - ( - const labelList& patchStarts, - const label faceI - ); - //- Calculate typical tolerance per face. Is currently max distance // from face centre to any of the face vertices. static scalarField calcFaceTol @@ -248,45 +227,67 @@ public: return true; } + //- Does this side own the patch ? + virtual bool owner() const = 0; - //- Are the coupled planes separated - bool separated() const + //- Does the coupled side own the patch ? + virtual bool neighbour() const + { + return !owner(); + } + + //- Transform a patch-based position from other side to this side + virtual void transformPosition(pointField& l) const = 0; + + //- Are the planes separated. + virtual bool separated() const { return separation_.size(); } - //- Return the offset (distance) vector from one side of the couple - // to the other - const vectorField& separation() const + //- If the planes are separated the separation vector. + virtual const vectorField& separation() const { return separation_; } - //- Are the cyclic planes parallel - bool parallel() const + //- Are the cyclic planes parallel. + virtual bool parallel() const { return forwardT_.empty(); } - //- Return face transformation tensor - const tensorField& forwardT() const + //- Return face transformation tensor. + virtual const tensorField& forwardT() const { return forwardT_; } - //- Return neighbour-cell transformation tensor - const tensorField& reverseT() const + //- Return neighbour-cell transformation tensor. + virtual const tensorField& reverseT() const { return reverseT_; } //- Are faces collocated. Either size 0,1 or length of patch - const boolList& collocated() const + virtual const boolList& collocated() const { return collocated_; } + //- Calculate the patch geometry + virtual void calcGeometry + ( + const primitivePatch& referPatch, + const UList<point>& thisCtrs, + const UList<point>& thisAreas, + const UList<point>& thisCc, + const UList<point>& nbrCtrs, + const UList<point>& nbrAreas, + const UList<point>& nbrCc + ) = 0; + //- Initialize ordering for primitivePatch. Does not // refer to *this (except for name() and type() etc.) virtual void initOrder diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C index 1341d8083da274298d94d58457f0b31aaef489de..4348d321cfc7cccff5df8c7fc9128260a3037c47 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C @@ -33,7 +33,8 @@ License #include "matchPoints.H" #include "EdgeMap.H" #include "Time.H" -#include "transformList.H" +#include "diagTensor.H" +#include "transformField.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -88,38 +89,12 @@ void Foam::cyclicPolyPatch::calcTransforms() { if (size()) { - const pointField& points = this->points(); + // Half0 - // Determine geometric quantities on the two halves - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + const cyclicPolyPatch& half0 = *this; - primitivePatch half0 - ( - SubList<face> - ( - *this, - size()/2 - ), - points - ); - - pointField half0Ctrs(calcFaceCentres(half0, half0.points())); + const pointField& half0Ctrs = half0.faceCentres(); - scalarField half0Tols(calcFaceTol(half0, half0.points(), half0Ctrs)); - - primitivePatch half1 - ( - SubList<face> - ( - *this, - size()/2, - size()/2 - ), - points - ); - pointField half1Ctrs(calcFaceCentres(half1, half1.points())); - - // Dump halves if (debug) { fileName casePath(boundaryMesh().mesh().time().path()); @@ -128,6 +103,27 @@ void Foam::cyclicPolyPatch::calcTransforms() Pout<< "cyclicPolyPatch::calcTransforms : Writing half0" << " faces to OBJ file " << nm0 << endl; writeOBJ(nm0, half0, half0.points()); + } + + vectorField half0Areas(half0.size()); + + forAll(half0, facei) + { + half0Areas[facei] = half0[facei].normal(half0.points()); + } + + + + // Half0 + + const cyclicPolyPatch& half1 = neighbPatch(); + + const pointField& half1Ctrs = half1.faceCentres(); + + // Dump halves + if (debug) + { + fileName casePath(boundaryMesh().mesh().time().path()); fileName nm1(casePath/name()+"_half1_faces.obj"); Pout<< "cyclicPolyPatch::calcTransforms : Writing half1" @@ -151,17 +147,65 @@ void Foam::cyclicPolyPatch::calcTransforms() } } - vectorField half0Normals(half0.size()); - vectorField half1Normals(half1.size()); + vectorField half1Areas(half1.size()); - for (label facei = 0; facei < size()/2; facei++) + forAll(half1, facei) { - half0Normals[facei] = operator[](facei).normal(points); - label nbrFacei = facei+size()/2; - half1Normals[facei] = operator[](nbrFacei).normal(points); + half1Areas[facei] = half1[facei].normal(half1.points()); + } - scalar magSf = mag(half0Normals[facei]); - scalar nbrMagSf = mag(half1Normals[facei]); + calcTransforms + ( + half0, + half0Ctrs, + half0Areas, + half1Ctrs, + half1Areas + ); + } +} + + +void Foam::cyclicPolyPatch::calcTransforms +( + const primitivePatch& half0, + const UList<point>& half0Ctrs, + const UList<point>& half0Areas, + const UList<point>& half1Ctrs, + const UList<point>& half1Areas +) +{ + if (half0Ctrs.size() != half1Ctrs.size()) + { + FatalErrorIn + ( + "cyclicPolyPatch::calcTransforms()" + ) << "For patch " << name() + << " there are " << half0Ctrs.size() + << " face centres, for the neighbour patch " << neighbPatch().name() + << " there are " << half1Ctrs.size() + << exit(FatalError); + } + + if (half0Ctrs.size() > 0) + { + scalarField half0Tols + ( + calcFaceTol + ( + half0, + half0.points(), + static_cast<const pointField&>(half0Ctrs) + ) + ); + + vectorField half0Normals(half0Areas.size()); + vectorField half1Normals(half1Areas.size()); + + forAll(half0, facei) + { + scalar magSf = mag(half0Areas[facei]); + scalar nbrMagSf = mag(half1Areas[facei]); scalar avSf = (magSf + nbrMagSf)/2.0; if (magSf < ROOTVSMALL && nbrMagSf < ROOTVSMALL) @@ -177,8 +221,7 @@ void Foam::cyclicPolyPatch::calcTransforms() FatalErrorIn ( "cyclicPolyPatch::calcTransforms()" - ) << "face " << facei << " area does not match neighbour " - << nbrFacei << " by " + ) << "face " << facei << " area does not match neighbour by " << 100*mag(magSf - nbrMagSf)/avSf << "% -- possible face ordering problem." << endl << "patch:" << name() @@ -187,268 +230,29 @@ void Foam::cyclicPolyPatch::calcTransforms() << " matching tolerance:" << coupledPolyPatch::matchTol << endl << "Mesh face:" << start()+facei - << " vertices:" - << UIndirectList<point>(points, operator[](facei))() + << " fc:" << half0Ctrs[facei] << endl - << "Neighbour face:" << start()+nbrFacei - << " vertices:" - << UIndirectList<point>(points, operator[](nbrFacei))() + << "Neighbour fc:" << half1Ctrs[facei] << endl << "Rerun with cyclic debug flag set" << " for more information." << exit(FatalError); } else { - half0Normals[facei] /= magSf; - half1Normals[facei] /= nbrMagSf; + half0Normals[facei] = half0Areas[facei] / magSf; + half1Normals[facei] = half1Areas[facei] / nbrMagSf; } } - - // See if transformation is prescribed - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - - switch (transform_) - { - case ROTATIONAL: - { - // Specified single rotation tensor. - - // Get best fitting face and its opposite number - label face0 = getConsistentRotationFace(half0Ctrs); - label face1 = face0; - - vector n0 = - ( - (half0Ctrs[face0] - rotationCentre_) - ^ rotationAxis_ - ); - vector n1 = - ( - (half1Ctrs[face1] - rotationCentre_) - ^ -rotationAxis_ - ); - n0 /= mag(n0) + VSMALL; - n1 /= mag(n1) + VSMALL; - - if (debug) - { - Pout<< "cyclicPolyPatch::calcTransforms :" - << " Specified rotation :" - << " n0:" << n0 << " n1:" << n1 << endl; - } - - // Calculate transformation tensors from face0,1 only. - // Note: can use tight tolerance now. - calcTransformTensors - ( - pointField(1, half0Ctrs[face0]), - pointField(1, half1Ctrs[face1]), - vectorField(1, n0), - vectorField(1, n1), - scalarField(1, half0Tols[face0]), - 1E-4 - ); - - break; - } - - default: - { - // Calculate transformation tensors from all faces. - calcTransformTensors - ( - half0Ctrs, - half1Ctrs, - half0Normals, - half1Normals, - half0Tols - ); - - break; - } - } - } -} - - -// Get geometric zones of patch by looking at normals. -// Method 1: any edge with sharpish angle is edge between two halves. -// (this will handle e.g. wedge geometries). -// Also two fully disconnected regions will be handled this way. -// Method 2: sort faces into two halves based on face normal. -bool Foam::cyclicPolyPatch::getGeometricHalves -( - const primitivePatch& pp, - labelList& half0ToPatch, - labelList& half1ToPatch -) const -{ - // Calculate normals - const vectorField& faceNormals = pp.faceNormals(); - - // Find edges with sharp angles. - boolList regionEdge(pp.nEdges(), false); - - const labelListList& edgeFaces = pp.edgeFaces(); - - label nRegionEdges = 0; - - forAll(edgeFaces, edgeI) - { - const labelList& eFaces = edgeFaces[edgeI]; - - // Check manifold edges for sharp angle. - // (Non-manifold already handled by patchZones) - if (eFaces.size() == 2) - { - if ((faceNormals[eFaces[0]] & faceNormals[eFaces[1]])< featureCos_) - { - regionEdge[edgeI] = true; - - nRegionEdges++; - } - } - } - - - // For every face determine zone it is connected to (without crossing - // any regionEdge) - patchZones ppZones(pp, regionEdge); - - if (debug) - { - Pout<< "cyclicPolyPatch::getGeometricHalves : " - << "Found " << nRegionEdges << " edges on patch " << name() - << " where the cos of the angle between two connected faces" - << " was less than " << featureCos_ << nl - << "Patch divided by these and by single sides edges into " - << ppZones.nZones() << " parts." << endl; - - - // Dumping zones to obj files. - - labelList nZoneFaces(ppZones.nZones()); - - for (label zoneI = 0; zoneI < ppZones.nZones(); zoneI++) - { - OFstream stream - ( - boundaryMesh().mesh().time().path() - /name()+"_zone_"+Foam::name(zoneI)+".obj" - ); - Pout<< "cyclicPolyPatch::getGeometricHalves : Writing zone " - << zoneI << " face centres to OBJ file " << stream.name() - << endl; - - labelList zoneFaces(findIndices(ppZones, zoneI)); - - forAll(zoneFaces, i) - { - writeOBJ(stream, pp[zoneFaces[i]].centre(pp.points())); - } - - nZoneFaces[zoneI] = zoneFaces.size(); - } - } - - - if (ppZones.nZones() == 2) - { - half0ToPatch = findIndices(ppZones, 0); - half1ToPatch = findIndices(ppZones, 1); - } - else - { - if (debug) - { - Pout<< "cyclicPolyPatch::getGeometricHalves :" - << " falling back to face-normal comparison" << endl; - } - label n0Faces = 0; - half0ToPatch.setSize(pp.size()); - - label n1Faces = 0; - half1ToPatch.setSize(pp.size()); - - // Compare to face 0 normal. - forAll(faceNormals, faceI) - { - if ((faceNormals[faceI] & faceNormals[0]) > 0) - { - half0ToPatch[n0Faces++] = faceI; - } - else - { - half1ToPatch[n1Faces++] = faceI; - } - } - half0ToPatch.setSize(n0Faces); - half1ToPatch.setSize(n1Faces); - - if (debug) - { - Pout<< "cyclicPolyPatch::getGeometricHalves :" - << " Number of faces per zone:(" - << n0Faces << ' ' << n1Faces << ')' << endl; - } - } - - if (half0ToPatch.size() != half1ToPatch.size()) - { - fileName casePath(boundaryMesh().mesh().time().path()); - - // Dump halves - { - fileName nm0(casePath/name()+"_half0_faces.obj"); - Pout<< "cyclicPolyPatch::getGeometricHalves : Writing half0" - << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, UIndirectList<face>(pp, half0ToPatch)(), pp.points()); - - fileName nm1(casePath/name()+"_half1_faces.obj"); - Pout<< "cyclicPolyPatch::getGeometricHalves : Writing half1" - << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, UIndirectList<face>(pp, half1ToPatch)(), pp.points()); - } - - // Dump face centres - { - OFstream str0(casePath/name()+"_half0.obj"); - Pout<< "cyclicPolyPatch::getGeometricHalves : Writing half0" - << " face centres to OBJ file " << str0.name() << endl; - - forAll(half0ToPatch, i) - { - writeOBJ(str0, pp[half0ToPatch[i]].centre(pp.points())); - } - - OFstream str1(casePath/name()+"_half1.obj"); - Pout<< "cyclicPolyPatch::getGeometricHalves : Writing half1" - << " face centres to OBJ file " << str1.name() << endl; - forAll(half1ToPatch, i) - { - writeOBJ(str1, pp[half1ToPatch[i]].centre(pp.points())); - } - } - - SeriousErrorIn + // Calculate transformation tensors + calcTransformTensors ( - "cyclicPolyPatch::getGeometricHalves" - "(const primitivePatch&, labelList&, labelList&) const" - ) << "Patch " << name() << " gets decomposed in two zones of" - << "inequal size: " << half0ToPatch.size() - << " and " << half1ToPatch.size() << endl - << "This means that the patch is either not two separate regions" - << " or one region where the angle between the different regions" - << " is not sufficiently sharp." << endl - << "Please adapt the featureCos setting." << endl - << "Continuing with incorrect face ordering from now on!" << endl; - - return false; - } - else - { - return true; + static_cast<const pointField&>(half0Ctrs), + static_cast<const pointField&>(half1Ctrs), + half0Normals, + half1Normals, + half0Tols + ); } } @@ -458,11 +262,9 @@ bool Foam::cyclicPolyPatch::getGeometricHalves // right ones. void Foam::cyclicPolyPatch::getCentresAndAnchors ( - const primitivePatch& pp, - const faceList& half0Faces, - const faceList& half1Faces, + const primitivePatch& pp0, + const primitivePatch& pp1, - pointField& ppPoints, pointField& half0Ctrs, pointField& half1Ctrs, pointField& anchors0, @@ -470,9 +272,9 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors ) const { // Get geometric data on both halves. - half0Ctrs = calcFaceCentres(half0Faces, pp.points()); - anchors0 = getAnchorPoints(half0Faces, pp.points()); - half1Ctrs = calcFaceCentres(half1Faces, pp.points()); + half0Ctrs = pp0.faceCentres(); + anchors0 = getAnchorPoints(pp0, pp0.points()); + half1Ctrs = pp1.faceCentres(); switch (transform_) { @@ -503,8 +305,6 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors anchors0[faceI] = Foam::transform(reverseT, anchors0[faceI]); } - ppPoints = Foam::transform(reverseT, pp.points()); - break; } //- Problem: usually specified translation is not accurate enough @@ -531,12 +331,12 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors // Determine the face with max area on both halves. These // two faces are used to determine the transformation tensors - label max0I = findMaxArea(pp.points(), half0Faces); - vector n0 = half0Faces[max0I].normal(pp.points()); + label max0I = findMaxArea(pp0.points(), pp0); + vector n0 = pp0[max0I].normal(pp0.points()); n0 /= mag(n0) + VSMALL; - label max1I = findMaxArea(pp.points(), half1Faces); - vector n1 = half1Faces[max1I].normal(pp.points()); + label max1I = findMaxArea(pp1.points(), pp1); + vector n1 = pp1[max1I].normal(pp1.points()); n1 /= mag(n1) + VSMALL; if (mag(n0 & n1) < 1-coupledPolyPatch::matchTol) @@ -565,19 +365,13 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors anchors0[faceI] ); } - ppPoints = Foam::transform(reverseT, pp.points()); } else { // Parallel translation. Get average of all used points. - primitiveFacePatch half0(half0Faces, pp.points()); - const pointField& half0Pts = half0.localPoints(); - const point ctr0(sum(half0Pts)/half0Pts.size()); - - primitiveFacePatch half1(half1Faces, pp.points()); - const pointField& half1Pts = half1.localPoints(); - const point ctr1(sum(half1Pts)/half1Pts.size()); + const point ctr0(sum(pp0.localPoints())/pp0.nPoints()); + const point ctr1(sum(pp1.localPoints())/pp1.nPoints()); if (debug) { @@ -589,7 +383,6 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors half0Ctrs += ctr1 - ctr0; anchors0 += ctr1 - ctr0; - ppPoints = pp.points() + ctr1 - ctr0; } break; } @@ -597,92 +390,7 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors // Calculate typical distance per face - tols = calcFaceTol(half1Faces, pp.points(), half1Ctrs); -} - - -// Calculates faceMap and rotation. Returns true if all ok. -bool Foam::cyclicPolyPatch::matchAnchors -( - const bool report, - const primitivePatch& pp, - const labelList& half0ToPatch, - const pointField& anchors0, - - const labelList& half1ToPatch, - const faceList& half1Faces, - const labelList& from1To0, - - const scalarField& tols, - - labelList& faceMap, - labelList& rotation -) const -{ - // Set faceMap such that half0 faces get first and corresponding half1 - // faces last. - - forAll(half0ToPatch, half0FaceI) - { - // Label in original patch - label patchFaceI = half0ToPatch[half0FaceI]; - - faceMap[patchFaceI] = half0FaceI; - - // No rotation - rotation[patchFaceI] = 0; - } - - bool fullMatch = true; - - forAll(from1To0, half1FaceI) - { - label patchFaceI = half1ToPatch[half1FaceI]; - - // This face has to match the corresponding one on half0. - label half0FaceI = from1To0[half1FaceI]; - - label newFaceI = half0FaceI + pp.size()/2; - - faceMap[patchFaceI] = newFaceI; - - // Rotate patchFaceI such that its f[0] aligns with that of - // the corresponding face - // (which after shuffling will be at position half0FaceI) - - const point& wantedAnchor = anchors0[half0FaceI]; - - rotation[newFaceI] = getRotation - ( - pp.points(), - half1Faces[half1FaceI], - wantedAnchor, - tols[half1FaceI] - ); - - if (rotation[newFaceI] == -1) - { - fullMatch = false; - - if (report) - { - const face& f = half1Faces[half1FaceI]; - SeriousErrorIn - ( - "cyclicPolyPatch::matchAnchors(..)" - ) << "Patch:" << name() << " : " - << "Cannot find point on face " << f - << " with vertices:" - << UIndirectList<point>(pp.points(), f)() - << " that matches point " << wantedAnchor - << " when matching the halves of cyclic patch " << name() - << endl - << "Continuing with incorrect face ordering from now on!" - << endl; - } - } - } - return fullMatch; + tols = calcFaceTol(pp1, pp1.points(), half1Ctrs); } @@ -715,7 +423,7 @@ Foam::label Foam::cyclicPolyPatch::getConsistentRotationFace if (debug) { - Info<< "getConsistentRotationFace(const pointField&)" << nl + Pout<< "getConsistentRotationFace(const pointField&)" << nl << " rotFace = " << rotFace << nl << " point = " << faceCentres[rotFace] << endl; } @@ -736,14 +444,18 @@ Foam::cyclicPolyPatch::cyclicPolyPatch ) : coupledPolyPatch(name, size, start, index, bm), - coupledPointsPtr_(NULL), - coupledEdgesPtr_(NULL), - featureCos_(0.9), + neighbPatchName_(word::null), + neighbPatchID_(-1), transform_(UNKNOWN), rotationAxis_(vector::zero), rotationCentre_(point::zero), - separationVector_(vector::zero) -{} + separationVector_(vector::zero), + coupledPointsPtr_(NULL), + coupledEdgesPtr_(NULL) +{ + // Neighbour patch might not be valid yet so no transformation + // calculation possible. +} Foam::cyclicPolyPatch::cyclicPolyPatch @@ -755,15 +467,40 @@ Foam::cyclicPolyPatch::cyclicPolyPatch ) : coupledPolyPatch(name, dict, index, bm), - coupledPointsPtr_(NULL), - coupledEdgesPtr_(NULL), - featureCos_(0.9), + neighbPatchName_(dict.lookupOrDefault("neighbourPatch", word::null)), + neighbPatchID_(-1), transform_(UNKNOWN), rotationAxis_(vector::zero), rotationCentre_(point::zero), - separationVector_(vector::zero) + separationVector_(vector::zero), + coupledPointsPtr_(NULL), + coupledEdgesPtr_(NULL) { - dict.readIfPresent("featureCos", featureCos_); + if (neighbPatchName_ == word::null) + { + FatalIOErrorIn + ( + "cyclicPolyPatch::cyclicPolyPatch\n" + "(\n" + " const word& name,\n" + " const dictionary& dict,\n" + " const label index,\n" + " const polyBoundaryMesh& bm\n" + ")", + dict + ) << "No \"neighbourPatch\" provided." << endl + << "Is your mesh uptodate with split cyclics?" << endl + << "Run foamUpgradeCyclics to convert mesh and fields" + << " to split cyclics." << exit(FatalIOError); + } + + if (neighbPatchName_ == name) + { + FatalIOErrorIn("cyclicPolyPatch::cyclicPolyPatch(..)", dict) + << "Neighbour patch name " << neighbPatchName_ + << " cannot be the same as this patch " << name + << exit(FatalIOError); + } if (dict.found("transform")) { @@ -787,6 +524,9 @@ Foam::cyclicPolyPatch::cyclicPolyPatch } } } + + // Neighbour patch might not be valid yet so no transformation + // calculation possible. } @@ -797,14 +537,18 @@ Foam::cyclicPolyPatch::cyclicPolyPatch ) : coupledPolyPatch(pp, bm), - coupledPointsPtr_(NULL), - coupledEdgesPtr_(NULL), - featureCos_(pp.featureCos_), + neighbPatchName_(pp.neighbPatchName()), + neighbPatchID_(-1), transform_(pp.transform_), rotationAxis_(pp.rotationAxis_), rotationCentre_(pp.rotationCentre_), - separationVector_(pp.separationVector_) -{} + separationVector_(pp.separationVector_), + coupledPointsPtr_(NULL), + coupledEdgesPtr_(NULL) +{ + // Neighbour patch might not be valid yet so no transformation + // calculation possible. +} Foam::cyclicPolyPatch::cyclicPolyPatch @@ -813,18 +557,31 @@ Foam::cyclicPolyPatch::cyclicPolyPatch const polyBoundaryMesh& bm, const label index, const label newSize, - const label newStart + const label newStart, + const word& neighbPatchName ) : coupledPolyPatch(pp, bm, index, newSize, newStart), - coupledPointsPtr_(NULL), - coupledEdgesPtr_(NULL), - featureCos_(pp.featureCos_), + neighbPatchName_(neighbPatchName), + neighbPatchID_(-1), transform_(pp.transform_), rotationAxis_(pp.rotationAxis_), rotationCentre_(pp.rotationCentre_), - separationVector_(pp.separationVector_) -{} + separationVector_(pp.separationVector_), + coupledPointsPtr_(NULL), + coupledEdgesPtr_(NULL) +{ + if (neighbPatchName_ == name()) + { + FatalErrorIn("cyclicPolyPatch::cyclicPolyPatch(..)") + << "Neighbour patch name " << neighbPatchName_ + << " cannot be the same as this patch " << name() + << exit(FatalError); + } + + // Neighbour patch might not be valid yet so no transformation + // calculation possible. +} Foam::cyclicPolyPatch::cyclicPolyPatch @@ -837,13 +594,14 @@ Foam::cyclicPolyPatch::cyclicPolyPatch ) : coupledPolyPatch(pp, bm, index, mapAddressing, newStart), - coupledPointsPtr_(NULL), - coupledEdgesPtr_(NULL), - featureCos_(pp.featureCos_), + neighbPatchName_(pp.neighbPatchName_), + neighbPatchID_(-1), transform_(pp.transform_), rotationAxis_(pp.rotationAxis_), rotationCentre_(pp.rotationCentre_), - separationVector_(pp.separationVector_) + separationVector_(pp.separationVector_), + coupledPointsPtr_(NULL), + coupledEdgesPtr_(NULL) {} @@ -859,17 +617,72 @@ Foam::cyclicPolyPatch::~cyclicPolyPatch() // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // +void Foam::cyclicPolyPatch::transformPosition(pointField& l) const +{ + if (!parallel()) + { + Foam::transform(forwardT(), l); + } + else if (separated()) + { + l -= separation(); + } +} + + void Foam::cyclicPolyPatch::initGeometry(PstreamBuffers& pBufs) { polyPatch::initGeometry(pBufs); } + +void Foam::cyclicPolyPatch::initGeometry +( + const primitivePatch& referPatch, + UList<point>& nbrCtrs, + UList<point>& nbrAreas, + UList<point>& nbrCc +) +{} + + +void Foam::cyclicPolyPatch::calcGeometry +( + const primitivePatch& referPatch, + const UList<point>& thisCtrs, + const UList<point>& thisAreas, + const UList<point>& thisCc, + const UList<point>& nbrCtrs, + const UList<point>& nbrAreas, + const UList<point>& nbrCc +) +{ + calcTransforms + ( + referPatch, + thisCtrs, + thisAreas, + nbrCtrs, + nbrAreas + ); +} + + void Foam::cyclicPolyPatch::calcGeometry(PstreamBuffers& pBufs) { - polyPatch::calcGeometry(pBufs); - calcTransforms(); + calcGeometry + ( + *this, + faceCentres(), + faceAreas(), + faceCellCentres(), + neighbPatch().faceCentres(), + neighbPatch().faceAreas(), + neighbPatch().faceCellCentres() + ); } + void Foam::cyclicPolyPatch::initMovePoints ( PstreamBuffers& pBufs, @@ -906,17 +719,20 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledPoints() const { if (!coupledPointsPtr_) { - // Look at cyclic patch as two halves, A and B. - // Now all we know is that relative face index in halfA is same - // as coupled face in halfB and also that the 0th vertex + const faceList& nbrLocalFaces = neighbPatch().localFaces(); + const labelList& nbrMeshPoints = neighbPatch().meshPoints(); + + // Now all we know is that relative face index in *this is same + // as coupled face in nbrPatch and also that the 0th vertex // corresponds. - // From halfA point to halfB or -1. + // From local point to nbrPatch or -1. labelList coupledPoint(nPoints(), -1); - for (label patchFaceA = 0; patchFaceA < size()/2; patchFaceA++) + forAll(*this, patchFaceI) { - const face& fA = localFaces()[patchFaceA]; + const face& fA = localFaces()[patchFaceI]; + const face& fB = nbrLocalFaces[patchFaceI]; forAll(fA, indexA) { @@ -924,12 +740,10 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledPoints() const if (coupledPoint[patchPointA] == -1) { - const face& fB = localFaces()[patchFaceA + size()/2]; - label indexB = (fB.size() - indexA) % fB.size(); // Filter out points on wedge axis - if (patchPointA != fB[indexB]) + if (meshPoints()[patchPointA] != nbrMeshPoints[fB[indexB]]) { coupledPoint[patchPointA] = fB[indexB]; } @@ -958,7 +772,7 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledPoints() const OFstream str ( boundaryMesh().mesh().time().path() - /"coupledPoints.obj" + /name() + "_coupledPoints.obj" ); label vertI = 0; @@ -968,7 +782,7 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledPoints() const forAll(connected, i) { const point& a = points()[meshPoints()[connected[i][0]]]; - const point& b = points()[meshPoints()[connected[i][1]]]; + const point& b = points()[nbrMeshPoints[connected[i][1]]]; str<< "v " << a.x() << ' ' << a.y() << ' ' << a.z() << nl; str<< "v " << b.x() << ' ' << b.y() << ' ' << b.z() << nl; @@ -979,8 +793,20 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledPoints() const } // Remove any addressing calculated for the coupled edges calculation - const_cast<primitivePatch&>(static_cast<const primitivePatch&>(*this)) - .clearOut(); + const_cast<primitivePatch&> + ( + static_cast<const primitivePatch&> + ( + *this + ) + ).clearOut(); + const_cast<primitivePatch&> + ( + static_cast<const primitivePatch&> + ( + neighbPatch() + ) + ).clearOut(); } return *coupledPointsPtr_; } @@ -990,9 +816,9 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const { if (!coupledEdgesPtr_) { - // Build map from points on halfA to points on halfB. const edgeList& pointCouples = coupledPoints(); + // Build map from points on *this (A) to points on neighbourpatch (B) Map<label> aToB(2*pointCouples.size()); forAll(pointCouples, i) @@ -1002,12 +828,12 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const aToB.insert(e[0], e[1]); } - // Map from edge on half A to points (in halfB indices) + // Map from edge on A to points (in B indices) EdgeMap<label> edgeMap(nEdges()); - for (label patchFaceA = 0; patchFaceA < size()/2; patchFaceA++) + forAll(*this, patchFaceI) { - const labelList& fEdges = faceEdges()[patchFaceA]; + const labelList& fEdges = faceEdges()[patchFaceI]; forAll(fEdges, i) { @@ -1015,8 +841,7 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const const edge& e = edges()[edgeI]; - // Convert edge end points to corresponding points on halfB - // side. + // Convert edge end points to corresponding points on B side. Map<label>::const_iterator fnd0 = aToB.find(e[0]); if (fnd0 != aToB.end()) { @@ -1029,31 +854,44 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const } } - coupledEdgesPtr_ = new edgeList(nEdges()/2); + // Use the edgeMap to get the edges on the B side. + + const cyclicPolyPatch& neighbPatch = this->neighbPatch(); + const labelList& nbrMp = neighbPatch.meshPoints(); + const labelList& mp = meshPoints(); + + + + coupledEdgesPtr_ = new edgeList(edgeMap.size()); edgeList& coupledEdges = *coupledEdgesPtr_; label coupleI = 0; - for (label patchFaceB = size()/2; patchFaceB < size(); patchFaceB++) + forAll(neighbPatch, patchFaceI) { - const labelList& fEdges = faceEdges()[patchFaceB]; + const labelList& fEdges = neighbPatch.faceEdges()[patchFaceI]; forAll(fEdges, i) { label edgeI = fEdges[i]; - const edge& e = edges()[edgeI]; + const edge& e = neighbPatch.edges()[edgeI]; - // Look up halfA edge from HashTable. + // Look up A edge from HashTable. EdgeMap<label>::iterator iter = edgeMap.find(e); if (iter != edgeMap.end()) { - label halfAEdgeI = iter(); + label edgeA = iter(); + const edge& eA = edges()[edgeA]; // Store correspondence. Filter out edges on wedge axis. - if (halfAEdgeI != edgeI) + if + ( + edge(mp[eA[0]], mp[eA[1]]) + != edge(nbrMp[e[0]], nbrMp[e[1]]) + ) { - coupledEdges[coupleI++] = edge(halfAEdgeI, edgeI); + coupledEdges[coupleI++] = edge(edgeA, edgeI); } // Remove so we build unique list @@ -1070,7 +908,7 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const { const edge& e = coupledEdges[i]; - if (e[0] == e[1] || e[0] < 0 || e[1] < 0) + if (e[0] < 0 || e[1] < 0) { FatalErrorIn("cyclicPolyPatch::coupledEdges() const") << "Problem : at position " << i @@ -1084,7 +922,7 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const OFstream str ( boundaryMesh().mesh().time().path() - /"coupledEdges.obj" + /name() + "_coupledEdges.obj" ); label vertI = 0; @@ -1096,7 +934,10 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const const edge& e = coupledEdges[i]; const point& a = edges()[e[0]].centre(localPoints()); - const point& b = edges()[e[1]].centre(localPoints()); + const point& b = neighbPatch.edges()[e[1]].centre + ( + neighbPatch.localPoints() + ); str<< "v " << a.x() << ' ' << a.y() << ' ' << a.z() << nl; str<< "v " << b.x() << ' ' << b.y() << ' ' << b.z() << nl; @@ -1107,8 +948,20 @@ const Foam::edgeList& Foam::cyclicPolyPatch::coupledEdges() const } // Remove any addressing calculated for the coupled edges calculation - const_cast<primitivePatch&>(static_cast<const primitivePatch&>(*this)) - .clearOut(); + const_cast<primitivePatch&> + ( + static_cast<const primitivePatch&> + ( + *this + ) + ).clearOut(); + const_cast<primitivePatch&> + ( + static_cast<const primitivePatch&> + ( + neighbPatch + ) + ).clearOut(); } return *coupledEdgesPtr_; } @@ -1119,7 +972,21 @@ void Foam::cyclicPolyPatch::initOrder PstreamBuffers&, const primitivePatch& pp ) const -{} +{ + if (owner()) + { + // Save patch for use in non-owner side ordering. Equivalent to + // processorPolyPatch using OPstream. + ownerPatchPtr_.reset + ( + new primitivePatch + ( + pp, + pp.points() + ) + ); + } +} // Return new ordering. Ordering is -faceMap: for every face index @@ -1140,148 +1007,36 @@ bool Foam::cyclicPolyPatch::order rotation.setSize(pp.size()); rotation = 0; - if (pp.empty()) + if (pp.empty() || transform_ == NOORDERING) { // No faces, nothing to change. return false; } - if (pp.size()&1) + if (owner()) { - FatalErrorIn("cyclicPolyPatch::order(..)") - << "Size of cyclic " << name() << " should be a multiple of 2" - << ". It is " << pp.size() << abort(FatalError); - } - - if (transform_ == NOORDERING) - { - if (debug) + // Do nothing (i.e. identical mapping, zero rotation). + // See comment at top. + forAll(faceMap, patchFaceI) { - Pout<< "cyclicPolyPatch::order : noOrdering mode." << endl; + faceMap[patchFaceI] = patchFaceI; } - return false; - } - - - label halfSize = pp.size()/2; - - // Supplied primitivePatch already with new points. - // Cyclics are limited to one transformation tensor - // currently anyway (i.e. straight plane) so should not be too big a - // problem. - - - // Indices of faces on half0 - labelList half0ToPatch; - // Indices of faces on half1 - labelList half1ToPatch; - - - // 1. Test if already correctly oriented by starting from trivial ordering. - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - - half0ToPatch = identity(halfSize); - half1ToPatch = half0ToPatch + halfSize; - - // Get faces - faceList half0Faces(UIndirectList<face>(pp, half0ToPatch)); - faceList half1Faces(UIndirectList<face>(pp, half1ToPatch)); - - // Get geometric quantities - pointField half0Ctrs, half1Ctrs, anchors0, ppPoints; - scalarField tols; - getCentresAndAnchors - ( - pp, - half0Faces, - half1Faces, - - ppPoints, - half0Ctrs, - half1Ctrs, - anchors0, - tols - ); - - // Geometric match of face centre vectors - labelList from1To0; - bool matchedAll = matchPoints - ( - half1Ctrs, - half0Ctrs, - tols, - false, - from1To0 - ); - - if (debug) - { - Pout<< "cyclicPolyPatch::order : test if already ordered:" - << matchedAll << endl; - - // Dump halves - fileName nm0("match1_"+name()+"_half0_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half0" - << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, half0Faces, ppPoints); - - fileName nm1("match1_"+name()+"_half1_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half1" - << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, half1Faces, pp.points()); - - OFstream ccStr - ( - boundaryMesh().mesh().time().path() - /"match1_"+ name() + "_faceCentres.obj" - ); - Pout<< "cyclicPolyPatch::order : " - << "Dumping currently found cyclic match as lines between" - << " corresponding face centres to file " << ccStr.name() - << endl; - // Recalculate untransformed face centres - //pointField rawHalf0Ctrs = calcFaceCentres(half0Faces, pp.points()); - label vertI = 0; - - forAll(half1Ctrs, i) - { - //if (from1To0[i] != -1) - { - // Write edge between c1 and c0 - //const point& c0 = rawHalf0Ctrs[from1To0[i]]; - //const point& c0 = half0Ctrs[from1To0[i]]; - const point& c0 = half0Ctrs[i]; - const point& c1 = half1Ctrs[i]; - writeOBJ(ccStr, c0, c1, vertI); - } - } + return false; } - - - // 2. Ordered in pairs (so 0,1 coupled and 2,3 etc.) - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - - if (!matchedAll) + else { - label faceI = 0; - for (label i = 0; i < halfSize; i++) - { - half0ToPatch[i] = faceI++; - half1ToPatch[i] = faceI++; - } - - // And redo all matching - half0Faces = UIndirectList<face>(pp, half0ToPatch); - half1Faces = UIndirectList<face>(pp, half1ToPatch); + // Get stored geometry from initOrder invocation of owner. + const primitivePatch& pp0 = neighbPatch().ownerPatchPtr_(); + // Get geometric quantities + pointField half0Ctrs, half1Ctrs, anchors0; + scalarField tols; getCentresAndAnchors ( + pp0, pp, - half0Faces, - half1Faces, - ppPoints, half0Ctrs, half1Ctrs, anchors0, @@ -1289,34 +1044,40 @@ bool Foam::cyclicPolyPatch::order ); // Geometric match of face centre vectors - matchedAll = matchPoints + bool matchedAll = matchPoints ( half1Ctrs, half0Ctrs, tols, - false, - from1To0 + true, + faceMap ); - if (debug) + if (!matchedAll || debug) { - Pout<< "cyclicPolyPatch::order : test if pairwise ordered:" - << matchedAll << endl; // Dump halves - fileName nm0("match2_"+name()+"_half0_faces.obj"); + fileName nm0 + ( + boundaryMesh().mesh().time().path() + /name()+"_half0_faces.obj" + ); Pout<< "cyclicPolyPatch::order : Writing half0" << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, half0Faces, ppPoints); + writeOBJ(nm0, pp0, pp0.points()); - fileName nm1("match2_"+name()+"_half1_faces.obj"); + fileName nm1 + ( + boundaryMesh().mesh().time().path() + /name()+"_half1_faces.obj" + ); Pout<< "cyclicPolyPatch::order : Writing half1" << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, half1Faces, pp.points()); + writeOBJ(nm1, pp, pp.points()); OFstream ccStr ( boundaryMesh().mesh().time().path() - /"match2_"+name()+"_faceCentres.obj" + /name() + "_faceCentres.obj" ); Pout<< "cyclicPolyPatch::order : " << "Dumping currently found cyclic match as lines between" @@ -1330,312 +1091,95 @@ bool Foam::cyclicPolyPatch::order forAll(half1Ctrs, i) { - if (from1To0[i] != -1) + if (faceMap[i] != -1) { // Write edge between c1 and c0 - //const point& c0 = rawHalf0Ctrs[from1To0[i]]; - const point& c0 = half0Ctrs[from1To0[i]]; + const point& c0 = half0Ctrs[faceMap[i]]; const point& c1 = half1Ctrs[i]; writeOBJ(ccStr, c0, c1, vertI); } } } - } - - - // 3. Baffles(coincident faces) converted into cyclics (e.g. jump) - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - - if (!matchedAll) - { - label baffleI = 0; - - forAll(pp, faceI) - { - const face& f = pp.localFaces()[faceI]; - const labelList& pFaces = pp.pointFaces()[f[0]]; - - label matchedFaceI = -1; - - forAll(pFaces, i) - { - label otherFaceI = pFaces[i]; - - if (otherFaceI > faceI) - { - const face& otherF = pp.localFaces()[otherFaceI]; - - // Note: might pick up two similar oriented faces - // (but that is illegal anyway) - if (f == otherF) - { - matchedFaceI = otherFaceI; - break; - } - } - } - - if (matchedFaceI != -1) - { - half0ToPatch[baffleI] = faceI; - half1ToPatch[baffleI] = matchedFaceI; - baffleI++; - } - } - if (baffleI == halfSize) + if (!matchedAll) { - // And redo all matching - half0Faces = UIndirectList<face>(pp, half0ToPatch); - half1Faces = UIndirectList<face>(pp, half1ToPatch); - - getCentresAndAnchors - ( - pp, - half0Faces, - half1Faces, - - ppPoints, - half0Ctrs, - half1Ctrs, - anchors0, - tols - ); - - // Geometric match of face centre vectors - matchedAll = matchPoints + SeriousErrorIn ( - half1Ctrs, - half0Ctrs, - tols, - false, - from1To0 - ); - - if (debug) - { - Pout<< "cyclicPolyPatch::order : test if baffles:" - << matchedAll << endl; - // Dump halves - fileName nm0("match3_"+name()+"_half0_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half0" - << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, half0Faces, ppPoints); - - fileName nm1("match3_"+name()+"_half1_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half1" - << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, half1Faces, pp.points()); - - OFstream ccStr - ( - boundaryMesh().mesh().time().path() - /"match3_"+ name() + "_faceCentres.obj" - ); - Pout<< "cyclicPolyPatch::order : " - << "Dumping currently found cyclic match as lines between" - << " corresponding face centres to file " << ccStr.name() - << endl; - - // Recalculate untransformed face centres - //pointField rawHalf0Ctrs = - // calcFaceCentres(half0Faces, pp.points()); - label vertI = 0; + "cyclicPolyPatch::order" + "(const primitivePatch&, labelList&, labelList&) const" + ) << "Patch:" << name() << " : " + << "Cannot match vectors to faces on both sides of patch" + << endl + << " Perhaps your faces do not match?" + << " The obj files written contain the current match." << endl + << " Continuing with incorrect face ordering from now on!" + << endl; - forAll(half1Ctrs, i) - { - if (from1To0[i] != -1) - { - // Write edge between c1 and c0 - //const point& c0 = rawHalf0Ctrs[from1To0[i]]; - const point& c0 = half0Ctrs[from1To0[i]]; - const point& c1 = half1Ctrs[i]; - writeOBJ(ccStr, c0, c1, vertI); - } - } - } + return false; } - } - - // 4. Automatic geometric ordering - // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - if (!matchedAll) - { - // Split faces according to feature angle or topology - bool okSplit = getGeometricHalves(pp, half0ToPatch, half1ToPatch); - - if (!okSplit) + // Set rotation. + forAll(faceMap, oldFaceI) { - // Did not split into two equal parts. - return false; - } - - // And redo all matching - half0Faces = UIndirectList<face>(pp, half0ToPatch); - half1Faces = UIndirectList<face>(pp, half1ToPatch); - - getCentresAndAnchors - ( - pp, - half0Faces, - half1Faces, - - ppPoints, - half0Ctrs, - half1Ctrs, - anchors0, - tols - ); - - // Geometric match of face centre vectors - matchedAll = matchPoints - ( - half1Ctrs, - half0Ctrs, - tols, - false, - from1To0 - ); + // The face f will be at newFaceI (after morphing) and we want its + // anchorPoint (= f[0]) to align with the anchorpoint for the + // corresponding face on the other side. - if (debug) - { - Pout<< "cyclicPolyPatch::order : automatic ordering result:" - << matchedAll << endl; - // Dump halves - fileName nm0("match4_"+name()+"_half0_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half0" - << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, half0Faces, ppPoints); + label newFaceI = faceMap[oldFaceI]; - fileName nm1("match4_"+name()+"_half1_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half1" - << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, half1Faces, pp.points()); + const point& wantedAnchor = anchors0[newFaceI]; - OFstream ccStr + rotation[newFaceI] = getRotation ( - boundaryMesh().mesh().time().path() - /"match4_"+ name() + "_faceCentres.obj" + pp.points(), + pp[oldFaceI], + wantedAnchor, + tols[oldFaceI] ); - Pout<< "cyclicPolyPatch::order : " - << "Dumping currently found cyclic match as lines between" - << " corresponding face centres to file " << ccStr.name() - << endl; - - // Recalculate untransformed face centres - //pointField rawHalf0Ctrs = - // calcFaceCentres(half0Faces, pp.points()); - label vertI = 0; - forAll(half1Ctrs, i) + if (rotation[newFaceI] == -1) { - if (from1To0[i] != -1) - { - // Write edge between c1 and c0 - //const point& c0 = rawHalf0Ctrs[from1To0[i]]; - const point& c0 = half0Ctrs[from1To0[i]]; - const point& c1 = half1Ctrs[i]; - writeOBJ(ccStr, c0, c1, vertI); - } + SeriousErrorIn + ( + "cyclicPolyPatch::order(const primitivePatch&" + ", labelList&, labelList&) const" + ) << "in patch " << name() + << " : " + << "Cannot find point on face " << pp[oldFaceI] + << " with vertices " + << IndirectList<point>(pp.points(), pp[oldFaceI])() + << " that matches point " << wantedAnchor + << " when matching the halves of processor patch " << name() + << "Continuing with incorrect face ordering from now on!" + << endl; + + return false; } } - } + ownerPatchPtr_.clear(); - if (!matchedAll || debug) - { - // Dump halves - fileName nm0(name()+"_half0_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half0" - << " faces to OBJ file " << nm0 << endl; - writeOBJ(nm0, half0Faces, pp.points()); + // Return false if no change neccesary, true otherwise. - fileName nm1(name()+"_half1_faces.obj"); - Pout<< "cyclicPolyPatch::order : Writing half1" - << " faces to OBJ file " << nm1 << endl; - writeOBJ(nm1, half1Faces, pp.points()); - - OFstream ccStr - ( - boundaryMesh().mesh().time().path() - /name() + "_faceCentres.obj" - ); - Pout<< "cyclicPolyPatch::order : " - << "Dumping currently found cyclic match as lines between" - << " corresponding face centres to file " << ccStr.name() - << endl; - - // Recalculate untransformed face centres - //pointField rawHalf0Ctrs = calcFaceCentres(half0Faces, pp.points()); - label vertI = 0; - - forAll(half1Ctrs, i) + forAll(faceMap, faceI) { - if (from1To0[i] != -1) + if (faceMap[faceI] != faceI || rotation[faceI] != 0) { - // Write edge between c1 and c0 - //const point& c0 = rawHalf0Ctrs[from1To0[i]]; - const point& c0 = half0Ctrs[from1To0[i]]; - const point& c1 = half1Ctrs[i]; - writeOBJ(ccStr, c0, c1, vertI); + return true; } } - } - - if (!matchedAll) - { - SeriousErrorIn - ( - "cyclicPolyPatch::order" - "(const primitivePatch&, labelList&, labelList&) const" - ) << "Patch:" << name() << " : " - << "Cannot match vectors to faces on both sides of patch" << endl - << " Perhaps your faces do not match?" - << " The obj files written contain the current match." << endl - << " Continuing with incorrect face ordering from now on!" - << endl; - - return false; - } - - - // Set faceMap such that half0 faces get first and corresponding half1 - // faces last. - matchAnchors - ( - true, // report if anchor matching error - pp, - half0ToPatch, - anchors0, - half1ToPatch, - half1Faces, - from1To0, - tols, - faceMap, - rotation - ); - - // Return false if no change neccesary, true otherwise. - - forAll(faceMap, faceI) - { - if (faceMap[faceI] != faceI || rotation[faceI] != 0) - { - return true; - } + return false; } - - return false; } void Foam::cyclicPolyPatch::write(Ostream& os) const { polyPatch::write(os); - os.writeKeyword("featureCos") << featureCos_ << token::END_STATEMENT << nl; + os.writeKeyword("neighbourPatch") << neighbPatchName_ + << token::END_STATEMENT << nl; switch (transform_) { case ROTATIONAL: diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.H b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.H index f8ae312f20e08a1373c2d76a6b3922ea1ea0822f..324a9f90d6e0d3ef5171bda279179655b601bfef 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.H +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.H @@ -29,11 +29,10 @@ Description Note: morph patch face ordering uses geometric matching so with the following restrictions: - -halves should be flat planes. + -coupled patches should be flat planes. -no rotation in patch plane - Uses a featureCos to find the two halves (or should be fully - disconnected). Uses coupledPolyPatch::calcFaceTol to calculate + Uses coupledPolyPatch::calcFaceTol to calculate tolerance per face which might need tweaking. Switch on 'cyclicPolyPatch' debug flag to write .obj files to show @@ -48,10 +47,9 @@ SourceFiles #define cyclicPolyPatch_H #include "coupledPolyPatch.H" -#include "SubField.H" -#include "FixedList.H" #include "edgeList.H" -#include "transform.H" +#include "polyBoundaryMesh.H" +#include "diagTensorField.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -82,18 +80,11 @@ private: // Private data - //- List of edges formed from connected points. e[0] is the point on - // the first half of the patch, e[1] the corresponding point on the - // second half. - mutable edgeList* coupledPointsPtr_; - - //- List of connected edges. e[0] is the edge on the first half of the - // patch, e[1] the corresponding edge on the second half. - mutable edgeList* coupledEdgesPtr_; + //- Name of other half + const word neighbPatchName_; - //- Morph:angle between normals of neighbouring faces. - // Used to split cyclic into halves. - scalar featureCos_; + //- Index of other half + mutable label neighbPatchID_; //- Type of transformation - rotational or translational transformType transform_; @@ -112,60 +103,50 @@ private: vector separationVector_; + //- List of edges formed from connected points. e[0] is the point on + // the first half of the patch, e[1] the corresponding point on the + // second half. + mutable edgeList* coupledPointsPtr_; + + //- List of connected edges. e[0] is the edge on the first half of the + // patch, e[1] the corresponding edge on the second half. + mutable edgeList* coupledEdgesPtr_; + + //- Temporary storage of owner side patch during ordering. + mutable autoPtr<primitivePatch> ownerPatchPtr_; + + // Private Member Functions //- Find amongst selected faces the one with the largest area static label findMaxArea(const pointField&, const faceList&); + void calcTransforms + ( + const primitivePatch& half0, + const UList<point>& half0Ctrs, + const UList<point>& half0Areas, + const UList<point>& half1Ctrs, + const UList<point>& half1Areas + ); // Face ordering - //- Find the two parts of the faces of pp using feature edges. - // Returns true if successfull. - bool getGeometricHalves - ( - const primitivePatch&, - labelList&, - labelList& - ) const; - //- Calculate geometric factors of the two halves. void getCentresAndAnchors ( - const primitivePatch&, - const faceList& half0Faces, - const faceList& half1Faces, + const primitivePatch& pp0, + const primitivePatch& pp1, - pointField& ppPoints, pointField& half0Ctrs, pointField& half1Ctrs, pointField& anchors0, scalarField& tols ) const; - //- Given matched faces matches the anchor point. Sets faceMap, - // rotation. Returns true if all matched. - bool matchAnchors - ( - const bool report, - const primitivePatch&, - const labelList&, - const pointField&, - const labelList&, - const faceList&, - const labelList&, - const scalarField&, - - labelList& faceMap, - labelList& rotation - ) const; - //- For rotational cases, try to find a unique face on each side // of the cyclic. - label getConsistentRotationFace - ( - const pointField& faceCentres - ) const; + label getConsistentRotationFace(const pointField&) const; protected: @@ -178,9 +159,30 @@ protected: //- Initialise the calculation of the patch geometry virtual void initGeometry(PstreamBuffers&); + //- Initialise the calculation of the patch geometry + virtual void initGeometry + ( + const primitivePatch& referPatch, + UList<point>& nbrCtrs, + UList<point>& nbrAreas, + UList<point>& nbrCc + ); + //- Calculate the patch geometry virtual void calcGeometry(PstreamBuffers&); + //- Calculate the patch geometry + virtual void calcGeometry + ( + const primitivePatch& referPatch, + const UList<point>& thisCtrs, + const UList<point>& thisAreas, + const UList<point>& thisCc, + const UList<point>& nbrCtrs, + const UList<point>& nbrAreas, + const UList<point>& nbrCc + ); + //- Initialise the patches for moving points virtual void initMovePoints(PstreamBuffers&, const pointField&); @@ -231,7 +233,8 @@ public: const polyBoundaryMesh& bm, const label index, const label newSize, - const label newStart + const label newStart, + const word& neighbPatchName ); //- Construct given the original patch and a map @@ -262,7 +265,15 @@ public: { return autoPtr<polyPatch> ( - new cyclicPolyPatch(*this, bm, index, newSize, newStart) + new cyclicPolyPatch + ( + *this, + bm, + index, + newSize, + newStart, + neighbPatchName_ + ) ); } @@ -289,103 +300,107 @@ public: // Member Functions - //- Return connected points (in patch local point indexing). Demand - // driven calculation. Does primitivePatch::clearOut after calculation! - const edgeList& coupledPoints() const; - - //- Return connected edges (in patch local edge indexing). Demand - // driven calculation. Does primitivePatch::clearOut after calculation! - const edgeList& coupledEdges() const; - - - - // Transformation + const word& neighbPatchName() const + { + return neighbPatchName_; + } - vector separation(const label facei) const + //- Neighbour patchID. + virtual label neighbPatchID() const + { + if (neighbPatchID_ == -1) { - if (facei < size()/2) + neighbPatchID_ = this->boundaryMesh().findPatchID + ( + neighbPatchName_ + ); + if (neighbPatchID_ == -1) { - return coupledPolyPatch::separation()[0]; - } - else - { - return -coupledPolyPatch::separation()[0]; + FatalErrorIn("cyclicPolyPatch::neighbPatchID() const") + << "Illegal neighbourPatch name " << neighbPatchName_ + << endl << "Valid patch names are " + << this->boundaryMesh().names() + << exit(FatalError); } } + return neighbPatchID_; + } - const tensor& transformT(const label facei) const - { - if (facei < size()/2) - { - return reverseT()[0]; - } - else - { - return forwardT()[0]; - } - } + virtual bool owner() const + { + return index() < neighbPatchID(); + } - template<class T> - T transform(const T& t, const label facei) const - { - if (parallel()) - { - return t; - } - else - { - return Foam::transform(transformT(facei), t); - } - } + virtual bool neighbour() const + { + return !owner(); + } - label transformLocalFace(const label facei) const - { - if (facei < size()/2) - { - return facei + size()/2; - } - else - { - return facei - size()/2; - } - } + const cyclicPolyPatch& neighbPatch() const + { + const polyPatch& pp = this->boundaryMesh()[neighbPatchID()]; + return refCast<const cyclicPolyPatch>(pp); + } - label transformGlobalFace(const label facei) const - { - if (facei - start() < size()/2) - { - return facei + size()/2; - } - else - { - return facei - size()/2; - } - } + //- Return connected points (from patch local to neighbour patch local) + // Demand driven calculation. Does primitivePatch::clearOut after + // calculation! + const edgeList& coupledPoints() const; - //- Type of transform - transformType transform() const - { - return transform_; - } + //- Return connected edges (from patch local to neighbour patch local). + // Demand driven calculation. Does primitivePatch::clearOut after + // calculation! + const edgeList& coupledEdges() const; - //- Axis of rotation for rotational cyclics - const vector& rotationAxis() const - { - return rotationAxis_; - } + //- Transform a patch-based position from other side to this side + virtual void transformPosition(pointField& l) const; - //- point on axis of rotation for rotational cyclics - const point& rotationCentre() const + + // Transformation + + label transformGlobalFace(const label facei) const + { + label offset = facei-start(); + label neighbStart = neighbPatch().start(); + + if (offset >= 0 && offset < size()) { - return rotationCentre_; + return neighbStart+offset; } - - //- Translation vector for translational cyclics - const vector& separationVector() const + else { - return separationVector_; + FatalErrorIn + ( + "cyclicPolyPatch::transformGlobalFace(const label) const" + ) << "Face " << facei << " not in patch " << name() + << exit(FatalError); + return -1; } + } + //- Type of transform + transformType transform() const + { + return transform_; + } + + //- Axis of rotation for rotational cyclics + const vector& rotationAxis() const + { + return rotationAxis_; + } + + //- point on axis of rotation for rotational cyclics + const point& rotationCentre() const + { + return rotationCentre_; + } + + //- Translation vector for translational cyclics + const vector& separationVector() const + { + return separationVector_; + } //- Initialize ordering for primitivePatch. Does not diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.C index f2b5c4b09525433c1e425f740033c61598866147..277a274b91087d2396e4f2d5033571d6c707e569 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.C +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.C @@ -62,9 +62,9 @@ Foam::processorPolyPatch::processorPolyPatch neighbProcNo_(neighbProcNo), neighbFaceCentres_(), neighbFaceAreas_(), - neighbFaceCellCentres_(), - neighbPointsPtr_(NULL), - neighbEdgesPtr_(NULL) + neighbFaceCellCentres_() +// neighbPointsPtr_(NULL), +// neighbEdgesPtr_(NULL) {} @@ -81,9 +81,9 @@ Foam::processorPolyPatch::processorPolyPatch neighbProcNo_(readLabel(dict.lookup("neighbProcNo"))), neighbFaceCentres_(), neighbFaceAreas_(), - neighbFaceCellCentres_(), - neighbPointsPtr_(NULL), - neighbEdgesPtr_(NULL) + neighbFaceCellCentres_() +// neighbPointsPtr_(NULL), +// neighbEdgesPtr_(NULL) {} @@ -98,9 +98,9 @@ Foam::processorPolyPatch::processorPolyPatch neighbProcNo_(pp.neighbProcNo_), neighbFaceCentres_(), neighbFaceAreas_(), - neighbFaceCellCentres_(), - neighbPointsPtr_(NULL), - neighbEdgesPtr_(NULL) + neighbFaceCellCentres_() +// neighbPointsPtr_(NULL), +// neighbEdgesPtr_(NULL) {} @@ -118,9 +118,9 @@ Foam::processorPolyPatch::processorPolyPatch neighbProcNo_(pp.neighbProcNo_), neighbFaceCentres_(), neighbFaceAreas_(), - neighbFaceCellCentres_(), - neighbPointsPtr_(NULL), - neighbEdgesPtr_(NULL) + neighbFaceCellCentres_() +// neighbPointsPtr_(NULL), +// neighbEdgesPtr_(NULL) {} @@ -129,7 +129,7 @@ Foam::processorPolyPatch::processorPolyPatch const processorPolyPatch& pp, const polyBoundaryMesh& bm, const label index, - const unallocLabelList& mapAddressing, + const unallocLabelList& mapAddressing, const label newStart ) : @@ -138,9 +138,9 @@ Foam::processorPolyPatch::processorPolyPatch neighbProcNo_(pp.neighbProcNo_), neighbFaceCentres_(), neighbFaceAreas_(), - neighbFaceCellCentres_(), - neighbPointsPtr_(NULL), - neighbEdgesPtr_(NULL) + neighbFaceCellCentres_() +// neighbPointsPtr_(NULL), +// neighbEdgesPtr_(NULL) {} @@ -148,8 +148,8 @@ Foam::processorPolyPatch::processorPolyPatch Foam::processorPolyPatch::~processorPolyPatch() { - deleteDemandDrivenData(neighbPointsPtr_); - deleteDemandDrivenData(neighbEdgesPtr_); + neighbPointsPtr_.clear(); + neighbEdgesPtr_.clear(); } @@ -157,6 +157,7 @@ Foam::processorPolyPatch::~processorPolyPatch() void Foam::processorPolyPatch::initGeometry(PstreamBuffers& pBufs) { +//Pout<< "**processorPolyPatch::initGeometry()" << endl; if (Pstream::parRun()) { UOPstream toNeighbProc(neighbProcNo(), pBufs); @@ -171,6 +172,7 @@ void Foam::processorPolyPatch::initGeometry(PstreamBuffers& pBufs) void Foam::processorPolyPatch::calcGeometry(PstreamBuffers& pBufs) { +//Pout<< "processorPolyPatch::calcGeometry() for " << name() << endl; if (Pstream::parRun()) { { @@ -182,6 +184,9 @@ void Foam::processorPolyPatch::calcGeometry(PstreamBuffers& pBufs) >> neighbFaceCellCentres_; } +//Pout<< "processorPolyPatch::calcGeometry() : received data for " +// << neighbFaceCentres_.size() << " faces." << endl; + // My normals vectorField faceNormals(size()); @@ -247,6 +252,9 @@ void Foam::processorPolyPatch::calcGeometry(PstreamBuffers& pBufs) nbrFaceNormals, calcFaceTol(*this, points(), faceCentres()) ); +//Pout<< "**neighbFaceCentres_:" << neighbFaceCentres_ << endl; +//Pout<< "**neighbFaceAreas_:" << neighbFaceAreas_ << endl; +//Pout<< "**neighbFaceCellCentres_:" << neighbFaceCellCentres_ << endl; } } @@ -276,9 +284,6 @@ void Foam::processorPolyPatch::initUpdateMesh(PstreamBuffers& pBufs) { polyPatch::initUpdateMesh(pBufs); - deleteDemandDrivenData(neighbPointsPtr_); - deleteDemandDrivenData(neighbEdgesPtr_); - if (Pstream::parRun()) { // Express all points as patch face and index in face. @@ -327,6 +332,9 @@ void Foam::processorPolyPatch::updateMesh(PstreamBuffers& pBufs) // For completeness polyPatch::updateMesh(pBufs); + neighbPointsPtr_.clear(); + neighbEdgesPtr_.clear(); + if (Pstream::parRun()) { labelList nbrPointFace; @@ -352,8 +360,8 @@ void Foam::processorPolyPatch::updateMesh(PstreamBuffers& pBufs) // Convert points. // ~~~~~~~~~~~~~~~ - neighbPointsPtr_ = new labelList(nPoints(), -1); - labelList& neighbPoints = *neighbPointsPtr_; + neighbPointsPtr_.reset(new labelList(nPoints(), -1)); + labelList& neighbPoints = neighbPointsPtr_(); forAll(nbrPointFace, nbrPointI) { @@ -386,8 +394,8 @@ void Foam::processorPolyPatch::updateMesh(PstreamBuffers& pBufs) // Convert edges. // ~~~~~~~~~~~~~~ - neighbEdgesPtr_ = new labelList(nEdges(), -1); - labelList& neighbEdges = *neighbEdgesPtr_; + neighbEdgesPtr_.reset(new labelList(nEdges(), -1)); + labelList& neighbEdges = neighbEdgesPtr_(); forAll(nbrEdgeFace, nbrEdgeI) { @@ -425,25 +433,25 @@ void Foam::processorPolyPatch::updateMesh(PstreamBuffers& pBufs) const Foam::labelList& Foam::processorPolyPatch::neighbPoints() const { - if (!neighbPointsPtr_) + if (!neighbPointsPtr_.valid()) { FatalErrorIn("processorPolyPatch::neighbPoints() const") << "No extended addressing calculated for patch " << name() << abort(FatalError); } - return *neighbPointsPtr_; + return neighbPointsPtr_(); } const Foam::labelList& Foam::processorPolyPatch::neighbEdges() const { - if (!neighbEdgesPtr_) + if (!neighbEdgesPtr_.valid()) { FatalErrorIn("processorPolyPatch::neighbEdges() const") << "No extended addressing calculated for patch " << name() << abort(FatalError); } - return *neighbEdgesPtr_; + return neighbEdgesPtr_(); } @@ -470,7 +478,7 @@ void Foam::processorPolyPatch::initOrder writeOBJ(nm, pp, pp.points()); // Calculate my face centres - pointField ctrs(calcFaceCentres(pp, pp.points())); + const pointField& fc = pp.faceCentres(); OFstream localStr ( @@ -478,26 +486,22 @@ void Foam::processorPolyPatch::initOrder /name() + "_localFaceCentres.obj" ); Pout<< "processorPolyPatch::order : " - << "Dumping " << ctrs.size() + << "Dumping " << fc.size() << " local faceCentres to " << localStr.name() << endl; - forAll(ctrs, faceI) + forAll(fc, faceI) { - writeOBJ(localStr, ctrs[faceI]); + writeOBJ(localStr, fc[faceI]); } } - const bool isMaster = Pstream::myProcNo() < neighbProcNo(); - - if (isMaster) + if (owner()) { - pointField ctrs(calcFaceCentres(pp, pp.points())); - pointField anchors(getAnchorPoints(pp, pp.points())); // Now send all info over to the neighbour UOPstream toNeighbour(neighbProcNo(), pBufs); - toNeighbour << ctrs << anchors; + toNeighbour << pp.faceCentres() << anchors; } } @@ -514,6 +518,8 @@ bool Foam::processorPolyPatch::order labelList& rotation ) const { + // Note: we only get the faces that originate from internal faces. + if (!Pstream::parRun()) { return false; @@ -525,9 +531,7 @@ bool Foam::processorPolyPatch::order rotation.setSize(pp.size()); rotation = 0; - const bool isMaster = Pstream::myProcNo() < neighbProcNo(); - - if (isMaster) + if (owner()) { // Do nothing (i.e. identical mapping, zero rotation). // See comment at top. @@ -549,11 +553,8 @@ bool Foam::processorPolyPatch::order fromNeighbour >> masterCtrs >> masterAnchors; } - // Calculate my face centres - pointField ctrs(calcFaceCentres(pp, pp.points())); - // Calculate typical distance from face centre - scalarField tols(calcFaceTol(pp, pp.points(), ctrs)); + scalarField tols(calcFaceTol(pp, pp.points(), pp.faceCentres())); if (debug || masterCtrs.size() != pp.size()) { @@ -591,84 +592,14 @@ bool Foam::processorPolyPatch::order // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ // 1. Try existing ordering and transformation - bool matchedAll = false; - - if - ( - separated() - && (separation().size() == 1 || separation().size() == pp.size()) - ) - { - vectorField transformedCtrs; - - const vectorField& v = separation(); - - if (v.size() == 1) - { - transformedCtrs = masterCtrs-v[0]; - } - else - { - transformedCtrs = masterCtrs-v; - } - matchedAll = matchPoints - ( - ctrs, - transformedCtrs, - tols, - true, - faceMap - ); - - if (matchedAll) - { - // Use transformed centers from now on - masterCtrs = transformedCtrs; - - // Transform anchors - if (v.size() == 1) - { - masterAnchors -= v[0]; - } - else - { - masterAnchors -= v; - } - } - } - else if + bool matchedAll = matchPoints ( - !parallel() - && (forwardT().size() == 1 || forwardT().size() == pp.size()) - ) - { - vectorField transformedCtrs = masterCtrs; - transformList(forwardT(), transformedCtrs); - matchedAll = matchPoints - ( - ctrs, - transformedCtrs, - tols, - true, - faceMap - ); - - if (matchedAll) - { - // Use transformed centers from now on - masterCtrs = transformedCtrs; - - // Transform anchors - transformList(forwardT(), masterAnchors); - } - } - - - // 2. Try zero separation automatic matching - if (!matchedAll) - { - matchedAll = matchPoints(ctrs, masterCtrs, tols, true, faceMap); - } + pp.faceCentres(), + masterCtrs, + tols, + true, + faceMap + ); if (!matchedAll || debug) { @@ -695,14 +626,14 @@ bool Foam::processorPolyPatch::order label vertI = 0; - forAll(ctrs, faceI) + forAll(pp.faceCentres(), faceI) { label masterFaceI = faceMap[faceI]; if (masterFaceI != -1) { const point& c0 = masterCtrs[masterFaceI]; - const point& c1 = ctrs[faceI]; + const point& c1 = pp.faceCentres()[faceI]; writeOBJ(ccStr, c0, c1, vertI); } } @@ -718,7 +649,7 @@ bool Foam::processorPolyPatch::order << "Cannot match vectors to faces on both sides of patch" << endl << " masterCtrs[0]:" << masterCtrs[0] << endl - << " ctrs[0]:" << ctrs[0] << endl + << " ctrs[0]:" << pp.faceCentres()[0] << endl << " Please check your topology changes or maybe you have" << " multiple separated (from cyclics) processor patches" << endl diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.H b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.H index 8b168b9806ae23444d3c907afea901c30ac7cd86..0af1cfaa17f334f28006754162207e7449cb7ede 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.H +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatch.H @@ -40,6 +40,8 @@ SourceFiles #define processorPolyPatch_H #include "coupledPolyPatch.H" +#include "polyBoundaryMesh.H" +#include "faceListFwd.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -70,23 +72,11 @@ class processorPolyPatch //- Corresponding neighbouring local point label for every local point // (so localPoints()[i] == neighb.localPoints()[neighbPoints_[i]]) - mutable labelList* neighbPointsPtr_; + mutable autoPtr<labelList> neighbPointsPtr_; //- Corresponding neighbouring local edge label for every local edge // (so edges()[i] == neighb.edges()[neighbEdges_[i]]) - mutable labelList* neighbEdgesPtr_; - - - - // Private static data - - //- Whether to use geometric or topological matching - static bool geometricMatch_; - - //- Relative tolerance (for geometric matching only). Is factor of - // maximum edge length per face. - static scalar matchTol_; - + mutable autoPtr<labelList> neighbEdgesPtr_; protected: @@ -98,6 +88,22 @@ protected: //- Calculate the patch geometry void calcGeometry(PstreamBuffers&); + //- Calculate the patch geometry with externally + // provided geometry + virtual void calcGeometry + ( + const primitivePatch& referPatch, + const UList<point>& thisCtrs, + const UList<point>& thisAreas, + const UList<point>& thisCc, + const UList<point>& nbrCtrs, + const UList<point>& nbrAreas, + const UList<point>& nbrCc + ) + { + notImplemented("processorPolyPatch::calcGeometry(..)"); + } + //- Initialise the patches for moving points void initMovePoints(PstreamBuffers&, const pointField&); @@ -236,7 +242,7 @@ public: } //- Does the processor own the patch ? - bool owner() const + virtual bool owner() const { return (myProcNo_ < neighbProcNo_); } @@ -265,16 +271,21 @@ public: return neighbFaceCellCentres_; } - //- Return neighbour point labels. This is for my local point (-1 or) - // the corresponding local point on the other side. It is -1 if - // there are multiple corresponding points on this or the other side - // (can happen for cyclics being converted into proc patches) + //- Return neighbour point labels. WIP. const labelList& neighbPoints() const; - //- Return neighbour edge labels. This is for my local edge (-1 or) the - // corresponding local edge on the other side. See above for -1 cause. + //- Return neighbour edge labels. WIP. const labelList& neighbEdges() const; + //- Return message tag to use for communication + virtual int tag() const + { + return Pstream::msgType(); + } + + //- Transform a patch-based position from other side to this side + virtual void transformPosition(pointField& l) const + {} //- Initialize ordering for primitivePatch. Does not // refer to *this (except for name() and type() etc.) diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatchTemplates.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatchTemplates.C new file mode 100644 index 0000000000000000000000000000000000000000..391f4ecbf64fe02d62d1cfa55cb0978a3c42d0cb --- /dev/null +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processor/processorPolyPatchTemplates.C @@ -0,0 +1,60 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2008 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorPolyPatch.H" +#include "transformField.H" + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +template<class T> +void Foam::processorPolyPatch::transform(Field<T>& l) const +{ + if (l.size() != size()) + { + FatalErrorIn("processorPolyPatch::transform(Field<T>&) const") + << "Size of field " << l.size() << " differs from patch size " + << size() << abort(FatalError); + } + + forAll(patchIDs_, subI) + { + label patchI = patchIDs_[subI]; + + if (patchI != -1) + { + // Get field on patch + typename Field<T>::subField subFld(subSlice(l, subI)); + + refCast<const coupledPolyPatch> + ( + boundaryMesh()[patchI] + ).transform(subFld); + } + } +} + + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.C new file mode 100644 index 0000000000000000000000000000000000000000..df93919fd21bb5c2da94bb35f929bb1d62458d75 --- /dev/null +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.C @@ -0,0 +1,246 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicPolyPatch.H" +#include "addToRunTimeSelectionTable.H" +#include "SubField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + defineTypeNameAndDebug(processorCyclicPolyPatch, 0); + addToRunTimeSelectionTable(polyPatch, processorCyclicPolyPatch, dictionary); +} + + +// * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +Foam::processorCyclicPolyPatch::processorCyclicPolyPatch +( + const word& name, + const label size, + const label start, + const label index, + const polyBoundaryMesh& bm, + const int myProcNo, + const int neighbProcNo, + const word& referPatchName +) +: + processorPolyPatch(name, size, start, index, bm, myProcNo, neighbProcNo), + tag_(UPstream::allocateTag()), + referPatchName_(referPatchName), + referPatchID_(-1) +{} + + +Foam::processorCyclicPolyPatch::processorCyclicPolyPatch +( + const word& name, + const dictionary& dict, + const label index, + const polyBoundaryMesh& bm +) +: + processorPolyPatch(name, dict, index, bm), + tag_(UPstream::allocateTag()), + referPatchName_(dict.lookup("referPatch")), + referPatchID_(-1) +{} + + +Foam::processorCyclicPolyPatch::processorCyclicPolyPatch +( + const processorCyclicPolyPatch& pp, + const polyBoundaryMesh& bm +) +: + processorPolyPatch(pp, bm), + tag_(pp.tag_), + referPatchName_(pp.referPatchName()), + referPatchID_(-1) +{} + + +Foam::processorCyclicPolyPatch::processorCyclicPolyPatch +( + const processorCyclicPolyPatch& pp, + const polyBoundaryMesh& bm, + const label index, + const label newSize, + const label newStart, + const word& referPatchName +) +: + processorPolyPatch(pp, bm, index, newSize, newStart), + tag_(pp.tag_), + referPatchName_(referPatchName), + referPatchID_(-1) +{} + + +Foam::processorCyclicPolyPatch::processorCyclicPolyPatch +( + const processorCyclicPolyPatch& pp, + const polyBoundaryMesh& bm, + const label index, + const unallocLabelList& mapAddressing, + const label newStart +) +: + processorPolyPatch(pp, bm, index, mapAddressing, newStart), + tag_(pp.tag_), + referPatchName_(pp.referPatchName()), + referPatchID_(-1) +{} + + +// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * // + +Foam::processorCyclicPolyPatch::~processorCyclicPolyPatch() +{ + UPstream::freeTag(tag_); +} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + + +void Foam::processorCyclicPolyPatch::initGeometry(PstreamBuffers& pBufs) +{ + // Send over processorPolyPatch data + processorPolyPatch::initGeometry(pBufs); +} + + +void Foam::processorCyclicPolyPatch::calcGeometry(PstreamBuffers& pBufs) +{ + // Receive and initialise processorPolyPatch data + processorPolyPatch::calcGeometry(pBufs); + + if (Pstream::parRun()) + { + + // Where do we store the calculated transformation? + // - on the processor patch? + // - on the underlying cyclic patch? + // - or do we not auto-calculate the transformation but + // have option of reading it. + + // Update underlying cyclic + coupledPolyPatch& pp = const_cast<coupledPolyPatch&>(referPatch()); + + Pout<< "updating geometry on refered patch:" << pp.name() << endl; + + pp.calcGeometry + ( + *this, + faceCentres(), + faceAreas(), + faceCellCentres(), + neighbFaceCentres(), + neighbFaceAreas(), + neighbFaceCellCentres() + ); + } +} + + +void Foam::processorCyclicPolyPatch::initMovePoints +( + PstreamBuffers& pBufs, + const pointField& p +) +{ + // Recalculate geometry + initGeometry(pBufs); +} + + +void Foam::processorCyclicPolyPatch::movePoints +( + PstreamBuffers& pBufs, + const pointField& +) +{ + calcGeometry(pBufs); +} + + +void Foam::processorCyclicPolyPatch::initUpdateMesh(PstreamBuffers& pBufs) +{ + processorPolyPatch::initUpdateMesh(pBufs); +} + + +void Foam::processorCyclicPolyPatch::updateMesh(PstreamBuffers& pBufs) +{ + referPatchID_ = -1; + processorPolyPatch::updateMesh(pBufs); +} + + +void Foam::processorCyclicPolyPatch::initOrder +( + PstreamBuffers& pBufs, + const primitivePatch& pp +) const +{ + // For now use the same algorithm as processorPolyPatch + processorPolyPatch::initOrder(pBufs, pp); +} + + +// Return new ordering. Ordering is -faceMap: for every face index +// the new face -rotation:for every new face the clockwise shift +// of the original face. Return false if nothing changes (faceMap +// is identity, rotation is 0) +bool Foam::processorCyclicPolyPatch::order +( + PstreamBuffers& pBufs, + const primitivePatch& pp, + labelList& faceMap, + labelList& rotation +) const +{ + // For now use the same algorithm as processorPolyPatch + return processorPolyPatch::order(pBufs, pp, faceMap, rotation); +} + + +void Foam::processorCyclicPolyPatch::write(Ostream& os) const +{ + processorPolyPatch::write(os); + os.writeKeyword("referPatch") << referPatchName_ + << token::END_STATEMENT << nl; +} + + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.H b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.H new file mode 100644 index 0000000000000000000000000000000000000000..b0ffa28086342d5e5506fa21510c6d0fc67439a7 --- /dev/null +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/processorCyclic/processorCyclicPolyPatch.H @@ -0,0 +1,394 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicPolyPatch + +Description + Neighbour processor patch. + + Note: morph patch face ordering is geometric. + +SourceFiles + processorCyclicPolyPatch.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicPolyPatch_H +#define processorCyclicPolyPatch_H + +#include "processorPolyPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicPolyPatch Declaration +\*---------------------------------------------------------------------------*/ + +class processorCyclicPolyPatch +: + public processorPolyPatch +{ + // Private data + + //- Message tag to use for communication + const int tag_; + + //- Name of originating patch + const word referPatchName_; + + //- Index of originating patch + mutable label referPatchID_; + + // Private member functions + + +protected: + + // Protected Member functions + + //- Initialise the calculation of the patch geometry + void initGeometry(PstreamBuffers&); + +// //- Initialise the calculation of the patch geometry with externally +// // provided geometry +// virtual void initGeometry +// ( +// const primitivePatch& referPatch, +// UList<point>&, +// UList<point>&, +// UList<point>& +// ) +// { +// notImplemented("processorCyclicPolyPatch::initGeometry(..)"); +// } + + //- Calculate the patch geometry + void calcGeometry(PstreamBuffers&); + + //- Calculate the patch geometry with externally + // provided geometry + virtual void calcGeometry + ( + const primitivePatch& referPatch, + const UList<point>& thisCtrs, + const UList<point>& thisAreas, + const UList<point>& thisCc, + const UList<point>& nbrCtrs, + const UList<point>& nbrAreas, + const UList<point>& nbrCc + ) + { + notImplemented("processorCyclicPolyPatch::calcGeometry(..)"); + } + + //- Initialise the patches for moving points + void initMovePoints(PstreamBuffers&, const pointField&); + + //- Correct patches after moving points + void movePoints(PstreamBuffers&, const pointField&); + + //- Initialise the update of the patch topology + virtual void initUpdateMesh(PstreamBuffers&); + + //- Update of the patch topology + virtual void updateMesh(PstreamBuffers&); + + +public: + + //- Runtime type information + TypeName("processorCyclic"); + + + // Constructors + + //- Construct from components + processorCyclicPolyPatch + ( + const word& name, + const label size, + const label start, + const label index, + const polyBoundaryMesh& bm, + const int myProcNo, + const int neighbProcNo, + const word& referPatchName + ); + + //- Construct from dictionary + processorCyclicPolyPatch + ( + const word& name, + const dictionary& dict, + const label index, + const polyBoundaryMesh& + ); + + //- Construct as copy, resetting the boundary mesh + processorCyclicPolyPatch + ( + const processorCyclicPolyPatch&, + const polyBoundaryMesh& + ); + + //- Construct as given the original patch and resetting the + // face list and boundary mesh information + processorCyclicPolyPatch + ( + const processorCyclicPolyPatch& pp, + const polyBoundaryMesh& bm, + const label index, + const label newSize, + const label newStart, + const word& referPatchName + ); + + //- Construct given the original patch and a map + processorCyclicPolyPatch + ( + const processorCyclicPolyPatch& pp, + const polyBoundaryMesh& bm, + const label index, + const unallocLabelList& mapAddressing, + const label newStart + ); + + + //- Construct and return a clone, resetting the boundary mesh + virtual autoPtr<polyPatch> clone(const polyBoundaryMesh& bm) const + { + return autoPtr<polyPatch>(new processorCyclicPolyPatch(*this, bm)); + } + + //- Construct and return a clone, resetting the face list + // and boundary mesh + virtual autoPtr<polyPatch> clone + ( + const polyBoundaryMesh& bm, + const label index, + const label newSize, + const label newStart, + const word& referPatchName + ) const + { + return autoPtr<polyPatch> + ( + new processorCyclicPolyPatch + ( + *this, + bm, + index, + newSize, + newStart, + referPatchName + ) + ); + } + + //- Construct and return a clone, resetting the face list + // and boundary mesh + virtual autoPtr<polyPatch> clone + ( + const polyBoundaryMesh& bm, + const label index, + const unallocLabelList& mapAddressing, + const label newStart + ) const + { + return autoPtr<polyPatch> + ( + new processorCyclicPolyPatch + ( + *this, + bm, + index, + mapAddressing, + newStart + ) + ); + } + + + // Destructor + + virtual ~processorCyclicPolyPatch(); + + + // Member functions + + const word& referPatchName() const + { + return referPatchName_; + } + + //- Referring patchID. + label referPatchID() const + { + if (referPatchID_ == -1) + { + referPatchID_ = this->boundaryMesh().findPatchID + ( + referPatchName_ + ); + if (referPatchID_ == -1) + { + FatalErrorIn + ( + "processorCyclicPolyPatch::referPatchID() const" + ) << "Illegal referPatch name " << referPatchName_ + << endl << "Valid patch names are " + << this->boundaryMesh().names() + << exit(FatalError); + } + } + return referPatchID_; + } + + const coupledPolyPatch& referPatch() const + { + const polyPatch& pp = this->boundaryMesh()[referPatchID()]; + return refCast<const coupledPolyPatch>(pp); + } + + //- Return message tag to use for communication + virtual int tag() const + { + return tag_; + } + + //- Does this side own the patch ? + virtual bool owner() const + { + return referPatch().owner(); + } + +// //- Transform a patch-based field from other side to this side. +// virtual bool doTransform() const +// { +// return referPatch().doTransform(); +// } +// virtual void transform(scalarField& l) const +// { +// referPatch().transform(l); +// } +// virtual void transform(vectorField& l) const +// { +// referPatch().transform(l); +// } +// virtual void transform(sphericalTensorField& l) const +// { +// referPatch().transform(l); +// } +// virtual void transform(diagTensorField& l) const +// { +// referPatch().transform(l); +// } +// virtual void transform(symmTensorField& l) const +// { +// referPatch().transform(l); +// } +// virtual void transform(tensorField& l) const +// { +// referPatch().transform(l); +// } + + //- Transform a patch-based position from other side to this side + virtual void transformPosition(pointField& l) const + { + referPatch().transformPosition(l); + } + + //- Are the planes separated. + virtual bool separated() const + { + return referPatch().separated(); + } + + //- If the planes are separated the separation vector. + virtual const vectorField& separation() const + { + return referPatch().separation(); + } + + //- Are the cyclic planes parallel. + virtual bool parallel() const + { + return referPatch().parallel(); + } + + //- Return face transformation tensor. + virtual const tensorField& forwardT() const + { + return referPatch().forwardT(); + } + + //- Return neighbour-cell transformation tensor. + virtual const tensorField& reverseT() const + { + return referPatch().reverseT(); + } + + //- Are faces collocated. Either size 0,1 or length of patch + virtual const boolList& collocated() const + { + return referPatch().collocated(); + } + + + //- Initialize ordering for primitivePatch. Does not + // refer to *this (except for name() and type() etc.) + virtual void initOrder(PstreamBuffers&, const primitivePatch&) const; + + //- Return new ordering for primitivePatch. + // Ordering is -faceMap: for every face + // index of the new face -rotation:for every new face the clockwise + // shift of the original face. Return false if nothing changes + // (faceMap is identity, rotation is 0), true otherwise. + virtual bool order + ( + PstreamBuffers&, + const primitivePatch&, + labelList& faceMap, + labelList& rotation + ) const; + + + //- Write the polyPatch data as a dictionary + virtual void write(Ostream&) const; +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/polyPatch/polyPatch.H b/src/OpenFOAM/meshes/polyMesh/polyPatches/polyPatch/polyPatch.H index c9e5a8c8530d42ca7f53a4d8acc33f418749ff61..66daf6793bd9a499db9c8ba5d4177bffe7c1b2a6 100644 --- a/src/OpenFOAM/meshes/polyMesh/polyPatches/polyPatch/polyPatch.H +++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/polyPatch/polyPatch.H @@ -87,12 +87,6 @@ class polyPatch mutable labelList* mePtr_; - // Private Member Functions - - //- Calculate labels of mesh edges - void calcMeshEdges() const; - - protected: // Protected Member Functions diff --git a/src/OpenFOAM/meshes/polyMesh/syncTools/dummyTransform.H b/src/OpenFOAM/meshes/polyMesh/syncTools/dummyTransform.H new file mode 100644 index 0000000000000000000000000000000000000000..cdda839d32b6a6d45437cbf626721d33fdc2c5c9 --- /dev/null +++ b/src/OpenFOAM/meshes/polyMesh/syncTools/dummyTransform.H @@ -0,0 +1,121 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +InClass + Foam::dummyTransform + +Description + Dummy transform to be used with syncTools. + +\*---------------------------------------------------------------------------*/ + +#ifndef dummyTransform_H +#define dummyTransform_H + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class dummyTransform Declaration +\*---------------------------------------------------------------------------*/ + +class dummyTransform +{ +public: + template<class T> + void operator()(const coupledPolyPatch& cpp, Field<T>& fld) const + {} + template<class T, template<class> class Container> + void operator()(const coupledPolyPatch& cpp, Container<T>& map) const + {} +}; + + +template<class T> +class pTraits<List<T> > +: + public List<T> +{ +public: + typedef label cmptType; + + pTraits(Istream& is) + : + List<T>(is) + {} +}; + +template<class T> +class pTraits<UList<T> > +: + public UList<T> +{ +public: + typedef label cmptType; + + pTraits(Istream& is) + : + UList<T>(is) + {} +}; + +template<class T> +class pTraits<Field<T> > +: + public Field<T> +{ +public: + typedef label cmptType; + + pTraits(Istream& is) + : + Field<T>(is) + {} +}; + +template<> +class pTraits<face> +: + public face +{ +public: + typedef label cmptType; + + pTraits(Istream& is) + : + face(is) + {} +}; + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.C b/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.C index 8bf68ba40b0527cafd5a67eceb0f398cfc31a56e..843e84908c1017fcfd59a1c732e4cdba89acc6da 100644 --- a/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.C +++ b/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.C @@ -28,6 +28,77 @@ License // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Field<label>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<label>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<label>& +) const +{} + + +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Field<scalar>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<scalar>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<scalar>& +) const +{} + + +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Field<bool>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<bool>& +) const +{} +template<> +void Foam::syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<bool>& +) const +{} + + +// * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // + // Does anyone have couples? Since meshes might have 0 cells and 0 proc // boundaries need to reduce this info. bool Foam::syncTools::hasCouples(const polyBoundaryMesh& patches) @@ -46,31 +117,6 @@ bool Foam::syncTools::hasCouples(const polyBoundaryMesh& patches) } -void Foam::syncTools::checkTransform -( - const coupledPolyPatch& pp, - const bool applySeparation -) -{ - if (!pp.parallel() && pp.forwardT().size() > 1) - { - FatalErrorIn("syncTools::checkTransform(const coupledPolyPatch&)") - << "Non-uniform transformation not supported for point or edge" - << " fields." << endl - << "Patch:" << pp.name() - << abort(FatalError); - } - if (applySeparation && pp.separated() && pp.separation().size() > 1) - { - FatalErrorIn("syncTools::checkTransform(const coupledPolyPatch&)") - << "Non-uniform separation vector not supported for point or edge" - << " fields." << endl - << "Patch:" << pp.name() - << abort(FatalError); - } -} - - // Determines for every point whether it is coupled and if so sets only one. Foam::PackedBoolList Foam::syncTools::getMasterPoints(const polyMesh& mesh) { @@ -154,36 +200,16 @@ Foam::PackedBoolList Foam::syncTools::getMasterFaces(const polyMesh& mesh) { if (patches[patchI].coupled()) { - if (Pstream::parRun() && isA<processorPolyPatch>(patches[patchI])) - { - const processorPolyPatch& pp = - refCast<const processorPolyPatch>(patches[patchI]); + const coupledPolyPatch& pp = + refCast<const coupledPolyPatch>(patches[patchI]); - if (!pp.owner()) - { - forAll(pp, i) - { - isMasterFace.unset(pp.start()+i); - } - } - } - else if (isA<cyclicPolyPatch>(patches[patchI])) + if (!pp.owner()) { - const cyclicPolyPatch& pp = - refCast<const cyclicPolyPatch>(patches[patchI]); - - for (label i = pp.size()/2; i < pp.size(); i++) + forAll(pp, i) { isMasterFace.unset(pp.start()+i); } } - else - { - FatalErrorIn("syncTools::getMasterFaces(const polyMesh&)") - << "Cannot handle coupled patch " << patches[patchI].name() - << " of type " << patches[patchI].type() - << abort(FatalError); - } } } @@ -191,100 +217,4 @@ Foam::PackedBoolList Foam::syncTools::getMasterFaces(const polyMesh& mesh) } -template <> -void Foam::syncTools::separateList -( - const vectorField& separation, - UList<vector>& field -) -{ - if (separation.size() == 1) - { - // Single value for all. - - forAll(field, i) - { - field[i] += separation[0]; - } - } - else if (separation.size() == field.size()) - { - forAll(field, i) - { - field[i] += separation[i]; - } - } - else - { - FatalErrorIn - ( - "syncTools::separateList(const vectorField&, UList<vector>&)" - ) << "Sizes of field and transformation not equal. field:" - << field.size() << " transformation:" << separation.size() - << abort(FatalError); - } -} - - -template <> -void Foam::syncTools::separateList -( - const vectorField& separation, - Map<vector>& field -) -{ - if (separation.size() == 1) - { - // Single value for all. - forAllIter(Map<vector>, field, iter) - { - iter() += separation[0]; - } - } - else if (separation.size() == field.size()) - { - forAllIter(Map<vector>, field, iter) - { - iter() += separation[iter.key()]; - } - } - else - { - FatalErrorIn - ( - "syncTools::separateList(const vectorField&, Map<vector>&)" - ) << "Sizes of field and transformation not equal. field:" - << field.size() << " transformation:" << separation.size() - << abort(FatalError); - } -} - - -template <> -void Foam::syncTools::separateList -( - const vectorField& separation, - EdgeMap<vector>& field -) -{ - if (separation.size() == 1) - { - // Single value for all. - forAllIter(EdgeMap<vector>, field, iter) - { - iter() += separation[0]; - } - } - else - { - FatalErrorIn - ( - "syncTools::separateList(const vectorField&, EdgeMap<vector>&)" - ) << "Multiple separation vectors not supported. field:" - << field.size() << " transformation:" << separation.size() - << abort(FatalError); - } -} - - // ************************************************************************* // diff --git a/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.H b/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.H index 04ca6121cdc5149c2348100ee6281a681f876c67..725270a489536543116ef2e17d1469893b5bad61 100644 --- a/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.H +++ b/src/OpenFOAM/meshes/polyMesh/syncTools/syncTools.H @@ -50,10 +50,12 @@ SourceFiles #include "UList.H" #include "Pstream.H" -#include "transformList.H" #include "Map.H" #include "EdgeMap.H" #include "PackedBoolList.H" +#include "polyMesh.H" +#include "coupledPolyPatch.H" +#include "transformList.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -61,8 +63,6 @@ namespace Foam { class polyBoundaryMesh; -class polyMesh; -class coupledPolyPatch; /*---------------------------------------------------------------------------*\ Class syncTools Declaration @@ -75,20 +75,6 @@ class syncTools //- Check whether uses couples. static bool hasCouples(const polyBoundaryMesh&); - //- Check for single transformation tensor only. - static void checkTransform(const coupledPolyPatch&, const bool); - - //- Apply separation to list. Either single vector or one vector - // per element. - template <class T> - static void separateList(const vectorField&, UList<T>&); - - template <class T> - static void separateList(const vectorField&, Map<T>&); - - template <class T> - static void separateList(const vectorField&, EdgeMap<T>&); - //- Combine value with existing value in map. template <class T, class CombineOp> static void combine @@ -112,116 +98,383 @@ class syncTools public: - // Static data members + // Public classes + + class transform + { + public: + //- Transform patch-based field + template<class T> + void operator()(const coupledPolyPatch& cpp, Field<T>& fld) const + { + if (!cpp.parallel()) + { + transformList(cpp.forwardT(), fld); + } + } + + //- Transform sparse field + template<class T, template<class> class Container> + void operator()(const coupledPolyPatch& cpp, Container<T>& map) + const + { + if (!cpp.parallel()) + { + transformList(cpp.forwardT(), map); + } + } + }; + + class transformPosition + { + public: + void operator()(const coupledPolyPatch& cpp, pointField& fld) const + { + cpp.transformPosition(fld); + } + template<template<class> class Container> + void operator()(const coupledPolyPatch& cpp, Container<point>& map) + const + { + Field<point> fld(map.size()); + label i = 0; + forAllConstIter(typename Container<point>, map, iter) + { + fld[i++] = iter(); + } + cpp.transformPosition(fld); + i = 0; + forAllIter(typename Container<point>, map, iter) + { + iter() = fld[i++]; + } + } + }; + + + // Basic routines with user-supplied transformation. Preferably + // use specialisations below. - //- Synchronize values on all mesh points. - // Applies rotation and optionally separation for parallel cyclics - template <class T, class CombineOp> - static void syncPointList - ( - const polyMesh&, - UList<T>&, - const CombineOp& cop, - const T& nullValue, - const bool applySeparation - ); + //- Synchronize values on selected points. + template <class T, class CombineOp, class TransformOp> + static void syncPointMap + ( + const polyMesh&, + Map<T>& pointValues, + const CombineOp& cop, + const TransformOp& top + ); - //- Synchronize values on selected mesh points. - // Applies rotation and optionally separation for parallel cyclics - template <class T, class CombineOp> - static void syncPointList - ( - const polyMesh&, - const labelList& meshPoints, - UList<T>&, - const CombineOp& bop, - const T& nullValue, - const bool applySeparation - ); + //- Synchronize values on selected edges. + template <class T, class CombineOp, class TransformOp> + static void syncEdgeMap + ( + const polyMesh&, + EdgeMap<T>& edgeValues, + const CombineOp& cop, + const TransformOp& top + ); - //- Synchronize values on all mesh edges. - // Applies rotation and optionally separation for parallel cyclics - template <class T, class CombineOp> - static void syncEdgeList - ( - const polyMesh&, - UList<T>&, - const CombineOp& cop, - const T& nullValue, - const bool applySeparation - ); + //- Synchronize values on all mesh points. + template <class T, class CombineOp, class TransformOp> + static void syncPointList + ( + const polyMesh&, + UList<T>&, + const CombineOp& cop, + const T& nullValue, + const TransformOp& top + ); - //- Synchronize values on boundary faces only. - // Optionally applies rotation tensor for non-parallel cyclics - // (but not separation!) - template <class T, class CombineOp> - static void syncBoundaryFaceList - ( - const polyMesh&, - UList<T>&, - const CombineOp& cop, - const bool applySeparation - ); + //- Synchronize values on selected mesh points. + template <class T, class CombineOp, class TransformOp> + static void syncPointList + ( + const polyMesh&, + const labelList& meshPoints, + UList<T>&, + const CombineOp& cop, + const T& nullValue, + const TransformOp& top + ); - //- Synchronize values on all mesh faces. - // Optionally applies rotation tensor for non-parallel cyclics - // (but not separation!) - template <class T, class CombineOp> - static void syncFaceList - ( - const polyMesh&, - UList<T>&, - const CombineOp& cop, - const bool applySeparation - ); + //- Synchronize values on all mesh edges. + template <class T, class CombineOp, class TransformOp> + static void syncEdgeList + ( + const polyMesh&, + UList<T>&, + const CombineOp& cop, + const T& nullValue, + const TransformOp& top + ); - //- Swap coupled face values. - // Applies rotation and optionally separation for parallel cyclics - template <class T> - static void swapBoundaryFaceList - ( - const polyMesh&, - UList<T>&, - const bool applySeparation - ); + //- Synchronize values on boundary faces only. + template <class T, class CombineOp, class TransformOp> + static void syncBoundaryFaceList + ( + const polyMesh&, + UList<T>&, + const CombineOp& cop, + const TransformOp& top + ); - //- Swap coupled face values. - // Applies rotation and optionally separation for parallel cyclics - template <class T> - static void swapFaceList - ( - const polyMesh&, - UList<T>&, - const bool applySeparation - ); + + // Synchronise point-wise data + + //- Synchronize values on all mesh points. + template <class T, class CombineOp> + static void syncPointList + ( + const polyMesh& mesh, + UList<T>& l, + const CombineOp& cop, + const T& nullValue + ) + { + syncPointList(mesh, l, cop, nullValue, transform()); + } + + //- Synchronize locations on all mesh points. + template <class CombineOp> + static void syncPointPositions + ( + const polyMesh& mesh, + UList<point>& l, + const CombineOp& cop, + const point& nullValue + ) + { + syncPointList(mesh, l, cop, nullValue, transformPosition()); + } + + //- Synchronize values on selected mesh points. + template <class T, class CombineOp> + static void syncPointList + ( + const polyMesh& mesh, + const labelList& meshPoints, + UList<T>& l, + const CombineOp& cop, + const T& nullValue + ) + { + syncPointList + ( + mesh, + meshPoints, + l, + cop, + nullValue, + transform() + ); + } + + //- Synchronize locations on selected mesh points. + template <class CombineOp> + static void syncPointPositions + ( + const polyMesh& mesh, + const labelList& meshPoints, + UList<point>& l, + const CombineOp& cop, + const point& nullValue + ) + { + syncPointList + ( + mesh, + meshPoints, + l, + cop, + nullValue, + transformPosition() + ); + } + + + // Synchronise edge-wise data + + //- Synchronize values on all mesh edges. + template <class T, class CombineOp> + static void syncEdgeList + ( + const polyMesh& mesh, + UList<T>& l, + const CombineOp& cop, + const T& nullValue + ) + { + syncEdgeList(mesh, l, cop, nullValue, transform()); + } + + //- Synchronize values on all mesh edges. + template <class CombineOp> + static void syncEdgePositions + ( + const polyMesh& mesh, + UList<point>& l, + const CombineOp& cop, + const point& nullValue + ) + { + syncEdgeList(mesh, l, cop, nullValue, transformPosition()); + } + + + // Synchronise face-wise data + + //- Synchronize values on boundary faces only. + template <class T, class CombineOp> + static void syncBoundaryFaceList + ( + const polyMesh& mesh, + UList<T>& l, + const CombineOp& cop + ) + { + syncBoundaryFaceList(mesh, l, cop, transform()); + } + + //- Synchronize locations on boundary faces only. + template <class CombineOp> + static void syncBoundaryFacePositions + ( + const polyMesh& mesh, + UList<point>& l, + const CombineOp& cop + ) + { + syncBoundaryFaceList(mesh, l, cop, transformPosition()); + } + + //- Synchronize values on all mesh faces. + template <class T, class CombineOp> + static void syncFaceList + ( + const polyMesh& mesh, + UList<T>& l, + const CombineOp& cop + ) + { + SubList<T> bndValues + ( + l, + mesh.nFaces()-mesh.nInternalFaces(), + mesh.nInternalFaces() + ); + + syncBoundaryFaceList(mesh, bndValues, cop, transform()); + } + + //- Synchronize locations on all mesh faces. + template <class CombineOp> + static void syncFacePositions + ( + const polyMesh& mesh, + UList<point>& l, + const CombineOp& cop + ) + { + SubList<point> bndValues + ( + l, + mesh.nFaces()-mesh.nInternalFaces(), + mesh.nInternalFaces() + ); + syncBoundaryFaceList(mesh, bndValues, cop, transformPosition()); + } + + //- Swap coupled boundary face values. + template <class T> + static void swapBoundaryFaceList + ( + const polyMesh& mesh, + UList<T>& l + ) + { + syncBoundaryFaceList(mesh, l, eqOp<T>(), transform()); + } + + //- Swap coupled positions. + template <class T> + static void swapBoundaryFacePositions + ( + const polyMesh& mesh, + UList<T>& l + ) + { + syncBoundaryFaceList(mesh, l, eqOp<T>(), transformPosition()); + } + + //- Swap coupled face values. + template <class T> + static void swapFaceList + ( + const polyMesh& mesh, + UList<T>& l + ) + { + SubList<T> bndValues + ( + l, + mesh.nFaces()-mesh.nInternalFaces(), + mesh.nInternalFaces() + ); + syncBoundaryFaceList(mesh, bndValues, eqOp<T>(), transform()); + } // Sparse versions //- Synchronize values on selected points. - // Applies rotation and optionally separation for parallel - // cyclics. template <class T, class CombineOp> static void syncPointMap ( - const polyMesh&, - Map<T>& pointValues, - const CombineOp& cop, - const bool applySeparation - ); + const polyMesh& mesh, + Map<T>& l, + const CombineOp& cop + ) + { + syncPointMap(mesh, l, cop, transform()); + } + + //- Synchronize locations on selected points. + template <class CombineOp> + static void syncPointPositions + ( + const polyMesh& mesh, + Map<point>& l, + const CombineOp& cop + ) + { + syncPointMap(mesh, l, cop, transformPosition()); + } //- Synchronize values on selected edges. Edges are represented // by the two vertices that make it up so global edges never get // constructed. - // Applies rotation and optionally separation for parallel - // cyclics. template <class T, class CombineOp> static void syncEdgeMap ( - const polyMesh&, - EdgeMap<T>& edgeValues, - const CombineOp& cop, - const bool applySeparation - ); + const polyMesh& mesh, + EdgeMap<T>& l, + const CombineOp& cop + ) + { + syncEdgeMap(mesh, l, cop, transform()); + } + + //- Synchronize locations on selected edges. + template <class T, class CombineOp> + static void syncEdgePositions + ( + const polyMesh& mesh, + EdgeMap<T>& l, + const CombineOp& cop + ) + { + syncEdgeMap(mesh, l, cop, transformPosition()); + } // PackedList versions @@ -273,13 +526,62 @@ public: template<> -void syncTools::separateList(const vectorField&, UList<vector>&); +void syncTools::transform::operator() +( + const coupledPolyPatch&, + Field<label>& +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<label>& +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<label>& +) const; + template<> -void syncTools::separateList(const vectorField&, Map<vector>&); +void syncTools::transform::operator() +( + const coupledPolyPatch&, + Field<scalar>& +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<scalar>& +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<scalar>& +) const; template<> -void syncTools::separateList(const vectorField&, EdgeMap<vector>&); +void syncTools::transform::operator() +( + const coupledPolyPatch& cpp, + Field<bool>& fld +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + Map<bool>& +) const; +template<> +void syncTools::transform::operator() +( + const coupledPolyPatch&, + EdgeMap<bool>& +) const; // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // diff --git a/src/OpenFOAM/meshes/polyMesh/syncTools/syncToolsTemplates.C b/src/OpenFOAM/meshes/polyMesh/syncTools/syncToolsTemplates.C index 3591eac7562b6f39225b12d543a06f6d0893a52e..9675d29bb71f29c7c81b3adffe7a26834ce6ce75 100644 --- a/src/OpenFOAM/meshes/polyMesh/syncTools/syncToolsTemplates.C +++ b/src/OpenFOAM/meshes/polyMesh/syncTools/syncToolsTemplates.C @@ -30,35 +30,11 @@ License #include "globalMeshData.H" #include "contiguous.H" #include "transform.H" +#include "transformList.H" -// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // - -template <class T> -void Foam::syncTools::separateList -( - const vectorField& separation, - UList<T>& field -) -{} - - -template <class T> -void Foam::syncTools::separateList -( - const vectorField& separation, - Map<T>& field -) -{} - - -template <class T> -void Foam::syncTools::separateList -( - const vectorField& separation, - EdgeMap<T>& field -) -{} +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // +// * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // // Combine val with existing value at index template <class T, class CombineOp> @@ -106,13 +82,13 @@ void Foam::syncTools::combine } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncPointMap ( const polyMesh& mesh, Map<T>& pointValues, // from mesh point label to value const CombineOp& cop, - const bool applySeparation + const TransformOp& top ) { const polyBoundaryMesh& patches = mesh.boundaryMesh(); @@ -122,11 +98,10 @@ void Foam::syncTools::syncPointMap return; } - // Is there any coupled patch with transformation? - bool hasTransformation = false; - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -156,18 +131,16 @@ void Foam::syncTools::syncPointMap if (iter != pointValues.end()) { - if (nbrPts[i] >= 0) - { - patchInfo.insert(nbrPts[i], iter()); - } + patchInfo.insert(nbrPts[i], iter()); } } - OPstream toNeighb(Pstream::blocking, procPatch.neighbProcNo()); + UOPstream toNeighb(procPatch.neighbProcNo(), pBufs); toNeighb << patchInfo; } } + pBufs.finishedSends(); // Receive and combine. @@ -181,26 +154,16 @@ void Foam::syncTools::syncPointMap { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - checkTransform(procPatch, applySeparation); - IPstream fromNb(Pstream::blocking, procPatch.neighbProcNo()); + UIPstream fromNb(procPatch.neighbProcNo(), pBufs); Map<T> nbrPatchInfo(fromNb); - if (!procPatch.parallel()) - { - hasTransformation = true; - transformList(procPatch.forwardT(), nbrPatchInfo); - } - else if (applySeparation && procPatch.separated()) - { - hasTransformation = true; - separateList(-procPatch.separation(), nbrPatchInfo); - } + // Transform + top(procPatch, nbrPatchInfo); const labelList& meshPts = procPatch.meshPoints(); // Only update those values which come from neighbour - forAllConstIter(typename Map<T>, nbrPatchInfo, nbrIter) { combine @@ -222,105 +185,86 @@ void Foam::syncTools::syncPointMap { const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - checkTransform(cycPatch, applySeparation); - - const edgeList& coupledPoints = cycPatch.coupledPoints(); - const labelList& meshPts = cycPatch.meshPoints(); - - // Extract local values. Create map from nbrPoint to value. - Map<T> half0Values(meshPts.size() / 20); - Map<T> half1Values(meshPts.size() / 20); - forAll(coupledPoints, i) + if (cycPatch.owner()) { - const edge& e = coupledPoints[i]; + // Owner does all. - typename Map<T>::const_iterator point0Fnd = - pointValues.find(meshPts[e[0]]); - - if (point0Fnd != pointValues.end()) - { - half0Values.insert(i, point0Fnd()); - } + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const edgeList& coupledPoints = cycPatch.coupledPoints(); + const labelList& meshPtsA = cycPatch.meshPoints(); + const labelList& meshPtsB = nbrPatch.meshPoints(); - typename Map<T>::const_iterator point1Fnd = - pointValues.find(meshPts[e[1]]); + // Extract local values. Create map from coupled-edge to value. + Map<T> half0Values(meshPtsA.size() / 20); + Map<T> half1Values(half0Values.size()); - if (point1Fnd != pointValues.end()) + forAll(coupledPoints, i) { - half1Values.insert(i, point1Fnd()); - } - } + const edge& e = coupledPoints[i]; - if (!cycPatch.parallel()) - { - hasTransformation = true; - transformList(cycPatch.reverseT(), half0Values); - transformList(cycPatch.forwardT(), half1Values); - } - else if (applySeparation && cycPatch.separated()) - { - hasTransformation = true; + typename Map<T>::const_iterator point0Fnd = + pointValues.find(meshPtsA[e[0]]); - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); - separateList(-v, half1Values); - } - - forAll(coupledPoints, i) - { - const edge& e = coupledPoints[i]; + if (point0Fnd != pointValues.end()) + { + half0Values.insert(i, point0Fnd()); + } - typename Map<T>::const_iterator half1Fnd = half1Values.find(i); + typename Map<T>::const_iterator point1Fnd = + pointValues.find(meshPtsB[e[1]]); - if (half1Fnd != half1Values.end()) - { - combine - ( - pointValues, - cop, - meshPts[e[0]], - half1Fnd() - ); + if (point1Fnd != pointValues.end()) + { + half1Values.insert(i, point1Fnd()); + } } - typename Map<T>::const_iterator half0Fnd = half0Values.find(i); + // Transform to receiving side + top(cycPatch, half1Values); + top(nbrPatch, half0Values); - if (half0Fnd != half0Values.end()) + forAll(coupledPoints, i) { - combine - ( - pointValues, - cop, - meshPts[e[1]], - half0Fnd() - ); + const edge& e = coupledPoints[i]; + + typename Map<T>::const_iterator half0Fnd = + half0Values.find(i); + + if (half0Fnd != half0Values.end()) + { + combine + ( + pointValues, + cop, + meshPtsB[e[1]], + half0Fnd() + ); + } + + typename Map<T>::const_iterator half1Fnd = + half1Values.find(i); + + if (half1Fnd != half1Values.end()) + { + combine + ( + pointValues, + cop, + meshPtsA[e[0]], + half1Fnd() + ); + } } } } } - //- Note: hasTransformation is only used for warning messages so - // reduction not strictly nessecary. - //reduce(hasTransformation, orOp<bool>()); - // Synchronize multiple shared points. const globalMeshData& pd = mesh.globalData(); if (pd.nGlobalPoints() > 0) { - if (hasTransformation) - { - WarningIn - ( - "syncTools<class T, class CombineOp>::syncPointMap" - "(const polyMesh&, Map<T>&, const CombineOp&" - ", const bool)" - ) << "There are decomposed cyclics in this mesh with" - << " transformations." << endl - << "This is not supported. The result will be incorrect" - << endl; - } // meshPoint per local index const labelList& sharedPtLabels = pd.sharedPointLabels(); // global shared index per local index @@ -364,7 +308,7 @@ void Foam::syncTools::syncPointMap slave++ ) { - IPstream fromSlave(Pstream::blocking, slave); + IPstream fromSlave(Pstream::scheduled, slave); Map<T> nbrValues(fromSlave); // Merge neighbouring values with my values @@ -388,22 +332,22 @@ void Foam::syncTools::syncPointMap slave++ ) { - OPstream toSlave(Pstream::blocking, slave); + OPstream toSlave(Pstream::scheduled, slave); toSlave << sharedPointValues; } } else { - // Send to master + // Slave: send to master { - OPstream toMaster(Pstream::blocking, Pstream::masterNo()); + OPstream toMaster(Pstream::scheduled, Pstream::masterNo()); toMaster << sharedPointValues; } // Receive merged values { IPstream fromMaster ( - Pstream::blocking, + Pstream::scheduled, Pstream::masterNo() ); fromMaster >> sharedPointValues; @@ -443,13 +387,13 @@ void Foam::syncTools::syncPointMap } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncEdgeMap ( const polyMesh& mesh, EdgeMap<T>& edgeValues, const CombineOp& cop, - const bool applySeparation + const TransformOp& top ) { const polyBoundaryMesh& patches = mesh.boundaryMesh(); @@ -469,6 +413,8 @@ void Foam::syncTools::syncEdgeMap if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -482,6 +428,7 @@ void Foam::syncTools::syncEdgeMap const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); + // Get data per patch edge in neighbouring edge. const edgeList& edges = procPatch.edges(); @@ -501,19 +448,16 @@ void Foam::syncTools::syncEdgeMap if (iter != edgeValues.end()) { const edge nbrEdge(nbrPts[e[0]], nbrPts[e[1]]); - - if (nbrEdge[0] >= 0 && nbrEdge[1] >= 0) - { - patchInfo.insert(nbrEdge, iter()); - } + patchInfo.insert(nbrEdge, iter()); } } - OPstream toNeighb(Pstream::blocking, procPatch.neighbProcNo()); + UOPstream toNeighb(procPatch.neighbProcNo(), pBufs); toNeighb << patchInfo; } } + pBufs.finishedSends(); // Receive and combine. @@ -527,23 +471,19 @@ void Foam::syncTools::syncEdgeMap { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - checkTransform(procPatch, applySeparation); - - const labelList& meshPts = procPatch.meshPoints(); - IPstream fromNbr(Pstream::blocking, procPatch.neighbProcNo()); - EdgeMap<T> nbrPatchInfo(fromNbr); - - if (!procPatch.parallel()) + EdgeMap<T> nbrPatchInfo; { - transformList(procPatch.forwardT(), nbrPatchInfo); - } - else if (applySeparation && procPatch.separated()) - { - separateList(-procPatch.separation(), nbrPatchInfo); + UIPstream fromNbr(procPatch.neighbProcNo(), pBufs); + fromNbr >> nbrPatchInfo; } + // Apply transform to convert to this side properties. + top(procPatch, nbrPatchInfo); + + // Only update those values which come from neighbour + const labelList& meshPts = procPatch.meshPoints(); forAllConstIter(typename EdgeMap<T>, nbrPatchInfo, nbrIter) { @@ -572,99 +512,95 @@ void Foam::syncTools::syncEdgeMap { const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - checkTransform(cycPatch, applySeparation); - const edgeList& coupledEdges = cycPatch.coupledEdges(); - const labelList& meshPts = cycPatch.meshPoints(); - const edgeList& edges = cycPatch.edges(); + if (cycPatch.owner()) + { + // Owner does all. - // Extract local values. Create map from nbrPoint to value. - Map<T> half0Values(meshPts.size() / 20); - Map<T> half1Values(meshPts.size() / 20); + const edgeList& coupledEdges = cycPatch.coupledEdges(); + const labelList& meshPtsA = cycPatch.meshPoints(); + const edgeList& edgesA = cycPatch.edges(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& meshPtsB = nbrPatch.meshPoints(); + const edgeList& edgesB = nbrPatch.edges(); - forAll(coupledEdges, i) - { - const edge& twoEdges = coupledEdges[i]; + // Extract local values. Create map from edge to value. + Map<T> half0Values(edgesA.size() / 20); + Map<T> half1Values(half0Values.size()); + forAll(coupledEdges, i) { - const edge& e0 = edges[twoEdges[0]]; - const edge meshEdge0(meshPts[e0[0]], meshPts[e0[1]]); - - typename EdgeMap<T>::const_iterator iter = - edgeValues.find(meshEdge0); + const edge& twoEdges = coupledEdges[i]; - if (iter != edgeValues.end()) { - half0Values.insert(i, iter()); - } - } - { - const edge& e1 = edges[twoEdges[1]]; - const edge meshEdge1(meshPts[e1[0]], meshPts[e1[1]]); + const edge& e0 = edgesA[twoEdges[0]]; + const edge meshEdge0(meshPtsA[e0[0]], meshPtsA[e0[1]]); - typename EdgeMap<T>::const_iterator iter = - edgeValues.find(meshEdge1); + typename EdgeMap<T>::const_iterator iter = + edgeValues.find(meshEdge0); - if (iter != edgeValues.end()) - { - half1Values.insert(i, iter()); + if (iter != edgeValues.end()) + { + half0Values.insert(i, iter()); + } } - } - } + { + const edge& e1 = edgesB[twoEdges[1]]; + const edge meshEdge1(meshPtsB[e1[0]], meshPtsB[e1[1]]); + typename EdgeMap<T>::const_iterator iter = + edgeValues.find(meshEdge1); - // Transform + if (iter != edgeValues.end()) + { + half1Values.insert(i, iter()); + } + } + } - if (!cycPatch.parallel()) - { - transformList(cycPatch.reverseT(), half0Values); - transformList(cycPatch.forwardT(), half1Values); - } - else if (applySeparation && cycPatch.separated()) - { - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); - separateList(-v, half1Values); - } + // Transform to this side + top(cycPatch, half1Values); + top(nbrPatch, half0Values); - // Extract and combine information + // Extract and combine information - forAll(coupledEdges, i) - { - const edge& twoEdges = coupledEdges[i]; + forAll(coupledEdges, i) + { + const edge& twoEdges = coupledEdges[i]; - typename Map<T>::const_iterator half1Fnd = - half1Values.find(i); + typename Map<T>::const_iterator half1Fnd = + half1Values.find(i); - if (half1Fnd != half1Values.end()) - { - const edge& e0 = edges[twoEdges[0]]; - const edge meshEdge0(meshPts[e0[0]], meshPts[e0[1]]); + if (half1Fnd != half1Values.end()) + { + const edge& e0 = edgesA[twoEdges[0]]; + const edge meshEdge0(meshPtsA[e0[0]], meshPtsA[e0[1]]); - combine - ( - edgeValues, - cop, - meshEdge0, // edge - half1Fnd() // value - ); - } + combine + ( + edgeValues, + cop, + meshEdge0, // edge + half1Fnd() // value + ); + } - typename Map<T>::const_iterator half0Fnd = - half0Values.find(i); - if (half0Fnd != half0Values.end()) - { - const edge& e1 = edges[twoEdges[1]]; - const edge meshEdge1(meshPts[e1[0]], meshPts[e1[1]]); + typename Map<T>::const_iterator half0Fnd = + half0Values.find(i); + if (half0Fnd != half0Values.end()) + { + const edge& e1 = edgesB[twoEdges[1]]; + const edge meshEdge1(meshPtsB[e1[0]], meshPtsB[e1[1]]); - combine - ( - edgeValues, - cop, - meshEdge1, // edge - half0Fnd() // value - ); + combine + ( + edgeValues, + cop, + meshEdge1, // edge + half0Fnd() // value + ); + } } } } @@ -759,7 +695,7 @@ void Foam::syncTools::syncEdgeMap slave++ ) { - IPstream fromSlave(Pstream::blocking, slave); + IPstream fromSlave(Pstream::scheduled, slave); EdgeMap<T> nbrValues(fromSlave); // Merge neighbouring values with my values @@ -784,7 +720,7 @@ void Foam::syncTools::syncEdgeMap ) { - OPstream toSlave(Pstream::blocking, slave); + OPstream toSlave(Pstream::scheduled, slave); toSlave << sharedEdgeValues; } } @@ -792,12 +728,12 @@ void Foam::syncTools::syncEdgeMap { // Send to master { - OPstream toMaster(Pstream::blocking, Pstream::masterNo()); + OPstream toMaster(Pstream::scheduled, Pstream::masterNo()); toMaster << sharedEdgeValues; } // Receive merged values { - IPstream fromMaster(Pstream::blocking, Pstream::masterNo()); + IPstream fromMaster(Pstream::scheduled, Pstream::masterNo()); fromMaster >> sharedEdgeValues; } } @@ -831,14 +767,14 @@ void Foam::syncTools::syncEdgeMap } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncPointList ( const polyMesh& mesh, UList<T>& pointValues, const CombineOp& cop, const T& nullValue, - const bool applySeparation + const TransformOp& top ) { if (pointValues.size() != mesh.nPoints()) @@ -860,11 +796,10 @@ void Foam::syncTools::syncPointList return; } - // Is there any coupled patch with transformation? - bool hasTransformation = false; - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -879,7 +814,7 @@ void Foam::syncTools::syncPointList refCast<const processorPolyPatch>(patches[patchI]); // Get data per patchPoint in neighbouring point numbers. - List<T> patchInfo(procPatch.nPoints(), nullValue); + Field<T> patchInfo(procPatch.nPoints()); const labelList& meshPts = procPatch.meshPoints(); const labelList& nbrPts = procPatch.neighbPoints(); @@ -887,17 +822,15 @@ void Foam::syncTools::syncPointList forAll(nbrPts, pointI) { label nbrPointI = nbrPts[pointI]; - if (nbrPointI >= 0 && nbrPointI < patchInfo.size()) - { - patchInfo[nbrPointI] = pointValues[meshPts[pointI]]; - } + patchInfo[nbrPointI] = pointValues[meshPts[pointI]]; } - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); toNbr << patchInfo; } } + pBufs.finishedSends(); // Receive and combine. @@ -911,32 +844,15 @@ void Foam::syncTools::syncPointList { const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - checkTransform(procPatch, applySeparation); - List<T> nbrPatchInfo(procPatch.nPoints()); + Field<T> nbrPatchInfo(procPatch.nPoints()); { - // We do not know the number of points on the other side - // so cannot use Pstream::read. - IPstream fromNbr - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); + UIPstream fromNbr(procPatch.neighbProcNo(), pBufs); fromNbr >> nbrPatchInfo; } - // Null any value which is not on neighbouring processor - nbrPatchInfo.setSize(procPatch.nPoints(), nullValue); - if (!procPatch.parallel()) - { - hasTransformation = true; - transformList(procPatch.forwardT(), nbrPatchInfo); - } - else if (applySeparation && procPatch.separated()) - { - hasTransformation = true; - separateList(-procPatch.separation(), nbrPatchInfo); - } + // Transform to this side + top(procPatch, nbrPatchInfo); const labelList& meshPts = procPatch.meshPoints(); @@ -957,77 +873,50 @@ void Foam::syncTools::syncPointList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - checkTransform(cycPatch, applySeparation); - - const edgeList& coupledPoints = cycPatch.coupledPoints(); - const labelList& meshPts = cycPatch.meshPoints(); - - List<T> half0Values(coupledPoints.size()); - List<T> half1Values(coupledPoints.size()); - - forAll(coupledPoints, i) + if (cycPatch.owner()) { - const edge& e = coupledPoints[i]; + // Owner does all. - label point0 = meshPts[e[0]]; - label point1 = meshPts[e[1]]; + const edgeList& coupledPoints = cycPatch.coupledPoints(); + const labelList& meshPts = cycPatch.meshPoints(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshPoints = nbrPatch.meshPoints(); - half0Values[i] = pointValues[point0]; - half1Values[i] = pointValues[point1]; - } + Field<T> half0Values(coupledPoints.size()); + Field<T> half1Values(coupledPoints.size()); - if (!cycPatch.parallel()) - { - hasTransformation = true; - transformList(cycPatch.reverseT(), half0Values); - transformList(cycPatch.forwardT(), half1Values); - } - else if (applySeparation && cycPatch.separated()) - { - hasTransformation = true; - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); - separateList(-v, half1Values); - } + forAll(coupledPoints, i) + { + const edge& e = coupledPoints[i]; + half0Values[i] = pointValues[meshPts[e[0]]]; + half1Values[i] = pointValues[nbrMeshPoints[e[1]]]; + } - forAll(coupledPoints, i) - { - const edge& e = coupledPoints[i]; + //SubField<T> slice0(half0Values, half0Values.size()); + //SubField<T> slice1(half1Values, half1Values.size()); + //top(cycPatch, reinterpret_cast<Field<T>&>(slice1)); + //top(nbrPatch, reinterpret_cast<Field<T>&>(slice0)); - label point0 = meshPts[e[0]]; - label point1 = meshPts[e[1]]; + top(cycPatch, half1Values); + top(nbrPatch, half0Values); - cop(pointValues[point0], half1Values[i]); - cop(pointValues[point1], half0Values[i]); + forAll(coupledPoints, i) + { + const edge& e = coupledPoints[i]; + cop(pointValues[meshPts[e[0]]], half1Values[i]); + cop(pointValues[nbrMeshPoints[e[1]]], half0Values[i]); + } } } } - //- Note: hasTransformation is only used for warning messages so - // reduction not strictly nessecary. - //reduce(hasTransformation, orOp<bool>()); - // Synchronize multiple shared points. const globalMeshData& pd = mesh.globalData(); if (pd.nGlobalPoints() > 0) { - if (hasTransformation) - { - WarningIn - ( - "syncTools<class T, class CombineOp>::syncPointList" - "(const polyMesh&, UList<T>&, const CombineOp&, const T&" - ", const bool)" - ) << "There are decomposed cyclics in this mesh with" - << " transformations." << endl - << "This is not supported. The result will be incorrect" - << endl; - } - - // Values on shared points. - List<T> sharedPts(pd.nGlobalPoints(), nullValue); + Field<T> sharedPts(pd.nGlobalPoints(), nullValue); forAll(pd.sharedPointLabels(), i) { @@ -1051,7 +940,7 @@ void Foam::syncTools::syncPointList } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncPointList ( const polyMesh& mesh, @@ -1059,7 +948,7 @@ void Foam::syncTools::syncPointList UList<T>& pointValues, const CombineOp& cop, const T& nullValue, - const bool applySeparation + const TransformOp& top ) { if (pointValues.size() != meshPoints.size()) @@ -1079,7 +968,7 @@ void Foam::syncTools::syncPointList return; } - List<T> meshValues(mesh.nPoints(), nullValue); + Field<T> meshValues(mesh.nPoints(), nullValue); forAll(meshPoints, i) { @@ -1092,7 +981,7 @@ void Foam::syncTools::syncPointList meshValues, cop, // combine op nullValue, // null value - applySeparation // separation + top // position or field ); forAll(meshPoints, i) @@ -1102,14 +991,14 @@ void Foam::syncTools::syncPointList } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncEdgeList ( const polyMesh& mesh, UList<T>& edgeValues, const CombineOp& cop, const T& nullValue, - const bool applySeparation + const TransformOp& top ) { if (edgeValues.size() != mesh.nEdges()) @@ -1131,11 +1020,10 @@ void Foam::syncTools::syncEdgeList return; } - // Is there any coupled patch with transformation? - bool hasTransformation = false; - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -1153,23 +1041,22 @@ void Foam::syncTools::syncEdgeList const labelList& neighbEdges = procPatch.neighbEdges(); // Get region per patch edge in neighbouring edge numbers. - List<T> patchInfo(procPatch.nEdges(), nullValue); + Field<T> patchInfo(procPatch.nEdges(), nullValue); forAll(neighbEdges, edgeI) { label nbrEdgeI = neighbEdges[edgeI]; - if (nbrEdgeI >= 0 && nbrEdgeI < patchInfo.size()) - { - patchInfo[nbrEdgeI] = edgeValues[meshEdges[edgeI]]; - } + patchInfo[nbrEdgeI] = edgeValues[meshEdges[edgeI]]; } - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); toNbr << patchInfo; - } + } } + pBufs.finishedSends(); + // Receive and combine. forAll(patches, patchI) @@ -1183,40 +1070,23 @@ void Foam::syncTools::syncEdgeList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - checkTransform(procPatch, applySeparation); - const labelList& meshEdges = procPatch.meshEdges(); // Receive from neighbour. Is per patch edge the region of the // neighbouring patch edge. - List<T> nbrPatchInfo(procPatch.nEdges()); + Field<T> nbrPatchInfo(procPatch.nEdges()); { - IPstream fromNeighb - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); + UIPstream fromNeighb(procPatch.neighbProcNo(), pBufs); fromNeighb >> nbrPatchInfo; } - // Null any value which is not on neighbouring processor - nbrPatchInfo.setSize(procPatch.nEdges(), nullValue); - if (!procPatch.parallel()) - { - hasTransformation = true; - transformList(procPatch.forwardT(), nbrPatchInfo); - } - else if (applySeparation && procPatch.separated()) - { - hasTransformation = true; - separateList(-procPatch.separation(), nbrPatchInfo); - } + // Transform to this side + top(procPatch, nbrPatchInfo); forAll(meshEdges, edgeI) { label meshEdgeI = meshEdges[edgeI]; - cop(edgeValues[meshEdgeI], nbrPatchInfo[edgeI]); } } @@ -1231,49 +1101,38 @@ void Foam::syncTools::syncEdgeList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - checkTransform(cycPatch, applySeparation); - - const edgeList& coupledEdges = cycPatch.coupledEdges(); - const labelList& meshEdges = cycPatch.meshEdges(); - - List<T> half0Values(coupledEdges.size()); - List<T> half1Values(coupledEdges.size()); - - forAll(coupledEdges, i) + if (cycPatch.owner()) { - const edge& e = coupledEdges[i]; - - label meshEdge0 = meshEdges[e[0]]; - label meshEdge1 = meshEdges[e[1]]; + // Owner does all. + const edgeList& coupledEdges = cycPatch.coupledEdges(); + const labelList& meshEdges = cycPatch.meshEdges(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshEdges = nbrPatch.meshEdges(); - half0Values[i] = edgeValues[meshEdge0]; - half1Values[i] = edgeValues[meshEdge1]; - } + Field<T> half0Values(coupledEdges.size()); + Field<T> half1Values(coupledEdges.size()); - if (!cycPatch.parallel()) - { - hasTransformation = true; - transformList(cycPatch.reverseT(), half0Values); - transformList(cycPatch.forwardT(), half1Values); - } - else if (applySeparation && cycPatch.separated()) - { - hasTransformation = true; - - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); - separateList(-v, half1Values); - } + forAll(coupledEdges, i) + { + const edge& e = coupledEdges[i]; + half0Values[i] = edgeValues[meshEdges[e[0]]]; + half1Values[i] = edgeValues[nbrMeshEdges[e[1]]]; + } - forAll(coupledEdges, i) - { - const edge& e = coupledEdges[i]; + //SubField<T> slice0(half0Values, half0Values.size()); + //SubField<T> slice1(half1Values, half1Values.size()); + //top(cycPatch, reinterpret_cast<Field<T>&>(slice1)); + //top(nbrPatch, reinterpret_cast<Field<T>&>(slice0)); - label meshEdge0 = meshEdges[e[0]]; - label meshEdge1 = meshEdges[e[1]]; + top(cycPatch, half1Values); + top(nbrPatch, half0Values); - cop(edgeValues[meshEdge0], half1Values[i]); - cop(edgeValues[meshEdge1], half0Values[i]); + forAll(coupledEdges, i) + { + const edge& e = coupledEdges[i]; + cop(edgeValues[meshEdges[e[0]]], half1Values[i]); + cop(edgeValues[nbrMeshEdges[e[1]]], half0Values[i]); + } } } } @@ -1287,21 +1146,8 @@ void Foam::syncTools::syncEdgeList if (pd.nGlobalEdges() > 0) { - if (hasTransformation) - { - WarningIn - ( - "syncTools<class T, class CombineOp>::syncEdgeList" - "(const polyMesh&, UList<T>&, const CombineOp&, const T&" - ", const bool)" - ) << "There are decomposed cyclics in this mesh with" - << " transformations." << endl - << "This is not supported. The result will be incorrect" - << endl; - } - // Values on shared edges. - List<T> sharedPts(pd.nGlobalEdges(), nullValue); + Field<T> sharedPts(pd.nGlobalEdges(), nullValue); forAll(pd.sharedEdgeLabels(), i) { @@ -1326,13 +1172,13 @@ void Foam::syncTools::syncEdgeList } -template <class T, class CombineOp> +template <class T, class CombineOp, class TransformOp> void Foam::syncTools::syncBoundaryFaceList ( const polyMesh& mesh, UList<T>& faceValues, const CombineOp& cop, - const bool applySeparation + const TransformOp& top ) { const label nBFaces = mesh.nFaces() - mesh.nInternalFaces(); @@ -1359,6 +1205,8 @@ void Foam::syncTools::syncBoundaryFaceList if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -1374,26 +1222,21 @@ void Foam::syncTools::syncBoundaryFaceList label patchStart = procPatch.start()-mesh.nInternalFaces(); - if (contiguous<T>()) - { - OPstream::write + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); + toNbr << + SubField<T> ( - Pstream::blocking, - procPatch.neighbProcNo(), - reinterpret_cast<const char*>(&faceValues[patchStart]), - procPatch.size()*sizeof(T) + faceValues, + procPatch.size(), + patchStart ); - } - else - { - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); - toNbr << - SubList<T>(faceValues, procPatch.size(), patchStart); - } } } + pBufs.finishedSends(); + + // Receive and combine. forAll(patches, patchI) @@ -1407,37 +1250,12 @@ void Foam::syncTools::syncBoundaryFaceList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - List<T> nbrPatchInfo(procPatch.size()); + Field<T> nbrPatchInfo(procPatch.size()); - if (contiguous<T>()) - { - IPstream::read - ( - Pstream::blocking, - procPatch.neighbProcNo(), - reinterpret_cast<char*>(nbrPatchInfo.begin()), - nbrPatchInfo.byteSize() - ); - } - else - { - IPstream fromNeighb - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - fromNeighb >> nbrPatchInfo; - } - - if (!procPatch.parallel()) - { - transformList(procPatch.forwardT(), nbrPatchInfo); - } - else if (applySeparation && procPatch.separated()) - { - separateList(-procPatch.separation(), nbrPatchInfo); - } + UIPstream fromNeighb(procPatch.neighbProcNo(), pBufs); + fromNeighb >> nbrPatchInfo; + top(procPatch, nbrPatchInfo); label bFaceI = procPatch.start()-mesh.nInternalFaces(); @@ -1457,103 +1275,40 @@ void Foam::syncTools::syncBoundaryFaceList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - label patchStart = cycPatch.start()-mesh.nInternalFaces(); + if (cycPatch.owner()) + { + // Owner does all. + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + label ownStart = cycPatch.start()-mesh.nInternalFaces(); + label nbrStart = nbrPatch.start()-mesh.nInternalFaces(); - label half = cycPatch.size()/2; - label half1Start = patchStart+half; + label sz = cycPatch.size(); - List<T> half0Values(SubList<T>(faceValues, half, patchStart)); - List<T> half1Values(SubList<T>(faceValues, half, half1Start)); + // Transform (copy of) data on both sides + Field<T> ownVals(SubField<T>(faceValues, sz, ownStart)); + top(nbrPatch, ownVals); - if (!cycPatch.parallel()) - { - transformList(cycPatch.reverseT(), half0Values); - transformList(cycPatch.forwardT(), half1Values); - } - else if (applySeparation && cycPatch.separated()) - { - const vectorField& v = cycPatch.coupledPolyPatch::separation(); - separateList(v, half0Values); - separateList(-v, half1Values); - } + Field<T> nbrVals(SubField<T>(faceValues, sz, nbrStart)); + top(cycPatch, nbrVals); - label i0 = patchStart; - forAll(half1Values, i) - { - cop(faceValues[i0++], half1Values[i]); - } + label i0 = ownStart; + forAll(nbrVals, i) + { + cop(faceValues[i0++], nbrVals[i]); + } - label i1 = half1Start; - forAll(half0Values, i) - { - cop(faceValues[i1++], half0Values[i]); + label i1 = nbrStart; + forAll(ownVals, i) + { + cop(faceValues[i1++], ownVals[i]); + } } } } } -template <class T, class CombineOp> -void Foam::syncTools::syncFaceList -( - const polyMesh& mesh, - UList<T>& faceValues, - const CombineOp& cop, - const bool applySeparation -) -{ - if (faceValues.size() != mesh.nFaces()) - { - FatalErrorIn - ( - "syncTools<class T, class CombineOp>::syncFaceList" - "(const polyMesh&, UList<T>&, const CombineOp&" - ", const bool)" - ) << "Number of values " << faceValues.size() - << " is not equal to the number of faces in the mesh " - << mesh.nFaces() << abort(FatalError); - } - - SubList<T> bndValues - ( - faceValues, - mesh.nFaces()-mesh.nInternalFaces(), - mesh.nInternalFaces() - ); - - syncBoundaryFaceList - ( - mesh, - bndValues, - cop, - applySeparation - ); -} - - -template <class T> -void Foam::syncTools::swapBoundaryFaceList -( - const polyMesh& mesh, - UList<T>& faceValues, - const bool applySeparation -) -{ - syncBoundaryFaceList(mesh, faceValues, eqOp<T>(), applySeparation); -} - - -template <class T> -void Foam::syncTools::swapFaceList -( - const polyMesh& mesh, - UList<T>& faceValues, - const bool applySeparation -) -{ - syncFaceList(mesh, faceValues, eqOp<T>(), applySeparation); -} - +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // template <unsigned nBits, class CombineOp> void Foam::syncTools::syncFaceList @@ -1581,11 +1336,10 @@ void Foam::syncTools::syncFaceList return; } - // Patch data (proc patches only). - List<List<unsigned int> > patchValues(patches.size()); - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -1599,19 +1353,20 @@ void Foam::syncTools::syncFaceList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - patchValues[patchI].setSize(procPatch.size()); + List<unsigned int> patchInfo(procPatch.size()); forAll(procPatch, i) { - patchValues[patchI][i] = - faceValues.get(procPatch.start()+i); + patchInfo[i] = faceValues[procPatch.start()+i]; } - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); - toNbr << patchValues[patchI]; + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); + toNbr << patchInfo; } } + pBufs.finishedSends(); + // Receive and combine. forAll(patches, patchI) @@ -1625,23 +1380,20 @@ void Foam::syncTools::syncFaceList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); + List<unsigned int> patchInfo(procPatch.size()); { - IPstream fromNbr - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - fromNbr >> patchValues[patchI]; + UIPstream fromNbr(procPatch.neighbProcNo(), pBufs); + fromNbr >> patchInfo; } // Combine (bitwise) forAll(procPatch, i) { - unsigned int patchVal = patchValues[patchI][i]; + unsigned int patchVal = patchInfo[i]; label meshFaceI = procPatch.start()+i; - unsigned int faceVal = faceValues.get(meshFaceI); + unsigned int faceVal = faceValues[meshFaceI]; cop(faceVal, patchVal); - faceValues.set(meshFaceI, faceVal); + faceValues[meshFaceI] = faceVal; } } } @@ -1655,21 +1407,25 @@ void Foam::syncTools::syncFaceList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - label half = cycPatch.size()/2; - - for (label i = 0; i < half; i++) + if (cycPatch.owner()) { - label meshFace0 = cycPatch.start()+i; - unsigned int val0 = faceValues.get(meshFace0); - label meshFace1 = meshFace0 + half; - unsigned int val1 = faceValues.get(meshFace1); + // Owner does all. + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); - unsigned int t = val0; - cop(t, val1); - faceValues.set(meshFace0, t); + for (label i = 0; i < cycPatch.size(); i++) + { + label meshFace0 = cycPatch.start()+i; + unsigned int val0 = faceValues[meshFace0]; + label meshFace1 = nbrPatch.start()+i; + unsigned int val1 = faceValues[meshFace1]; + + unsigned int t = val0; + cop(t, val1); + faceValues[meshFace0] = t; - cop(val1, val0); - faceValues.set(meshFace1, val1); + cop(val1, val0); + faceValues[meshFace1] = val1; + } } } } @@ -1702,7 +1458,7 @@ void Foam::syncTools::syncPointList ( "syncTools<unsigned nBits, class CombineOp>::syncPointList" "(const polyMesh&, PackedList<nBits>&, const CombineOp&" - ", const unsigned int&)" + ", const unsigned int)" ) << "Number of values " << pointValues.size() << " is not equal to the number of points in the mesh " << mesh.nPoints() << abort(FatalError); @@ -1715,11 +1471,10 @@ void Foam::syncTools::syncPointList return; } - // Patch data (proc patches only). - List<List<unsigned int> > patchValues(patches.size()); - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -1733,8 +1488,7 @@ void Foam::syncTools::syncPointList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - patchValues[patchI].setSize(procPatch.nPoints()); - patchValues[patchI] = nullValue; + List<unsigned int> patchInfo(procPatch.nPoints()); const labelList& meshPts = procPatch.meshPoints(); const labelList& nbrPts = procPatch.neighbPoints(); @@ -1742,19 +1496,17 @@ void Foam::syncTools::syncPointList forAll(nbrPts, pointI) { label nbrPointI = nbrPts[pointI]; - if (nbrPointI >= 0 && nbrPointI < procPatch.nPoints()) - { - patchValues[patchI][nbrPointI] = - pointValues.get(meshPts[pointI]); - } + patchInfo[nbrPointI] = pointValues[meshPts[pointI]]; } - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); - toNbr << patchValues[patchI]; + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); + toNbr << patchInfo; } } + pBufs.finishedSends(); + // Receive and combine. forAll(patches, patchI) @@ -1768,28 +1520,22 @@ void Foam::syncTools::syncPointList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); + List<unsigned int> nbrPatchInfo(procPatch.nPoints()); { // We do not know the number of points on the other side // so cannot use Pstream::read. - IPstream fromNbr - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - fromNbr >> patchValues[patchI]; + UIPstream fromNbr(procPatch.neighbProcNo(), pBufs); + fromNbr >> nbrPatchInfo; } - // Null any value which is not on neighbouring processor - patchValues[patchI].setSize(procPatch.nPoints(), nullValue); - const labelList& meshPts = procPatch.meshPoints(); forAll(meshPts, pointI) { label meshPointI = meshPts[pointI]; - unsigned int pointVal = pointValues.get(meshPointI); - cop(pointVal, patchValues[patchI][pointI]); - pointValues.set(meshPointI, pointVal); + unsigned int pointVal = pointValues[meshPointI]; + cop(pointVal, nbrPatchInfo[pointI]); + pointValues[meshPointI] = pointVal; } } } @@ -1803,24 +1549,30 @@ void Foam::syncTools::syncPointList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - const edgeList& coupledPoints = cycPatch.coupledPoints(); - const labelList& meshPts = cycPatch.meshPoints(); - - forAll(coupledPoints, i) + if (cycPatch.owner()) { - const edge& e = coupledPoints[i]; - - label point0 = meshPts[e[0]]; - label point1 = meshPts[e[1]]; + // Owner does all. - unsigned int val0 = pointValues.get(point0); - unsigned int t = val0; - unsigned int val1 = pointValues.get(point1); + const edgeList& coupledPoints = cycPatch.coupledPoints(); + const labelList& meshPts = cycPatch.meshPoints(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshPts = nbrPatch.meshPoints(); - cop(t, val1); - pointValues.set(point0, t); - cop(val1, val0); - pointValues.set(point1, val1); + forAll(coupledPoints, i) + { + const edge& e = coupledPoints[i]; + label meshPoint0 = meshPts[e[0]]; + label meshPoint1 = nbrMeshPts[e[1]]; + + unsigned int val0 = pointValues[meshPoint0]; + unsigned int val1 = pointValues[meshPoint1]; + unsigned int t = val0; + + cop(val0, val1); + pointValues[meshPoint0] = val0; + cop(val1, t); + pointValues[meshPoint1] = val1; + } } } } @@ -1837,7 +1589,7 @@ void Foam::syncTools::syncPointList { label meshPointI = pd.sharedPointLabels()[i]; // Fill my entries in the shared points - sharedPts[pd.sharedPointAddr()[i]] = pointValues.get(meshPointI); + sharedPts[pd.sharedPointAddr()[i]] = pointValues[meshPointI]; } // Combine on master. @@ -1849,7 +1601,7 @@ void Foam::syncTools::syncPointList forAll(pd.sharedPointLabels(), i) { label meshPointI = pd.sharedPointLabels()[i]; - pointValues.set(meshPointI, sharedPts[pd.sharedPointAddr()[i]]); + pointValues[meshPointI] = sharedPts[pd.sharedPointAddr()[i]]; } } } @@ -1870,7 +1622,7 @@ void Foam::syncTools::syncEdgeList ( "syncTools<unsigned nBits, class CombineOp>::syncEdgeList" "(const polyMesh&, PackedList<nBits>&, const CombineOp&" - ", const unsigned int&)" + ", const unsigned int)" ) << "Number of values " << edgeValues.size() << " is not equal to the number of edges in the mesh " << mesh.nEdges() << abort(FatalError); @@ -1883,11 +1635,10 @@ void Foam::syncTools::syncEdgeList return; } - // Patch data (proc patches only). - List<List<unsigned int> > patchValues(patches.size()); - if (Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send forAll(patches, patchI) @@ -1901,7 +1652,7 @@ void Foam::syncTools::syncEdgeList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); - patchValues[patchI].setSize(procPatch.nEdges(), nullValue); + List<unsigned int> patchInfo(procPatch.nEdges()); const labelList& meshEdges = procPatch.meshEdges(); const labelList& neighbEdges = procPatch.neighbEdges(); @@ -1909,18 +1660,15 @@ void Foam::syncTools::syncEdgeList forAll(neighbEdges, edgeI) { label nbrEdgeI = neighbEdges[edgeI]; - if (nbrEdgeI >= 0 && nbrEdgeI < procPatch.nEdges()) - { - patchValues[patchI][nbrEdgeI] = - edgeValues.get(meshEdges[edgeI]); - } + patchInfo[nbrEdgeI] = edgeValues[meshEdges[edgeI]]; } - OPstream toNbr(Pstream::blocking, procPatch.neighbProcNo()); - toNbr << patchValues[patchI]; + UOPstream toNbr(procPatch.neighbProcNo(), pBufs); + toNbr << patchInfo; } } + pBufs.finishedSends(); // Receive and combine. @@ -1935,26 +1683,23 @@ void Foam::syncTools::syncEdgeList const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(patches[patchI]); + // Receive from neighbour. + List<unsigned int> nbrPatchInfo(procPatch.nEdges()); + { - IPstream fromNeighb - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - fromNeighb >> patchValues[patchI]; + UIPstream fromNeighb(procPatch.neighbProcNo(), pBufs); + fromNeighb >> nbrPatchInfo; } - patchValues[patchI].setSize(procPatch.nEdges(), nullValue); - const labelList& meshEdges = procPatch.meshEdges(); forAll(meshEdges, edgeI) { - unsigned int patchVal = patchValues[patchI][edgeI]; + unsigned int patchVal = nbrPatchInfo[edgeI]; label meshEdgeI = meshEdges[edgeI]; - unsigned int edgeVal = edgeValues.get(meshEdgeI); + unsigned int edgeVal = edgeValues[meshEdgeI]; cop(edgeVal, patchVal); - edgeValues.set(meshEdgeI, edgeVal); + edgeValues[meshEdgeI] = edgeVal; } } } @@ -1968,24 +1713,30 @@ void Foam::syncTools::syncEdgeList const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch>(patches[patchI]); - const edgeList& coupledEdges = cycPatch.coupledEdges(); - const labelList& meshEdges = cycPatch.meshEdges(); - - forAll(coupledEdges, i) + if (cycPatch.owner()) { - const edge& e = coupledEdges[i]; + // Owner does all. + const edgeList& coupledEdges = cycPatch.coupledEdges(); + const labelList& meshEdges = cycPatch.meshEdges(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshEdges = nbrPatch.meshEdges(); - label edge0 = meshEdges[e[0]]; - label edge1 = meshEdges[e[1]]; + forAll(coupledEdges, i) + { + const edge& e = coupledEdges[i]; + + label edge0 = meshEdges[e[0]]; + label edge1 = nbrMeshEdges[e[1]]; - unsigned int val0 = edgeValues.get(edge0); - unsigned int t = val0; - unsigned int val1 = edgeValues.get(edge1); + unsigned int val0 = edgeValues[edge0]; + unsigned int t = val0; + unsigned int val1 = edgeValues[edge1]; - cop(t, val1); - edgeValues.set(edge0, t); - cop(val1, val0); - edgeValues.set(edge1, val1); + cop(t, val1); + edgeValues[edge0] = t; + cop(val1, val0); + edgeValues[edge1] = val1; + } } } } @@ -2002,7 +1753,7 @@ void Foam::syncTools::syncEdgeList { label meshEdgeI = pd.sharedEdgeLabels()[i]; // Fill my entries in the shared edges - sharedPts[pd.sharedEdgeAddr()[i]] = edgeValues.get(meshEdgeI); + sharedPts[pd.sharedEdgeAddr()[i]] = edgeValues[meshEdgeI]; } // Combine on master. @@ -2014,7 +1765,7 @@ void Foam::syncTools::syncEdgeList forAll(pd.sharedEdgeLabels(), i) { label meshEdgeI = pd.sharedEdgeLabels()[i]; - edgeValues.set(meshEdgeI, sharedPts[pd.sharedEdgeAddr()[i]]); + edgeValues[meshEdgeI] = sharedPts[pd.sharedEdgeAddr()[i]]; } } } diff --git a/src/OpenFOAM/meshes/polyMesh/zones/faceZone/faceZone.C b/src/OpenFOAM/meshes/polyMesh/zones/faceZone/faceZone.C index 8c5b79e80a25f8b8b931795dc6b205e74336e1fb..ddda6efaf96248e2496a015db334b128fa3a4e6e 100644 --- a/src/OpenFOAM/meshes/polyMesh/zones/faceZone/faceZone.C +++ b/src/OpenFOAM/meshes/polyMesh/zones/faceZone/faceZone.C @@ -463,9 +463,9 @@ bool Foam::faceZone::checkParallelSync(const bool report) const } } boolList myZoneFace(neiZoneFace); - syncTools::swapBoundaryFaceList(mesh, neiZoneFace, false); + syncTools::swapBoundaryFaceList(mesh, neiZoneFace); boolList myZoneFlip(neiZoneFlip); - syncTools::swapBoundaryFaceList(mesh, neiZoneFlip, false); + syncTools::swapBoundaryFaceList(mesh, neiZoneFlip); forAll(*this, i) { diff --git a/src/dynamicFvMesh/dynamicRefineFvMesh/dynamicRefineFvMesh.C b/src/dynamicFvMesh/dynamicRefineFvMesh/dynamicRefineFvMesh.C index a8b9ec79878a31c5b47a63b74aecd1690ba01b3d..5ecd3efdb9f28220ca7aa12b46ea7a021982ddf4 100644 --- a/src/dynamicFvMesh/dynamicRefineFvMesh/dynamicRefineFvMesh.C +++ b/src/dynamicFvMesh/dynamicRefineFvMesh/dynamicRefineFvMesh.C @@ -84,7 +84,7 @@ void Foam::dynamicRefineFvMesh::calculateProtectedCells { neiLevel[faceI-nInternalFaces()] = cellLevel[faceOwner()[faceI]]; } - syncTools::swapBoundaryFaceList(*this, neiLevel, false); + syncTools::swapBoundaryFaceList(*this, neiLevel); while (true) @@ -122,7 +122,7 @@ void Foam::dynamicRefineFvMesh::calculateProtectedCells } } - syncTools::syncFaceList(*this, seedFace, orEqOp<bool>(), false); + syncTools::syncFaceList(*this, seedFace, orEqOp<bool>()); // Extend unrefineableCell @@ -846,7 +846,7 @@ void Foam::dynamicRefineFvMesh::extendMarkedCells } } - syncTools::syncFaceList(*this, markedFace, orEqOp<bool>(), false); + syncTools::syncFaceList(*this, markedFace, orEqOp<bool>()); // Update cells using any markedFace for (label faceI = 0; faceI < nInternalFaces(); faceI++) @@ -933,7 +933,7 @@ Foam::dynamicRefineFvMesh::dynamicRefineFvMesh(const IOobject& io) { neiLevel[faceI] = cellLevel[faceOwner()[faceI]]; } - syncTools::swapFaceList(*this, neiLevel, false); + syncTools::swapFaceList(*this, neiLevel); boolList protectedFace(nFaces(), false); @@ -965,13 +965,7 @@ Foam::dynamicRefineFvMesh::dynamicRefineFvMesh(const IOobject& io) } } - syncTools::syncFaceList - ( - *this, - protectedFace, - orEqOp<bool>(), - false - ); + syncTools::syncFaceList(*this, protectedFace, orEqOp<bool>()); for (label faceI = 0; faceI < nInternalFaces(); faceI++) { diff --git a/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.C b/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.C index 889f15c5f23633b45d0a32a1083855aab09fae73..7524a0723f47b55974130d83e02616c9e8720cfb 100644 --- a/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.C +++ b/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.C @@ -29,6 +29,9 @@ License #include "faceCoupleInfo.H" #include "processorFvPatchField.H" #include "processorFvsPatchField.H" +#include "processorCyclicPolyPatch.H" +#include "processorCyclicFvPatchField.H" +#include "processorCyclicFvsPatchField.H" #include "polyTopoChange.H" #include "removeCells.H" #include "polyModifyFace.H" @@ -128,6 +131,7 @@ void Foam::fvMeshDistribute::printMeshInfo(const fvMesh& mesh) { Pout<< "Primitives:" << nl << " points :" << mesh.nPoints() << nl + << " bb :" << boundBox(mesh.points(), false) << nl << " internalFaces:" << mesh.nInternalFaces() << nl << " faces :" << mesh.nFaces() << nl << " cells :" << mesh.nCells() << nl; @@ -187,7 +191,8 @@ void Foam::fvMeshDistribute::printCoupleInfo const primitiveMesh& mesh, const labelList& sourceFace, const labelList& sourceProc, - const labelList& sourceNewProc + const labelList& sourcePatch, + const labelList& sourceNewNbrProc ) { Pout<< nl @@ -202,7 +207,7 @@ void Foam::fvMeshDistribute::printCoupleInfo << " fc:" << mesh.faceCentres()[meshFaceI] << " connects to proc:" << sourceProc[bFaceI] << "/face:" << sourceFace[bFaceI] - << " which will move to proc:" << sourceNewProc[bFaceI] + << " which will move to proc:" << sourceNewNbrProc[bFaceI] << endl; } } @@ -270,32 +275,87 @@ Foam::label Foam::fvMeshDistribute::findNonEmptyPatch() const } -// Appends processorPolyPatch. Returns patchID. -Foam::label Foam::fvMeshDistribute::addProcPatch -( - const word& patchName, - const label nbrProc -) +//// Appends processorPolyPatch. Returns patchID. +//Foam::label Foam::fvMeshDistribute::addProcPatch +//( +// const word& patchName, +// const label nbrProc +//) +//{ +// // Clear local fields and e.g. polyMesh globalMeshData. +// mesh_.clearOut(); +// +// +// polyBoundaryMesh& polyPatches = +// const_cast<polyBoundaryMesh&>(mesh_.boundaryMesh()); +// fvBoundaryMesh& fvPatches = const_cast<fvBoundaryMesh&>(mesh_.boundary()); +// +// if (polyPatches.findPatchID(patchName) != -1) +// { +// FatalErrorIn("fvMeshDistribute::addProcPatch(const word&, const label)") +// << "Cannot create patch " << patchName << " since already exists." +// << nl +// << "Current patch names:" << polyPatches.names() +// << exit(FatalError); +// } +// +// +// +// // Add the patch +// // ~~~~~~~~~~~~~ +// +// label sz = polyPatches.size(); +// +// // Add polyPatch +// polyPatches.setSize(sz+1); +// polyPatches.set +// ( +// sz, +// new processorPolyPatch +// ( +// patchName, +// 0, // size +// mesh_.nFaces(), +// sz, +// mesh_.boundaryMesh(), +// Pstream::myProcNo(), +// nbrProc +// ) +// ); +// fvPatches.setSize(sz+1); +// fvPatches.set +// ( +// sz, +// fvPatch::New +// ( +// polyPatches[sz], // point to newly added polyPatch +// mesh_.boundary() +// ) +// ); +// +// return sz; +//} + + +// Appends polyPatch. Returns patchID. +Foam::label Foam::fvMeshDistribute::addPatch(polyPatch* patchPtr) { // Clear local fields and e.g. polyMesh globalMeshData. mesh_.clearOut(); - polyBoundaryMesh& polyPatches = const_cast<polyBoundaryMesh&>(mesh_.boundaryMesh()); fvBoundaryMesh& fvPatches = const_cast<fvBoundaryMesh&>(mesh_.boundary()); - if (polyPatches.findPatchID(patchName) != -1) + if (polyPatches.findPatchID(patchPtr->name()) != -1) { - FatalErrorIn("fvMeshDistribute::addProcPatch(const word&, const label)") - << "Cannot create patch " << patchName << " since already exists." - << nl - << "Current patch names:" << polyPatches.names() - << exit(FatalError); + FatalErrorIn("fvMeshDistribute::addPatch(polyPatch*)") + << "Cannot create patch " << patchPtr->name() + << " since already exists." << nl + << "Current patch names:" << polyPatches.names() << exit(FatalError); } - // Add the patch // ~~~~~~~~~~~~~ @@ -303,20 +363,7 @@ Foam::label Foam::fvMeshDistribute::addProcPatch // Add polyPatch polyPatches.setSize(sz+1); - polyPatches.set - ( - sz, - new processorPolyPatch - ( - patchName, - 0, // size - mesh_.nFaces(), - sz, - mesh_.boundaryMesh(), - Pstream::myProcNo(), - nbrProc - ) - ); + polyPatches.set(sz, patchPtr); fvPatches.setSize(sz+1); fvPatches.set ( @@ -624,25 +671,27 @@ void Foam::fvMeshDistribute::getNeighbourData const labelList& distribution, labelList& sourceFace, labelList& sourceProc, - labelList& sourceNewProc + labelList& sourcePatch, + labelList& sourceNewNbrProc ) const { label nBnd = mesh_.nFaces() - mesh_.nInternalFaces(); sourceFace.setSize(nBnd); sourceProc.setSize(nBnd); - sourceNewProc.setSize(nBnd); + sourcePatch.setSize(nBnd); + sourceNewNbrProc.setSize(nBnd); const polyBoundaryMesh& patches = mesh_.boundaryMesh(); // Get neighbouring meshFace labels and new processor of coupled boundaries. labelList nbrFaces(nBnd, -1); - labelList nbrNewProc(nBnd, -1); + labelList nbrNewNbrProc(nBnd, -1); forAll(patches, patchI) { const polyPatch& pp = patches[patchI]; - if (isA<processorPolyPatch>(pp)) + if (pp.coupled()) { label offset = pp.start() - mesh_.nInternalFaces(); @@ -654,7 +703,7 @@ void Foam::fvMeshDistribute::getNeighbourData } // Which processor they will end up on - SubList<label>(nbrNewProc, pp.size(), offset).assign + SubList<label>(nbrNewNbrProc, pp.size(), offset).assign ( UIndirectList<label>(distribution, pp.faceCells())() ); @@ -663,8 +712,8 @@ void Foam::fvMeshDistribute::getNeighbourData // Exchange the boundary data - syncTools::swapBoundaryFaceList(mesh_, nbrFaces, false); - syncTools::swapBoundaryFaceList(mesh_, nbrNewProc, false); + syncTools::swapBoundaryFaceList(mesh_, nbrFaces); + syncTools::swapBoundaryFaceList(mesh_, nbrNewNbrProc); forAll(patches, patchI) @@ -679,7 +728,7 @@ void Foam::fvMeshDistribute::getNeighbourData // Check which of the two faces we store. - if (Pstream::myProcNo() < procPatch.neighbProcNo()) + if (procPatch.owner()) { // Use my local face labels forAll(pp, i) @@ -687,7 +736,7 @@ void Foam::fvMeshDistribute::getNeighbourData label bndI = offset + i; sourceFace[bndI] = pp.start()+i; sourceProc[bndI] = Pstream::myProcNo(); - sourceNewProc[bndI] = nbrNewProc[bndI]; + sourceNewNbrProc[bndI] = nbrNewNbrProc[bndI]; } } else @@ -698,7 +747,50 @@ void Foam::fvMeshDistribute::getNeighbourData label bndI = offset + i; sourceFace[bndI] = nbrFaces[bndI]; sourceProc[bndI] = procPatch.neighbProcNo(); - sourceNewProc[bndI] = nbrNewProc[bndI]; + sourceNewNbrProc[bndI] = nbrNewNbrProc[bndI]; + } + } + + + label patchI = -1; + if (isA<processorCyclicPolyPatch>(pp)) + { + patchI = refCast<const processorCyclicPolyPatch> + ( + pp + ).referPatchID(); + } + + forAll(pp, i) + { + label bndI = offset + i; + sourcePatch[bndI] = patchI; + } + } + else if (isA<cyclicPolyPatch>(pp)) + { + const cyclicPolyPatch& cpp = refCast<const cyclicPolyPatch>(pp); + + if (cpp.owner()) + { + forAll(pp, i) + { + label bndI = offset + i; + sourceFace[bndI] = pp.start()+i; + sourceProc[bndI] = Pstream::myProcNo(); + sourcePatch[bndI] = patchI; + sourceNewNbrProc[bndI] = nbrNewNbrProc[bndI]; + } + } + else + { + forAll(pp, i) + { + label bndI = offset + i; + sourceFace[bndI] = nbrFaces[bndI]; + sourceProc[bndI] = Pstream::myProcNo(); + sourcePatch[bndI] = patchI; + sourceNewNbrProc[bndI] = nbrNewNbrProc[bndI]; } } } @@ -708,9 +800,10 @@ void Foam::fvMeshDistribute::getNeighbourData forAll(pp, i) { label bndI = offset + i; - sourceFace[bndI] = patchI; + sourceFace[bndI] = -1; sourceProc[bndI] = -1; - sourceNewProc[bndI] = -1; + sourcePatch[bndI] = patchI; + sourceNewNbrProc[bndI] = -1; } } } @@ -731,16 +824,19 @@ void Foam::fvMeshDistribute::subsetBoundaryData const labelList& sourceFace, const labelList& sourceProc, - const labelList& sourceNewProc, + const labelList& sourcePatch, + const labelList& sourceNewNbrProc, labelList& subFace, labelList& subProc, - labelList& subNewProc + labelList& subPatch, + labelList& subNewNbrProc ) { subFace.setSize(mesh.nFaces() - mesh.nInternalFaces()); subProc.setSize(mesh.nFaces() - mesh.nInternalFaces()); - subNewProc.setSize(mesh.nFaces() - mesh.nInternalFaces()); + subPatch.setSize(mesh.nFaces() - mesh.nInternalFaces()); + subNewNbrProc.setSize(mesh.nFaces() - mesh.nInternalFaces()); forAll(subFace, newBFaceI) { @@ -753,6 +849,7 @@ void Foam::fvMeshDistribute::subsetBoundaryData { subFace[newBFaceI] = oldFaceI; subProc[newBFaceI] = Pstream::myProcNo(); + subPatch[newBFaceI] = -1; label oldOwn = oldFaceOwner[oldFaceI]; label oldNei = oldFaceNeighbour[oldFaceI]; @@ -760,12 +857,12 @@ void Foam::fvMeshDistribute::subsetBoundaryData if (oldOwn == cellMap[mesh.faceOwner()[newFaceI]]) { // We kept the owner side. Where does the neighbour move to? - subNewProc[newBFaceI] = oldDistribution[oldNei]; + subNewNbrProc[newBFaceI] = oldDistribution[oldNei]; } else { // We kept the neighbour side. - subNewProc[newBFaceI] = oldDistribution[oldOwn]; + subNewNbrProc[newBFaceI] = oldDistribution[oldOwn]; } } else @@ -775,7 +872,8 @@ void Foam::fvMeshDistribute::subsetBoundaryData subFace[newBFaceI] = sourceFace[oldBFaceI]; subProc[newBFaceI] = sourceProc[oldBFaceI]; - subNewProc[newBFaceI] = sourceNewProc[oldBFaceI]; + subPatch[newBFaceI] = sourcePatch[oldBFaceI]; + subNewNbrProc[newBFaceI] = sourceNewNbrProc[oldBFaceI]; } } } @@ -788,11 +886,13 @@ void Foam::fvMeshDistribute::findCouples const primitiveMesh& mesh, const labelList& sourceFace, const labelList& sourceProc, + const labelList& sourcePatch, const label domain, const primitiveMesh& domainMesh, const labelList& domainFace, const labelList& domainProc, + const labelList& domainPatch, labelList& masterCoupledFaces, labelList& slaveCoupledFaces @@ -802,9 +902,16 @@ void Foam::fvMeshDistribute::findCouples // with same face+proc. HashTable<label, labelPair, labelPair::Hash<> > map(domainFace.size()); - forAll(domainFace, bFaceI) + forAll(domainProc, bFaceI) { - map.insert(labelPair(domainFace[bFaceI], domainProc[bFaceI]), bFaceI); + if (domainProc[bFaceI] != -1 && domainPatch[bFaceI] == -1) + { + map.insert + ( + labelPair(domainFace[bFaceI], domainProc[bFaceI]), + bFaceI + ); + } } @@ -816,7 +923,7 @@ void Foam::fvMeshDistribute::findCouples forAll(sourceFace, bFaceI) { - if (sourceProc[bFaceI] != -1) + if (sourceProc[bFaceI] != -1 && sourcePatch[bFaceI] == -1) { labelPair myData(sourceFace[bFaceI], sourceProc[bFaceI]); @@ -934,105 +1041,202 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::fvMeshDistribute::doRemoveCells // the processor patchID. void Foam::fvMeshDistribute::addProcPatches ( - const labelList& neighbourNewProc, // processor that neighbour is on - labelList& procPatchID + const labelList& nbrProc, // processor that neighbour is now on + const labelList& referPatchID, // patchID (or -1) I originated from + List<Map<label> >& procPatchID ) { - // Now use the neighbourFace/Proc to repatch the mesh. These two lists + // Now use the neighbourFace/Proc to repatch the mesh. These lists // contain for all current boundary faces the global patchID (for non-proc // patch) or the processor. - labelList procPatchSizes(Pstream::nProcs(), 0); - - forAll(neighbourNewProc, bFaceI) - { - if (neighbourNewProc[bFaceI] != -1) - { - procPatchSizes[neighbourNewProc[bFaceI]]++; - } - } - - // Per neighbour processor the label of the processor patch procPatchID.setSize(Pstream::nProcs()); - forAll(procPatchSizes, procI) + forAll(nbrProc, bFaceI) { - if (procPatchSizes[procI] > 0) - { - const word patchName = - "procBoundary" - + name(Pstream::myProcNo()) - + "to" - + name(procI); + label procI = nbrProc[bFaceI]; - - procPatchID[procI] = addProcPatch(patchName, procI); - addPatchFields<volScalarField> - ( - processorFvPatchField<scalar>::typeName - ); - addPatchFields<volVectorField> - ( - processorFvPatchField<vector>::typeName - ); - addPatchFields<volSphericalTensorField> - ( - processorFvPatchField<sphericalTensor>::typeName - ); - addPatchFields<volSymmTensorField> - ( - processorFvPatchField<symmTensor>::typeName - ); - addPatchFields<volTensorField> - ( - processorFvPatchField<tensor>::typeName - ); - - addPatchFields<surfaceScalarField> - ( - processorFvPatchField<scalar>::typeName - ); - addPatchFields<surfaceVectorField> - ( - processorFvPatchField<vector>::typeName - ); - addPatchFields<surfaceSphericalTensorField> - ( - processorFvPatchField<sphericalTensor>::typeName - ); - addPatchFields<surfaceSymmTensorField> - ( - processorFvPatchField<symmTensor>::typeName - ); - addPatchFields<surfaceTensorField> - ( - processorFvPatchField<tensor>::typeName - ); - } - else + if (procI != -1 && procI != Pstream::myProcNo()) { - procPatchID[procI] = -1; + if (!procPatchID[procI].found(referPatchID[bFaceI])) + { + // No patch for neighbour yet. Is either a normal processor + // patch or a processorCyclic patch. + + if (referPatchID[bFaceI] == -1) + { + // Ordinary processor boundary + + const word patchName = + "procBoundary" + + name(Pstream::myProcNo()) + + "to" + + name(procI); + + procPatchID[procI].insert + ( + referPatchID[bFaceI], + addPatch + ( + new processorPolyPatch + ( + patchName, + 0, // size + mesh_.nFaces(), + mesh_.boundaryMesh().size(), + mesh_.boundaryMesh(), + Pstream::myProcNo(), + nbrProc[bFaceI] + ) + ) + ); + + addPatchFields<volScalarField> + ( + processorFvPatchField<scalar>::typeName + ); + addPatchFields<volVectorField> + ( + processorFvPatchField<vector>::typeName + ); + addPatchFields<volSphericalTensorField> + ( + processorFvPatchField<sphericalTensor>::typeName + ); + addPatchFields<volSymmTensorField> + ( + processorFvPatchField<symmTensor>::typeName + ); + addPatchFields<volTensorField> + ( + processorFvPatchField<tensor>::typeName + ); + + addPatchFields<surfaceScalarField> + ( + processorFvPatchField<scalar>::typeName + ); + addPatchFields<surfaceVectorField> + ( + processorFvPatchField<vector>::typeName + ); + addPatchFields<surfaceSphericalTensorField> + ( + processorFvPatchField<sphericalTensor>::typeName + ); + addPatchFields<surfaceSymmTensorField> + ( + processorFvPatchField<symmTensor>::typeName + ); + addPatchFields<surfaceTensorField> + ( + processorFvPatchField<tensor>::typeName + ); + } + else + { + // Processor boundary originating from cyclic + const word& cycName = mesh_.boundaryMesh() + [ + referPatchID[bFaceI] + ].name(); + + const word patchName = + "procBoundary" + + name(Pstream::myProcNo()) + + "to" + + name(procI) + + "through" + + cycName; + + procPatchID[procI].insert + ( + referPatchID[bFaceI], + addPatch + ( + new processorCyclicPolyPatch + ( + patchName, + 0, // size + mesh_.nFaces(), + mesh_.boundaryMesh().size(), + mesh_.boundaryMesh(), + Pstream::myProcNo(), + nbrProc[bFaceI], + cycName + ) + ) + ); + + addPatchFields<volScalarField> + ( + processorCyclicFvPatchField<scalar>::typeName + ); + addPatchFields<volVectorField> + ( + processorCyclicFvPatchField<vector>::typeName + ); + addPatchFields<volSphericalTensorField> + ( + processorCyclicFvPatchField<sphericalTensor>::typeName + ); + addPatchFields<volSymmTensorField> + ( + processorCyclicFvPatchField<symmTensor>::typeName + ); + addPatchFields<volTensorField> + ( + processorCyclicFvPatchField<tensor>::typeName + ); + + addPatchFields<surfaceScalarField> + ( + processorCyclicFvPatchField<scalar>::typeName + ); + addPatchFields<surfaceVectorField> + ( + processorCyclicFvPatchField<vector>::typeName + ); + addPatchFields<surfaceSphericalTensorField> + ( + processorCyclicFvPatchField<sphericalTensor>::typeName + ); + addPatchFields<surfaceSymmTensorField> + ( + processorCyclicFvPatchField<symmTensor>::typeName + ); + addPatchFields<surfaceTensorField> + ( + processorCyclicFvPatchField<tensor>::typeName + ); + } + } } } } // Get boundary faces to be repatched. Is -1 or new patchID -Foam::labelList Foam::fvMeshDistribute::getProcBoundaryPatch +Foam::labelList Foam::fvMeshDistribute::getBoundaryPatch ( - const labelList& neighbourNewProc, // new processor per boundary face - const labelList& procPatchID // patchID + const labelList& nbrProc, // new processor per boundary face + const labelList& referPatchID, // patchID (or -1) I originated from + const List<Map<label> >& procPatchID // per proc the new procPatches ) { - labelList patchIDs(neighbourNewProc); + labelList patchIDs(nbrProc); - forAll(neighbourNewProc, bFaceI) + forAll(nbrProc, bFaceI) { - if (neighbourNewProc[bFaceI] != -1) + if (nbrProc[bFaceI] == Pstream::myProcNo()) { - label nbrProc = neighbourNewProc[bFaceI]; - - patchIDs[bFaceI] = procPatchID[nbrProc]; + label origPatchI = referPatchID[bFaceI]; + patchIDs[bFaceI] = origPatchI; + } + else if (nbrProc[bFaceI] != -1) + { + label origPatchI = referPatchID[bFaceI]; + patchIDs[bFaceI] = procPatchID[nbrProc[bFaceI]][origPatchI]; } else { @@ -1055,7 +1259,8 @@ void Foam::fvMeshDistribute::sendMesh const labelList& sourceFace, const labelList& sourceProc, - const labelList& sourceNewProc, + const labelList& sourcePatch, + const labelList& sourceNewNbrProc, UOPstream& toDomain ) { @@ -1191,7 +1396,8 @@ void Foam::fvMeshDistribute::sendMesh << sourceFace << sourceProc - << sourceNewProc; + << sourcePatch + << sourceNewNbrProc; if (debug) @@ -1212,7 +1418,8 @@ Foam::autoPtr<Foam::fvMesh> Foam::fvMeshDistribute::receiveMesh const Time& runTime, labelList& domainSourceFace, labelList& domainSourceProc, - labelList& domainSourceNewProc, + labelList& domainSourcePatch, + labelList& domainSourceNewNbrProc, UIPstream& fromNbr ) { @@ -1230,7 +1437,8 @@ Foam::autoPtr<Foam::fvMesh> Foam::fvMeshDistribute::receiveMesh fromNbr >> domainSourceFace >> domainSourceProc - >> domainSourceNewProc; + >> domainSourcePatch + >> domainSourceNewNbrProc; // Construct fvMesh autoPtr<fvMesh> domainMeshPtr @@ -1448,16 +1656,37 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // physical boundary: // sourceProc = -1 - // sourceNewProc = -1 - // sourceFace = patchID - // coupled boundary: - // sourceProc = proc - // sourceNewProc = distribution[cell on proc] - // sourceFace = face + // sourceNewNbrProc = -1 + // sourceFace = -1 + // sourcePatch = patchID + // processor boundary: + // sourceProc = proc (on owner side) + // sourceNewNbrProc = distribution of coupled cell + // sourceFace = face (on owner side) + // sourcePatch = -1 + // ?cyclic: + // ? sourceProc = proc + // ? sourceNewNbrProc = distribution of coupled cell + // ? sourceFace = face (on owner side) + // ? sourcePatch = patchID + // processor-cyclic boundary: + // sourceProc = proc (on owner side) + // sourceNewNbrProc = distribution of coupled cell + // sourceFace = face (on owner side) + // sourcePatch = patchID + + labelList sourcePatch; labelList sourceFace; labelList sourceProc; - labelList sourceNewProc; - getNeighbourData(distribution, sourceFace, sourceProc, sourceNewProc); + labelList sourceNewNbrProc; + getNeighbourData + ( + distribution, + sourceFace, + sourceProc, + sourcePatch, + sourceNewNbrProc + ); // Remove meshPhi. Since this would otherwise disappear anyway @@ -1529,7 +1758,8 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute inplaceReorder(bFaceMap, sourceFace); inplaceReorder(bFaceMap, sourceProc); - inplaceReorder(bFaceMap, sourceNewProc); + inplaceReorder(bFaceMap, sourcePatch); + inplaceReorder(bFaceMap, sourceNewNbrProc); } @@ -1632,7 +1862,8 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // Subset the boundary fields (owner/neighbour/processor) labelList procSourceFace; labelList procSourceProc; - labelList procSourceNewProc; + labelList procSourcePatch; + labelList procSourceNewNbrProc; subsetBoundaryData ( @@ -1647,11 +1878,13 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute sourceFace, sourceProc, - sourceNewProc, + sourcePatch, + sourceNewNbrProc, procSourceFace, procSourceProc, - procSourceNewProc + procSourcePatch, + procSourceNewNbrProc ); @@ -1668,7 +1901,8 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute procSourceFace, procSourceProc, - procSourceNewProc, + procSourcePatch, + procSourceNewNbrProc, str ); sendFields<volScalarField>(recvProc, volScalars, subsetter, str); @@ -1771,7 +2005,8 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // fields labelList domainSourceFace; labelList domainSourceProc; - labelList domainSourceNewProc; + labelList domainSourcePatch; + labelList domainSourceNewNbrProc; subsetBoundaryData ( @@ -1786,16 +2021,19 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute sourceFace, sourceProc, - sourceNewProc, + sourcePatch, + sourceNewNbrProc, domainSourceFace, domainSourceProc, - domainSourceNewProc + domainSourcePatch, + domainSourceNewNbrProc ); sourceFace.transfer(domainSourceFace); sourceProc.transfer(domainSourceProc); - sourceNewProc.transfer(domainSourceNewProc); + sourcePatch.transfer(domainSourcePatch); + sourceNewNbrProc.transfer(domainSourceNewNbrProc); } @@ -1848,7 +2086,8 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // Receive from sendProc labelList domainSourceFace; labelList domainSourceProc; - labelList domainSourceNewProc; + labelList domainSourcePatch; + labelList domainSourceNewNbrProc; autoPtr<fvMesh> domainMeshPtr; PtrList<volScalarField> vsf; @@ -1874,10 +2113,14 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute const_cast<Time&>(mesh_.time()), domainSourceFace, domainSourceProc, - domainSourceNewProc, + domainSourcePatch, + domainSourceNewNbrProc, str ); fvMesh& domainMesh = domainMeshPtr(); + // Force construction of various on mesh. + //(void)domainMesh.globalData(); + // Receive fields. Read as single dictionary because // of problems reading consecutive fields from single stream. @@ -2006,11 +2249,13 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute sourceFace, sourceProc, + sourcePatch, sendProc, domainMesh, domainSourceFace, domainSourceProc, + domainSourcePatch, masterCoupledFaces, slaveCoupledFaces @@ -2045,33 +2290,38 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // Update mesh data: sourceFace,sourceProc for added // mesh. - sourceFace = - mapBoundaryData - ( - mesh_, - map(), - sourceFace, - domainMesh.nInternalFaces(), - domainSourceFace - ); - sourceProc = - mapBoundaryData - ( - mesh_, - map(), - sourceProc, - domainMesh.nInternalFaces(), - domainSourceProc - ); - sourceNewProc = - mapBoundaryData - ( - mesh_, - map(), - sourceNewProc, - domainMesh.nInternalFaces(), - domainSourceNewProc - ); + sourceFace = mapBoundaryData + ( + mesh_, + map(), + sourceFace, + domainMesh.nInternalFaces(), + domainSourceFace + ); + sourceProc = mapBoundaryData + ( + mesh_, + map(), + sourceProc, + domainMesh.nInternalFaces(), + domainSourceProc + ); + sourcePatch = mapBoundaryData + ( + mesh_, + map(), + sourcePatch, + domainMesh.nInternalFaces(), + domainSourcePatch + ); + sourceNewNbrProc = mapBoundaryData + ( + mesh_, + map(), + sourceNewNbrProc, + domainMesh.nInternalFaces(), + domainSourceNewNbrProc + ); // Update all addressing so xxProcAddressing points to correct item // in masterMesh. @@ -2141,11 +2391,13 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // Add processorPatches // ~~~~~~~~~~~~~~~~~~~~ - // Per neighbour processor the patchID to it (or -1). - labelList procPatchID; + // Per neighbour processor, per originating patch, the patchID + // For faces resulting from internal faces or normal processor patches + // the originating patch is -1. For cyclics this is the cyclic patchID. + List<Map<label> > procPatchID; - // Add processor patches. - addProcPatches(sourceNewProc, procPatchID); + // Add processor and processorCyclic patches. + addProcPatches(sourceNewNbrProc, sourcePatch, procPatchID); // Put faces into correct patch. Note that we now have proper // processorPolyPatches again so repatching will take care of coupled face @@ -2154,9 +2406,10 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::fvMeshDistribute::distribute // Get boundary faces to be repatched. Is -1 or new patchID labelList newPatchID ( - getProcBoundaryPatch + getBoundaryPatch ( - sourceNewProc, + sourceNewNbrProc, + sourcePatch, procPatchID ) ); diff --git a/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.H b/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.H index 5af95fb1076fd2d8bc791a95c80cb3a9f8e66058..f85e1b53acd501a06bdcb72e48cf90287fc90bab 100644 --- a/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.H +++ b/src/dynamicMesh/fvMeshDistribute/fvMeshDistribute.H @@ -102,8 +102,8 @@ class fvMeshDistribute //- Find patch to put exposed faces into. label findNonEmptyPatch() const; - //- Appends processorPolyPatch. Returns patchID. - label addProcPatch(const word& patchName, const label nbrProc); + //- Appends polyPatch. Returns patchID. + label addPatch(polyPatch*); //- Add patch field template<class GeoField> @@ -169,6 +169,7 @@ class fvMeshDistribute const labelList& distribution, labelList& sourceFace, labelList& sourceProc, + labelList& sourcePatch, labelList& sourceNewProc ) const; @@ -186,10 +187,12 @@ class fvMeshDistribute const labelList& sourceFace, const labelList& sourceProc, + const labelList& sourcePatch, const labelList& sourceNewProc, labelList& subFace, labelList& subProc, + labelList& subPatch, labelList& subNewProc ); @@ -200,11 +203,13 @@ class fvMeshDistribute const primitiveMesh&, const labelList& sourceFace, const labelList& sourceProc, + const labelList& sourcePatch, const label domain, const primitiveMesh& domainMesh, const labelList& domainFace, const labelList& domainProc, + const labelList& domainPatch, labelList& masterCoupledFaces, labelList& slaveCoupledFaces @@ -235,15 +240,17 @@ class fvMeshDistribute // proc the processor patchID. void addProcPatches ( - const labelList&, // processor that neighbour is on - labelList& procPatchID + const labelList&, // processor that neighbour is now on + const labelList&, // -1 or patch that face originated from + List<Map<label> >& procPatchID ); //- Get boundary faces to be repatched. Is -1 or new patchID - static labelList getProcBoundaryPatch + static labelList getBoundaryPatch ( - const labelList& neighbourNewProc,// new processor per b. face - const labelList& procPatchID // patchID + const labelList& neighbourNewProc, // new processor per b. face + const labelList& referPatchID, // -1 or original patch + const List<Map<label> >& procPatchID// patchID ); //- Send mesh and coupling data. @@ -256,6 +263,7 @@ class fvMeshDistribute const wordList& cellZoneNames, const labelList& sourceFace, const labelList& sourceProc, + const labelList& sourcePatch, const labelList& sourceNewProc, UOPstream& toDomain ); @@ -279,6 +287,7 @@ class fvMeshDistribute const Time& runTime, labelList& domainSourceFace, labelList& domainSourceProc, + labelList& domainSourcePatch, labelList& domainSourceNewProc, UIPstream& fromNbr ); @@ -328,6 +337,7 @@ public: const primitiveMesh&, const labelList&, const labelList&, + const labelList&, const labelList& ); diff --git a/src/dynamicMesh/motionSmoother/motionSmoother.C b/src/dynamicMesh/motionSmoother/motionSmoother.C index 5c3d79a97856578e87810318dd51ab95edf347f5..9cb0eff0754e184dc3e0b3aa3bad90b0aedeecb2 100644 --- a/src/dynamicMesh/motionSmoother/motionSmoother.C +++ b/src/dynamicMesh/motionSmoother/motionSmoother.C @@ -40,6 +40,80 @@ defineTypeNameAndDebug(Foam::motionSmoother, 0); // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // +void Foam::motionSmoother::testSyncPositions +( + const pointField& fld, + const scalar maxMag +) const +{ + pointField syncedFld(fld); + + syncTools::syncPointPositions + ( + mesh_, + syncedFld, + minEqOp<point>(), // combine op + point(GREAT,GREAT,GREAT) // null + ); + + forAll(syncedFld, i) + { + if (mag(syncedFld[i] - fld[i]) > maxMag) + { + FatalErrorIn + ( + "motionSmoother::testSyncPositions(const pointField&)" + ) << "On point " << i << " point:" << fld[i] + << " synchronised point:" << syncedFld[i] + << abort(FatalError); + } + } +} + + +//Foam::tmp<Foam::scalarField> Foam::motionSmoother::sumWeights +//( +// const scalarField& edgeWeight +//) const +//{ +// tmp<scalarField> tsumWeight +// ( +// new scalarField +// ( +// mesh_.nPoints(), +// 0.0 +// ) +// ); +// scalarField& sumWeight = tsumWeight(); +// +// const edgeList& edges = mesh_.edges(); +// +// forAll(edges, edgeI) +// { +// if (isMasterEdge_.get(edgeI) == 1) +// { +// const edge& e = edges[edgeI]; +// const scalar w = edgeWeight[edgeI]; +// sumWeight[e[0]] += w; +// sumWeight[e[1]] += w; +// } +// } +// +// +// // Add coupled contributions +// // ~~~~~~~~~~~~~~~~~~~~~~~~~ +// syncTools::syncPointList +// ( +// mesh, +// sumWeight, +// plusEqOp<scalar>(), +// scalar(0) // null value +// ); +// +// return tsumWeight; +//} + + // From pointPatchInterpolation void Foam::motionSmoother::makePatchPatchAddressing() { @@ -209,8 +283,7 @@ void Foam::motionSmoother::minSmooth tmp<pointScalarField> tavgFld = avg ( fld, - scalarField(mesh_.nEdges(), 1.0), // uniform weighting - false // fld is not position. + scalarField(mesh_.nEdges(), 1.0) // uniform weighting ); const pointScalarField& avgFld = tavgFld(); @@ -243,8 +316,7 @@ void Foam::motionSmoother::minSmooth tmp<pointScalarField> tavgFld = avg ( fld, - scalarField(mesh_.nEdges(), 1.0), // uniform weighting - false // fld is not position. + scalarField(mesh_.nEdges(), 1.0) // uniform weighting ); const pointScalarField& avgFld = tavgFld(); @@ -612,8 +684,7 @@ void Foam::motionSmoother::setDisplacement(pointField& patchDisp) mesh_, displacement_, maxMagEqOp(), // combine op - vector::zero, // null value - false // no separation + vector::zero // null value ); // Adapt the fixedValue bc's (i.e. copy internal point data to @@ -718,8 +789,7 @@ void Foam::motionSmoother::correctBoundaryConditions mesh_, displacement, maxMagEqOp(), // combine op - vector::zero, // null value - false // no separation + vector::zero // null value ); } @@ -769,14 +839,7 @@ Foam::tmp<Foam::scalarField> Foam::motionSmoother::movePoints { Pout<< "motionSmoother::movePoints : testing sync of newPoints." << endl; - testSyncField - ( - newPoints, - minEqOp<point>(), // combine op - vector(GREAT,GREAT,GREAT), // null - true, // separation - 1E-6*mesh_.bounds().mag() - ); + testSyncPositions(newPoints, 1E-6*mesh_.bounds().mag()); } tmp<scalarField> tsweptVol = mesh_.movePoints(newPoints); @@ -894,8 +957,7 @@ bool Foam::motionSmoother::scaleMesh mesh_, displacement_, maxMagEqOp(), - vector::zero, // null value - false // no separation + vector::zero // null value ); // Set newPoints as old + scale*displacement @@ -926,7 +988,6 @@ bool Foam::motionSmoother::scaleMesh totalDisplacement, maxMagEqOp(), vector::zero, // null value - false, // separation 1E-6*mesh_.bounds().mag() ); } @@ -1056,8 +1117,7 @@ bool Foam::motionSmoother::scaleMesh mesh_, scale_, maxEqOp<scalar>(), - -GREAT, // null value - false // no separation + -GREAT // null value ); diff --git a/src/dynamicMesh/motionSmoother/motionSmoother.H b/src/dynamicMesh/motionSmoother/motionSmoother.H index ee306dd3c9a2eed2ba5dd137897ff9a7a38c370a..729cbb28a558890cbfd4d50547c7be6019ac1b56 100644 --- a/src/dynamicMesh/motionSmoother/motionSmoother.H +++ b/src/dynamicMesh/motionSmoother/motionSmoother.H @@ -183,8 +183,15 @@ class motionSmoother tmp<GeometricField<Type, pointPatchField, pointMesh> > avg ( const GeometricField<Type, pointPatchField, pointMesh>& fld, - const scalarField& edgeWeight, - const bool separation + const scalarField& edgeWeight + ) const; + + //- Average postion of connected points. + template <class Type> + tmp<GeometricField<Type, pointPatchField, pointMesh> > avgPositions + ( + const GeometricField<Type, pointPatchField, pointMesh>& fld, + const scalarField& edgeWeight ) const; //- Check constraints @@ -201,17 +208,19 @@ class motionSmoother GeometricField<Type, pointPatchField, pointMesh>& ) const; - //- Test synchronisation of pointField + //- Test synchronisation of generic field (not positions!) on points template<class Type, class CombineOp> void testSyncField ( const Field<Type>&, const CombineOp& cop, const Type& zero, - const bool separation, const scalar maxMag ) const; + //- Test synchronisation of points + void testSyncPositions(const pointField&, const scalar maxMag) const; + //- Assemble tensors for multi-patch constraints void makePatchPatchAddressing(); @@ -476,14 +485,13 @@ public: // Helper functions to manipulate displacement vector. - //- Fully explicit smoothing of internal points with varying - // diffusivity. + //- Fully explicit smoothing of fields (not positions) + // of internal points with varying diffusivity. template <class Type> void smooth ( const GeometricField<Type, pointPatchField, pointMesh>& fld, const scalarField& edgeWeight, - const bool separation, GeometricField<Type, pointPatchField, pointMesh>& newFld ) const; }; diff --git a/src/dynamicMesh/motionSmoother/motionSmootherTemplates.C b/src/dynamicMesh/motionSmoother/motionSmootherTemplates.C index 1660a29e18decf00024f479d9a6a8bf5f50c700f..a444276c195136a0cf2883e493dfd7b8a7ca2464 100644 --- a/src/dynamicMesh/motionSmoother/motionSmootherTemplates.C +++ b/src/dynamicMesh/motionSmoother/motionSmootherTemplates.C @@ -155,11 +155,10 @@ void Foam::motionSmoother::applyCornerConstraints // Average of connected points. template <class Type> Foam::tmp<Foam::GeometricField<Type, Foam::pointPatchField, Foam::pointMesh> > - Foam::motionSmoother::avg +Foam::motionSmoother::avg ( const GeometricField<Type, pointPatchField, pointMesh>& fld, - const scalarField& edgeWeight, - const bool separation + const scalarField& edgeWeight ) const { tmp<GeometricField<Type, pointPatchField, pointMesh> > tres @@ -172,7 +171,8 @@ Foam::tmp<Foam::GeometricField<Type, Foam::pointPatchField, Foam::pointMesh> > fld.time().timeName(), fld.db(), IOobject::NO_READ, - IOobject::NO_WRITE + IOobject::NO_WRITE, + false ), fld.mesh(), dimensioned<Type>("zero", fld.dimensions(), pTraits<Type>::zero) @@ -217,17 +217,14 @@ Foam::tmp<Foam::GeometricField<Type, Foam::pointPatchField, Foam::pointMesh> > mesh, res, plusEqOp<Type>(), - pTraits<Type>::zero, // null value - separation // separation + pTraits<Type>::zero // null value ); - syncTools::syncPointList ( mesh, sumWeight, plusEqOp<scalar>(), - scalar(0), // null value - false // separation + scalar(0) // null value ); @@ -260,16 +257,10 @@ void Foam::motionSmoother::smooth ( const GeometricField<Type, pointPatchField, pointMesh>& fld, const scalarField& edgeWeight, - const bool separation, GeometricField<Type, pointPatchField, pointMesh>& newFld ) const { - tmp<pointVectorField> tavgFld = avg - ( - fld, - edgeWeight, // weighting - separation // whether to apply separation vector - ); + tmp<pointVectorField> tavgFld = avg(fld, edgeWeight); const pointVectorField& avgFld = tavgFld(); forAll(fld, pointI) @@ -285,14 +276,13 @@ void Foam::motionSmoother::smooth } -//- Test synchronisation of pointField +//- Test synchronisation of generic field (not positions!) on points template<class Type, class CombineOp> void Foam::motionSmoother::testSyncField ( const Field<Type>& fld, const CombineOp& cop, const Type& zero, - const bool separation, const scalar maxMag ) const { @@ -309,13 +299,11 @@ void Foam::motionSmoother::testSyncField mesh_, syncedFld, cop, - zero, // null value - separation // separation + zero ); forAll(syncedFld, i) { - if (syncedFld[i] != fld[i]) if (mag(syncedFld[i] - fld[i]) > maxMag) { FatalErrorIn diff --git a/src/dynamicMesh/motionSmoother/polyMeshGeometry/polyMeshGeometry.C b/src/dynamicMesh/motionSmoother/polyMeshGeometry/polyMeshGeometry.C index a4c05fe4126d17e91ed75ae242aa65cfa34c5155..b79089bf044879ac87613037f6485e3d6d746e72 100644 --- a/src/dynamicMesh/motionSmoother/polyMeshGeometry/polyMeshGeometry.C +++ b/src/dynamicMesh/motionSmoother/polyMeshGeometry/polyMeshGeometry.C @@ -425,13 +425,13 @@ bool Foam::polyMeshGeometry::checkFaceDotProduct // Calculate coupled cell centre - vectorField neiCc(mesh.nFaces()-mesh.nInternalFaces()); + pointField neiCc(mesh.nFaces()-mesh.nInternalFaces()); for (label faceI = mesh.nInternalFaces(); faceI < mesh.nFaces(); faceI++) { neiCc[faceI-mesh.nInternalFaces()] = cellCentres[own[faceI]]; } - syncTools::swapBoundaryFaceList(mesh, neiCc, true); + syncTools::swapBoundaryFacePositions(mesh, neiCc); scalar minDDotS = GREAT; @@ -927,13 +927,13 @@ bool Foam::polyMeshGeometry::checkFaceSkewness const polyBoundaryMesh& patches = mesh.boundaryMesh(); // Calculate coupled cell centre - vectorField neiCc(mesh.nFaces()-mesh.nInternalFaces()); + pointField neiCc(mesh.nFaces()-mesh.nInternalFaces()); for (label faceI = mesh.nInternalFaces(); faceI < mesh.nFaces(); faceI++) { neiCc[faceI-mesh.nInternalFaces()] = cellCentres[own[faceI]]; } - syncTools::swapBoundaryFaceList(mesh, neiCc, true); + syncTools::swapBoundaryFacePositions(mesh, neiCc); scalar maxSkew = 0; @@ -1135,13 +1135,13 @@ bool Foam::polyMeshGeometry::checkFaceWeights const polyBoundaryMesh& patches = mesh.boundaryMesh(); // Calculate coupled cell centre - vectorField neiCc(mesh.nFaces()-mesh.nInternalFaces()); + pointField neiCc(mesh.nFaces()-mesh.nInternalFaces()); for (label faceI = mesh.nInternalFaces(); faceI < mesh.nFaces(); faceI++) { neiCc[faceI-mesh.nInternalFaces()] = cellCentres[own[faceI]]; } - syncTools::swapBoundaryFaceList(mesh, neiCc, true); + syncTools::swapBoundaryFacePositions(mesh, neiCc); scalar minWeight = GREAT; @@ -1298,7 +1298,7 @@ bool Foam::polyMeshGeometry::checkVolRatio { neiVols[faceI-mesh.nInternalFaces()] = cellVolumes[own[faceI]]; } - syncTools::swapBoundaryFaceList(mesh, neiVols, true); + syncTools::swapBoundaryFaceList(mesh, neiVols); scalar minRatio = GREAT; @@ -1641,13 +1641,13 @@ bool Foam::polyMeshGeometry::checkFaceTwist const polyBoundaryMesh& patches = mesh.boundaryMesh(); // Calculate coupled cell centre - vectorField neiCc(mesh.nFaces()-mesh.nInternalFaces()); + pointField neiCc(mesh.nFaces()-mesh.nInternalFaces()); for (label faceI = mesh.nInternalFaces(); faceI < mesh.nFaces(); faceI++) { neiCc[faceI-mesh.nInternalFaces()] = cellCentres[own[faceI]]; } - syncTools::swapBoundaryFaceList(mesh, neiCc, true); + syncTools::swapBoundaryFacePositions(mesh, neiCc); forAll(checkFaces, i) { diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/addPatchCellLayer.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/addPatchCellLayer.C index 9105db90237a277097b97aeccc2f756c138f2621..170052341d98007089273d72455e50e3d3d707c6 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/addPatchCellLayer.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/addPatchCellLayer.C @@ -34,6 +34,7 @@ License #include "polyModifyFace.H" #include "polyAddCell.H" #include "globalIndex.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -103,8 +104,8 @@ Foam::labelListList Foam::addPatchCellLayer::calcGlobalEdgeFaces mesh, globalEdgeFaces, uniqueEqOp(), - labelList(), // null value - false // no separation + labelList(), // null value + Foam::dummyTransform() // dummy transform ); // Extract pp part @@ -636,7 +637,7 @@ void Foam::addPatchCellLayer::setRefinement { labelList n(mesh_.nPoints(), 0); UIndirectList<label>(n, meshPoints) = nPointLayers; - syncTools::syncPointList(mesh_, n, maxEqOp<label>(), 0, false); + syncTools::syncPointList(mesh_, n, maxEqOp<label>(), 0); // Non-synced forAll(meshPoints, i) @@ -680,8 +681,7 @@ void Foam::addPatchCellLayer::setRefinement mesh_, nFromFace, maxEqOp<label>(), - 0, - false + 0 ); forAll(nPointLayers, i) @@ -718,8 +718,7 @@ void Foam::addPatchCellLayer::setRefinement mesh_, d, minEqOp<vector>(), - vector::max, - false + vector::max ); forAll(meshPoints, i) @@ -1190,8 +1189,7 @@ void Foam::addPatchCellLayer::setRefinement mesh_, meshEdgeLayers, maxEqOp<label>(), - 0, // initial value - false // no separation + 0 // initial value ); forAll(meshEdges, edgeI) diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/combineFaces.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/combineFaces.C index 5dc59ad815b8ff84bfb64c6f72d18cad81a90377..83414d1c98c0d16290c3e8d218290642346b576f 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/combineFaces.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/combineFaces.C @@ -708,8 +708,7 @@ void Foam::combineFaces::setRefinement mesh_, nPointFaces, plusEqOp<label>(), - 0, // null value - false // no separation + 0 // null value ); // Remove all unused points. Store position if undoable. diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/hexRef8.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/hexRef8.C index 5a5e108134e953f6564de1328637da534cbe471d..ea2479c07edb42dac165c64dbe1f385b0f6626c0 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/hexRef8.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/hexRef8.C @@ -412,8 +412,7 @@ Foam::scalar Foam::hexRef8::getLevel0EdgeLength() const mesh_, edgeLevel, ifEqEqOp<labelMax>(), - labelMin, - false // no separation + labelMin ); // Now use the edgeLevel with a valid value to determine the @@ -1618,7 +1617,7 @@ Foam::label Foam::hexRef8::faceConsistentRefinement } // Swap to neighbour - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); // Now we have neighbour value see which cells need refinement forAll(neiLevel, i) @@ -1700,7 +1699,7 @@ void Foam::hexRef8::checkWantedRefinementLevels } // Swap to neighbour - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); // Now we have neighbour value see which cells need refinement forAll(neiLevel, i) @@ -2369,8 +2368,7 @@ Foam::labelList Foam::hexRef8::consistentSlowRefinement mesh_, maxPointCount, maxEqOp<label>(), - labelMin, // null value - false // no separation + labelMin // null value ); // Update allFaceInfo from maxPointCount for all points to check @@ -2509,9 +2507,9 @@ Foam::labelList Foam::hexRef8::consistentSlowRefinement } // Swap to neighbour - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); - syncTools::swapBoundaryFaceList(mesh_, neiCount, false); - syncTools::swapBoundaryFaceList(mesh_, neiRefCount, false); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); + syncTools::swapBoundaryFaceList(mesh_, neiCount); + syncTools::swapBoundaryFaceList(mesh_, neiRefCount); // Now we have neighbour value see which cells need refinement forAll(neiLevel, i) @@ -3156,8 +3154,7 @@ Foam::labelListList Foam::hexRef8::setRefinement mesh_, edgeMidPoint, maxEqOp<label>(), - labelMin, - false // no separation + labelMin ); @@ -3179,13 +3176,12 @@ Foam::labelListList Foam::hexRef8::setRefinement edgeMids[edgeI] = mesh_.edges()[edgeI].centre(mesh_.points()); } } - syncTools::syncEdgeList + syncTools::syncEdgePositions ( mesh_, edgeMids, maxEqOp<vector>(), - point(-GREAT, -GREAT, -GREAT), - true // apply separation + point(-GREAT, -GREAT, -GREAT) ); @@ -3310,7 +3306,7 @@ Foam::labelListList Foam::hexRef8::setRefinement } // Swap. - syncTools::swapBoundaryFaceList(mesh_, newNeiLevel, false); + syncTools::swapBoundaryFaceList(mesh_, newNeiLevel); // So now we have information on the neighbour. @@ -3342,8 +3338,7 @@ Foam::labelListList Foam::hexRef8::setRefinement ( mesh_, faceMidPoint, - maxEqOp<label>(), - false + maxEqOp<label>() ); @@ -3369,12 +3364,11 @@ Foam::labelListList Foam::hexRef8::setRefinement bFaceMids[i] = mesh_.faceCentres()[faceI]; } } - syncTools::syncBoundaryFaceList + syncTools::syncBoundaryFacePositions ( mesh_, bFaceMids, - maxEqOp<vector>(), - true // apply separation + maxEqOp<vector>() ); forAll(faceMidPoint, faceI) @@ -4404,7 +4398,7 @@ void Foam::hexRef8::checkMesh() const } // Replace data on coupled patches with their neighbour ones. - syncTools::swapBoundaryFaceList(mesh_, nei, false); + syncTools::swapBoundaryFaceList(mesh_, nei); const polyBoundaryMesh& patches = mesh_.boundaryMesh(); @@ -4459,7 +4453,7 @@ void Foam::hexRef8::checkMesh() const } // Replace data on coupled patches with their neighbour ones. - syncTools::swapBoundaryFaceList(mesh_, neiFaceAreas, false); + syncTools::swapBoundaryFaceList(mesh_, neiFaceAreas); forAll(neiFaceAreas, i) { @@ -4502,7 +4496,7 @@ void Foam::hexRef8::checkMesh() const } // Replace data on coupled patches with their neighbour ones. - syncTools::swapBoundaryFaceList(mesh_, nVerts, false); + syncTools::swapBoundaryFaceList(mesh_, nVerts); forAll(nVerts, i) { @@ -4551,7 +4545,7 @@ void Foam::hexRef8::checkMesh() const // Replace data on coupled patches with their neighbour ones. Apply // rotation transformation (but not separation since is relative vector // to point on same face. - syncTools::swapBoundaryFaceList(mesh_, anchorPoints, false); + syncTools::swapBoundaryFaceList(mesh_, anchorPoints); forAll(anchorPoints, i) { @@ -4656,7 +4650,7 @@ void Foam::hexRef8::checkRefinementLevels } // No separation - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); forAll(neiLevel, i) { @@ -4698,8 +4692,7 @@ void Foam::hexRef8::checkRefinementLevels mesh_, syncPointLevel, minEqOp<label>(), - labelMax, - false // no separation + labelMax ); @@ -4746,8 +4739,7 @@ void Foam::hexRef8::checkRefinementLevels mesh_, maxPointLevel, maxEqOp<label>(), - labelMin, // null value - false // no separation + labelMin // null value ); // Check 2:1 across boundary points @@ -5197,7 +5189,7 @@ Foam::labelList Foam::hexRef8::consistentUnrefinement } // Swap to neighbour - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); forAll(neiLevel, i) { diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/localPointRegion.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/localPointRegion.C index ab83b55415688f9c757244feea1d83aaefad583e..e7028e6424054c5fa04e5be905c32bd1780c007d 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/localPointRegion.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/localPointRegion.C @@ -29,6 +29,7 @@ License #include "mapPolyMesh.H" #include "globalIndex.H" #include "indirectPrimitivePatch.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -57,15 +58,6 @@ public: }; }; - -// Dummy transform for faces. Used in synchronisation -void transformList -( - const tensorField& rotTensor, - UList<face>& field -) -{}; - } // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -263,8 +255,7 @@ void Foam::localPointRegion::calcPointRegions mesh, candidatePoint, orEqOp<bool>(), - false, // nullValue - false // applySeparation + false // nullValue ); @@ -419,12 +410,18 @@ void Foam::localPointRegion::calcPointRegions // Transport minimum across coupled faces // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ - syncTools::syncFaceList + SubList<face> l ( - mesh, minRegion, + mesh.nFaces()-mesh.nInternalFaces(), + mesh.nInternalFaces() + ); + syncTools::syncBoundaryFaceList + ( + mesh, + l, minEqOpFace(), - false // applySeparation + Foam::dummyTransform() // dummy transformation ); } diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/removeCells.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/removeCells.C index 2560de3471afd4ef7844ae518b7389d68903389f..c778b65d0ad80c05578883c09ca4dbce0f35ae5c 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/removeCells.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/removeCells.C @@ -130,8 +130,7 @@ Foam::labelList Foam::removeCells::getExposedFaces ( mesh_, nCellsUsingFace, - plusEqOp<label>(), - false + plusEqOp<label>() ); } diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/removeFaces.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/removeFaces.C index 7b01c6dbcc4b0112098206ce93e67a3453938c2a..e6eebc5c3f1609af59ffa30d311daec906831440 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/removeFaces.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/removeFaces.C @@ -1084,8 +1084,7 @@ void Foam::removeFaces::setRefinement mesh_, nFacesPerEdge, maxEqOp<label>(), - labelMin, // guaranteed to be overridden by maxEqOp - false // no separation + labelMin // guaranteed to be overridden by maxEqOp ); // Convert to labelHashSet @@ -1187,8 +1186,7 @@ void Foam::removeFaces::setRefinement syncTools::swapFaceList ( mesh_, - nbrFaceRegion, - false // no separation + nbrFaceRegion ); labelList toNbrRegion(nRegions, -1); @@ -1305,8 +1303,7 @@ void Foam::removeFaces::setRefinement mesh_, nEdgesPerPoint, maxEqOp<label>(), - labelMin, - false // no separation + labelMin ); forAll(nEdgesPerPoint, pointI) diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.C b/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.C index 92ba164bb82de00df1319b2d2f31f5a869585d7c..e793d9ea33c6626d33f833ad4fd9799ca9d2d57c 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.C +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.C @@ -33,6 +33,7 @@ License #include "polyModifyFace.H" #include "syncTools.H" #include "faceSet.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // @@ -41,6 +42,55 @@ namespace Foam defineTypeNameAndDebug(removePoints, 0); +//- Combine-reduce operator to combine data on faces. Takes care +// of reverse orientation on coupled face. +template <class T, template<class> class CombineOp> +class faceEqOp +{ + +public: + + void operator()(List<T>& x, const List<T>& y) const + { + if (y.size() > 0) + { + if (x.size() == 0) + { + x = y; + } + else + { + label j = 0; + forAll(x, i) + { + CombineOp<T>()(x[i], y[j]); + j = y.rcIndex(j); + } + } + } + } +}; + + +//// Dummy transform for List. Used in synchronisation. +//template <class T> +//class dummyTransformList +//{ +//public: +// void operator()(const coupledPolyPatch&, Field<List<T> >&) const +// {} +//}; +//// Dummy template specialisation. Used in synchronisation. +//template<> +//class pTraits<boolList> +//{ +//public: +// +// //- Component type +// typedef label cmptType; +//}; + + } // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -247,8 +297,7 @@ Foam::label Foam::removePoints::countPointUsage mesh_, pointCanBeDeleted, andEqOp<bool>(), - true, // null value - false // no separation + true // null value ); return returnReduce(nDeleted, sumOp<label>()); @@ -662,7 +711,7 @@ void Foam::removePoints::getUnrefimentSet mesh_, faceVertexRestore, faceEqOp<bool, orEqOp>(), // special operator to handle faces - false // no separation + Foam::dummyTransform() // no transformation ); // So now if any of the points-to-restore is used by any coupled face diff --git a/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.H b/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.H index d9fd959a2c9ad6c2ee7ab8c1073ba8eb4e2a467a..f44e57684d04807b2061d9b23c75f10abdfb3780 100644 --- a/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.H +++ b/src/dynamicMesh/polyTopoChange/polyTopoChange/removePoints.H @@ -59,38 +59,6 @@ class face; class removePoints { - // Private classes - - //- Combine-reduce operator to combine data on faces. Takes care - // of reverse orientation on coupled face. - template <class T, template<class> class CombineOp> - class faceEqOp - { - - public: - - void operator()(List<T>& x, const List<T>& y) const - { - if (y.size() > 0) - { - if (x.empty()) - { - x = y; - } - else - { - label j = 0; - forAll(x, i) - { - CombineOp<T>()(x[i], y[j]); - j = y.rcIndex(j); - } - } - } - } - }; - - // Private data //- Reference to mesh diff --git a/src/finiteVolume/Make/files b/src/finiteVolume/Make/files index 0fc8dbf70c3fb01ebe2dccb752d356959605024a..85714b5f9cf76bbded048864bc6a4440d2e44741 100644 --- a/src/finiteVolume/Make/files +++ b/src/finiteVolume/Make/files @@ -21,6 +21,7 @@ $(constraintFvPatches)/symmetry/symmetryFvPatch.C $(constraintFvPatches)/wedge/wedgeFvPatch.C $(constraintFvPatches)/cyclic/cyclicFvPatch.C $(constraintFvPatches)/processor/processorFvPatch.C +$(constraintFvPatches)/processorCyclic/processorCyclicFvPatch.C derivedFvPatches = $(fvPatches)/derived $(derivedFvPatches)/wall/wallFvPatch.C @@ -99,6 +100,8 @@ $(constraintFvPatchFields)/empty/emptyFvPatchFields.C $(constraintFvPatchFields)/jumpCyclic/jumpCyclicFvPatchFields.C $(constraintFvPatchFields)/processor/processorFvPatchFields.C $(constraintFvPatchFields)/processor/processorFvPatchScalarField.C +$(constraintFvPatchFields)/processorCyclic/processorCyclicFvPatchFields.C +$(constraintFvPatchFields)/processorCyclic/processorCyclicFvPatchScalarField.C $(constraintFvPatchFields)/symmetry/symmetryFvPatchFields.C $(constraintFvPatchFields)/wedge/wedgeFvPatchFields.C $(constraintFvPatchFields)/wedge/wedgeFvPatchScalarField.C @@ -106,6 +109,7 @@ $(constraintFvPatchFields)/wedge/wedgeFvPatchScalarField.C derivedFvPatchFields = $(fvPatchFields)/derived $(derivedFvPatchFields)/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.C $(derivedFvPatchFields)/advective/advectiveFvPatchFields.C + $(derivedFvPatchFields)/directMappedFixedValue/directMappedFixedValueFvPatchFields.C $(derivedFvPatchFields)/directMappedVelocityFluxFixedValue/directMappedVelocityFluxFixedValueFvPatchField.C $(derivedFvPatchFields)/fan/fanFvPatchFields.C @@ -150,6 +154,7 @@ $(derivedFvPatchFields)/turbulentIntensityKineticEnergyInlet/turbulentIntensityK $(derivedFvPatchFields)/uniformFixedValue/uniformFixedValueFvPatchFields.C $(derivedFvPatchFields)/waveTransmissive/waveTransmissiveFvPatchFields.C $(derivedFvPatchFields)/uniformDensityHydrostaticPressure/uniformDensityHydrostaticPressureFvPatchScalarField.C +$(derivedFvPatchFields)/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.C fvsPatchFields = fields/fvsPatchFields $(fvsPatchFields)/fvsPatchField/fvsPatchFields.C @@ -164,6 +169,7 @@ constraintFvsPatchFields = $(fvsPatchFields)/constraint $(constraintFvsPatchFields)/cyclic/cyclicFvsPatchFields.C $(constraintFvsPatchFields)/empty/emptyFvsPatchFields.C $(constraintFvsPatchFields)/processor/processorFvsPatchFields.C +$(constraintFvsPatchFields)/processorCyclic/processorCyclicFvsPatchFields.C $(constraintFvsPatchFields)/symmetry/symmetryFvsPatchFields.C $(constraintFvsPatchFields)/wedge/wedgeFvsPatchFields.C diff --git a/src/finiteVolume/cfdTools/general/fieldSources/timeActivatedExplicitSource/TimeActivatedExplicitSource.C b/src/finiteVolume/cfdTools/general/fieldSources/timeActivatedExplicitSource/TimeActivatedExplicitSource.C index 1873bbe3fec8ca7db272376d5a39dff8ed6d5d10..f5a768c4a8b15062a9c71b67f9e4559dc13f623d 100644 --- a/src/finiteVolume/cfdTools/general/fieldSources/timeActivatedExplicitSource/TimeActivatedExplicitSource.C +++ b/src/finiteVolume/cfdTools/general/fieldSources/timeActivatedExplicitSource/TimeActivatedExplicitSource.C @@ -326,7 +326,7 @@ Foam::TimeActivatedExplicitSource<Type>::TimeActivatedExplicitSource : name_(name), mesh_(mesh), - active_(dict.lookup("active")), + active_(readBool(dict.lookup("active"))), timeStart_(readScalar(dict.lookup("timeStart"))), duration_(readScalar(dict.lookup("duration"))), volumeMode_(wordToVolumeModeType(dict.lookup("volumeMode"))), diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/cyclic/cyclicFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/constraint/cyclic/cyclicFvPatchField.C index 77ad9595b2769d74fd5c26b434105dca7e20a7b2..b0faf1caac38176e3d8f607545c3483793a170dd 100644 --- a/src/finiteVolume/fields/fvPatchFields/constraint/cyclic/cyclicFvPatchField.C +++ b/src/finiteVolume/fields/fvPatchFields/constraint/cyclic/cyclicFvPatchField.C @@ -24,6 +24,7 @@ License \*---------------------------------------------------------------------------*/ #include "cyclicFvPatchField.H" +#include "transformField.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -141,34 +142,28 @@ template<class Type> tmp<Field<Type> > cyclicFvPatchField<Type>::patchNeighbourField() const { const Field<Type>& iField = this->internalField(); - const unallocLabelList& faceCells = cyclicPatch_.faceCells(); + const unallocLabelList& nbrFaceCells = + cyclicPatch().cyclicPatch().neighbPatch().faceCells(); tmp<Field<Type> > tpnf(new Field<Type>(this->size())); Field<Type>& pnf = tpnf(); - label sizeby2 = this->size()/2; if (doTransform()) { - for (label facei=0; facei<sizeby2; facei++) + forAll(pnf, facei) { pnf[facei] = transform ( - forwardT()[0], iField[faceCells[facei + sizeby2]] - ); - - pnf[facei + sizeby2] = transform - ( - reverseT()[0], iField[faceCells[facei]] + forwardT()[0], iField[nbrFaceCells[facei]] ); } } else { - for (label facei=0; facei<sizeby2; facei++) + forAll(pnf, facei) { - pnf[facei] = iField[faceCells[facei + sizeby2]]; - pnf[facei + sizeby2] = iField[faceCells[facei]]; + pnf[facei] = iField[nbrFaceCells[facei]]; } } @@ -189,19 +184,20 @@ void cyclicFvPatchField<Type>::updateInterfaceMatrix { scalarField pnf(this->size()); - label sizeby2 = this->size()/2; - const unallocLabelList& faceCells = cyclicPatch_.faceCells(); + const unallocLabelList& nbrFaceCells = + cyclicPatch().cyclicPatch().neighbPatch().faceCells(); - for (label facei=0; facei<sizeby2; facei++) + forAll(pnf, facei) { - pnf[facei] = psiInternal[faceCells[facei + sizeby2]]; - pnf[facei + sizeby2] = psiInternal[faceCells[facei]]; + pnf[facei] = psiInternal[nbrFaceCells[facei]]; } // Transform according to the transformation tensors transformCoupleField(pnf, cmpt); // Multiply the field by coefficients and add into the result + const unallocLabelList& faceCells = cyclicPatch_.faceCells(); + forAll(faceCells, elemI) { result[faceCells[elemI]] -= coeffs[elemI]*pnf[elemI]; diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/jumpCyclic/jumpCyclicFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/constraint/jumpCyclic/jumpCyclicFvPatchField.C index 4b6b4660ffb6aa7d9d2a9c211604563e7dbfdecc..1c4d5f84a39dac075cc5f2c70dd56cdddcac0993 100644 --- a/src/finiteVolume/fields/fvPatchFields/constraint/jumpCyclic/jumpCyclicFvPatchField.C +++ b/src/finiteVolume/fields/fvPatchFields/constraint/jumpCyclic/jumpCyclicFvPatchField.C @@ -99,37 +99,34 @@ template<class Type> tmp<Field<Type> > jumpCyclicFvPatchField<Type>::patchNeighbourField() const { const Field<Type>& iField = this->internalField(); - const unallocLabelList& faceCells = this->cyclicPatch().faceCells(); + const unallocLabelList& nbrFaceCells = + this->cyclicPatch().neighbFvPatch().faceCells(); tmp<Field<Type> > tpnf(new Field<Type>(this->size())); Field<Type>& pnf = tpnf(); tmp<Field<scalar> > tjf = jump(); + if (!this->cyclicPatch().owner()) + { + tjf = -tjf; + } const Field<scalar>& jf = tjf(); - label sizeby2 = this->size()/2; - if (this->doTransform()) { - for (label facei=0; facei<sizeby2; facei++) + forAll(*this, facei) { pnf[facei] = transform ( - this->forwardT()[0], iField[faceCells[facei + sizeby2]] + this->forwardT()[0], iField[nbrFaceCells[facei]] ) - jf[facei]; - - pnf[facei + sizeby2] = transform - ( - this->reverseT()[0], iField[faceCells[facei]] + jf[facei] - ); } } else { - for (label facei=0; facei<sizeby2; facei++) + forAll(*this, facei) { - pnf[facei] = iField[faceCells[facei + sizeby2]] - jf[facei]; - pnf[facei + sizeby2] = iField[faceCells[facei]] + jf[facei]; + pnf[facei] = iField[nbrFaceCells[facei]] - jf[facei]; } } @@ -150,26 +147,28 @@ void jumpCyclicFvPatchField<Type>::updateInterfaceMatrix { scalarField pnf(this->size()); - label sizeby2 = this->size()/2; - const unallocLabelList& faceCells = this->cyclicPatch().faceCells(); + const unallocLabelList& nbrFaceCells = + this->cyclicPatch().neighbFvPatch().faceCells(); if (&psiInternal == &this->internalField()) { tmp<Field<scalar> > tjf = jump(); + if (!this->cyclicPatch().owner()) + { + tjf = -tjf; + } const Field<scalar>& jf = tjf(); - for (label facei=0; facei<sizeby2; facei++) + forAll(*this, facei) { - pnf[facei] = psiInternal[faceCells[facei + sizeby2]] - jf[facei]; - pnf[facei + sizeby2] = psiInternal[faceCells[facei]] + jf[facei]; + pnf[facei] = psiInternal[nbrFaceCells[facei]] - jf[facei]; } } else { - for (label facei=0; facei<sizeby2; facei++) + forAll(*this, facei) { - pnf[facei] = psiInternal[faceCells[facei + sizeby2]]; - pnf[facei + sizeby2] = psiInternal[faceCells[facei]]; + pnf[facei] = psiInternal[nbrFaceCells[facei]]; } } @@ -177,6 +176,7 @@ void jumpCyclicFvPatchField<Type>::updateInterfaceMatrix this->transformCoupleField(pnf, cmpt); // Multiply the field by coefficients and add into the result + const unallocLabelList& faceCells = this->cyclicPatch().faceCells(); forAll(faceCells, elemI) { result[faceCells[elemI]] -= coeffs[elemI]*pnf[elemI]; diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processor/processorFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/constraint/processor/processorFvPatchField.C index 1e4e55637dd4d5cb0c1a176fbb2b379b27d3a276..9b287f8fa7431c39f323c8f5c60a03122a6152ff 100644 --- a/src/finiteVolume/fields/fvPatchFields/constraint/processor/processorFvPatchField.C +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processor/processorFvPatchField.C @@ -73,7 +73,7 @@ processorFvPatchField<Type>::processorFvPatchField coupledFvPatchField<Type>(ptf, p, iF, mapper), procPatch_(refCast<const processorFvPatch>(p)) { - if (!isType<processorFvPatch>(this->patch())) + if (!isA<processorFvPatch>(this->patch())) { FatalErrorIn ( @@ -105,7 +105,7 @@ processorFvPatchField<Type>::processorFvPatchField coupledFvPatchField<Type>(p, iF, dict), procPatch_(refCast<const processorFvPatch>(p)) { - if (!isType<processorFvPatch>(p)) + if (!isA<processorFvPatch>(p)) { FatalIOErrorIn ( diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.C new file mode 100644 index 0000000000000000000000000000000000000000..4b688ee853df447a38a8453883ced394ca969992 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.C @@ -0,0 +1,266 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvPatchField.H" +#include "processorCyclicFvPatch.H" +#include "demandDrivenData.H" +#include "transformField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const fvPatch& p, + const DimensionedField<Type, volMesh>& iF +) +: + processorFvPatchField<Type>(p, iF), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{} + + +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const fvPatch& p, + const DimensionedField<Type, volMesh>& iF, + const Field<Type>& f +) +: + //coupledFvPatchField<Type>(p, iF, f), + processorFvPatchField<Type>(p, iF, f), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{} + + +// Construct by mapping given processorCyclicFvPatchField<Type> +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const processorCyclicFvPatchField<Type>& ptf, + const fvPatch& p, + const DimensionedField<Type, volMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + //coupledFvPatchField<Type>(ptf, p, iF, mapper), + processorFvPatchField<Type>(ptf, p, iF, mapper), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{ + if (!isType<processorCyclicFvPatch>(this->patch())) + { + FatalErrorIn + ( + "processorCyclicFvPatchField<Type>::processorCyclicFvPatchField\n" + "(\n" + " const processorCyclicFvPatchField<Type>& ptf,\n" + " const fvPatch& p,\n" + " const DimensionedField<Type, volMesh>& iF,\n" + " const fvPatchFieldMapper& mapper\n" + ")\n" + ) << "\n patch type '" << p.type() + << "' not constraint type '" << typeName << "'" + << "\n for patch " << p.name() + << " of field " << this->dimensionedInternalField().name() + << " in file " << this->dimensionedInternalField().objectPath() + << exit(FatalIOError); + } +} + + +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const fvPatch& p, + const DimensionedField<Type, volMesh>& iF, + const dictionary& dict +) +: + //coupledFvPatchField<Type>(p, iF, dict), + processorFvPatchField<Type>(p, iF, dict), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{ + if (!isType<processorCyclicFvPatch>(p)) + { + FatalIOErrorIn + ( + "processorCyclicFvPatchField<Type>::processorCyclicFvPatchField\n" + "(\n" + " const fvPatch& p,\n" + " const Field<Type>& field,\n" + " const dictionary& dict\n" + ")\n", + dict + ) << "\n patch type '" << p.type() + << "' not constraint type '" << typeName << "'" + << "\n for patch " << p.name() + << " of field " << this->dimensionedInternalField().name() + << " in file " << this->dimensionedInternalField().objectPath() + << exit(FatalIOError); + } +} + + +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const processorCyclicFvPatchField<Type>& ptf +) +: + //processorLduInterfaceField(), + //coupledFvPatchField<Type>(ptf), + processorFvPatchField<Type>(ptf), + procPatch_(refCast<const processorCyclicFvPatch>(ptf.patch())) +{} + + +template<class Type> +processorCyclicFvPatchField<Type>::processorCyclicFvPatchField +( + const processorCyclicFvPatchField<Type>& ptf, + const DimensionedField<Type, volMesh>& iF +) +: + //coupledFvPatchField<Type>(ptf, iF), + processorFvPatchField<Type>(ptf, iF), + procPatch_(refCast<const processorCyclicFvPatch>(ptf.patch())) +{} + + +// * * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicFvPatchField<Type>::~processorCyclicFvPatchField() +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +//template<class Type> +//tmp<Field<Type> > processorCyclicFvPatchField<Type>::patchNeighbourField() const +//{ +// return *this; +//} +// +// +//template<class Type> +//void processorCyclicFvPatchField<Type>::initEvaluate +//( +// const Pstream::commsTypes commsType +//) +//{ +// if (Pstream::parRun()) +// { +// procPatch_.compressedSend(commsType, this->patchInternalField()()); +// } +//} +// +// +//template<class Type> +//void processorCyclicFvPatchField<Type>::evaluate +//( +// const Pstream::commsTypes commsType +//) +//{ +// if (Pstream::parRun()) +// { +// procPatch_.compressedReceive<Type>(commsType, *this); +// +// if (doTransform()) +// { +// transform(*this, procPatch_.forwardT(), *this); +// } +// } +//} +// +// +//template<class Type> +//tmp<Field<Type> > processorCyclicFvPatchField<Type>::snGrad() const +//{ +// return this->patch().deltaCoeffs()*(*this - this->patchInternalField()); +//} +// +// +//template<class Type> +//void processorCyclicFvPatchField<Type>::initInterfaceMatrixUpdate +//( +// const scalarField& psiInternal, +// scalarField&, +// const lduMatrix&, +// const scalarField&, +// const direction, +// const Pstream::commsTypes commsType +//) const +//{ +// procPatch_.compressedSend +// ( +// commsType, +// this->patch().patchInternalField(psiInternal)() +// ); +//} +// +// +//template<class Type> +//void processorCyclicFvPatchField<Type>::updateInterfaceMatrix +//( +// const scalarField&, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +//) const +//{ +// scalarField pnf +// ( +// procPatch_.compressedReceive<scalar>(commsType, this->size())() +// ); +// +// // Transform according to the transformation tensor +// transformCoupleField(pnf, cmpt); +// +// // Multiply the field by coefficients and add into the result +// +// const unallocLabelList& faceCells = this->patch().faceCells(); +// +// forAll(faceCells, elemI) +// { +// result[faceCells[elemI]] -= coeffs[elemI]*pnf[elemI]; +// } +//} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.H b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.H new file mode 100644 index 0000000000000000000000000000000000000000..3df31b88a756073b6df63d0dae421840e702290e --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchField.H @@ -0,0 +1,338 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicFvPatchField + +Description + Foam::processorCyclicFvPatchField + +SourceFiles + processorCyclicFvPatchField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvPatchField_H +#define processorCyclicFvPatchField_H + +//#include "coupledFvPatchField.H" +//#include "processorLduInterfaceField.H" +#include "processorCyclicFvPatch.H" +#include "processorFvPatchField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicFvPatch Declaration +\*---------------------------------------------------------------------------*/ + +template<class Type> +class processorCyclicFvPatchField +: +// public processorLduInterfaceField, +// public coupledFvPatchField<Type> + public processorFvPatchField<Type> +{ + // Private data + + //- Local reference cast into the processor patch + const processorCyclicFvPatch& procPatch_; + + // Private Member Functions + +// //- Get other patchfield +// const coupledFvPatchField<Type>& patchField(const label patchID) const; +public: + + //- Runtime type information + TypeName(processorCyclicFvPatch::typeName_()); + + + // Constructors + + //- Construct from patch and internal field + processorCyclicFvPatchField + ( + const fvPatch&, + const DimensionedField<Type, volMesh>& + ); + + //- Construct from patch and internal field and patch field + processorCyclicFvPatchField + ( + const fvPatch&, + const DimensionedField<Type, volMesh>&, + const Field<Type>& + ); + + //- Construct from patch, internal field and dictionary + processorCyclicFvPatchField + ( + const fvPatch&, + const DimensionedField<Type, volMesh>&, + const dictionary& + ); + + //- Construct by mapping given processorCyclicFvPatchField onto a + // new patch + processorCyclicFvPatchField + ( + const processorCyclicFvPatchField<Type>&, + const fvPatch&, + const DimensionedField<Type, volMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct as copy + processorCyclicFvPatchField(const processorCyclicFvPatchField<Type>&); + + //- Construct and return a clone + virtual tmp<fvPatchField<Type> > clone() const + { + return tmp<fvPatchField<Type> > + ( + new processorCyclicFvPatchField<Type>(*this) + ); + } + + //- Construct as copy setting internal field reference + processorCyclicFvPatchField + ( + const processorCyclicFvPatchField<Type>&, + const DimensionedField<Type, volMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvPatchField<Type> > clone + ( + const DimensionedField<Type, volMesh>& iF + ) const + { + return tmp<fvPatchField<Type> > + ( + new processorCyclicFvPatchField<Type>(*this, iF) + ); + } + + + // Destructor + + ~processorCyclicFvPatchField(); + + + // Member functions + + // Access + +// //- Return true if running parallel +// virtual bool coupled() const +// { +// if (Pstream::parRun()) +// { +// return true; +// } +// else +// { +// return false; +// } +// } +// +// //- Return neighbour field given internal field +// tmp<Field<Type> > patchNeighbourField() const; +// +// +// // Evaluation functions +// +// //- Initialise the evaluation of the patch field +// virtual void initEvaluate(const Pstream::commsTypes commsType); +// +// //- Evaluate the patch field +// virtual void evaluate(const Pstream::commsTypes commsType); +// +// //- Return patch-normal gradient +// virtual tmp<Field<Type> > snGrad() const; +// +// //- Initialise neighbour matrix update +// virtual void initInterfaceMatrixUpdate +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix& m, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +// ) const; +// +// //- Update result field based on interface functionality +// virtual void updateInterfaceMatrix +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix& m, +// const scalarField& coeffs, +// const direction cmpt, +// const Pstream::commsTypes commsType +// ) const; +// +// //- Processor coupled interface functions +// +// //- Return processor number +// virtual int myProcNo() const +// { +// return procPatch_.myProcNo(); +// } +// +// //- Return neigbour processor number +// virtual int neighbProcNo() const +// { +// return procPatch_.neighbProcNo(); +// } + + //- Does the patch field perform the transfromation + virtual bool doTransform() const + { + return !(procPatch_.parallel() || pTraits<Type>::rank == 0); + } + + //- Return face transformation tensor + virtual const tensorField& forwardT() const + { + return procPatch_.forwardT(); + } + +// //- Return rank of component for transform +// virtual int rank() const +// { +// return pTraits<Type>::rank; +// } + +// //- Transform given patch component field +// void transformCoupleField +// ( +// scalarField& f, +// const direction cmpt +// ) const; + +// // Referred-patch functionality. Get called with a slice (size, start) +// // of a patch that supplies fields and geometry/topology. +// +// //- Get patch-normal gradient +// virtual void snGrad +// ( +// Field<Type>& exchangeBuf, +// const Field<Type>& subFld, +// const coupledFvPatch& referringPatch, +// const label size, +// const label start +// ) const +// { +// notImplemented("processorCyclicFvPatchField::snGrad(..)"); +// } +// +// //- Initialise the evaluation of the patch field. +// virtual void initEvaluate +// ( +// Field<Type>& exchangeBuf, +// const coupledFvPatch& referringPatch, +// const label size, +// const label start +// ) const +// { +// notImplemented("processorCyclicFvPatchField::initEvaluate(..)"); +// } +// +// //- Evaluate the patch field. +// virtual void evaluate +// ( +// Field<Type>& exchangeBuf, +// const coupledFvPatch& referringPatch, +// const label size, +// const label start +// ) const +// { +// notImplemented("processorCyclicFvPatchField::evaluate(..)"); +// } +// +// //- Initialise neighbour matrix update +// virtual void initInterfaceMatrixUpdate +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix& m, +// const scalarField& coeffs, +// const direction cmpt, +// const coupledFvPatch& referringPatch, +// const label size, +// const label start, +// scalarField& exchangeBuf +// ) const +// { +// notImplemented +// ( +// "processorCyclicFvPatchField::initInterfaceMatrixUpdate(..)" +// ); +// } +// +// //- Update result field based on interface functionality +// virtual void updateInterfaceMatrix +// ( +// const scalarField& psiInternal, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction, +// const coupledFvPatch& referringPatch, +// const label size, +// const label start, +// scalarField& exchangeBuf +// ) const +// { +// notImplemented +// ( +// "processorCyclicFvPatchField::updateInterfaceMatrix(..)" +// ); +// } + + +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#ifdef NoRepository +# include "processorCyclicFvPatchField.C" +#endif + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.C b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.C new file mode 100644 index 0000000000000000000000000000000000000000..3f11c04ce8286b82a02f1133308b060ebc36a860 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.C @@ -0,0 +1,45 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvPatchFields.H" +#include "addToRunTimeSelectionTable.H" +#include "volFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +makePatchFields(processorCyclic); +//makePatchTypeField(fvPatchScalarField, processorCyclicFvPatchScalarField); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.H b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.H new file mode 100644 index 0000000000000000000000000000000000000000..e4ea110ee83a2b1169c39fa870c44df60781e3c7 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFields.H @@ -0,0 +1,50 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvPatchFields_H +#define processorCyclicFvPatchFields_H + +#include "processorCyclicFvPatchScalarField.H" +#include "fieldTypes.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makePatchTypeFieldTypedefs(processorCyclic) + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFieldsFwd.H b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFieldsFwd.H new file mode 100644 index 0000000000000000000000000000000000000000..32465f89bdfb4a9b637d133d6017f593f4aa1313 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchFieldsFwd.H @@ -0,0 +1,51 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvPatchFieldsFwd_H +#define processorCyclicFvPatchFieldsFwd_H + +#include "fieldTypes.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +template<class Type> class processorCyclicFvPatchField; + +makePatchTypeFieldTypedefs(processor) + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.C b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.C new file mode 100644 index 0000000000000000000000000000000000000000..9283a96691bb30e1dece847435cc51b0872e7026 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.C @@ -0,0 +1,84 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvPatchScalarField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +//template<> +//void processorCyclicFvPatchField<scalar>::initInterfaceMatrixUpdate +//( +// const scalarField& psiInternal, +// scalarField&, +// const lduMatrix&, +// const scalarField&, +// const direction, +// const Pstream::commsTypes commsType +//) const +//{ +// procPatch_.compressedSend +// ( +// commsType, +// patch().patchInternalField(psiInternal)() +// ); +//} +// +// +//template<> +//void processorCyclicFvPatchField<scalar>::updateInterfaceMatrix +//( +// const scalarField&, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction, +// const Pstream::commsTypes commsType +//) const +//{ +// scalarField pnf +// ( +// procPatch_.compressedReceive<scalar>(commsType, this->size())() +// ); +// +// const unallocLabelList& faceCells = patch().faceCells(); +// +// forAll(faceCells, facei) +// { +// result[faceCells[facei]] -= coeffs[facei]*pnf[facei]; +// } +//} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.H b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.H new file mode 100644 index 0000000000000000000000000000000000000000..ddbe013dc44b4945bf9e8e2d115e60fa7d65afdc --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/constraint/processorCyclic/processorCyclicFvPatchScalarField.H @@ -0,0 +1,72 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvPatchScalarField_H +#define processorCyclicFvPatchScalarField_H + +#include "processorCyclicFvPatchField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +//template<> +//void processorCyclicFvPatchField<scalar>::initInterfaceMatrixUpdate +//( +// const scalarField&, +// scalarField&, +// const lduMatrix&, +// const scalarField&, +// const direction, +// const Pstream::commsTypes commsType +//) const; +// +// +//template<> +//void processorCyclicFvPatchField<scalar>::updateInterfaceMatrix +//( +// const scalarField&, +// scalarField& result, +// const lduMatrix&, +// const scalarField& coeffs, +// const direction, +// const Pstream::commsTypes commsType +//) const; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.C b/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.C index 2b9fd7434944c31bcf4384cd6500c7d61d0c6f24..c7288f621f1fb8778b4aef14310fe5a8b3bf3e20 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.C +++ b/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.C @@ -27,6 +27,7 @@ License #include "addToRunTimeSelectionTable.H" #include "volFields.H" #include "surfaceFields.H" +#include "cyclicFvPatch.H" // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // @@ -44,6 +45,7 @@ activeBaffleVelocityFvPatchVectorField orientation_(1), initWallSf_(0), initCyclicSf_(0), + nbrCyclicSf_(0), openFraction_(0), openingTime_(0), maxOpenFractionDelta_(0), @@ -67,6 +69,7 @@ activeBaffleVelocityFvPatchVectorField orientation_(ptf.orientation_), initWallSf_(ptf.initWallSf_), initCyclicSf_(ptf.initCyclicSf_), + nbrCyclicSf_(ptf.nbrCyclicSf_), openFraction_(ptf.openFraction_), openingTime_(ptf.openingTime_), maxOpenFractionDelta_(ptf.maxOpenFractionDelta_), @@ -89,6 +92,13 @@ activeBaffleVelocityFvPatchVectorField orientation_(readLabel(dict.lookup("orientation"))), initWallSf_(p.Sf()), initCyclicSf_(p.boundaryMesh()[cyclicPatchLabel_].Sf()), + nbrCyclicSf_ + ( + refCast<const cyclicFvPatch> + ( + p.boundaryMesh()[cyclicPatchLabel_] + ).neighbFvPatch().Sf() + ), openFraction_(readScalar(dict.lookup("openFraction"))), openingTime_(readScalar(dict.lookup("openingTime"))), maxOpenFractionDelta_(readScalar(dict.lookup("maxOpenFractionDelta"))), @@ -111,6 +121,7 @@ activeBaffleVelocityFvPatchVectorField orientation_(ptf.orientation_), initWallSf_(ptf.initWallSf_), initCyclicSf_(ptf.initCyclicSf_), + nbrCyclicSf_(ptf.nbrCyclicSf_), openFraction_(ptf.openFraction_), openingTime_(ptf.openingTime_), maxOpenFractionDelta_(ptf.maxOpenFractionDelta_), @@ -132,6 +143,7 @@ activeBaffleVelocityFvPatchVectorField orientation_(ptf.orientation_), initWallSf_(ptf.initWallSf_), initCyclicSf_(ptf.initCyclicSf_), + nbrCyclicSf_(ptf.nbrCyclicSf_), openFraction_(ptf.openFraction_), openingTime_(ptf.openingTime_), maxOpenFractionDelta_(ptf.maxOpenFractionDelta_), @@ -160,6 +172,13 @@ void Foam::activeBaffleVelocityFvPatchVectorField::autoMap [ cyclicPatchLabel_ ].patchSlice(areas); + nbrCyclicSf_ = refCast<const cyclicFvPatch> + ( + patch().boundaryMesh() + [ + cyclicPatchLabel_ + ] + ).neighbFvPatch().patch().patchSlice(areas); } void Foam::activeBaffleVelocityFvPatchVectorField::rmap @@ -177,6 +196,13 @@ void Foam::activeBaffleVelocityFvPatchVectorField::rmap [ cyclicPatchLabel_ ].patchSlice(areas); + nbrCyclicSf_ = refCast<const cyclicFvPatch> + ( + patch().boundaryMesh() + [ + cyclicPatchLabel_ + ] + ).neighbFvPatch().patch().patchSlice(areas); } @@ -197,19 +223,24 @@ void Foam::activeBaffleVelocityFvPatchVectorField::updateCoeffs() const fvPatch& cyclicPatch = patch().boundaryMesh()[cyclicPatchLabel_]; const labelList& cyclicFaceCells = cyclicPatch.patch().faceCells(); - label nCyclicFaces = cyclicFaceCells.size(); - label nCyclicFacesPerSide = nCyclicFaces/2; + const fvPatch& nbrPatch = refCast<const cyclicFvPatch> + ( + cyclicPatch + ).neighbFvPatch(); + const labelList& nbrFaceCells = nbrPatch.patch().faceCells(); scalar forceDiff = 0; - for (label facei=0; facei<nCyclicFacesPerSide; facei++) + // Add this side + forAll(cyclicFaceCells, facei) { forceDiff += p[cyclicFaceCells[facei]]*mag(initCyclicSf_[facei]); } - for (label facei=nCyclicFacesPerSide; facei<nCyclicFaces; facei++) + // Remove other side + forAll(nbrFaceCells, facei) { - forceDiff -= p[cyclicFaceCells[facei]]*mag(initCyclicSf_[facei]); + forceDiff -= p[nbrFaceCells[facei]]*mag(nbrCyclicSf_[facei]); } openFraction_ = @@ -239,10 +270,16 @@ void Foam::activeBaffleVelocityFvPatchVectorField::updateCoeffs() } const_cast<scalarField&>(patch().magSf()) = mag(patch().Sf()); + // Update owner side of cyclic const_cast<vectorField&>(cyclicPatch.Sf()) = openFraction_*initCyclicSf_; const_cast<scalarField&>(cyclicPatch.magSf()) = mag(cyclicPatch.Sf()); + // Update neighbour side of cyclic + const_cast<vectorField&>(nbrPatch.Sf()) = + openFraction_*nbrCyclicSf_; + const_cast<scalarField&>(nbrPatch.magSf()) = + mag(nbrPatch.Sf()); curTimeIndex_ = this->db().time().timeIndex(); } diff --git a/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.H b/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.H index c35cbc058e40b58c381be0f8ff9de77810f1f754..2bc39eedefbf8395f23989a6fbbf8d69c60e8fca 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.H +++ b/src/finiteVolume/fields/fvPatchFields/derived/activeBaffleVelocity/activeBaffleVelocityFvPatchVectorField.H @@ -71,9 +71,12 @@ class activeBaffleVelocityFvPatchVectorField //- Initial wall patch areas vectorField initWallSf_; - //- Initial cyclic patch areas + //- Initial this-side cyclic patch areas vectorField initCyclicSf_; + //- Initial neighbour-side cyclic patch areas + vectorField nbrCyclicSf_; + //- Current fraction of the active baffle which is open scalar openFraction_; diff --git a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.C index 19181e0f4ed9929c055dabf723124d3f53c71616..e5bfc0c7f5db0dc8d5055168812144fceb3ddc73 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.C +++ b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.C @@ -42,7 +42,7 @@ fanFvPatchField<Type>::fanFvPatchField : jumpCyclicFvPatchField<Type>(p, iF), f_(0), - jump_(this->size()/2, 0.0) + jump_(this->size(), 0.0) {} @@ -71,12 +71,14 @@ fanFvPatchField<Type>::fanFvPatchField : jumpCyclicFvPatchField<Type>(p, iF), f_(), - jump_(this->size()/2, 0.0) + jump_(this->size(), 0.0) { { Istream& is = dict.lookup("f"); is.format(IOstream::ASCII); is >> f_; + + // Check that f_ table is same on both sides.? } if (dict.found("value")) @@ -128,21 +130,7 @@ void fanFvPatchField<Type>::autoMap ) { jumpCyclicFvPatchField<Type>::autoMap(m); - - // Jump is half size. Expand to full size, map and truncate. - if (jump_.size() && jump_.size() == this->size()/2) - { - label oldSize = jump_.size(); - jump_.setSize(this->size()); - - for (label i = oldSize; i < jump_.size(); i++) - { - jump_[i] = jump_[i-oldSize]; - } - - jump_.autoMap(m); - jump_.setSize(oldSize); - } + jump_.autoMap(m); } @@ -155,24 +143,9 @@ void fanFvPatchField<Type>::rmap { jumpCyclicFvPatchField<Type>::rmap(ptf, addr); - // Jump is half size. Expand to full size, map and truncate. - if (jump_.size() && jump_.size() == this->size()/2) - { - label oldSize = jump_.size(); - jump_.setSize(this->size()); - - for (label i = oldSize; i < jump_.size(); i++) - { - jump_[i] = jump_[i-oldSize]; - } - - const fanFvPatchField<Type>& tiptf = - refCast<const fanFvPatchField<Type> >(ptf); - - jump_.rmap(tiptf.jump_, addr); - - jump_.setSize(oldSize); - } + const fanFvPatchField<Type>& tiptf = + refCast<const fanFvPatchField<Type> >(ptf); + jump_.rmap(tiptf.jump_, addr); } diff --git a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.H b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.H index ed19c47d689e23f0f8c5523dbd4a17096e00ba2b..5fbd932690dec303f86674ae731e57f48aa89a28 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.H +++ b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchField.H @@ -131,7 +131,13 @@ public: // Access - //- Return the "jump" across the patch as a "half" field + //- Return the polynomial coefficients + const List<scalar>& f() const + { + return f_; + } + + //- Return the "jump" across the patch. virtual tmp<Field<Type> > jump() const { return jump_; diff --git a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchFields.C b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchFields.C index f7371a7360f58a3f6f887958bdd0de9df6b51c29..a27f526741bd7fe9004f74c909489a427ddfc99a 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchFields.C +++ b/src/finiteVolume/fields/fvPatchFields/derived/fan/fanFvPatchFields.C @@ -46,6 +46,7 @@ void Foam::fanFvPatchField<Foam::scalar>::updateCoeffs() return; } + // Constant jump_ = f_[0]; if (f_.size() > 1) @@ -56,21 +57,11 @@ void Foam::fanFvPatchField<Foam::scalar>::updateCoeffs() const fvsPatchField<scalar>& phip = patch().patchField<surfaceScalarField, scalar>(phi); - scalarField Un = max - ( - scalarField::subField(phip, size()/2) - /scalarField::subField(patch().magSf(), size()/2), - scalar(0) - ); + scalarField Un = max(phip/patch().magSf(), scalar(0)); if (phi.dimensions() == dimDensity*dimVelocity*dimArea) { - Un /= - scalarField::subField - ( - patch().lookupPatchField<volScalarField, scalar>("rho"), - size()/2 - ); + Un /= patch().lookupPatchField<volScalarField, scalar>("rho"); } for (label i=1; i<f_.size(); i++) diff --git a/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.C b/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.C new file mode 100644 index 0000000000000000000000000000000000000000..c08dbde49564de384d626271b7f76334cebb3965 --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.C @@ -0,0 +1,200 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2006-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "swirlMassFlowRateInletVelocityFvPatchVectorField.H" +#include "volFields.H" +#include "addToRunTimeSelectionTable.H" +#include "fvPatchFieldMapper.H" +#include "surfaceFields.H" +#include "mathematicalConstants.H" + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +Foam:: +swirlMassFlowRateInletVelocityFvPatchVectorField:: +swirlMassFlowRateInletVelocityFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchField<vector>(p, iF), + flowRate_(0), + phiName_("phi"), + rhoName_("rho"), + rpm_(0) +{} + + +Foam:: +swirlMassFlowRateInletVelocityFvPatchVectorField:: +swirlMassFlowRateInletVelocityFvPatchVectorField +( + const swirlMassFlowRateInletVelocityFvPatchVectorField& ptf, + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + fixedValueFvPatchField<vector>(ptf, p, iF, mapper), + flowRate_(ptf.flowRate_), + phiName_(ptf.phiName_), + rhoName_(ptf.rhoName_) +{} + + +Foam:: +swirlMassFlowRateInletVelocityFvPatchVectorField:: +swirlMassFlowRateInletVelocityFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const dictionary& dict +) +: + fixedValueFvPatchField<vector>(p, iF, dict), + flowRate_(readScalar(dict.lookup("flowRate"))), + phiName_(dict.lookupOrDefault<word>("phi", "phi")), + rhoName_(dict.lookupOrDefault<word>("rho", "rho")), + rpm_(readScalar(dict.lookup("rpm"))) +{} + + +Foam:: +swirlMassFlowRateInletVelocityFvPatchVectorField:: +swirlMassFlowRateInletVelocityFvPatchVectorField +( + const swirlMassFlowRateInletVelocityFvPatchVectorField& ptf +) +: + fixedValueFvPatchField<vector>(ptf), + flowRate_(ptf.flowRate_), + phiName_(ptf.phiName_), + rhoName_(ptf.rhoName_), + rpm_(ptf.rpm_) +{} + + +Foam:: +swirlMassFlowRateInletVelocityFvPatchVectorField:: +swirlMassFlowRateInletVelocityFvPatchVectorField +( + const swirlMassFlowRateInletVelocityFvPatchVectorField& ptf, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchField<vector>(ptf, iF), + flowRate_(ptf.flowRate_), + phiName_(ptf.phiName_), + rhoName_(ptf.rhoName_), + rpm_(ptf.rpm_) +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +void Foam::swirlMassFlowRateInletVelocityFvPatchVectorField::updateCoeffs() +{ + if (updated()) + { + return; + } + + scalar totArea = gSum(patch().magSf()); + // a simpler way of doing this would be nice + scalar avgU = -flowRate_/totArea; + + vector center = gSum(patch().Cf()*patch().magSf())/totArea; + vector normal = gSum(patch().nf()*patch().magSf())/totArea; + + vectorField tangVelo = + (rpm_*constant::mathematical::pi/30.0) + *(patch().Cf() - center) ^ normal; + + vectorField n = patch().nf(); + + const surfaceScalarField& phi = + db().lookupObject<surfaceScalarField>(phiName_); + + if (phi.dimensions() == dimVelocity*dimArea) + { + // volumetric flow-rate + operator==(tangVelo + n*avgU); + } + else if (phi.dimensions() == dimDensity*dimVelocity*dimArea) + { + const fvPatchField<scalar>& rhop = + patch().lookupPatchField<volScalarField, scalar>(rhoName_); + + // mass flow-rate + operator==(tangVelo + n*avgU/rhop); + } + else + { + FatalErrorIn + ( + "swirlMassFlowRateInletVelocityFvPatchVectorField::updateCoeffs()" + ) << "dimensions of " << phiName_ << " are incorrect" << nl + << " on patch " << this->patch().name() + << " of field " << this->dimensionedInternalField().name() + << " in file " << this->dimensionedInternalField().objectPath() + << nl << exit(FatalError); + } + + fixedValueFvPatchField<vector>::updateCoeffs(); +} + + +void Foam::swirlMassFlowRateInletVelocityFvPatchVectorField::write(Ostream& os) const +{ + fvPatchField<vector>::write(os); + os.writeKeyword("flowRate") << flowRate_ << token::END_STATEMENT << nl; + if (phiName_ != "phi") + { + os.writeKeyword("phi") << phiName_ << token::END_STATEMENT << nl; + } + if (rhoName_ != "rho") + { + os.writeKeyword("rho") << rhoName_ << token::END_STATEMENT << nl; + } + os.writeKeyword("rpm") << rpm_ << token::END_STATEMENT << nl; + writeEntry("value", os); +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + makePatchTypeField + ( + fvPatchVectorField, + swirlMassFlowRateInletVelocityFvPatchVectorField + ); +} + + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.H b/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.H new file mode 100644 index 0000000000000000000000000000000000000000..bef41d4655cc95eb07a3f875721803e2cf4450eb --- /dev/null +++ b/src/finiteVolume/fields/fvPatchFields/derived/swirlMassFlowRateInletVelocity/swirlMassFlowRateInletVelocityFvPatchVectorField.H @@ -0,0 +1,191 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::swirlMassFlowRateInletVelocityFvPatchVectorField + +Description + Describes a volumetric/mass flow normal vector boundary condition by its + magnitude as an integral over its area with a swirl component determined + by the RPM + + The basis of the patch (volumetric or mass) is determined by the + dimensions of the flux, phi. + The current density is used to correct the velocity when applying the + mass basis. + + Example of the boundary condition specification: + @verbatim + inlet + { + type swirlMassFlowRateInletVelocity; + flowRate 0.2; // Volumetric/mass flow rate [m3/s or kg/s] + rpm 100; + } + @endverbatim + +Note + - The value is positive inwards + +SourceFiles + swirlMassFlowRateInletVelocityFvPatchVectorField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef swirlMassFlowRateInletVelocityFvPatchVectorField_H +#define swirlMassFlowRateInletVelocityFvPatchVectorField_H + +#include "fixedValueFvPatchFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +/*---------------------------------------------------------------------------*\ + Class swirlMassFlowRateInletVelocityFvPatchVectorField Declaration +\*---------------------------------------------------------------------------*/ + +class swirlMassFlowRateInletVelocityFvPatchVectorField +: + public fixedValueFvPatchVectorField +{ + // Private data + + //- Inlet integral flow rate + scalar flowRate_; + + //- Name of the flux transporting the field + word phiName_; + + //- Name of the density field used to normalize the mass flux + word rhoName_; + + //- RPM + scalar rpm_; + + +public: + + //- Runtime type information + TypeName("swirlMassFlowRateInletVelocity"); + + + // Constructors + + //- Construct from patch and internal field + swirlMassFlowRateInletVelocityFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct from patch, internal field and dictionary + swirlMassFlowRateInletVelocityFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const dictionary& + ); + + //- Construct by mapping given + // flowRateInletVelocityFvPatchVectorField + // onto a new patch + swirlMassFlowRateInletVelocityFvPatchVectorField + ( + const swirlMassFlowRateInletVelocityFvPatchVectorField&, + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct as copy + swirlMassFlowRateInletVelocityFvPatchVectorField + ( + const swirlMassFlowRateInletVelocityFvPatchVectorField& + ); + + //- Construct and return a clone + virtual tmp<fvPatchVectorField> clone() const + { + return tmp<fvPatchVectorField> + ( + new swirlMassFlowRateInletVelocityFvPatchVectorField(*this) + ); + } + + //- Construct as copy setting internal field reference + swirlMassFlowRateInletVelocityFvPatchVectorField + ( + const swirlMassFlowRateInletVelocityFvPatchVectorField&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvPatchVectorField> clone + ( + const DimensionedField<vector, volMesh>& iF + ) const + { + return tmp<fvPatchVectorField> + ( + new swirlMassFlowRateInletVelocityFvPatchVectorField(*this, iF) + ); + } + + + // Member functions + + // Access + + //- Return the flux + scalar flowRate() const + { + return flowRate_; + } + + //- Return reference to the flux to allow adjustment + scalar& flowRate() + { + return flowRate_; + } + + + //- Update the coefficients associated with the patch field + virtual void updateCoeffs(); + + //- Write + virtual void write(Ostream&) const; + +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvPatchFields/derived/timeVaryingMappedFixedValue/timeVaryingMappedFixedValueFvPatchField.H b/src/finiteVolume/fields/fvPatchFields/derived/timeVaryingMappedFixedValue/timeVaryingMappedFixedValueFvPatchField.H index 4b41508a868caf95ad2b97fe3e9b9bd979dbf328..a949b8e5a31ee3d255f9f14f350e196317181675 100644 --- a/src/finiteVolume/fields/fvPatchFields/derived/timeVaryingMappedFixedValue/timeVaryingMappedFixedValueFvPatchField.H +++ b/src/finiteVolume/fields/fvPatchFields/derived/timeVaryingMappedFixedValue/timeVaryingMappedFixedValueFvPatchField.H @@ -110,13 +110,11 @@ class timeVaryingMappedFixedValueFvPatchField label& hi ) const; + //- Read boundary points and determine interpolation weights to patch // faceCentres void readSamplePoints(); - //- Find boundary data inbetween current time and interpolate - void checkTable(); - //- Do actual interpolation using current weights tmp<Field<Type> > interpolate(const Field<Type>&) const; @@ -199,6 +197,12 @@ public: return referenceCS_; } + //- Return startSampledValues + const Field<Type> startSampledValues() + { + return startSampledValues_; + } + // Mapping functions @@ -216,6 +220,12 @@ public: ); + // Utility functions + + //- Find boundary data inbetween current time and interpolate + void checkTable(); + + // Evaluation functions //- Update the coefficients associated with the patch field diff --git a/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.C b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.C new file mode 100644 index 0000000000000000000000000000000000000000..918c7731196179a68e365b4869f07b8a14612d5b --- /dev/null +++ b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.C @@ -0,0 +1,157 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvsPatchField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const fvPatch& p, + const DimensionedField<Type, surfaceMesh>& iF +) +: + coupledFvsPatchField<Type>(p, iF), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{} + + +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const fvPatch& p, + const DimensionedField<Type, surfaceMesh>& iF, + const Field<Type>& f +) +: + coupledFvsPatchField<Type>(p, iF, f), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{} + + +// Construct by mapping given processorCyclicFvsPatchField<Type> +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const processorCyclicFvsPatchField<Type>& ptf, + const fvPatch& p, + const DimensionedField<Type, surfaceMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + coupledFvsPatchField<Type>(ptf, p, iF, mapper), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{ + if (!isType<processorCyclicFvPatch>(this->patch())) + { + FatalErrorIn + ( + "processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField\n" + "(\n" + " const processorCyclicFvsPatchField<Type>& ptf,\n" + " const fvPatch& p,\n" + " const DimensionedField<Type, surfaceMesh>& iF,\n" + " const fvPatchFieldMapper& mapper\n" + ")\n" + ) << "Field type does not correspond to patch type for patch " + << this->patch().index() << "." << endl + << "Field type: " << typeName << endl + << "Patch type: " << this->patch().type() + << exit(FatalError); + } +} + + +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const fvPatch& p, + const DimensionedField<Type, surfaceMesh>& iF, + const dictionary& dict +) +: + coupledFvsPatchField<Type>(p, iF, dict), + procPatch_(refCast<const processorCyclicFvPatch>(p)) +{ + if (!isType<processorCyclicFvPatch>(p)) + { + FatalIOErrorIn + ( + "processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField\n" + "(\n" + " const fvPatch& p,\n" + " const Field<Type>& field,\n" + " const dictionary& dict\n" + ")\n", + dict + ) << "patch " << this->patch().index() << " not processor type. " + << "Patch type = " << p.type() + << exit(FatalIOError); + } +} + + +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const processorCyclicFvsPatchField<Type>& ptf +) +: + coupledFvsPatchField<Type>(ptf), + procPatch_(refCast<const processorCyclicFvPatch>(ptf.patch())) +{} + + +template<class Type> +processorCyclicFvsPatchField<Type>::processorCyclicFvsPatchField +( + const processorCyclicFvsPatchField<Type>& ptf, + const DimensionedField<Type, surfaceMesh>& iF +) +: + coupledFvsPatchField<Type>(ptf, iF), + procPatch_(refCast<const processorCyclicFvPatch>(ptf.patch())) +{} + + +// * * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * // + +template<class Type> +processorCyclicFvsPatchField<Type>::~processorCyclicFvsPatchField() +{} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.H b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.H new file mode 100644 index 0000000000000000000000000000000000000000..b418bd7aa9e4129c22d7bd9b7c8fcead7d7b6f43 --- /dev/null +++ b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchField.H @@ -0,0 +1,173 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicFvsPatchField + +Description + Foam::processorCyclicFvsPatchField + +SourceFiles + processorCyclicFvsPatchField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvsPatchField_H +#define processorCyclicFvsPatchField_H + +#include "coupledFvsPatchField.H" +#include "processorCyclicFvPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicFvsPatch Declaration +\*---------------------------------------------------------------------------*/ + +template<class Type> +class processorCyclicFvsPatchField +: + public coupledFvsPatchField<Type> +{ + // Private data + + //- Local reference cast into the processor patch + const processorCyclicFvPatch& procPatch_; + + +public: + + //- Runtime type information + TypeName(processorCyclicFvPatch::typeName_()); + + + // Constructors + + //- Construct from patch and internal field + processorCyclicFvsPatchField + ( + const fvPatch&, + const DimensionedField<Type, surfaceMesh>& + ); + + //- Construct from patch and internal field and patch field + processorCyclicFvsPatchField + ( + const fvPatch&, + const DimensionedField<Type, surfaceMesh>&, + const Field<Type>& + ); + + //- Construct from patch, internal field and dictionary + processorCyclicFvsPatchField + ( + const fvPatch&, + const DimensionedField<Type, surfaceMesh>&, + const dictionary& + ); + + //- Construct by mapping given processorCyclicFvsPatchField onto a + // new patch + processorCyclicFvsPatchField + ( + const processorCyclicFvsPatchField<Type>&, + const fvPatch&, + const DimensionedField<Type, surfaceMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct as copy + processorCyclicFvsPatchField(const processorCyclicFvsPatchField<Type>&); + + //- Construct and return a clone + virtual tmp<fvsPatchField<Type> > clone() const + { + return tmp<fvsPatchField<Type> > + ( + new processorCyclicFvsPatchField<Type>(*this) + ); + } + + //- Construct as copy setting internal field reference + processorCyclicFvsPatchField + ( + const processorCyclicFvsPatchField<Type>&, + const DimensionedField<Type, surfaceMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvsPatchField<Type> > clone + ( + const DimensionedField<Type, surfaceMesh>& iF + ) const + { + return tmp<fvsPatchField<Type> > + ( + new processorCyclicFvsPatchField<Type>(*this, iF) + ); + } + + + // Destructor + + ~processorCyclicFvsPatchField(); + + + // Member functions + + // Access + + //- Return true if running parallel + virtual bool coupled() const + { + if (Pstream::parRun()) + { + return true; + } + else + { + return false; + } + } +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#ifdef NoRepository +# include "processorCyclicFvsPatchField.C" +#endif + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.C b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.C new file mode 100644 index 0000000000000000000000000000000000000000..9ac8157e92c317a52f9ce7cf5ce245e031221c0c --- /dev/null +++ b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.C @@ -0,0 +1,44 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvsPatchFields.H" +#include "fvsPatchFields.H" +#include "addToRunTimeSelectionTable.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // + +makeFvsPatchFields(processorCyclic); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.H b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.H new file mode 100644 index 0000000000000000000000000000000000000000..5e4684c48080c4fd378848b182e08e91f89cef71 --- /dev/null +++ b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFields.H @@ -0,0 +1,50 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvsPatchFields_H +#define processorCyclicFvsPatchFields_H + +#include "processorCyclicFvsPatchField.H" +#include "fieldTypes.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makeFvsPatchTypeFieldTypedefs(processorCyclic) + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFieldsFwd.H b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFieldsFwd.H new file mode 100644 index 0000000000000000000000000000000000000000..ad19f47e4e56ed30f8fb28627520cbda5620c569 --- /dev/null +++ b/src/finiteVolume/fields/fvsPatchFields/constraint/processorCyclic/processorCyclicFvsPatchFieldsFwd.H @@ -0,0 +1,51 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvsPatchFieldsFwd_H +#define processorCyclicFvsPatchFieldsFwd_H + +#include "fieldTypes.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +template<class Type> class processorCyclicFvsPatchField; + +makeFvsPatchTypeFieldTypedefs(processor) + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fvMatrices/solvers/MULES/MULESTemplates.C b/src/finiteVolume/fvMatrices/solvers/MULES/MULESTemplates.C index 2fe12f0317b013b5daa1d850119614ffb9778354..d99aa43eb1f14c0ed1b8e3dad53f8b3e30c752d3 100644 --- a/src/finiteVolume/fvMatrices/solvers/MULES/MULESTemplates.C +++ b/src/finiteVolume/fvMatrices/solvers/MULES/MULESTemplates.C @@ -590,7 +590,7 @@ void Foam::MULES::limiter } } - syncTools::syncFaceList(mesh, allLambda, minEqOp<scalar>(), false); + syncTools::syncFaceList(mesh, allLambda, minEqOp<scalar>()); } } diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CECCellToCellStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CECCellToCellStencil.C index aed12722c9df675808d81a141776df43854fb890..eb0f4303e175c79c55b92bf795680c1c4ca653ab 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CECCellToCellStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CECCellToCellStencil.C @@ -25,6 +25,7 @@ License #include "CECCellToCellStencil.H" #include "syncTools.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -56,13 +57,7 @@ void Foam::CECCellToCellStencil::calcEdgeBoundaryData ); } - syncTools::syncEdgeMap - ( - mesh(), - neiGlobal, - unionEqOp(), - false // apply separation - ); + syncTools::syncEdgeMap(mesh(), neiGlobal, unionEqOp(), dummyTransform()); } diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CFCCellToCellStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CFCCellToCellStencil.C index b121eb29c1c5914364eacb851ac1ced008f9ae1f..c5d0eaec92cce92b304112c603cde071dde898da 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CFCCellToCellStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CFCCellToCellStencil.C @@ -78,7 +78,7 @@ void Foam::CFCCellToCellStencil::calcFaceBoundaryData } } } - syncTools::swapBoundaryFaceList(mesh(), neiGlobal, false); + syncTools::swapBoundaryFaceList(mesh(), neiGlobal); } diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CPCCellToCellStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CPCCellToCellStencil.C index bae45472a9d4df140049a6e37e5973cbb0998306..a4f757505402ff4a04be40cf40561d7bc0210f90 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CPCCellToCellStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToCell/fullStencils/CPCCellToCellStencil.C @@ -25,6 +25,7 @@ License #include "CPCCellToCellStencil.H" #include "syncTools.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -61,7 +62,7 @@ void Foam::CPCCellToCellStencil::calcPointBoundaryData mesh(), neiGlobal, unionEqOp(), - false // apply separation + Foam::dummyTransform() // dummy transformation ); } diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/extendedUpwindCellToFaceStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/extendedUpwindCellToFaceStencil.C index a2259bfc723c16f1c679c731fa425f2bc31f614c..82e91bcd4e64c52af211e09fa6d958a3f224e174 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/extendedUpwindCellToFaceStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/extendedUpwindCellToFaceStencil.C @@ -27,6 +27,7 @@ License #include "cellToFaceStencil.H" #include "syncTools.H" #include "SortableList.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -315,7 +316,15 @@ void Foam::extendedUpwindCellToFaceStencil::transportStencils { neiBndStencil[faceI-mesh_.nInternalFaces()] = ownStencil[faceI]; } - syncTools::swapBoundaryFaceList(mesh_, neiBndStencil, false); + //syncTools::swapBoundaryFaceList(mesh_, neiBndStencil); + syncTools::syncBoundaryFaceList + ( + mesh_, + neiBndStencil, + eqOp<labelList>(), + dummyTransform() + ); + // Do the neighbour side diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/FECCellToFaceStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/FECCellToFaceStencil.C index 048ef4391b077a1d4e7e0f1e24561b4852acf788..52a7ad6a57cef3d733abc295fcfb44b6377debcf 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/FECCellToFaceStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/FECCellToFaceStencil.C @@ -26,9 +26,7 @@ License #include "FECCellToFaceStencil.H" #include "syncTools.H" #include "emptyPolyPatch.H" -//#include "meshTools.H" -//#include "OFstream.H" -//#include "Time.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -60,13 +58,7 @@ void Foam::FECCellToFaceStencil::calcEdgeBoundaryData ); } - syncTools::syncEdgeMap - ( - mesh(), - neiGlobal, - unionEqOp(), - false // apply separation - ); + syncTools::syncEdgeMap(mesh(), neiGlobal, unionEqOp(), dummyTransform()); } @@ -104,7 +96,7 @@ void Foam::FECCellToFaceStencil::calcFaceStencil } } } - syncTools::swapBoundaryFaceList(mesh(), neiGlobalCell, false); + syncTools::swapBoundaryFaceList(mesh(), neiGlobalCell); diff --git a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/cellToFaceStencil.C b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/cellToFaceStencil.C index d2289a721fc38f2be98201b25b9fed6436154fd8..e6d68f87dc9ce8578a86362d3ecd09e5426337ff 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/cellToFaceStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/cellToFace/fullStencils/cellToFaceStencil.C @@ -24,9 +24,10 @@ License \*---------------------------------------------------------------------------*/ #include "cellToFaceStencil.H" -#include "syncTools.H" #include "SortableList.H" #include "emptyPolyPatch.H" +#include "syncTools.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -370,7 +371,14 @@ void Foam::cellToFaceStencil::calcFaceStencil } } } - syncTools::swapBoundaryFaceList(mesh_, neiGlobalCellCells, false); + //syncTools::swapBoundaryFaceList(mesh_, neiGlobalCellCells); + syncTools::syncBoundaryFaceList + ( + mesh_, + neiGlobalCellCells, + eqOp<labelList>(), + dummyTransform() + ); diff --git a/src/finiteVolume/fvMesh/extendedStencil/faceToCell/fullStencils/CFCFaceToCellStencil.C b/src/finiteVolume/fvMesh/extendedStencil/faceToCell/fullStencils/CFCFaceToCellStencil.C index 91d4f9ed5d05de7766502b3857cb06928a6490e8..12a46a28e797241fa3dbafaa5108cd46c6bbb76b 100644 --- a/src/finiteVolume/fvMesh/extendedStencil/faceToCell/fullStencils/CFCFaceToCellStencil.C +++ b/src/finiteVolume/fvMesh/extendedStencil/faceToCell/fullStencils/CFCFaceToCellStencil.C @@ -26,6 +26,7 @@ License #include "CFCFaceToCellStencil.H" #include "syncTools.H" #include "emptyPolyPatch.H" +#include "dummyTransform.H" // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // @@ -80,7 +81,14 @@ void Foam::CFCFaceToCellStencil::calcFaceBoundaryData // Do nothing since face itself already in stencil } } - syncTools::swapBoundaryFaceList(mesh(), neiGlobal, false); + //syncTools::swapBoundaryFaceList(mesh(), neiGlobal); + syncTools::syncBoundaryFaceList + ( + mesh(), + neiGlobal, + eqOp<labelList>(), + dummyTransform() + ); } diff --git a/src/finiteVolume/fvMesh/fvMeshSubset/fvMeshSubset.C b/src/finiteVolume/fvMesh/fvMeshSubset/fvMeshSubset.C index 8cd71ce2c206076865c1095c94a7924f0971929a..f6266998a3ef5cfd915ea8aff26641c02175e0cd 100644 --- a/src/finiteVolume/fvMesh/fvMeshSubset/fvMeshSubset.C +++ b/src/finiteVolume/fvMesh/fvMeshSubset/fvMeshSubset.C @@ -102,6 +102,8 @@ void Foam::fvMeshSubset::doCoupledPatches if (syncPar && Pstream::parRun()) { + PstreamBuffers pBufs(Pstream::nonBlocking); + // Send face usage across processor patches forAll(oldPatches, oldPatchI) { @@ -112,17 +114,14 @@ void Foam::fvMeshSubset::doCoupledPatches const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); - OPstream toNeighbour - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); + UOPstream toNeighbour(procPatch.neighbProcNo(), pBufs); toNeighbour << SubList<label>(nCellsUsingFace, pp.size(), pp.start()); } } + pBufs.finishedSends(); // Receive face usage count and check for faces that become uncoupled. forAll(oldPatches, oldPatchI) @@ -134,11 +133,7 @@ void Foam::fvMeshSubset::doCoupledPatches const processorPolyPatch& procPatch = refCast<const processorPolyPatch>(pp); - IPstream fromNeighbour - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); + UIPstream fromNeighbour(procPatch.neighbProcNo(), pBufs); labelList nbrCellsUsingFace(fromNeighbour); diff --git a/src/finiteVolume/fvMesh/fvPatches/basic/coupled/coupledFvPatch.H b/src/finiteVolume/fvMesh/fvPatches/basic/coupled/coupledFvPatch.H index 013c3aa2ac576ae0a60a62c41936f3f811c9c80a..899bebc9ac03e670671fd36feb8b9a5e4356e6f5 100644 --- a/src/finiteVolume/fvMesh/fvPatches/basic/coupled/coupledFvPatch.H +++ b/src/finiteVolume/fvMesh/fvPatches/basic/coupled/coupledFvPatch.H @@ -103,23 +103,14 @@ public: return coupledPolyPatch_.coupled(); } - //- Return face transformation tensor - const tensorField& forwardT() const - { - return coupledPolyPatch_.forwardT(); - } + //- Are the cyclic planes parallel. + virtual bool parallel() const = 0; - //- Return neighbour-cell transformation tensor - const tensorField& reverseT() const - { - return coupledPolyPatch_.reverseT(); - } + //- Return face transformation tensor. + virtual const tensorField& forwardT() const = 0; - //- Are the cyclic planes parallel - bool parallel() const - { - return coupledPolyPatch_.parallel(); - } + //- Return neighbour-cell transformation tensor. + virtual const tensorField& reverseT() const = 0; //- Return faceCell addressing virtual const unallocLabelList& faceCells() const @@ -140,21 +131,6 @@ public: const unallocLabelList& internalData ) const = 0; - //- Initialise interface data transfer - virtual void initTransfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const - {} - - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const = 0; - //- Initialise neighbour field transfer virtual void initInternalFieldTransfer ( diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.C b/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.C index 19ff7e6e6c6cebc1edb964f30b3109b5da51a364..e6fe565f5c117592483cb5cfcb910f57ac46757b 100644 --- a/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.C +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.C @@ -26,6 +26,7 @@ License #include "cyclicFvPatch.H" #include "addToRunTimeSelectionTable.H" #include "fvMesh.H" +#include "transform.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -43,30 +44,31 @@ addToRunTimeSelectionTable(fvPatch, cyclicFvPatch, polyPatch); // Make patch weighting factors void cyclicFvPatch::makeWeights(scalarField& w) const { + const cyclicFvPatch& nbrPatch = neighbFvPatch(); + const scalarField& magFa = magSf(); + const scalarField& nbrMagFa = nbrPatch.magSf(); scalarField deltas = nf() & fvPatch::delta(); - label sizeby2 = deltas.size()/2; + scalarField nbrDeltas = nbrPatch.nf() & nbrPatch.fvPatch::delta(); - for (label facei = 0; facei < sizeby2; facei++) + forAll(magFa, facei) { - scalar avFa = (magFa[facei] + magFa[facei + sizeby2])/2.0; + scalar avFa = (magFa[facei] + nbrMagFa[facei])/2.0; - if (mag(magFa[facei] - magFa[facei + sizeby2])/avFa > 1e-4) + if (mag(magFa[facei] - nbrMagFa[facei])/avFa > 1e-4) { FatalErrorIn("cyclicFvPatch::makeWeights(scalarField& w) const") - << "face " << facei << " and " << facei + sizeby2 - << " areas do not match by " - << 100*mag(magFa[facei] - magFa[facei + sizeby2])/avFa + << "face " << facei << " areas do not match by " + << 100*mag(magFa[facei] - nbrMagFa[facei])/avFa << "% -- possible face ordering problem" << abort(FatalError); } scalar di = deltas[facei]; - scalar dni = deltas[facei + sizeby2]; + scalar dni = nbrDeltas[facei]; w[facei] = dni/(di + dni); - w[facei + sizeby2] = 1 - w[facei]; } } @@ -74,16 +76,18 @@ void cyclicFvPatch::makeWeights(scalarField& w) const // Make patch face - neighbour cell distances void cyclicFvPatch::makeDeltaCoeffs(scalarField& dc) const { + //const cyclicPolyPatch& nbrPatch = cyclicPolyPatch_.neighbPatch(); + const cyclicFvPatch& nbrPatch = neighbFvPatch(); + scalarField deltas = nf() & fvPatch::delta(); - label sizeby2 = deltas.size()/2; + scalarField nbrDeltas = nbrPatch.nf() & nbrPatch.fvPatch::delta(); - for (label facei = 0; facei < sizeby2; facei++) + forAll(deltas, facei) { scalar di = deltas[facei]; - scalar dni = deltas[facei + sizeby2]; + scalar dni = nbrDeltas[facei]; dc[facei] = 1.0/(di + dni); - dc[facei + sizeby2] = dc[facei]; } } @@ -92,7 +96,7 @@ void cyclicFvPatch::makeDeltaCoeffs(scalarField& dc) const tmp<vectorField> cyclicFvPatch::delta() const { vectorField patchD = fvPatch::delta(); - label sizeby2 = patchD.size()/2; + vectorField nbrPatchD = neighbFvPatch().fvPatch::delta(); tmp<vectorField> tpdv(new vectorField(patchD.size())); vectorField& pdv = tpdv(); @@ -100,24 +104,22 @@ tmp<vectorField> cyclicFvPatch::delta() const // To the transformation if necessary if (parallel()) { - for (label facei = 0; facei < sizeby2; facei++) + forAll(patchD, facei) { vector ddi = patchD[facei]; - vector dni = patchD[facei + sizeby2]; + vector dni = nbrPatchD[facei]; pdv[facei] = ddi - dni; - pdv[facei + sizeby2] = -pdv[facei]; } } else { - for (label facei = 0; facei < sizeby2; facei++) + forAll(patchD, facei) { vector ddi = patchD[facei]; - vector dni = patchD[facei + sizeby2]; + vector dni = nbrPatchD[facei]; pdv[facei] = ddi - transform(forwardT()[0], dni); - pdv[facei + sizeby2] = -transform(reverseT()[0], pdv[facei]); } } @@ -134,47 +136,13 @@ tmp<labelField> cyclicFvPatch::interfaceInternalField } -tmp<labelField> cyclicFvPatch::transfer -( - const Pstream::commsTypes, - const unallocLabelList& interfaceData -) const -{ - tmp<labelField> tpnf(new labelField(this->size())); - labelField& pnf = tpnf(); - - label sizeby2 = this->size()/2; - - for (label facei=0; facei<sizeby2; facei++) - { - pnf[facei] = interfaceData[facei + sizeby2]; - pnf[facei + sizeby2] = interfaceData[facei]; - } - - return tpnf; -} - - tmp<labelField> cyclicFvPatch::internalFieldTransfer ( const Pstream::commsTypes commsType, const unallocLabelList& iF ) const { - const unallocLabelList& faceCells = this->patch().faceCells(); - - tmp<labelField> tpnf(new labelField(this->size())); - labelField& pnf = tpnf(); - - label sizeby2 = this->size()/2; - - for (label facei=0; facei<sizeby2; facei++) - { - pnf[facei] = iF[faceCells[facei + sizeby2]]; - pnf[facei + sizeby2] = iF[faceCells[facei]]; - } - - return tpnf; + return neighbFvPatch().patchInternalField(iF); } diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.H b/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.H index 66a01caad8b6157d2b4cb0759593b7fbf945a8a0..ca2654c30ff5d0fd042daae7579488035e6d8ce6 100644 --- a/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.H +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/cyclic/cyclicFvPatch.H @@ -38,6 +38,7 @@ SourceFiles #include "coupledFvPatch.H" #include "cyclicLduInterface.H" #include "cyclicPolyPatch.H" +#include "fvBoundaryMesh.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -89,21 +90,61 @@ public: // Access + //- Return local reference cast into the cyclic patch + const cyclicPolyPatch& cyclicPatch() const + { + return cyclicPolyPatch_; + } + + //- Return neighbour + virtual label neighbPatchID() const + { + return cyclicPolyPatch_.neighbPatchID(); + } + + virtual bool owner() const + { + return cyclicPolyPatch_.owner(); + } + + //- Return processor number + virtual const cyclicLduInterface& neighbPatch() const + { + return refCast<const cyclicFvPatch> + ( + this->boundaryMesh()[cyclicPolyPatch_.neighbPatchID()] + ); + } + + //- Are the cyclic planes parallel + virtual bool parallel() const + { + return cyclicPolyPatch_.parallel(); + } + //- Return face transformation tensor - const tensorField& forwardT() const + virtual const tensorField& forwardT() const { - return coupledFvPatch::forwardT(); + return cyclicPolyPatch_.forwardT(); } //- Return neighbour-cell transformation tensor - const tensorField& reverseT() const + virtual const tensorField& reverseT() const { - return coupledFvPatch::reverseT(); + return cyclicPolyPatch_.reverseT(); + } + + const cyclicFvPatch& neighbFvPatch() const + { + return refCast<const cyclicFvPatch> + ( + this->boundaryMesh()[cyclicPolyPatch_.neighbPatchID()] + ); } //- Return delta (P to N) vectors across coupled patch - tmp<vectorField> delta() const; + virtual tmp<vectorField> delta() const; // Interface transfer functions @@ -115,13 +156,6 @@ public: const unallocLabelList& internalData ) const; - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - //- Return neighbour field virtual tmp<labelField> internalFieldTransfer ( diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.C b/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.C index 4c7c55bc8205d014443aede655986b9caa7eecf9..18c5827eec4847e77fd95962f3770720891462e0 100644 --- a/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.C +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.C @@ -122,26 +122,6 @@ tmp<labelField> processorFvPatch::interfaceInternalField } -void processorFvPatch::initTransfer -( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData -) const -{ - send(commsType, interfaceData); -} - - -tmp<labelField> processorFvPatch::transfer -( - const Pstream::commsTypes commsType, - const unallocLabelList& -) const -{ - return receive<label>(commsType, this->size()); -} - - void processorFvPatch::initInternalFieldTransfer ( const Pstream::commsTypes commsType, diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.H b/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.H index 300f2434313171d75470aceaacb2fd9fee4b9b17..68bff0e7e1e94b5e94700b7259d2dcb7250331ed 100644 --- a/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.H +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/processor/processorFvPatch.H @@ -99,6 +99,12 @@ public: return procPolyPatch_.neighbProcNo(); } + //- Return message tag used for sending + virtual int tag() const + { + return UPstream::msgType(); + } + //- Return true if running parallel virtual bool coupled() const { @@ -112,14 +118,31 @@ public: } } + const processorPolyPatch& procPolyPatch() const + { + return procPolyPatch_; + } + + //- Are the cyclic planes parallel + virtual bool parallel() const + { + return procPolyPatch_.parallel(); + } + //- Return face transformation tensor virtual const tensorField& forwardT() const { return procPolyPatch_.forwardT(); } + //- Return neighbour-cell transformation tensor. + virtual const tensorField& reverseT() const + { + return procPolyPatch_.reverseT(); + } + //- Return delta (P to N) vectors across coupled patch - tmp<vectorField> delta() const; + virtual tmp<vectorField> delta() const; // Interface transfer functions @@ -131,20 +154,6 @@ public: const unallocLabelList& internalData ) const; - //- Initialise interface data transfer - virtual void initTransfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - - //- Transfer and return neighbour field - virtual tmp<labelField> transfer - ( - const Pstream::commsTypes commsType, - const unallocLabelList& interfaceData - ) const; - //- Initialise neighbour field transfer virtual void initInternalFieldTransfer ( diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.C b/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.C new file mode 100644 index 0000000000000000000000000000000000000000..e972bcf0b678a95b472d731d7aeffa7e53fafb88 --- /dev/null +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.C @@ -0,0 +1,46 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "processorCyclicFvPatch.H" +#include "addToRunTimeSelectionTable.H" +#include "transformField.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +defineTypeNameAndDebug(processorCyclicFvPatch, 0); +addToRunTimeSelectionTable(fvPatch, processorCyclicFvPatch, polyPatch); + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.H b/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.H new file mode 100644 index 0000000000000000000000000000000000000000..1ff63acc10df69fb199ee26d7f8da7f427c1044a --- /dev/null +++ b/src/finiteVolume/fvMesh/fvPatches/constraint/processorCyclic/processorCyclicFvPatch.H @@ -0,0 +1,117 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 1991-2009 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 2 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::processorCyclicFvPatch + +Description + Processor patch. + +SourceFiles + processorCyclicFvPatch.C + +\*---------------------------------------------------------------------------*/ + +#ifndef processorCyclicFvPatch_H +#define processorCyclicFvPatch_H + +#include "processorCyclicPolyPatch.H" +#include "processorFvPatch.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +/*---------------------------------------------------------------------------*\ + Class processorCyclicFvPatch Declaration +\*---------------------------------------------------------------------------*/ + +class processorCyclicFvPatch +: + public processorFvPatch +{ + // Private Data + + const processorCyclicPolyPatch& procPolyPatch_; + +public: + + //- Runtime type information + TypeName(processorCyclicPolyPatch::typeName_()); + + + // Constructors + + //- Construct from components + processorCyclicFvPatch(const polyPatch& patch, const fvBoundaryMesh& bm) + : + processorFvPatch(patch, bm), + procPolyPatch_(refCast<const processorCyclicPolyPatch>(patch)) + {} + + + // Member functions + + //- Return message tag used for sending + virtual int tag() const + { + // Allocate from Pstream? + return procPolyPatch_.tag(); + } + + const processorCyclicPolyPatch& procPolyPatch() const + { + return procPolyPatch_; + } + + //- Are the cyclic planes parallel + virtual bool parallel() const + { + return procPolyPatch_.parallel(); + } + + //- Return face transformation tensor + virtual const tensorField& forwardT() const + { + return procPolyPatch_.forwardT(); + } + + //- Return neighbour-cell transformation tensor + virtual const tensorField& reverseT() const + { + return procPolyPatch_.reverseT(); + } +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/finiteVolume/fvMesh/singleCellFvMesh/singleCellFvMesh.C b/src/finiteVolume/fvMesh/singleCellFvMesh/singleCellFvMesh.C index 4b93d83e5c828dc51371dc8c082202042d6b6b58..86a60d8a7a74ab3ee65de824731a067b7738b9e0 100644 --- a/src/finiteVolume/fvMesh/singleCellFvMesh/singleCellFvMesh.C +++ b/src/finiteVolume/fvMesh/singleCellFvMesh/singleCellFvMesh.C @@ -81,7 +81,7 @@ void Foam::singleCellFvMesh::agglomerateMesh } } } - syncTools::swapBoundaryFaceList(mesh, nbrAgglom, false); + syncTools::swapBoundaryFaceList(mesh, nbrAgglom); // Get correspondence between this agglomeration and remote one diff --git a/src/finiteVolume/interpolation/surfaceInterpolation/schemes/UpwindFitScheme/UpwindFitData.C b/src/finiteVolume/interpolation/surfaceInterpolation/schemes/UpwindFitScheme/UpwindFitData.C index 47a7d69e46aa46d2762c12524f2b2cebc2c2c63c..b28ec8d4a8a2aa27b6c848d37caf69b78b8157cc 100644 --- a/src/finiteVolume/interpolation/surfaceInterpolation/schemes/UpwindFitScheme/UpwindFitData.C +++ b/src/finiteVolume/interpolation/surfaceInterpolation/schemes/UpwindFitScheme/UpwindFitData.C @@ -27,7 +27,6 @@ License #include "surfaceFields.H" #include "volFields.H" #include "SVD.H" -#include "syncTools.H" #include "extendedUpwindCellToFaceStencil.H" // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // diff --git a/src/lagrangian/basic/InteractionLists/InteractionLists.H b/src/lagrangian/basic/InteractionLists/InteractionLists.H index 77da111828664fa21f5b4e461ff20c7171a658b4..8382c77bd7509f900b4f30d0d45433c3b7d2a23f 100644 --- a/src/lagrangian/basic/InteractionLists/InteractionLists.H +++ b/src/lagrangian/basic/InteractionLists/InteractionLists.H @@ -287,10 +287,13 @@ public: wallFaceIndexAndTransformToDistribute() const; //- Return access to the referred wall faces - const List<referredWallFace>& referredWallFaces() const; + inline const List<referredWallFace>& referredWallFaces() const; + + //- Return the name of the velocity field + inline const word& UName() const; //- Return access to the referred wall data - const List<vector>& referredWallData() const; + inline const List<vector>& referredWallData() const; //- Return access to the referred particle container inline const List<IDLList<ParticleType> >& diff --git a/src/lagrangian/basic/InteractionLists/InteractionListsI.H b/src/lagrangian/basic/InteractionLists/InteractionListsI.H index ad28f696c5b1df3b6204d092889aefa1e49ccc79..1b61942f5eb671c6f97db05efbf25527b1b7b6bb 100644 --- a/src/lagrangian/basic/InteractionLists/InteractionListsI.H +++ b/src/lagrangian/basic/InteractionLists/InteractionListsI.H @@ -128,6 +128,13 @@ Foam::InteractionLists<ParticleType>::referredWallFaces() const } +template<class ParticleType> +const Foam::word& Foam::InteractionLists<ParticleType>::UName() const +{ + return UName_; +} + + template<class ParticleType> const Foam::List<Foam::vector>& Foam::InteractionLists<ParticleType>::referredWallData() const diff --git a/src/lagrangian/basic/Particle/Particle.C b/src/lagrangian/basic/Particle/Particle.C index b413211499ef6947f72bf5f701135663e8400808..5717e0c76d6ef84b0d1a9eef37c15357cff4015b 100644 --- a/src/lagrangian/basic/Particle/Particle.C +++ b/src/lagrangian/basic/Particle/Particle.C @@ -474,25 +474,27 @@ void Foam::Particle<ParticleType>::hitCyclicPatch TrackData& ) { - label patchFacei_ = cpp.whichFace(facei_); +// label patchFacei_ = cpp.whichFace(facei_); facei_ = cpp.transformGlobalFace(facei_); celli_ = cloud_.polyMesh_.faceOwner()[facei_]; + // Now the particle is on the receiving side + if (!cpp.parallel()) { - const tensor& T = cpp.transformT(patchFacei_); + const tensor& T = cpp.reverseT()[0]; transformPosition(T); static_cast<ParticleType&>(*this).transformProperties(T); } else if (cpp.separated()) { - position_ += cpp.separation(patchFacei_); + position_ += cpp.separation()[0]; static_cast<ParticleType&>(*this).transformProperties ( - cpp.separation(patchFacei_) + cpp.separation()[0] ); } } diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C index 486c0959dddfb299e64c1c7747ebc2ff3f98a62f..7fc3cf863634c4167d4fc3dc88fd087f5ba1ad4c 100644 --- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C +++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C @@ -42,7 +42,7 @@ template<class ParcelType> void Foam::KinematicCloud<ParcelType>::preEvolve() { this->dispersion().cacheFields(true); - forces_.cacheFields(true); + forces_.cacheFields(true, interpolationSchemes_); } @@ -152,7 +152,7 @@ void Foam::KinematicCloud<ParcelType>::postEvolve() } this->dispersion().cacheFields(false); - forces_.cacheFields(false); + forces_.cacheFields(false, interpolationSchemes_); this->postProcessing().post(); } diff --git a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C index 4d89dedde191f2b1bca08e07a3bf8b586910afb7..fc34e3b1614498aa2c19a7f3559d23bfbaf4d943 100644 --- a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C +++ b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C @@ -162,6 +162,7 @@ const Foam::vector Foam::KinematicParcel<ParcelType>::calcVelocity // Momentum source due to particle forces const vector FCoupled = mass*td.cloud().forces().calcCoupled ( + this->position(), cellI, dt, rhoc_, @@ -173,6 +174,7 @@ const Foam::vector Foam::KinematicParcel<ParcelType>::calcVelocity const vector FNonCoupled = mass*td.cloud().forces().calcNonCoupled ( + this->position(), cellI, dt, rhoc_, @@ -346,7 +348,7 @@ bool Foam::KinematicParcel<ParcelType>::hitPatch { ParcelType& p = static_cast<ParcelType&>(*this); - // Invoke poost-processing mdoel + // Invoke post-processing model td.cloud().postProcessing().postPatch(p, patchI); // Invoke surface film model diff --git a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.H b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.H index 4dd608c5bb236e4fd28137a281cbb4143e80755b..84123c89f4c202aa4bd926c10e42142d78686a11 100644 --- a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.H +++ b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.H @@ -182,8 +182,8 @@ public: // Constructors - //- Construct from components - inline trackData + //- Construct from components + inline trackData ( KinematicCloud<ParcelType>& cloud, const constantProperties& constProps, diff --git a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcelI.H b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcelI.H index 7f531a05cfd7b0598570694b43ea288eb779e676..ceef9ca8b2eb984d29fbafcf0d8b21c4c784f285 100644 --- a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcelI.H +++ b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcelI.H @@ -439,14 +439,23 @@ inline Foam::scalar Foam::KinematicParcel<ParcelType>::wallImpactDistance const vector& ) const { - // Do not use a wall impact distance to allow proper multiple face - // collisions. In a twisted mesh the particle can be within range - // of a wall but not in the cell attached to a wall face, hence - // miss the interaction. + const KinematicCloud<ParcelType>& c = + dynamic_cast<const KinematicCloud<ParcelType>&>(this->cloud()); - return 0.0; + if (c.collision().controlsWallInteraction()) + { + // Do not use a wall impact distance if the collision model + // controls wall interactions to allow proper multiple face + // collisions. In a twisted mesh the particle can be within + // range of a wall but not in the cell attached to a wall + // face, hence miss the interaction. - // return 0.5*d_; + return 0.0; + } + else + { + return 0.5*d_; + } } diff --git a/src/lagrangian/intermediate/particleForces/particleForces.C b/src/lagrangian/intermediate/particleForces/particleForces.C index 5d446037fe6b79a31eb33e8cd47ba965d7f68fe6..31db9460f1b98e485d6dfb6e3b58e8392c85546f 100644 --- a/src/lagrangian/intermediate/particleForces/particleForces.C +++ b/src/lagrangian/intermediate/particleForces/particleForces.C @@ -30,6 +30,24 @@ License #include "mathematicalConstants.H" #include "electromagneticConstants.H" +// * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // + +void Foam::particleForces::deleteFields() +{ + if (gradUPtr_) + { + delete gradUPtr_; + gradUPtr_ = NULL; + } + + if (HdotGradHInterPtr_) + { + delete HdotGradHInterPtr_; + HdotGradHInterPtr_ = NULL; + } +} + + // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // Foam::particleForces::particleForces @@ -85,7 +103,7 @@ Foam::particleForces::particleForces(const particleForces& f) Foam::particleForces::~particleForces() { - cacheFields(false); + deleteFields(); } @@ -151,26 +169,46 @@ const Foam::word& Foam::particleForces::HdotGradHName() const } -void Foam::particleForces::cacheFields(const bool store) +void Foam::particleForces::cacheFields +( + const bool store, + const dictionary& interpolationSchemes +) { - if (store && pressureGradient_) + if (store) { - const volVectorField& U = mesh_.lookupObject<volVectorField>(UName_); - gradUPtr_ = fvc::grad(U).ptr(); + if (pressureGradient_) + { + const volVectorField& U = + mesh_.lookupObject<volVectorField>(UName_); + + gradUPtr_ = fvc::grad(U).ptr(); + } + + if (paramagnetic_) + { + const volVectorField& HdotGradH = mesh_.lookupObject<volVectorField> + ( + HdotGradHName_ + ); + + HdotGradHInterPtr_ = interpolation<vector>::New + ( + interpolationSchemes, + HdotGradH + ).ptr(); + } } else { - if (gradUPtr_) - { - delete gradUPtr_; - gradUPtr_ = NULL; - } + deleteFields(); } } Foam::vector Foam::particleForces::calcCoupled ( + const vector& position, const label cellI, const scalar dt, const scalar rhoc, @@ -205,6 +243,7 @@ Foam::vector Foam::particleForces::calcCoupled Foam::vector Foam::particleForces::calcNonCoupled ( + const vector& position, const label cellI, const scalar dt, const scalar rhoc, @@ -226,15 +265,12 @@ Foam::vector Foam::particleForces::calcNonCoupled if (paramagnetic_) { - const volVectorField& HdotGradH = mesh_.lookupObject<volVectorField> - ( - HdotGradHName_ - ); + const interpolation<vector>& HdotGradHInter = *HdotGradHInterPtr_; accelTot += 3.0*constant::electromagnetic::mu0.value()/rho *magneticSusceptibility_/(magneticSusceptibility_ + 3) - *HdotGradH[cellI]; + *HdotGradHInter.interpolate(position, cellI); // force is: diff --git a/src/lagrangian/intermediate/particleForces/particleForces.H b/src/lagrangian/intermediate/particleForces/particleForces.H index 90c5ecafa43101deb433ddee8a3389fa04e9e41a..8c76b1f773dfbba1d90f146878e649468b36abcd 100644 --- a/src/lagrangian/intermediate/particleForces/particleForces.H +++ b/src/lagrangian/intermediate/particleForces/particleForces.H @@ -40,6 +40,7 @@ SourceFiles #include "Switch.H" #include "vector.H" #include "volFieldsFwd.H" +#include "interpolation.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -69,6 +70,9 @@ class particleForces //- Velocity gradient field const volTensorField* gradUPtr_; + //- HdotGradH interpolator + const interpolation<vector>* HdotGradHInterPtr_; + // Forces to include in particle motion evaluation @@ -101,6 +105,12 @@ class particleForces const word HdotGradHName_; + // Private Member Functions + + //- Delete cached carrier fields + void deleteFields(); + + public: // Constructors @@ -159,11 +169,16 @@ public: // Evaluation //- Cache carrier fields - void cacheFields(const bool store); + void cacheFields + ( + const bool store, + const dictionary& interpolationSchemes + ); //- Calculate action/reaction forces between carrier and particles vector calcCoupled ( + const vector& position, const label cellI, const scalar dt, const scalar rhoc, @@ -176,6 +191,7 @@ public: //- Calculate external forces applied to the particles vector calcNonCoupled ( + const vector& position, const label cellI, const scalar dt, const scalar rhoc, diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.H index 3420f8d9e5b2922170c051e9371db1616aac71b0..cbce0ee43acc85e130ea867c751128a69a7be97f 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.H @@ -141,6 +141,10 @@ public: //- Flag to indicate whether model activates injection model virtual bool active() const = 0; + //- Indicates whether model determines wall collisions or not, + // used to determine what value to use for wallImpactDistance + virtual bool controlsWallInteraction() const = 0; + // Collision function virtual void collide() = 0; }; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.C index f99edcd47f47be531341441632f4cc6c6b032635..993fe53b7041abab78c8238ea2e013123dfa5bc1 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.C @@ -61,6 +61,13 @@ bool Foam::NoCollision<CloudType>::active() const } +template<class CloudType> +bool Foam::NoCollision<CloudType>::controlsWallInteraction() const +{ + return false; +} + + template<class CloudType> void Foam::NoCollision<CloudType>::collide() {} diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.H index 5806806892e1e40186a2c6b4974498df2a59bc79..e0c0ffbc6b5b9400fd4f87aae33804fd47484102 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/NoCollision/NoCollision.H @@ -82,6 +82,10 @@ public: //- Flag to indicate whether model activates injection model virtual bool active() const; + //- Indicates whether model determines wall collisions or not, + // used to determine what value to use for wallImpactDistance + virtual bool controlsWallInteraction() const; + // Collision function virtual void collide(); }; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C index 967acf06401671c9cb4c47dd9e560f9d5ccc01d3..e1e1587c95dc9afae113bd90d7129d9f2eb85111 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C @@ -175,13 +175,20 @@ void Foam::PairCollision<CloudType>::wallInteraction() const labelListList directWallFaces = il_.dwfil(); + const labelList& patchID = mesh.boundaryMesh().patchID(); + + const volVectorField& U = mesh.lookupObject<volVectorField>(il_.UName()); + // Storage for the wall interaction sites - DynamicList<point> flatSites; + DynamicList<point> flatSitePoints; DynamicList<scalar> flatSiteExclusionDistancesSqr; - DynamicList<point> otherSites; + DynamicList<WallSiteData<vector> > flatSiteData; + DynamicList<point> otherSitePoints; DynamicList<scalar> otherSiteDistances; - DynamicList<point> sharpSites; + DynamicList<WallSiteData<vector> > otherSiteData; + DynamicList<point> sharpSitePoints; DynamicList<scalar> sharpSiteExclusionDistancesSqr; + DynamicList<WallSiteData<vector> > sharpSiteData; forAll(dil, realCellI) { @@ -191,19 +198,22 @@ void Foam::PairCollision<CloudType>::wallInteraction() // Loop over all Parcels in cell forAll(cellOccupancy_[realCellI], cellParticleI) { - flatSites.clear(); + flatSitePoints.clear(); flatSiteExclusionDistancesSqr.clear(); - otherSites.clear(); + flatSiteData.clear(); + otherSitePoints.clear(); otherSiteDistances.clear(); - sharpSites.clear(); + otherSiteData.clear(); + sharpSitePoints.clear(); sharpSiteExclusionDistancesSqr.clear(); + sharpSiteData.clear(); typename CloudType::parcelType& p = - *cellOccupancy_[realCellI][cellParticleI]; + *cellOccupancy_[realCellI][cellParticleI]; const point& pos = p.position(); - scalar r = p.d()/2; + scalar r = wallModel_->pREff(p); // real wallFace interactions @@ -229,6 +239,18 @@ void Foam::PairCollision<CloudType>::wallInteraction() scalar normalAlignment = normal & pW/mag(pW); + // Find the patchIndex and wallData for WallSiteData object + label patchI = patchID[realFaceI - mesh.nInternalFaces()]; + + label patchFaceI = + realFaceI - mesh.boundaryMesh()[patchI].start(); + + WallSiteData<vector> wSD + ( + patchI, + U.boundaryField()[patchI][patchFaceI] + ); + if (normalAlignment > cosPhiMinFlatWall) { // Guard against a flat interaction being @@ -239,25 +261,29 @@ void Foam::PairCollision<CloudType>::wallInteraction() ( !duplicatePointInList ( - flatSites, + flatSitePoints, nearPt, sqr(r*flatWallDuplicateExclusion) ) ) { - flatSites.append(nearPt); + flatSitePoints.append(nearPt); flatSiteExclusionDistancesSqr.append ( sqr(r) - sqr(nearest.distance()) ); + + flatSiteData.append(wSD); } } else { - otherSites.append(nearPt); + otherSitePoints.append(nearPt); otherSiteDistances.append(nearest.distance()); + + otherSiteData.append(wSD); } } } @@ -269,8 +295,10 @@ void Foam::PairCollision<CloudType>::wallInteraction() forAll(cellRefWallFaces, rWFI) { + label refWallFaceI = cellRefWallFaces[rWFI]; + const referredWallFace& rwf = - il_.referredWallFaces()[cellRefWallFaces[rWFI]]; + il_.referredWallFaces()[refWallFaceI]; const pointField& pts = rwf.points(); @@ -288,6 +316,14 @@ void Foam::PairCollision<CloudType>::wallInteraction() scalar normalAlignment = normal & pW/mag(pW); + // Find the patchIndex and wallData for WallSiteData object + + WallSiteData<vector> wSD + ( + rwf.patchIndex(), + il_.referredWallData()[refWallFaceI] + ); + if (normalAlignment > cosPhiMinFlatWall) { // Guard against a flat interaction being @@ -298,25 +334,29 @@ void Foam::PairCollision<CloudType>::wallInteraction() ( !duplicatePointInList ( - flatSites, + flatSitePoints, nearPt, sqr(r*flatWallDuplicateExclusion) ) ) { - flatSites.append(nearPt); + flatSitePoints.append(nearPt); flatSiteExclusionDistancesSqr.append ( sqr(r) - sqr(nearest.distance()) ); + + flatSiteData.append(wSD); } } else { - otherSites.append(nearPt); + otherSitePoints.append(nearPt); otherSiteDistances.append(nearest.distance()); + + otherSiteData.append(wSD); } } } @@ -338,13 +378,13 @@ void Foam::PairCollision<CloudType>::wallInteraction() { label orderedIndex = sortedOtherSiteIndices[siteI]; - const point& otherPt = otherSites[orderedIndex]; + const point& otherPt = otherSitePoints[orderedIndex]; if ( !duplicatePointInList ( - flatSites, + flatSitePoints, otherPt, flatSiteExclusionDistancesSqr ) @@ -357,23 +397,32 @@ void Foam::PairCollision<CloudType>::wallInteraction() ( !duplicatePointInList ( - sharpSites, + sharpSitePoints, otherPt, sharpSiteExclusionDistancesSqr ) ) { - sharpSites.append(otherPt); + sharpSitePoints.append(otherPt); sharpSiteExclusionDistancesSqr.append ( sqr(r) - sqr(otherSiteDistances[orderedIndex]) ); + + sharpSiteData.append(otherSiteData[orderedIndex]); } } } - evaluateWall(p, flatSites, sharpSites); + evaluateWall + ( + p, + flatSitePoints, + flatSiteData, + sharpSitePoints, + sharpSiteData + ); } } } @@ -463,11 +512,20 @@ template<class CloudType> void Foam::PairCollision<CloudType>::evaluateWall ( typename CloudType::parcelType& p, - const List<point>& flatSites, - const List<point>& sharpSites + const List<point>& flatSitePoints, + const List<WallSiteData<vector> >& flatSiteData, + const List<point>& sharpSitePoints, + const List<WallSiteData<vector> >& sharpSiteData ) const { - wallModel_->evaluateWall(p, flatSites, sharpSites); + wallModel_->evaluateWall + ( + p, + flatSitePoints, + flatSiteData, + sharpSitePoints, + sharpSiteData + ); } @@ -502,7 +560,8 @@ Foam::PairCollision<CloudType>::PairCollision ( owner.mesh(), readScalar(this->coeffDict().lookup("maxInteractionDistance")), - Switch(this->coeffDict().lookup("writeReferredParticleCloud")) + Switch(this->coeffDict().lookup("writeReferredParticleCloud")), + this->coeffDict().lookupOrDefault("UName", word("U")) ) {} @@ -552,6 +611,13 @@ bool Foam::PairCollision<CloudType>::active() const } +template<class CloudType> +bool Foam::PairCollision<CloudType>::controlsWallInteraction() const +{ + return true; +} + + template<class CloudType> void Foam::PairCollision<CloudType>::collide() { diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.H index 8582db464e25d6d2df5395344e85694b5b49895e..8699d477cdd225f52000a58bd283e8a175a4defd 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.H @@ -36,6 +36,7 @@ SourceFiles #include "CollisionModel.H" #include "InteractionLists.H" +#include "WallSiteData.H" // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // @@ -137,8 +138,10 @@ class PairCollision void evaluateWall ( typename CloudType::parcelType& p, - const List<point>& flatSites, - const List<point>& sharpSites + const List<point>& flatSitePoints, + const List<WallSiteData<vector> >& flatSiteData, + const List<point>& sharpSitePoints, + const List<WallSiteData<vector> >& sharpSiteData ) const; @@ -171,6 +174,10 @@ public: //- Flag to indicate whether model activates injection model virtual bool active() const; + //- Indicates whether model determines wall collisions or not, + // used to determine what value to use for wallImpactDistance + virtual bool controlsWallInteraction() const; + // Collision function virtual void collide(); }; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairModel/PairModel.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairModel/PairModel.H index 1b6d1e56be43bafb0a9b6f195e86e3ce4bde155a..b5b36fdb68b8e5542ea1d93d6c15e48fbf48f09e 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairModel/PairModel.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairModel/PairModel.H @@ -54,7 +54,7 @@ class PairModel { // Private data - //- The cloud dictionary + //- The CollisionModel dictionary const dictionary& dict_; //- Reference to the owner cloud class diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.C index bbefa136cacb2661e18efa1a8ac3406c26ecd01c..6c10eff509f8f3428ae62ee86183a6df5339f9a8 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.C @@ -45,13 +45,15 @@ void Foam::PairSpringSliderDashpot<CloudType>::findMinMaxProperties // Finding minimum diameter to avoid excessive arithmetic - RMin = min(p.d(), RMin); + scalar dEff = p.d()*cbrt(p.nParticle()*volumeFactor_); + + RMin = min(dEff, RMin); rhoMax = max(p.rho(), rhoMax); UMagMax = max ( - mag(p.U()) + mag(p.omega())*p.d()/2, + mag(p.U()) + mag(p.omega())*dEff/2, UMagMax ); } @@ -91,7 +93,8 @@ Foam::PairSpringSliderDashpot<CloudType>::PairSpringSliderDashpot ( this->coeffDict().lookup("collisionResolutionSteps") ) - ) + ), + volumeFactor_(this->dict().lookupOrDefault("volumeFactor", 1.0)) { scalar nu = this->owner().constProps().poissonsRatio(); @@ -155,7 +158,11 @@ void Foam::PairSpringSliderDashpot<CloudType>::evaluatePair { vector r_AB = (pA.position() - pB.position()); - scalar normalOverlapMag = 0.5*(pA.d() + pB.d()) - mag(r_AB); + scalar dAEff = pA.d()*cbrt(pA.nParticle()*volumeFactor_); + + scalar dBEff = pB.d()*cbrt(pB.nParticle()*volumeFactor_); + + scalar normalOverlapMag = 0.5*(dAEff + dBEff) - mag(r_AB); if (normalOverlapMag > 0) { @@ -166,7 +173,7 @@ void Foam::PairSpringSliderDashpot<CloudType>::evaluatePair vector U_AB = pA.U() - pB.U(); // Effective radius - scalar R = 0.5*pA.d()*pB.d()/(pA.d() + pB.d()); + scalar R = 0.5*dAEff*dBEff/(dAEff + dBEff); // Effective mass scalar M = pA.mass()*pB.mass()/(pA.mass() + pB.mass()); @@ -185,8 +192,8 @@ void Foam::PairSpringSliderDashpot<CloudType>::evaluatePair vector USlip_AB = U_AB - (U_AB & rHat_AB)*rHat_AB - + (pA.omega() ^ (pA.d()/2*-rHat_AB)) - - (pB.omega() ^ (pB.d()/2*rHat_AB)); + + (pA.omega() ^ (dAEff/2*-rHat_AB)) + - (pB.omega() ^ (dBEff/2*rHat_AB)); scalar deltaT = this->owner().mesh().time().deltaTValue(); @@ -215,7 +222,7 @@ void Foam::PairSpringSliderDashpot<CloudType>::evaluatePair { scalar kT = 8.0*sqrt(R*normalOverlapMag)*Gstar_; - scalar& etaT = etaN; + scalar etaT = etaN; // Tangential force vector fT_AB; @@ -233,16 +240,16 @@ void Foam::PairSpringSliderDashpot<CloudType>::evaluatePair else { fT_AB = - -kT*tangentialOverlapMag - *tangentialOverlap_AB/tangentialOverlapMag - - etaT*USlip_AB; + -kT*tangentialOverlapMag + *tangentialOverlap_AB/tangentialOverlapMag + - etaT*USlip_AB; } pA.f() += fT_AB; pB.f() += -fT_AB; - pA.torque() += (pA.d()/2*-rHat_AB) ^ fT_AB; - pB.torque() += (pB.d()/2*rHat_AB) ^ -fT_AB; + pA.torque() += (dAEff/2*-rHat_AB) ^ fT_AB; + pB.torque() += (dBEff/2*rHat_AB) ^ -fT_AB; } } } diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.H index 819e9a835bf72a7f1d4a530d697ad04a5d03b1c8..18b30753373fc338401f5a656ccb776ed40e60ea 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairModel/PairSpringSliderDashpot/PairSpringSliderDashpot.H @@ -74,6 +74,24 @@ class PairSpringSliderDashpot // harmonic approximation of the collision period scalar collisionResolutionSteps_; + //- Volume factor for determining the equivalent size of a + // parcel where nParticles is not 1. The equivalent size of + // the parcel is + // parcelEquivVolume = volumeFactor*nParticles*p.volume() + // so + // parcelEquivD = cbrt(volumeFactor*nParticles)*p.d() + // + When volumeFactor = 1, the particles are compressed + // together so that the equivalent volume of the parcel is + // the sum of the constituent particles + // + When volumeFactor = 3*sqrt(2)/pi, the particles are + // close packed, but uncompressed. + // + When volumeFactor > 3*sqrt(2)/pi, the particles loosely + // grouped. + // 3*sqrt(2)/pi = 1.350474 is the volume factor for close + // packing, i.e pi/(3*sqrt(2)) is the maximum close packing + // factor + scalar volumeFactor_; + // Private Member Functions @@ -104,6 +122,12 @@ public: // Member Functions + //- Return the volumeFactor + inline scalar volumeFactor() const + { + return volumeFactor_; + } + //- Whether the PairModel has a timestep limit that will // require subCycling virtual bool controlsTimestep() const; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallModel/WallModel.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallModel/WallModel.H index 7088c4df05116381982734d5155c62b37bb78700..31fde4e2991f3293e29e124f3e6f53453a7800da 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallModel/WallModel.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallModel/WallModel.H @@ -54,7 +54,7 @@ class WallModel { // Private data - //- The cloud dictionary + //- The CollisionModel dictionary const dictionary& dict_; //- Reference to the owner cloud class @@ -120,6 +120,9 @@ public: // Member Functions + //- Return the effective radius for a particle for the model + virtual scalar pREff(const typename CloudType::parcelType& p) const = 0; + //- Whether the WallModel has a timestep limit that will // require subCycling virtual bool controlsTimestep() const = 0; @@ -133,8 +136,10 @@ public: virtual void evaluateWall ( typename CloudType::parcelType& p, - const List<point>& flatSites, - const List<point>& sharpSites + const List<point>& flatSitePoints, + const List<WallSiteData<vector> >& flatSiteData, + const List<point>& sharpSitePoints, + const List<WallSiteData<vector> >& sharpSiteData ) const = 0; }; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.C index ba22ef38429ea87d3e9447423b3d2fb7a7d6dcb6..60c4218a7509d3786aec5f89440fe854d3ff16ea 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.C @@ -44,13 +44,16 @@ void Foam::WallSpringSliderDashpot<CloudType>::findMinMaxProperties const typename CloudType::parcelType& p = iter(); // Finding minimum diameter to avoid excessive arithmetic - rMin = min(p.d(), rMin); + + scalar dEff = p.d()*cbrt(p.nParticle()*volumeFactor_); + + rMin = min(dEff, rMin); rhoMax = max(p.rho(), rhoMax); UMagMax = max ( - mag(p.U()) + mag(p.omega())*p.d()/2, + mag(p.U()) + mag(p.omega())*dEff/2, UMagMax ); } @@ -66,25 +69,75 @@ void Foam::WallSpringSliderDashpot<CloudType>::evaluateWall ( typename CloudType::parcelType& p, const point& site, + const WallSiteData<vector>& data, scalar pNu, scalar pE, + scalar pREff, scalar Estar, - scalar kN + scalar kN, + scalar Gstar ) const { vector r_PW = p.position() - site; - scalar normalOverlapMag = p.d()/2 - mag(r_PW); + vector U_PW = p.U() - data.wallData(); + + scalar normalOverlapMag = pREff - mag(r_PW); vector rHat_PW = r_PW/(mag(r_PW) + VSMALL); scalar etaN = alpha_*sqrt(p.mass()*kN)*pow025(normalOverlapMag); vector fN_PW = - rHat_PW - *(kN*pow(normalOverlapMag, b_) - etaN*(p.U() & rHat_PW)); + rHat_PW + *(kN*pow(normalOverlapMag, b_) - etaN*(U_PW & rHat_PW)); p.f() += fN_PW; + + vector USlip_PW = + U_PW - (U_PW & rHat_PW)*rHat_PW + + (p.omega() ^ (pREff*-rHat_PW)); + + scalar deltaT = this->owner().mesh().time().deltaTValue(); + + // For remembering previous overlap + // vector deltaTangentialOverlap_PW = USlip_PW * deltaT; + // tangentialOverlap_PW += deltaTangentialOverlap_PW; + + vector tangentialOverlap_PW = USlip_PW * deltaT; + + scalar tangentialOverlapMag = mag(tangentialOverlap_PW); + + if (tangentialOverlapMag > VSMALL) + { + scalar kT = 8.0*sqrt(pREff*normalOverlapMag)*Gstar; + + scalar etaT = etaN; + + // Tangential force + vector fT_PW; + + if (kT*tangentialOverlapMag > mu_*mag(fN_PW)) + { + // Tangential force greater than sliding friction, + // particle slips + + fT_PW = -mu_*mag(fN_PW)*USlip_PW/mag(USlip_PW); + + // tangentialOverlap_PW = vector::zero; + } + else + { + fT_PW = + -kT*tangentialOverlapMag + *tangentialOverlap_PW/tangentialOverlapMag + - etaT*USlip_PW; + } + + p.f() += fT_PW; + + p.torque() += (pREff*-rHat_PW) ^ fT_PW; + } } @@ -109,7 +162,8 @@ Foam::WallSpringSliderDashpot<CloudType>::WallSpringSliderDashpot ( this->coeffDict().lookup("collisionResolutionSteps") ) - ) + ), + volumeFactor_(this->dict().lookupOrDefault("volumeFactor", 1.0)) {} @@ -122,6 +176,15 @@ Foam::WallSpringSliderDashpot<CloudType>::~WallSpringSliderDashpot() // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // +template<class CloudType> +Foam::scalar Foam::WallSpringSliderDashpot<CloudType>::pREff +( + const typename CloudType::parcelType& p +) const +{ + return p.d()/2*cbrt(p.nParticle()*volumeFactor_); +} + template<class CloudType> bool Foam::WallSpringSliderDashpot<CloudType>::controlsTimestep() const { @@ -164,28 +227,56 @@ template<class CloudType> void Foam::WallSpringSliderDashpot<CloudType>::evaluateWall ( typename CloudType::parcelType& p, - const List<point>& flatSites, - const List<point>& sharpSites + const List<point>& flatSitePoints, + const List<WallSiteData<vector> >& flatSiteData, + const List<point>& sharpSitePoints, + const List<WallSiteData<vector> >& sharpSiteData ) const { scalar pNu = this->owner().constProps().poissonsRatio(); scalar pE = this->owner().constProps().youngsModulus(); + scalar pREff = this->pREff(p); + scalar Estar = 1/((1 - sqr(pNu))/pE + (1 - sqr(nu_))/E_); - scalar kN = (4.0/3.0)*sqrt(p.d()/2)*Estar; + scalar kN = (4.0/3.0)*sqrt(pREff)*Estar; - forAll(flatSites, siteI) + scalar GStar = 1/(2*((2 + pNu - sqr(pNu))/pE + (2 + nu_ - sqr(nu_))/E_)); + + forAll(flatSitePoints, siteI) { - evaluateWall(p, flatSites[siteI], pNu, pE, Estar, kN); + evaluateWall + ( + p, + flatSitePoints[siteI], + flatSiteData[siteI], + pNu, + pE, + pREff, + Estar, + kN, + GStar + ); } - forAll(sharpSites, siteI) + forAll(sharpSitePoints, siteI) { // Treating sharp sites like flat sites - evaluateWall(p, sharpSites[siteI], pNu, pE, Estar, kN); + evaluateWall + ( + p, + sharpSitePoints[siteI], + sharpSiteData[siteI], + pNu, + pE, + pREff, + Estar, + kN, + GStar + ); } } diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.H index fcc83e22e6cb6278b13ba01960cfce9883a6fae9..2aefa7d7e7d70accf278ba26b29262146dd8078c 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallModel/WallSpringSliderDashpot/WallSpringSliderDashpot.H @@ -69,6 +69,24 @@ class WallSpringSliderDashpot // harmonic approximation of the collision period scalar collisionResolutionSteps_; + //- Volume factor for determining the equivalent size of a + // parcel where nParticles is not 1. The equivalent size of + // the parcel is + // parcelEquivVolume = volumeFactor*nParticles*p.volume() + // so + // parcelEquivD = cbrt(volumeFactor*nParticles)*p.d() + // + When volumeFactor = 1, the particles are compressed + // together so that the equivalent volume of the parcel is + // the sum of the constituent particles + // + When volumeFactor = 3*sqrt(2)/pi, the particles are + // close packed, but uncompressed. + // + When volumeFactor > 3*sqrt(2)/pi, the particles loosely + // grouped. + // 3*sqrt(2)/pi = 1.350474 is the volume factor for close + // packing, i.e pi/(3*sqrt(2)) is the maximum close packing + // factor + scalar volumeFactor_; + // Private Member Functions @@ -86,10 +104,13 @@ class WallSpringSliderDashpot ( typename CloudType::parcelType& p, const point& site, + const WallSiteData<vector>& data, scalar pNu, scalar pE, + scalar pREff, scalar Estar, - scalar kN + scalar kN, + scalar Gstar ) const; @@ -111,6 +132,15 @@ public: // Member Functions + //- Return the volumeFactor + inline scalar volumeFactor() const + { + return volumeFactor_; + } + + //- Return the effective radius for a particle for the model + virtual scalar pREff(const typename CloudType::parcelType& p) const; + //- Whether the WallModel has a timestep limit that will // require subCycling virtual bool controlsTimestep() const; @@ -124,8 +154,10 @@ public: virtual void evaluateWall ( typename CloudType::parcelType& p, - const List<point>& flatSites, - const List<point>& sharpSites + const List<point>& flatSitePoints, + const List<WallSiteData<vector> >& flatSiteData, + const List<point>& sharpSitePoints, + const List<WallSiteData<vector> >& sharpSiteData ) const; }; diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.C new file mode 100644 index 0000000000000000000000000000000000000000..a9aa774c647cca91bf61538b33ac8c3c3f6e701a --- /dev/null +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.C @@ -0,0 +1,121 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software: you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>. + +\*---------------------------------------------------------------------------*/ + +#include "WallSiteData.H" + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +template<class Type> +Foam::WallSiteData<Type>::WallSiteData() +: + patchI_(), + wallData_() +{} + + +template<class Type> +Foam::WallSiteData<Type>::WallSiteData +( + label patchI, + const Type& wallData +) +: + patchI_(patchI), + wallData_(wallData) +{} + + +// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * // + +template<class Type> +Foam::WallSiteData<Type>::~WallSiteData() +{} + + +// * * * * * * * * * * * * * * Member Operators * * * * * * * * * * * * * * // + +template<class Type> +bool Foam::WallSiteData<Type>::operator== +( + const WallSiteData<Type>& rhs +) const +{ + return patchI_ == rhs.patchI_ && wallData_ == rhs.wallData_; +} + + +template<class Type> +bool Foam::WallSiteData<Type>::operator!= +( + const WallSiteData<Type>& rhs +) const +{ + return !(*this == rhs); +} + + +// * * * * * * * * * * * * * * * IOstream Operators * * * * * * * * * * * * // + +template<class Type> +Foam::Istream& Foam::operator>> +( + Istream& is, + WallSiteData<Type>& wIS +) +{ + is >> wIS.patchI_ >> wIS.wallData_; + + // Check state of Istream + is.check + ( + "Foam::Istream& Foam::operator>>" + "(Foam::Istream&, Foam::WallSiteData<Type>&)" + ); + + return is; +} + + +template<class Type> +Foam::Ostream& Foam::operator<< +( + Ostream& os, + const WallSiteData<Type>& wIS +) +{ + os << wIS.patchI_ << token::SPACE << wIS.wallData_; + + // Check state of Ostream + os.check + ( + "Foam::Ostream& Foam::operator<<" + "(Ostream&, const WallSiteData<Type>&)" + ); + + return os; +} + + +// ************************************************************************* // diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.H new file mode 100644 index 0000000000000000000000000000000000000000..a179d4925c97c8399851a56039d5538cd3103528 --- /dev/null +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteData.H @@ -0,0 +1,144 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software: you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>. + +Class + Foam::WallSiteData + +Description + Stores the patch ID and templated data to represent a collision + with a wall to be passed to the wall model. + +SourceFiles + WallSiteDataI.H + WallSiteData.C + WallSiteDataIO.C + +\*---------------------------------------------------------------------------*/ + +#ifndef WallSiteData_H +#define WallSiteData_H + +#include "label.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ + +// Forward declaration of friend functions and operators + +template<class Type> +class WallSiteData; + +template<class Type> +Istream& operator>>(Istream&, WallSiteData<Type>&); + +template<class Type> +Ostream& operator<<(Ostream&, const WallSiteData<Type>&); + + +/*---------------------------------------------------------------------------*\ + Class WallSiteData Declaration +\*---------------------------------------------------------------------------*/ + +template<class Type> +class WallSiteData +{ + // Private data + + //- Index of originating patch + label patchI_; + + //- Wall data + Type wallData_; + + +public: + + // Constructors + + //- Construct null + WallSiteData(); + + //- Construct from components + WallSiteData + ( + label patchI, + const Type& wallData + ); + + + //- Destructor + ~WallSiteData(); + + + // Member Functions + + //- Return access to the patch index + inline label patchIndex() const; + + //- Return non-const access to the patch index + inline label& patchIndex(); + + //- Return access to wall data + inline const Type& wallData() const; + + //- Return non-const access to wall data + inline Type& wallData(); + + + // Member Operators + + bool operator==(const WallSiteData<Type>&) const; + bool operator!=(const WallSiteData<Type>&) const; + + + // IOstream Operators + + friend Istream& operator>> <Type> + (Istream&, WallSiteData<Type>&); + + friend Ostream& operator<< <Type> + (Ostream&, const WallSiteData<Type>&); +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#include "WallSiteDataI.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#ifdef NoRepository +# include "WallSiteData.C" +#endif + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteDataI.H b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteDataI.H new file mode 100644 index 0000000000000000000000000000000000000000..b28bf3be23edd1ccd892b08f1d25eb93353d48c4 --- /dev/null +++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/WallSiteData/WallSiteDataI.H @@ -0,0 +1,60 @@ +#/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software: you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>. + +\*---------------------------------------------------------------------------*/ + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +template<class Type> +Foam::label Foam::WallSiteData<Type>::patchIndex() const +{ + return patchI_; +} + + +template<class Type> +Foam::label& Foam::WallSiteData<Type>::patchIndex() +{ + return patchI_; +} + + +template<class Type> +const Type& Foam::WallSiteData<Type>::wallData() const +{ + return wallData_; +} + + +template<class Type> +Type& Foam::WallSiteData<Type>::wallData() +{ + return wallData_; +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +// ************************************************************************* // diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C index 84d959976d769204edb8f466f3d14b5dda1382ab..9b44324461ba87abce6e45c553f9f52fab06b71d 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C @@ -129,10 +129,11 @@ void Foam::InjectionModel<CloudType>::prepareForNextTimeStep template<class CloudType> -void Foam::InjectionModel<CloudType>::findCellAtPosition +bool Foam::InjectionModel<CloudType>::findCellAtPosition ( label& cellI, - vector& position + vector& position, + bool errorOnNotFound ) { const volVectorField& cellCentres = owner_.mesh().C(); @@ -176,17 +177,26 @@ void Foam::InjectionModel<CloudType>::findCellAtPosition if (procI == -1) { - FatalErrorIn - ( - "Foam::InjectionModel<CloudType>::findCellAtPosition" - "(" - "label&, " - "vector&" - ")" - )<< "Cannot find parcel injection cell. " - << "Parcel position = " << p0 << nl - << abort(FatalError); + if (errorOnNotFound) + { + FatalErrorIn + ( + "Foam::InjectionModel<CloudType>::findCellAtPosition" + "(" + "label&, " + "vector&" + ")" + ) << "Cannot find parcel injection cell. " + << "Parcel position = " << p0 << nl + << abort(FatalError); + } + else + { + return false; + } } + + return true; } @@ -212,7 +222,12 @@ Foam::scalar Foam::InjectionModel<CloudType>::setNumberOfParticles } case pbNumber: { - nP = massTotal_/(rho*volumeTotal_*parcels); + nP = massTotal_/(rho*volumeTotal_); + break; + } + case pbFixed: + { + nP = nParticleFixed_; break; } default: @@ -285,6 +300,7 @@ Foam::InjectionModel<CloudType>::InjectionModel(CloudType& owner) nInjections_(0), parcelsAddedTotal_(0), parcelBasis_(pbNumber), + nParticleFixed_(0.0), time0_(0.0), timeStep0_(0.0) { @@ -310,6 +326,7 @@ Foam::InjectionModel<CloudType>::InjectionModel nInjections_(0), parcelsAddedTotal_(0), parcelBasis_(pbNumber), + nParticleFixed_(0.0), time0_(owner.db().time().value()), timeStep0_(0.0) { @@ -320,6 +337,7 @@ Foam::InjectionModel<CloudType>::InjectionModel << endl; const word parcelBasisType = coeffDict_.lookup("parcelBasisType"); + if (parcelBasisType == "mass") { parcelBasis_ = pbMass; @@ -328,6 +346,16 @@ Foam::InjectionModel<CloudType>::InjectionModel { parcelBasis_ = pbNumber; } + else if (parcelBasisType == "fixed") + { + parcelBasis_ = pbFixed; + + Info<< " Choosing nParticle to be a fixed value, massTotal " + << "variable now does not determine anything." + << endl; + + nParticleFixed_ = readScalar(coeffDict_.lookup("nParticle")); + } else { FatalErrorIn @@ -338,7 +366,7 @@ Foam::InjectionModel<CloudType>::InjectionModel "CloudType&, " "const word&" ")" - )<< "parcelBasisType must be either 'number' or 'mass'" << nl + )<< "parcelBasisType must be either 'number', 'mass' or 'fixed'" << nl << exit(FatalError); } diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H index d7309f5a0a8081f67e85a20041e10688a6bed50c..ad3d4b1daeddba1bd4be74d814b4f79022c9eeec 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H @@ -73,7 +73,8 @@ public: enum parcelBasis { pbNumber, - pbMass + pbMass, + pbFixed }; @@ -137,6 +138,10 @@ protected: //- Parcel basis enumeration parcelBasis parcelBasis_; + //- nParticle to assign to parcels when the 'fixed' basis + // is selected + scalar nParticleFixed_; + //- Continuous phase time at start of injection time step [s] scalar time0_; @@ -175,7 +180,12 @@ protected: //- Find the cell that contains the supplied position // Will modify position slightly towards the owner cell centroid to // ensure that it lies in a cell and not edge/face - virtual void findCellAtPosition(label& cellI, vector& position); + virtual bool findCellAtPosition + ( + label& cellI, + vector& position, + bool errorOnNotFound = true + ); //- Set number of particles to inject given parcel properties virtual scalar setNumberOfParticles diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C index 9b9ec19084e474baca12f0d89176795014e18ab3..f64cdc22681c5282cb6547327e116b9781fc8dbf 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C +++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C @@ -25,6 +25,8 @@ License #include "ManualInjection.H" #include "mathematicalConstants.H" +#include "PackedBoolList.H" +#include "Switch.H" using namespace Foam::constant::mathematical; @@ -100,6 +102,40 @@ Foam::ManualInjection<CloudType>::ManualInjection ) ) { + Switch checkAndIgnoreOutOfBounds + ( + this->coeffDict().lookupOrDefault("checkAndIgnoreOutOfBounds", false) + ); + + label nRejected = 0; + + if (checkAndIgnoreOutOfBounds) + { + // Dummy cell + label cellI = -1; + + PackedBoolList keep(positions_.size(), true); + + forAll(positions_, pI) + { + if (!this->findCellAtPosition(cellI, positions_[pI], false)) + { + keep[pI] = false; + + nRejected++; + } + } + + if (nRejected > 0) + { + inplaceSubset(keep, positions_); + inplaceSubset(keep, diameters_); + + Info<< " " << nRejected + << " particles ignored, out of bounds." << endl; + } + } + // Construct parcel diameters forAll(diameters_, i) { diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H index 7d8305088f3f92f01eafbe171a6e565605e845ff..0202c9eb60be1a3c10324b67fd057208cdc1aa42 100644 --- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H +++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H @@ -76,9 +76,6 @@ class ManualInjection //- Parcel size PDF model const autoPtr<pdfs::pdf> parcelPDF_; - //- Number of particles represented by each parcel - scalar nParticlesPerParcel_; - protected: diff --git a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriver.C b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriver.C index 50942e39c72629a59aa17dd957a4f6c4fa0f487b..20a7e76b66bde027f981a0d594ade30861758963 100644 --- a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriver.C +++ b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriver.C @@ -487,8 +487,7 @@ Foam::labelList Foam::autoLayerDriver::collectFaces ( mesh, selected, - orEqOp<bool>(), // combine operator - false // separation + orEqOp<bool>() // combine operator ); labelList selectedFaces(findIndices(selected, true)); @@ -534,8 +533,7 @@ Foam::labelList Foam::autoLayerDriver::growFaceCellFace ( mesh, selected, - orEqOp<bool>(), // combine operator - false // separation + orEqOp<bool>() // combine operator ); return findIndices(selected, true); } @@ -1015,8 +1013,7 @@ void Foam::autoLayerDriver::handleFeatureAngle mesh, edgeNormal, nomalsCombine(), - point::max, // null value - false // no separation + point::max // null value ); label vertI = 0; @@ -1307,8 +1304,7 @@ void Foam::autoLayerDriver::setNumLayers pp.meshPoints(), maxLayers, maxEqOp<label>(), - labelMin, // null value - false // no separation + labelMin // null value ); syncTools::syncPointList ( @@ -1316,8 +1312,7 @@ void Foam::autoLayerDriver::setNumLayers pp.meshPoints(), minLayers, minEqOp<label>(), - labelMax, // null value - false // no separation + labelMax // null value ); // Unmark any point with different min and max @@ -1434,8 +1429,7 @@ void Foam::autoLayerDriver::growNoExtrusion pp.meshPoints(), status, minEqOp<label>(), - labelMax, // null value - false // no separation + labelMax // null value ); forAll(status, i) { @@ -1528,8 +1522,7 @@ void Foam::autoLayerDriver::calculateLayerThickness pp.meshPoints(), expansionRatio, minEqOp<scalar>(), - GREAT, // null value - false // no separation + GREAT // null value ); syncTools::syncPointList ( @@ -1537,8 +1530,7 @@ void Foam::autoLayerDriver::calculateLayerThickness pp.meshPoints(), thickness, minEqOp<scalar>(), - GREAT, // null value - false // no separation + GREAT // null value ); syncTools::syncPointList ( @@ -1546,8 +1538,7 @@ void Foam::autoLayerDriver::calculateLayerThickness pp.meshPoints(), minThickness, minEqOp<scalar>(), - GREAT, // null value - false // no separation + GREAT // null value ); @@ -1594,8 +1585,7 @@ void Foam::autoLayerDriver::calculateLayerThickness pp.meshPoints(), maxPointLevel, maxEqOp<label>(), - labelMin, // null value - false // no separation + labelMin // null value ); @@ -1664,8 +1654,7 @@ void Foam::autoLayerDriver::syncPatchDisplacement meshPoints, patchDisp, minEqOp<vector>(), - point::max, // null value - false // no separation + point::max // null value ); // Unmark if displacement too small @@ -1697,8 +1686,7 @@ void Foam::autoLayerDriver::syncPatchDisplacement meshPoints, syncPatchNLayers, minEqOp<label>(), - labelMax, // null value - false // no separation + labelMax // null value ); // Reset if differs @@ -1728,8 +1716,7 @@ void Foam::autoLayerDriver::syncPatchDisplacement meshPoints, syncPatchNLayers, maxEqOp<label>(), - labelMin, // null value - false // no separation + labelMin // null value ); // Reset if differs @@ -1815,8 +1802,7 @@ void Foam::autoLayerDriver::getPatchDisplacement meshPoints, pointNormals, plusEqOp<vector>(), - vector::zero, // null value - false // no separation + vector::zero // null value ); syncTools::syncPointList @@ -1825,8 +1811,7 @@ void Foam::autoLayerDriver::getPatchDisplacement meshPoints, nPointFaces, plusEqOp<label>(), - 0, // null value - false // no separation + 0 // null value ); forAll(pointNormals, i) @@ -2258,8 +2243,7 @@ void Foam::autoLayerDriver::setupLayerInfoTruncation pp.meshPoints(), foundNeighbour, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); forAll(pp.meshPoints(), patchPointI) @@ -2318,8 +2302,7 @@ void Foam::autoLayerDriver::setupLayerInfoTruncation pp.meshPoints(), nPatchPointLayers, maxEqOp<label>(), - 0, // null value - false // no separation + 0 // null value ); } } diff --git a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverShrink.C b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverShrink.C index 56597063fcdae8cbca33878009b2471a795fd87f..ae0a2d724d022532afa4129190ed2b4ec872398f 100644 --- a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverShrink.C +++ b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverShrink.C @@ -67,8 +67,7 @@ void Foam::autoLayerDriver::sumWeights meshPoints, invSumWeight, plusEqOp<scalar>(), - scalar(0.0), // null value - false // no separation + scalar(0.0) // null value ); forAll(invSumWeight, pointI) @@ -521,8 +520,7 @@ void Foam::autoLayerDriver::findIsolatedRegions pp.meshPoints(), keptPoints, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); label nChanged = 0; @@ -589,8 +587,7 @@ void Foam::autoLayerDriver::findIsolatedRegions pp.meshPoints(), isolatedPoint, plusEqOp<label>(), - 0, // null value - false // no separation + 0 // null value ); // stop layer growth on isolated faces @@ -724,8 +721,7 @@ void Foam::autoLayerDriver::medialAxisSmoothingInfo meshPoints, pointNormals, plusEqOp<vector>(), - vector::zero, // null value - false // no separation + vector::zero // null value ); syncTools::syncPointList @@ -734,8 +730,7 @@ void Foam::autoLayerDriver::medialAxisSmoothingInfo meshPoints, nPointFaces, plusEqOp<label>(), - 0, // null value - false // no separation + 0 // null value ); forAll(pointNormals, i) diff --git a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverTemplates.C b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverTemplates.C index d8784f5d03506db4025e396441197ba969a8fa7e..73f797dd8a29af3b950bbdfb4093909904d1163f 100644 --- a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverTemplates.C +++ b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoLayerDriverTemplates.C @@ -64,8 +64,7 @@ void Foam::autoLayerDriver::averageNeighbours meshPoints, average, plusEqOp<Type>(), - pTraits<Type>::zero, // null value - false // no separation + pTraits<Type>::zero // null value ); average *= invSumWeight; diff --git a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoSnapDriver.C b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoSnapDriver.C index a73e7bdcf606b1bd05b253cc612da9a159ab4396..0801f4de3e30ad56c349a5be21aa1f57cfb70588 100644 --- a/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoSnapDriver.C +++ b/src/mesh/autoMesh/autoHexMesh/autoHexMeshDriver/autoSnapDriver.C @@ -274,8 +274,7 @@ Foam::pointField Foam::autoSnapDriver::smoothPatchDisplacement pp.meshPoints(), avgBoundary, plusEqOp<point>(), // combine op - vector::zero, // null value - false // no separation + vector::zero // null value ); syncTools::syncPointList ( @@ -283,8 +282,7 @@ Foam::pointField Foam::autoSnapDriver::smoothPatchDisplacement pp.meshPoints(), nBoundary, plusEqOp<label>(), // combine op - 0, // null value - false // no separation + 0 // null value ); forAll(avgBoundary, i) @@ -322,36 +320,18 @@ Foam::pointField Foam::autoSnapDriver::smoothPatchDisplacement forAll(patches, patchI) { - if (Pstream::parRun() && isA<processorPolyPatch>(patches[patchI])) - { - const processorPolyPatch& pp = - refCast<const processorPolyPatch>(patches[patchI]); - - if (pp.myProcNo() < pp.neighbProcNo()) - { - const vectorField::subField faceCentres = pp.faceCentres(); - - forAll(pp, i) - { - const face& f = pp[i]; - const point& fc = faceCentres[i]; - - forAll(f, fp) - { - globalSum[f[fp]] += fc; - globalNum[f[fp]]++; - } - } - } - } - else if (isA<cyclicPolyPatch>(patches[patchI])) + if + ( + patches[patchI].coupled() + && refCast<const coupledPolyPatch>(patches[patchI]).owner() + ) { - const cyclicPolyPatch& pp = - refCast<const cyclicPolyPatch>(patches[patchI]); + const coupledPolyPatch& pp = + refCast<const coupledPolyPatch>(patches[patchI]); const vectorField::subField faceCentres = pp.faceCentres(); - for (label i = 0; i < pp.size()/2; i++) + forAll(pp, i) { const face& f = pp[i]; const point& fc = faceCentres[i]; @@ -370,16 +350,14 @@ Foam::pointField Foam::autoSnapDriver::smoothPatchDisplacement mesh, globalSum, plusEqOp<vector>(), // combine op - vector::zero, // null value - false // no separation + vector::zero // null value ); syncTools::syncPointList ( mesh, globalNum, plusEqOp<label>(), // combine op - 0, // null value - false // no separation + 0 // null value ); avgInternal.setSize(meshPoints.size()); @@ -815,8 +793,7 @@ Foam::scalarField Foam::autoSnapDriver::calcSnapDistance pp.meshPoints(), maxEdgeLen, maxEqOp<scalar>(), // combine op - -GREAT, // null value - false // no separation + -GREAT // null value ); return snapParams.snapTol()*maxEdgeLen; @@ -1123,8 +1100,7 @@ Foam::vectorField Foam::autoSnapDriver::calcNearestSurface pp.meshPoints(), patchDisp, minMagEqOp(), // combine op - vector(GREAT, GREAT, GREAT), // null value - false // no separation + vector(GREAT, GREAT, GREAT) // null value ); @@ -1178,7 +1154,7 @@ void Foam::autoSnapDriver::smoothDisplacement } pointVectorField oldDisp(disp); - meshMover.smooth(oldDisp, edgeGamma, false, disp); + meshMover.smooth(oldDisp, edgeGamma, disp); } Info<< "Displacement smoothed in = " << mesh.time().cpuTimeIncrement() << " s\n" << nl << endl; diff --git a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinement.C b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinement.C index 12298ce6e1669f793ff6050f1c4b6e88af98d469..0622273a4ef922a6342de997919c1a1eefb82a7a 100644 --- a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinement.C +++ b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinement.C @@ -146,8 +146,8 @@ void Foam::meshRefinement::calcNeighbourData } // Swap coupled boundaries. Apply separation to cc since is coordinate. - syncTools::swapBoundaryFaceList(mesh_, neiCc, true); - syncTools::swapBoundaryFaceList(mesh_, neiLevel, false); + syncTools::swapBoundaryFacePositions(mesh_, neiCc); + syncTools::swapBoundaryFaceList(mesh_, neiLevel); } @@ -235,7 +235,7 @@ void Foam::meshRefinement::updateIntersections(const labelList& changedFaces) // Make sure both sides have same information. This should be // case in general since same vectors but just to make sure. - syncTools::syncFaceList(mesh_, surfaceIndex_, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, surfaceIndex_, maxEqOp<label>()); label nHits = countHits(); label nTotHits = returnReduce(nHits, sumOp<label>()); @@ -275,11 +275,11 @@ void Foam::meshRefinement::checkData() // Get neighbouring face centres pointField neiBoundaryFc(boundaryFc); - syncTools::swapBoundaryFaceList + syncTools::syncBoundaryFacePositions ( mesh_, neiBoundaryFc, - true + eqOp<point>() ); // Compare @@ -339,7 +339,7 @@ void Foam::meshRefinement::checkData() mesh_.nInternalFaces() ) ); - syncTools::swapBoundaryFaceList(mesh_, neiHit, false); + syncTools::swapBoundaryFaceList(mesh_, neiHit); // Check forAll(surfaceHit, faceI) @@ -390,8 +390,7 @@ void Foam::meshRefinement::checkData() syncTools::swapBoundaryFaceList ( mesh_, - neiBoundarySurface, - false + neiBoundarySurface ); // Compare @@ -1158,8 +1157,7 @@ Foam::autoPtr<Foam::mapDistributePolyMesh> Foam::meshRefinement::balance ( mesh_, blockedFace, - andEqOp<bool>(), // combine operator - false // separation + andEqOp<bool>() // combine operator ); } reduce(nUnblocked, sumOp<label>()); @@ -1527,7 +1525,7 @@ void Foam::meshRefinement::checkCoupledFaceZones(const polyMesh& mesh) } labelList neiFaceToZone(faceToZone); - syncTools::swapBoundaryFaceList(mesh, neiFaceToZone, false); + syncTools::swapBoundaryFaceList(mesh, neiFaceToZone); forAll(faceToZone, i) { diff --git a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementBaffles.C b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementBaffles.C index 2491f557fb54cbc6e0dc876fae235d183ffff451..0eabd33adc2eaa89dc0f3628f2a3bc0c073284f2 100644 --- a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementBaffles.C +++ b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementBaffles.C @@ -354,8 +354,8 @@ void Foam::meshRefinement::getBafflePatches // might not be owner on the other processor but the neighbour is // not used when creating baffles from proc faces. // - tolerances issues occasionally crop up. - syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>(), false); - syncTools::syncFaceList(mesh_, neiPatch, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>()); + syncTools::syncFaceList(mesh_, neiPatch, maxEqOp<label>()); } @@ -386,9 +386,9 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::createBaffles if (debug) { labelList syncedOwnPatch(ownPatch); - syncTools::syncFaceList(mesh_, syncedOwnPatch, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, syncedOwnPatch, maxEqOp<label>()); labelList syncedNeiPatch(neiPatch); - syncTools::syncFaceList(mesh_, syncedNeiPatch, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, syncedNeiPatch, maxEqOp<label>()); forAll(syncedOwnPatch, faceI) { @@ -669,8 +669,7 @@ Foam::List<Foam::labelPair> Foam::meshRefinement::filterDuplicateFaces mesh_, nBafflesPerEdge, plusEqOp<label>(), // in-place add - 0, // initial value - false // no separation + 0 // initial value ); @@ -1030,7 +1029,7 @@ void Foam::meshRefinement::findCellZoneGeometric } } } - syncTools::swapBoundaryFaceList(mesh_, neiCellZone, false); + syncTools::swapBoundaryFaceList(mesh_, neiCellZone); forAll(patches, patchI) { @@ -1058,13 +1057,7 @@ void Foam::meshRefinement::findCellZoneGeometric } // Sync - syncTools::syncFaceList - ( - mesh_, - namedSurfaceIndex, - maxEqOp<label>(), - false - ); + syncTools::syncFaceList(mesh_, namedSurfaceIndex, maxEqOp<label>()); } //XXXXXXXXX void Foam::meshRefinement::findCellZoneInsideWalk @@ -1371,7 +1364,7 @@ void Foam::meshRefinement::findCellZoneTopo } } } - syncTools::swapBoundaryFaceList(mesh_, neiCellRegion, false); + syncTools::swapBoundaryFaceList(mesh_, neiCellRegion); // Calculate region to zone from cellRegions on either side of coupled // face. @@ -1492,7 +1485,7 @@ void Foam::meshRefinement::makeConsistentFaceIndex } } } - syncTools::swapBoundaryFaceList(mesh_, neiCellZone, false); + syncTools::swapBoundaryFaceList(mesh_, neiCellZone); // Use coupled cellZone to do check forAll(patches, patchI) @@ -1812,7 +1805,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::splitMesh blockedFace[faceI] = true; } } - syncTools::syncFaceList(mesh_, blockedFace, orEqOp<bool>(), false); + syncTools::syncFaceList(mesh_, blockedFace, orEqOp<bool>()); // Set region per cell based on walking regionSplit cellRegion(mesh_, blockedFace); @@ -1924,8 +1917,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::splitMesh mesh_, pointBaffle, maxEqOp<label>(), - -1, // null value - false // no separation + -1 // null value ); @@ -1950,7 +1942,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::splitMesh } } } - syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>()); // 3. From faces to cells (cellRegion) and back to faces (ownPatch) @@ -1999,7 +1991,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::splitMesh ownPatch.transfer(newOwnPatch); - syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>(), false); + syncTools::syncFaceList(mesh_, ownPatch, maxEqOp<label>()); } @@ -2376,8 +2368,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::zonify ( mesh_, namedSurfaceIndex, - maxEqOp<label>(), - false + maxEqOp<label>() ); // Print a bit @@ -2541,7 +2532,7 @@ Foam::autoPtr<Foam::mapPolyMesh> Foam::meshRefinement::zonify } } } - syncTools::swapBoundaryFaceList(mesh_, neiCellZone, false); + syncTools::swapBoundaryFaceList(mesh_, neiCellZone); // Get per face whether is it master (of a coupled set of faces) PackedBoolList isMasterFace(syncTools::getMasterFaces(mesh_)); diff --git a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C index f4a887279ead27b9f88ca46db27b4e3f11f957c9..5bef117c7f44bb9f61713de43564c6ac3c21a083 100644 --- a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C +++ b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C @@ -496,8 +496,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells mesh_, isBoundaryPoint, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); syncTools::syncEdgeList @@ -505,16 +504,14 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells mesh_, isBoundaryEdge, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); syncTools::syncFaceList ( mesh_, isBoundaryFace, - orEqOp<bool>(), - false // no separation + orEqOp<bool>() ); @@ -807,8 +804,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells mesh_, isBoundaryPoint, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); syncTools::syncEdgeList @@ -816,16 +812,14 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells mesh_, isBoundaryEdge, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); syncTools::syncFaceList ( mesh_, isBoundaryFace, - orEqOp<bool>(), - false // no separation + orEqOp<bool>() ); @@ -1109,8 +1103,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells // ( // mesh_, // facePatch, -// maxEqOp<label>(), -// false // no separation +// maxEqOp<label>() // ); // // return facePatch; diff --git a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementRefine.C b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementRefine.C index 23a0bfe6901ab801271d33890eb4e17f4c96c0d5..7a1968500f21020a4402b6a64b61230493d1a0fb 100644 --- a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementRefine.C +++ b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementRefine.C @@ -133,8 +133,7 @@ Foam::labelList Foam::meshRefinement::getChangedFaces ( mesh, refinedBoundaryFace, - orEqOp<bool>(), - false + orEqOp<bool>() ); @@ -176,8 +175,7 @@ Foam::labelList Foam::meshRefinement::getChangedFaces ( mesh, changedFace, - orEqOp<bool>(), - false + orEqOp<bool>() ); @@ -925,8 +923,8 @@ Foam::label Foam::meshRefinement::markSurfaceCurvatureRefinement neiBndMaxLevel[bFaceI] = cellMaxLevel[own]; neiBndMaxNormal[bFaceI] = cellMaxNormal[own]; } - syncTools::swapBoundaryFaceList(mesh_, neiBndMaxLevel, false); - syncTools::swapBoundaryFaceList(mesh_, neiBndMaxNormal, false); + syncTools::swapBoundaryFaceList(mesh_, neiBndMaxLevel); + syncTools::swapBoundaryFaceList(mesh_, neiBndMaxNormal); // Loop over all faces. Could only be checkFaces.. except if they're coupled diff --git a/src/mesh/blockMesh/blockMesh/blockMesh.C b/src/mesh/blockMesh/blockMesh/blockMesh.C index fc79070eee323c8b29c17ac69b2d9a36e820058a..8641c44a717fc9c9ab3e46a7a262e7decbd286e2 100644 --- a/src/mesh/blockMesh/blockMesh/blockMesh.C +++ b/src/mesh/blockMesh/blockMesh/blockMesh.C @@ -77,6 +77,24 @@ const Foam::polyMesh& Foam::blockMesh::topology() const } +Foam::PtrList<Foam::dictionary> Foam::blockMesh::patchDicts() const +{ + const polyPatchList& patchTopologies = topology().boundaryMesh(); + + PtrList<dictionary> patchDicts(patchTopologies.size()); + + forAll(patchTopologies, patchI) + { + OStringStream os; + patchTopologies[patchI].write(os); + IStringStream is(os.str()); + patchDicts.set(patchI, new dictionary(is)); + patchDicts[patchI].set("name", patchTopologies[patchI].name()); + } + return patchDicts; +} + + Foam::scalar Foam::blockMesh::scaleFactor() const { return scaleFactor_; @@ -116,22 +134,22 @@ const Foam::faceListList& Foam::blockMesh::patches() const } -Foam::wordList Foam::blockMesh::patchNames() const -{ - return topology().boundaryMesh().names(); -} - - -Foam::wordList Foam::blockMesh::patchTypes() const -{ - return topology().boundaryMesh().types(); -} - - -Foam::wordList Foam::blockMesh::patchPhysicalTypes() const -{ - return topology().boundaryMesh().physicalTypes(); -} +//Foam::wordList Foam::blockMesh::patchNames() const +//{ +// return topology().boundaryMesh().names(); +//} +// +// +//Foam::wordList Foam::blockMesh::patchTypes() const +//{ +// return topology().boundaryMesh().types(); +//} +// +// +//Foam::wordList Foam::blockMesh::patchPhysicalTypes() const +//{ +// return topology().boundaryMesh().physicalTypes(); +//} Foam::label Foam::blockMesh::numZonedBlocks() const diff --git a/src/mesh/blockMesh/blockMesh/blockMesh.H b/src/mesh/blockMesh/blockMesh/blockMesh.H index 4d1b1deb0aa285ef7234aaa77013cc55222290c1..fa91e40b689352a31ef165fbaef1740b3b4fa516 100644 --- a/src/mesh/blockMesh/blockMesh/blockMesh.H +++ b/src/mesh/blockMesh/blockMesh/blockMesh.H @@ -109,6 +109,24 @@ class blockMesh const faceList& patchShapes ) const; + bool readPatches + ( + const dictionary& meshDescription, + faceListList& tmpBlocksPatches, + wordList& patchNames, + wordList& patchTypes, + wordList& nbrPatchNames + ); + + bool readBoundary + ( + const dictionary& meshDescription, + faceListList& tmpBlocksPatches, + PtrList<dictionary>& patchDicts + ); + + void createCellShapes(cellShapeList& tmpBlockCells); + polyMesh* createTopology(IOdictionary&); void checkBlockMesh(const polyMesh&) const; @@ -163,11 +181,15 @@ public: const faceListList& patches() const; - wordList patchNames() const; - wordList patchTypes() const; + //- Get patch information from the topology mesh + PtrList<dictionary> patchDicts() const; - wordList patchPhysicalTypes() const; +// wordList patchNames() const; +// +// wordList patchTypes() const; +// +// wordList patchPhysicalTypes() const; //- Number of blocks with specified zones label numZonedBlocks() const; diff --git a/src/mesh/blockMesh/blockMesh/blockMeshTopology.C b/src/mesh/blockMesh/blockMesh/blockMeshTopology.C index 62d30c38965f862553b9b8bd464c0dbff079853e..9a962483681826ed40c7855855e397b8895527b3 100644 --- a/src/mesh/blockMesh/blockMesh/blockMeshTopology.C +++ b/src/mesh/blockMesh/blockMesh/blockMeshTopology.C @@ -27,11 +27,232 @@ License #include "Time.H" #include "preservePatchTypes.H" #include "emptyPolyPatch.H" +#include "cyclicPolyPatch.H" + + +bool Foam::blockMesh::readPatches +( + const dictionary& meshDescription, + faceListList& tmpBlocksPatches, + wordList& patchNames, + wordList& patchTypes, + wordList& nbrPatchNames +) +{ + bool topologyOK = true; + + ITstream& patchStream(meshDescription.lookup("patches")); + + // read number of patches in mesh + label nPatches = 0; + + token firstToken(patchStream); + + if (firstToken.isLabel()) + { + nPatches = firstToken.labelToken(); + + tmpBlocksPatches.setSize(nPatches); + patchNames.setSize(nPatches); + patchTypes.setSize(nPatches); + nbrPatchNames.setSize(nPatches); + } + else + { + patchStream.putBack(firstToken); + } + + // Read beginning of blocks + patchStream.readBegin("patches"); + + nPatches = 0; + + token lastToken(patchStream); + while + ( + !( + lastToken.isPunctuation() + && lastToken.pToken() == token::END_LIST + ) + ) + { + if (tmpBlocksPatches.size() <= nPatches) + { + tmpBlocksPatches.setSize(nPatches + 1); + patchNames.setSize(nPatches + 1); + patchTypes.setSize(nPatches + 1); + nbrPatchNames.setSize(nPatches + 1); + } + + patchStream.putBack(lastToken); + + patchStream + >> patchTypes[nPatches] + >> patchNames[nPatches]; + + // Read patch faces + patchStream >> tmpBlocksPatches[nPatches]; + + + // Catch multiple patches asap. + for (label i = 0; i < nPatches; i++) + { + if (patchNames[nPatches] == patchNames[i]) + { + FatalErrorIn + ( + "blockMesh::createTopology(IOdictionary&)" + ) << "Duplicate patch " << patchNames[nPatches] + << " at line " << patchStream.lineNumber() + << ". Exiting !" << nl + << exit(FatalError); + } + } + + topologyOK = topologyOK && patchLabelsOK + ( + nPatches, + blockPointField_, + tmpBlocksPatches[nPatches] + ); + + nPatches++; + + + // Split old style cyclics + + if (patchTypes[nPatches-1] == cyclicPolyPatch::typeName) + { + word halfA = patchNames[nPatches-1] + "_half0"; + word halfB = patchNames[nPatches-1] + "_half1"; + + WarningIn("blockMesh::createTopology(IOdictionary&)") + << "Old-style cyclic definition." + << " Splitting patch " + << patchNames[nPatches-1] << " into two halves " + << halfA << " and " << halfB << endl + << " Alternatively use new 'boundary' dictionary syntax." + << endl; + + // Add extra patch + if (tmpBlocksPatches.size() <= nPatches) + { + tmpBlocksPatches.setSize(nPatches + 1); + patchNames.setSize(nPatches + 1); + patchTypes.setSize(nPatches + 1); + nbrPatchNames.setSize(nPatches + 1); + } + + // Update halfA info + patchNames[nPatches-1] = halfA; + nbrPatchNames[nPatches-1] = halfB; + // Update halfB info + patchTypes[nPatches] = patchTypes[nPatches-1]; + patchNames[nPatches] = halfB; + nbrPatchNames[nPatches] = halfA; + + // Split faces + if ((tmpBlocksPatches[nPatches-1].size() % 2) != 0) + { + FatalErrorIn + ( + "blockMesh::createTopology(IOdictionary&)" + ) << "Size of cyclic faces is not a multiple of 2 :" + << tmpBlocksPatches[nPatches-1] + << exit(FatalError); + } + label sz = tmpBlocksPatches[nPatches-1].size()/2; + faceList unsplitFaces(tmpBlocksPatches[nPatches-1], true); + tmpBlocksPatches[nPatches-1] = faceList + ( + SubList<face>(unsplitFaces, sz) + ); + tmpBlocksPatches[nPatches] = faceList + ( + SubList<face>(unsplitFaces, sz, sz) + ); + + nPatches++; + } + + patchStream >> lastToken; + } + patchStream.putBack(lastToken); + + // Read end of blocks + patchStream.readEnd("patches"); + + return topologyOK; +} + + +bool Foam::blockMesh::readBoundary +( + const dictionary& meshDescription, + faceListList& tmpBlocksPatches, + PtrList<dictionary>& patchDicts +) +{ + bool topologyOK = true; + + // Read like boundary file + const PtrList<entry> patchesInfo + ( + meshDescription.lookup("boundary") + ); + + tmpBlocksPatches.setSize(patchesInfo.size()); + patchDicts.setSize(patchesInfo.size()); + + forAll(tmpBlocksPatches, patchI) + { + const entry& patchInfo = patchesInfo[patchI]; + + // Construct dictionary and add name + patchDicts.set(patchI, new dictionary(patchInfo.dict())); + patchDicts[patchI].set("name", patchInfo.keyword()); + // Read block faces + patchDicts[patchI].lookup("faces") >> tmpBlocksPatches[patchI]; + + topologyOK = topologyOK && patchLabelsOK + ( + patchI, + blockPointField_, + tmpBlocksPatches[patchI] + ); + } + + return topologyOK; +} + + +void Foam::blockMesh::createCellShapes +( + cellShapeList& tmpBlockCells +) +{ + const blockMesh& blocks = *this; + + tmpBlockCells.setSize(blocks.size()); + forAll(blocks, blockI) + { + tmpBlockCells[blockI] = cellShape(blocks[blockI].blockShape()); + + if (tmpBlockCells[blockI].mag(blockPointField_) < 0.0) + { + WarningIn + ( + "blockMesh::createTopology(IOdictionary&)" + ) << "negative volume block : " << blockI + << ", probably defined inside-out" << endl; + } + } +} // * * * * * * * * * * * * * Private Member Functions * * * * * * * * * * * // -Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& dict) +Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& meshDescription) { bool topologyOK = true; @@ -43,30 +264,30 @@ Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& dict) // get names/types for the unassigned patch faces // this is a bit heavy handed (and ugly), but there is currently // no easy way to rename polyMesh patches subsequently - if (const dictionary* dictPtr = dict.subDictPtr("defaultPatch")) + if (const dictionary* dictPtr = meshDescription.subDictPtr("defaultPatch")) { dictPtr->readIfPresent("name", defaultPatchName); dictPtr->readIfPresent("type", defaultPatchType); } // optional 'convertToMeters' or 'scale' scaling factor - if (!dict.readIfPresent("convertToMeters", scaleFactor_)) + if (!meshDescription.readIfPresent("convertToMeters", scaleFactor_)) { - dict.readIfPresent("scale", scaleFactor_); + meshDescription.readIfPresent("scale", scaleFactor_); } // // get the non-linear edges in mesh // - if (dict.found("edges")) + if (meshDescription.found("edges")) { if (verboseOutput) { Info<< "Creating curved edges" << endl; } - ITstream& is(dict.lookup("edges")); + ITstream& is(meshDescription.lookup("edges")); // read number of edges in mesh label nEdges = 0; @@ -134,7 +355,7 @@ Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& dict) } { - ITstream& is(dict.lookup("blocks")); + ITstream& is(meshDescription.lookup("blocks")); // read number of blocks in mesh label nBlocks = 0; @@ -201,6 +422,8 @@ Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& dict) } + polyMesh* blockMeshPtr = NULL; + // // Create the patches // @@ -209,160 +432,140 @@ Foam::polyMesh* Foam::blockMesh::createTopology(IOdictionary& dict) Info<< "Creating topology patches" << endl; } - faceListList tmpBlocksPatches; - wordList patchNames; - wordList patchTypes; - + if (meshDescription.found("patches")) { - ITstream& is(dict.lookup("patches")); + Info<< nl << "Reading patches section" << endl; - // read number of patches in mesh - label nPatches = 0; - - token firstToken(is); - - if (firstToken.isLabel()) - { - nPatches = firstToken.labelToken(); + faceListList tmpBlocksPatches; + wordList patchNames; + wordList patchTypes; + wordList nbrPatchNames; - tmpBlocksPatches.setSize(nPatches); - patchNames.setSize(nPatches); - patchTypes.setSize(nPatches); - } - else + topologyOK = topologyOK && readPatches + ( + meshDescription, + tmpBlocksPatches, + patchNames, + patchTypes, + nbrPatchNames + ); + + if (!topologyOK) { - is.putBack(firstToken); + FatalErrorIn("blockMesh::createTopology(IOdictionary&)") + << "Cannot create mesh due to errors in topology, exiting !" + << nl << exit(FatalError); } - // Read beginning of blocks - is.readBegin("patches"); + Info<< nl << "Creating block mesh topology" << endl; - nPatches = 0; + cellShapeList tmpBlockCells(blocks.size()); + createCellShapes(tmpBlockCells); - token lastToken(is); - while + + Info<< nl << "Reading physicalType from existing boundary file" << endl; + + wordList patchPhysicalTypes(tmpBlocksPatches.size()); + + preservePatchTypes ( - !( - lastToken.isPunctuation() - && lastToken.pToken() == token::END_LIST - ) - ) + meshDescription.time(), + meshDescription.time().constant(), + polyMesh::meshSubDir, + patchNames, + patchTypes, + defaultPatchName, + defaultPatchType, + patchPhysicalTypes + ); + + + // Convert into dictionary + PtrList<dictionary> patchDicts(patchNames.size()); + forAll(patchDicts, patchI) { - if (tmpBlocksPatches.size() <= nPatches) + patchDicts.set(patchI, new dictionary()); + patchDicts[patchI].set("name", patchNames[patchI]); + patchDicts[patchI].set("type", patchTypes[patchI]); + if (nbrPatchNames[patchI] != word::null) { - tmpBlocksPatches.setSize(nPatches + 1); - patchNames.setSize(nPatches + 1); - patchTypes.setSize(nPatches + 1); + patchDicts[patchI].set("neighbourPatch", nbrPatchNames[patchI]); } - - is.putBack(lastToken); - - is - >> patchTypes[nPatches] - >> patchNames[nPatches] - >> tmpBlocksPatches[nPatches]; - - - // Catch multiple patches asap. - for (label i = 0; i < nPatches; i++) + if (patchPhysicalTypes[patchI] != word::null) { - if (patchNames[nPatches] == patchNames[i]) - { - FatalErrorIn - ( - "blockMesh::createTopology(IOdictionary&)" - ) << "Duplicate patch " << patchNames[nPatches] - << " at line " << is.lineNumber() - << ". Exiting !" << nl - << exit(FatalError); - } + patchDicts[patchI].set + ( + "physicalType", + patchPhysicalTypes[patchI] + ); } - - topologyOK = topologyOK && patchLabelsOK - ( - nPatches, - blockPointField_, - tmpBlocksPatches[nPatches] - ); - - nPatches++; - - is >> lastToken; } - is.putBack(lastToken); - - // Read end of blocks - is.readEnd("patches"); - } - if (!topologyOK) - { - FatalErrorIn("blockMesh::createTopology(IOdictionary&)") - << "Cannot create mesh due to errors in topology, exiting !" << nl - << exit(FatalError); + blockMeshPtr = new polyMesh + ( + IOobject + ( + "blockMesh", + meshDescription.time().constant(), + meshDescription.time(), + IOobject::NO_READ, + IOobject::NO_WRITE, + false + ), + xferCopy(blockPointField_), // copy these points, do NOT move + tmpBlockCells, + tmpBlocksPatches, + patchDicts, + defaultPatchName, + defaultPatchType + ); } - - - // - // Create the topology - // - if (verboseOutput) + else if (meshDescription.found("boundary")) { - Info<< "Creating topology mesh" << endl; - } + faceListList tmpBlocksPatches; + PtrList<dictionary> patchDicts; - cellShapeList tmpBlockShapes(blocks.size()); - forAll(blocks, blockI) - { - tmpBlockShapes[blockI] = cellShape(blocks[blockI].blockShape()); + topologyOK = topologyOK && readBoundary + ( + meshDescription, + tmpBlocksPatches, + patchDicts + ); - if (tmpBlockShapes[blockI].mag(blockPointField_) < 0.0) + if (!topologyOK) { - WarningIn - ( - "blockMesh::createTopology(IOdictionary&)" - ) << "negative volume block : " << blockI - << ", probably defined inside-out" << endl; + FatalErrorIn("blockMesh::createTopology(IOdictionary&)") + << "Cannot create mesh due to errors in topology, exiting !" + << nl << exit(FatalError); } - } - wordList patchPhysicalTypes(tmpBlocksPatches.size()); - preservePatchTypes - ( - dict.time(), - dict.time().constant(), - polyMesh::meshSubDir, - patchNames, - patchTypes, - defaultPatchName, - defaultPatchType, - patchPhysicalTypes - ); + Info<< nl << "Creating block mesh topology" << endl; + cellShapeList tmpBlockCells(blocks.size()); + createCellShapes(tmpBlockCells); - // construct the topology as its own mesh - polyMesh* blockMeshPtr = new polyMesh - ( - IOobject + + blockMeshPtr = new polyMesh ( - "blockMesh", - dict.time().constant(), - dict.time(), - IOobject::NO_READ, - IOobject::NO_WRITE, - false - ), - xferCopy(blockPointField_), // copy these points, do NOT move - tmpBlockShapes, - tmpBlocksPatches, - patchNames, - patchTypes, - defaultPatchName, - defaultPatchType, - patchPhysicalTypes - ); + IOobject + ( + "blockMesh", + meshDescription.time().constant(), + meshDescription.time(), + IOobject::NO_READ, + IOobject::NO_WRITE, + false + ), + xferCopy(blockPointField_), // copy these points, do NOT move + tmpBlockCells, + tmpBlocksPatches, + patchDicts, + defaultPatchName, + defaultPatchType + ); + } checkBlockMesh(*blockMeshPtr); diff --git a/src/meshTools/PointEdgeWave/PointEdgeWave.C b/src/meshTools/PointEdgeWave/PointEdgeWave.C index d88b5699f45df9fe8aee1fb547ed94036c73995d..7d42f0c75e65e500dac79e2d84fdca112a5390ba 100644 --- a/src/meshTools/PointEdgeWave/PointEdgeWave.C +++ b/src/meshTools/PointEdgeWave/PointEdgeWave.C @@ -56,49 +56,6 @@ void Foam::PointEdgeWave<Type>::offset(const label val, labelList& elems) // - list of halfA points (in cyclic patch points) // - list of halfB points (can overlap with A!) // - for every patchPoint its corresponding point -template <class Type> -void Foam::PointEdgeWave<Type>::calcCyclicAddressing() -{ - label cycHalf = 0; - - forAll(mesh_.boundaryMesh(), patchI) - { - const polyPatch& patch = mesh_.boundaryMesh()[patchI]; - - if (isA<cyclicPolyPatch>(patch)) - { - label halfSize = patch.size()/2; - - SubList<face> halfAFaces - ( - mesh_.faces(), - halfSize, - patch.start() - ); - - cycHalves_.set - ( - cycHalf++, - new primitivePatch(halfAFaces, mesh_.points()) - ); - - SubList<face> halfBFaces - ( - mesh_.faces(), - halfSize, - patch.start() + halfSize - ); - - cycHalves_.set - ( - cycHalf++, - new primitivePatch(halfBFaces, mesh_.points()) - ); - } - } -} - - // Handle leaving domain. Implementation referred to Type template <class Type> void Foam::PointEdgeWave<Type>::leaveDomain @@ -575,96 +532,57 @@ void Foam::PointEdgeWave<Type>::handleCyclicPatches() // 1. Send all point info on cyclic patches. Send as // face label + offset in face. - label cycHalf = 0; - forAll(mesh_.boundaryMesh(), patchI) { const polyPatch& patch = mesh_.boundaryMesh()[patchI]; if (isA<cyclicPolyPatch>(patch)) { - const primitivePatch& halfA = cycHalves_[cycHalf++]; - const primitivePatch& halfB = cycHalves_[cycHalf++]; - - // HalfA : get all changed points in relative addressing - - DynamicList<Type> halfAInfo(halfA.nPoints()); - DynamicList<label> halfAPoints(halfA.nPoints()); - DynamicList<label> halfAOwner(halfA.nPoints()); - DynamicList<label> halfAIndex(halfA.nPoints()); - - getChangedPatchPoints - ( - halfA, - halfAInfo, - halfAPoints, - halfAOwner, - halfAIndex - ); + const cyclicPolyPatch& cycPatch = + refCast<const cyclicPolyPatch>(patch); - // HalfB : get all changed points in relative addressing + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); - DynamicList<Type> halfBInfo(halfB.nPoints()); - DynamicList<label> halfBPoints(halfB.nPoints()); - DynamicList<label> halfBOwner(halfB.nPoints()); - DynamicList<label> halfBIndex(halfB.nPoints()); + DynamicList<Type> nbrInfo(nbrPatch.nPoints()); + DynamicList<label> nbrPoints(nbrPatch.nPoints()); + DynamicList<label> nbrOwner(nbrPatch.nPoints()); + DynamicList<label> nbrIndex(nbrPatch.nPoints()); getChangedPatchPoints ( - halfB, - halfBInfo, - halfBPoints, - halfBOwner, - halfBIndex + nbrPatch, + nbrInfo, + nbrPoints, + nbrOwner, + nbrIndex ); - - // HalfA : adapt for leaving domain - leaveDomain(patch, halfA, halfAPoints, halfAInfo); - - // HalfB : adapt for leaving domain - leaveDomain(patch, halfB, halfBPoints, halfBInfo); - + // nbr : adapt for leaving domain + leaveDomain(nbrPatch, nbrPatch, nbrPoints, nbrInfo); // Apply rotation for non-parallel planes - const cyclicPolyPatch& cycPatch = - refCast<const cyclicPolyPatch>(patch); if (!cycPatch.parallel()) { // received data from half1 - transform(cycPatch.forwardT(), halfAInfo); - - // received data from half2 - transform(cycPatch.reverseT(), halfBInfo); + transform(cycPatch.forwardT(), nbrInfo); } if (debug) { Pout<< "Cyclic patch " << patchI << ' ' << patch.name() - << " Changed on first half : " << halfAInfo.size() - << " Changed on second half : " << halfBInfo.size() + << " Changed : " << nbrInfo.size() << endl; } // Half1: update with data from halfB updateFromPatchInfo ( - patch, - halfA, - halfBOwner, - halfBIndex, - halfBInfo - ); - - // Half2: update with data from halfA - updateFromPatchInfo - ( - patch, - halfB, - halfAOwner, - halfAIndex, - halfAInfo + cycPatch, + cycPatch, + nbrOwner, + nbrIndex, + nbrInfo ); if (debug) @@ -703,7 +621,6 @@ Foam::PointEdgeWave<Type>::PointEdgeWave changedEdges_(mesh_.nEdges()), nChangedEdges_(0), nCyclicPatches_(countPatchType<cyclicPolyPatch>()), - cycHalves_(2*nCyclicPatches_), nEvals_(0), nUnvisitedPoints_(mesh_.nPoints()), nUnvisitedEdges_(mesh_.nEdges()) @@ -736,13 +653,6 @@ Foam::PointEdgeWave<Type>::PointEdgeWave } - // Calculate cyclic halves addressing. - if (nCyclicPatches_ > 0) - { - calcCyclicAddressing(); - } - - // Set from initial changed points data setPointInfo(changedPoints, changedPointsInfo); diff --git a/src/meshTools/PointEdgeWave/PointEdgeWave.H b/src/meshTools/PointEdgeWave/PointEdgeWave.H index a40edb3b83cd7b8dc068ee121c59f3919c4ae2e5..2164ae1da13a94bb673c3de3e9c2377a14f34945 100644 --- a/src/meshTools/PointEdgeWave/PointEdgeWave.H +++ b/src/meshTools/PointEdgeWave/PointEdgeWave.H @@ -230,9 +230,6 @@ class PointEdgeWave //- Merge data from across processor boundaries void handleProcPatches(); - //- Calculate cyclic halves addressing. - void calcCyclicAddressing(); - //- Merge data from across cyclic boundaries void handleCyclicPatches(); diff --git a/src/meshTools/regionSplit/regionSplit.C b/src/meshTools/regionSplit/regionSplit.C index ae5edb82ad970b140f73c566003fdde5a11cbe00..d1645ae9ae773d37f096722eccc421d2ade58f57 100644 --- a/src/meshTools/regionSplit/regionSplit.C +++ b/src/meshTools/regionSplit/regionSplit.C @@ -209,16 +209,22 @@ void Foam::regionSplit::fillSeedMask { const polyPatch& pp = patches[patchI]; - if (isA<cyclicPolyPatch>(pp)) + if + ( + isA<cyclicPolyPatch>(pp) + && refCast<const cyclicPolyPatch>(pp).owner() + ) { - label faceI = pp.start(); + // Transfer from neighbourPatch to here or vice versa. + + const cyclicPolyPatch& cycPatch = + refCast<const cyclicPolyPatch>(pp); - label halfSz = pp.size()/2; + label faceI = cycPatch.start(); - for (label i = 0; i < halfSz; i++) + forAll(cycPatch, i) { - label otherFaceI = refCast<const cyclicPolyPatch>(pp) - .transformGlobalFace(faceI); + label otherFaceI = cycPatch.transformGlobalFace(faceI); transferCoupledFaceRegion ( @@ -268,7 +274,7 @@ Foam::label Foam::regionSplit::calcRegionSplit { // Check that blockedFace is synced. boolList syncBlockedFace(blockedFace); - syncTools::swapFaceList(mesh_, syncBlockedFace, false); + syncTools::swapFaceList(mesh_, syncBlockedFace); forAll(syncBlockedFace, faceI) { diff --git a/src/meshTools/sets/cellSources/regionToCell/regionToCell.C b/src/meshTools/sets/cellSources/regionToCell/regionToCell.C index d9be5d55cfd31218359d9632ee74fb18fb82dc1d..56ee4e493b4774a39d823b9810dee96292ddd0ec 100644 --- a/src/meshTools/sets/cellSources/regionToCell/regionToCell.C +++ b/src/meshTools/sets/cellSources/regionToCell/regionToCell.C @@ -97,7 +97,7 @@ void Foam::regionToCell::combine(topoSet& set, const bool add) const { neiSet[faceI-nInt] = inSubset[mesh_.faceOwner()[faceI]]; } - syncTools::swapBoundaryFaceList(mesh_, neiSet, false); + syncTools::swapBoundaryFaceList(mesh_, neiSet); // Find faces inbetween subSet and non-subset. for (label faceI = 0; faceI < nInt; faceI++) diff --git a/src/meshTools/sets/faceSources/cellToFace/cellToFace.C b/src/meshTools/sets/faceSources/cellToFace/cellToFace.C index 431fad348ce007bc895624c1478e033faaad654a..9a0fcc78798e5c11a958ffd206cd0c79d87df646 100644 --- a/src/meshTools/sets/faceSources/cellToFace/cellToFace.C +++ b/src/meshTools/sets/faceSources/cellToFace/cellToFace.C @@ -127,7 +127,7 @@ void Foam::cellToFace::combine(topoSet& set, const bool add) const } } } - syncTools::swapBoundaryFaceList(mesh_, neiInSet, false); + syncTools::swapBoundaryFaceList(mesh_, neiInSet); // Check all boundary faces diff --git a/src/meshTools/sets/topoSets/cellZoneSet.C b/src/meshTools/sets/topoSets/cellZoneSet.C index 9c506589b1ceb3794b556547dc5d25be474f8a8e..0a387c669ff885477df44ceeabc6385d3527abab 100644 --- a/src/meshTools/sets/topoSets/cellZoneSet.C +++ b/src/meshTools/sets/topoSets/cellZoneSet.C @@ -26,8 +26,6 @@ License #include "cellZoneSet.H" #include "mapPolyMesh.H" #include "polyMesh.H" -#include "processorPolyPatch.H" -#include "cyclicPolyPatch.H" #include "addToRunTimeSelectionTable.H" diff --git a/src/meshTools/sets/topoSets/faceSet.C b/src/meshTools/sets/topoSets/faceSet.C index 1dea0b0e9b02c0c5e35cd19f70ec4825dfee40bb..0569591704b9c4242a5fe794fc8bdddf746695d2 100644 --- a/src/meshTools/sets/topoSets/faceSet.C +++ b/src/meshTools/sets/topoSets/faceSet.C @@ -26,8 +26,7 @@ License #include "faceSet.H" #include "mapPolyMesh.H" #include "polyMesh.H" -#include "processorPolyPatch.H" -#include "cyclicPolyPatch.H" +#include "syncTools.H" #include "addToRunTimeSelectionTable.H" @@ -113,116 +112,40 @@ faceSet::~faceSet() void faceSet::sync(const polyMesh& mesh) { - const polyBoundaryMesh& patches = mesh.boundaryMesh(); + boolList set(mesh.nFaces(), false); + + forAllConstIter(faceSet, *this, iter) + { + set[iter.key()] = true; + } + syncTools::syncFaceList(mesh, set, orEqOp<bool>()); label nAdded = 0; - if (Pstream::parRun()) + forAll(set, faceI) { - // Send faces in set that are on a processorPatch. Send as patch face - // indices. - forAll(patches, patchI) + if (set[faceI]) { - const polyPatch& pp = patches[patchI]; - - if (isA<processorPolyPatch>(pp)) + if (insert(faceI)) { - const processorPolyPatch& procPatch = - refCast<const processorPolyPatch>(pp); - - // Convert faceSet locally to labelList. - DynamicList<label> setFaces(pp.size()); - - forAll(pp, i) - { - if (found(pp.start() + i)) - { - setFaces.append(i); - } - } - setFaces.shrink(); - - OPstream toNeighbour - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - - toNeighbour << setFaces; + nAdded++; } } - - // Receive - forAll(patches, patchI) + else if (found(faceI)) { - const polyPatch& pp = patches[patchI]; - - if (isA<processorPolyPatch>(pp)) - { - const processorPolyPatch& procPatch = - refCast<const processorPolyPatch>(pp); - - IPstream fromNeighbour - ( - Pstream::blocking, - procPatch.neighbProcNo() - ); - - labelList setFaces(fromNeighbour); - - forAll(setFaces, i) - { - if (insert(pp.start() + setFaces[i])) - { - nAdded++; - } - } - } + FatalErrorIn("faceSet::sync(const polyMesh&)") + << "Problem : syncing removed faces from set." + << abort(FatalError); } } - // Couple cyclic patches - forAll(patches, patchI) + reduce(nAdded, sumOp<label>()); + if (nAdded > 0) { - const polyPatch& pp = patches[patchI]; - - if (isA<cyclicPolyPatch>(pp)) - { - const cyclicPolyPatch& cycPatch = - refCast<const cyclicPolyPatch>(pp); - - forAll(cycPatch, i) - { - label thisFaceI = cycPatch.start() + i; - label otherFaceI = cycPatch.transformGlobalFace(thisFaceI); - - if (found(thisFaceI)) - { - if (insert(otherFaceI)) - { - nAdded++; - } - } - else if (found(otherFaceI)) - { - if (insert(thisFaceI)) - { - nAdded++; - } - } - } - } + Info<< "Added an additional " << nAdded + << " faces on coupled patches. " + << "(processorPolyPatch, cyclicPolyPatch)" << endl; } - - - reduce(nAdded, sumOp<label>()); - - //if (nAdded > 0) - //{ - // Info<< "Added an additional " << nAdded - // << " faces on coupled patches. " - // << "(processorPolyPatch, cyclicPolyPatch)" << endl; - //} } diff --git a/src/meshTools/sets/topoSets/faceZoneSet.C b/src/meshTools/sets/topoSets/faceZoneSet.C index fdee31918fc0257821b0807df6190f38356a2f51..ed552af24b20315f71b40823734e7b5ec8f7146a 100644 --- a/src/meshTools/sets/topoSets/faceZoneSet.C +++ b/src/meshTools/sets/topoSets/faceZoneSet.C @@ -26,8 +26,6 @@ License #include "faceZoneSet.H" #include "mapPolyMesh.H" #include "polyMesh.H" -#include "processorPolyPatch.H" -#include "cyclicPolyPatch.H" #include "addToRunTimeSelectionTable.H" diff --git a/src/meshTools/sets/topoSets/pointSet.C b/src/meshTools/sets/topoSets/pointSet.C index 4567847d49e317281a5523317590d68be87f192c..53e7c63591595516b5f72be6bcb1751096c9a26b 100644 --- a/src/meshTools/sets/topoSets/pointSet.C +++ b/src/meshTools/sets/topoSets/pointSet.C @@ -125,8 +125,7 @@ void pointSet::sync(const polyMesh& mesh) mesh, contents, orEqOp<bool>(), - false, // null value - false // no separation + false // null value ); // Convert back to labelHashSet diff --git a/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C b/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C index 2e240d6ea302c05f68c398bdaaa199662c4bff7e..4e026f9e487a7b46fc034f959fe8129ea22921ca 100644 --- a/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C +++ b/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C @@ -287,16 +287,25 @@ void Foam::decompositionMethod::calcCSR forAll(pbm, patchI) { - if (isA<cyclicPolyPatch>(pbm[patchI])) + if + ( + isA<cyclicPolyPatch>(pbm[patchI]) + && refCast<const cyclicPolyPatch>(pbm[patchI]).owner() + ) { - const unallocLabelList& faceCells = pbm[patchI].faceCells(); + const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch> + ( + pbm[patchI] + ); - label sizeby2 = faceCells.size()/2; + const unallocLabelList& faceCells = cycPatch.faceCells(); + const unallocLabelList& nbrCells = + cycPatch.neighbPatch().faceCells(); - for (label faceI=0; faceI<sizeby2; faceI++) + forAll(faceCells, facei) { - label own = faceCells[faceI]; - label nei = faceCells[faceI + sizeby2]; + label own = faceCells[facei]; + label nei = nbrCells[facei]; if (cellPair.insert(edge(own, nei))) { @@ -348,16 +357,25 @@ void Foam::decompositionMethod::calcCSR cellPair.clear(); forAll(pbm, patchI) { - if (isA<cyclicPolyPatch>(pbm[patchI])) + if + ( + isA<cyclicPolyPatch>(pbm[patchI]) + && refCast<const cyclicPolyPatch>(pbm[patchI]).owner() + ) { - const unallocLabelList& faceCells = pbm[patchI].faceCells(); + const cyclicPolyPatch& cycPatch = refCast<const cyclicPolyPatch> + ( + pbm[patchI] + ); - label sizeby2 = faceCells.size()/2; + const unallocLabelList& faceCells = cycPatch.faceCells(); + const unallocLabelList& nbrCells = + cycPatch.neighbPatch().faceCells(); - for (label faceI=0; faceI<sizeby2; faceI++) + forAll(faceCells, facei) { - label own = faceCells[faceI]; - label nei = faceCells[faceI + sizeby2]; + label own = faceCells[facei]; + label nei = nbrCells[facei]; if (cellPair.insert(edge(own, nei))) { @@ -479,7 +497,7 @@ void Foam::decompositionMethod::calcDistributedCSR } // Get the cell on the other side of coupled patches - syncTools::swapBoundaryFaceList(mesh, globalNeighbour, false); + syncTools::swapBoundaryFaceList(mesh, globalNeighbour); // Count number of faces (internal + coupled) diff --git a/src/postProcessing/functionObjects/field/fieldValues/faceSource/faceSource.C b/src/postProcessing/functionObjects/field/fieldValues/faceSource/faceSource.C index 517e5803b74c637eba7d25f895346ead24c46b98..bc0639b28bbae66b0877a38871dc598de9e5d31e 100644 --- a/src/postProcessing/functionObjects/field/fieldValues/faceSource/faceSource.C +++ b/src/postProcessing/functionObjects/field/fieldValues/faceSource/faceSource.C @@ -27,7 +27,7 @@ License #include "fvMesh.H" #include "cyclicPolyPatch.H" #include "emptyPolyPatch.H" -#include "processorPolyPatch.H" +#include "coupledPolyPatch.H" #include "surfaceFields.H" #include "volFields.H" @@ -96,9 +96,9 @@ void Foam::fieldValues::faceSource::setFaceZoneFaces() { facePatchId = mesh().boundaryMesh().whichPatch(faceI); const polyPatch& pp = mesh().boundaryMesh()[facePatchId]; - if (isA<processorPolyPatch>(pp)) + if (isA<coupledPolyPatch>(pp)) { - if (refCast<const processorPolyPatch>(pp).owner()) + if (refCast<const coupledPolyPatch>(pp).owner()) { faceId = pp.whichFace(faceI); } @@ -107,18 +107,6 @@ void Foam::fieldValues::faceSource::setFaceZoneFaces() faceId = -1; } } - else if (isA<cyclicPolyPatch>(pp)) - { - label patchFaceI = faceI - pp.start(); - if (patchFaceI < pp.size()/2) - { - faceId = patchFaceI; - } - else - { - faceId = -1; - } - } else if (!isA<emptyPolyPatch>(pp)) { faceId = faceI - pp.start(); diff --git a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint.H b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint.H index 3c63ece5dab6fec115b6dbdb473ab8a3bcf54df0..c6cbc3c11fe6665a55a711c91b34005788fe8edb 100644 --- a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint.H +++ b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint/sixDoFRigidBodyMotionConstraint.H @@ -36,7 +36,7 @@ Description SourceFiles sixDoFRigidBodyMotionConstraint.C - dynamicFvMeshNew.C + sixDoFRigidBodyMotionConstraintNew.C \*---------------------------------------------------------------------------*/ diff --git a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint.H b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint.H index bab292bc4ddf0df3835431c1977b5a3109788713..545b17db8dead568bb815fb0eb090b095a51bc38 100644 --- a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint.H +++ b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint/sixDoFRigidBodyMotionRestraint.H @@ -36,7 +36,7 @@ Description SourceFiles sixDoFRigidBodyMotionRestraint.C - dynamicFvMeshNew.C + sixDoFRigidBodyMotionRestraintNew.C \*---------------------------------------------------------------------------*/ diff --git a/src/sampling/sampledSurface/isoSurface/isoSurface.C b/src/sampling/sampledSurface/isoSurface/isoSurface.C index 405065906fa2a066f8901b715139dc6dea90a738..82a8c80185af319dd30cf72dd9cd7e4b84727104 100644 --- a/src/sampling/sampledSurface/isoSurface/isoSurface.C +++ b/src/sampling/sampledSurface/isoSurface/isoSurface.C @@ -26,7 +26,6 @@ License #include "isoSurface.H" #include "fvMesh.H" #include "mergePoints.H" -#include "syncTools.H" #include "addToRunTimeSelectionTable.H" #include "slicedVolFields.H" #include "volFields.H" @@ -56,10 +55,10 @@ bool Foam::isoSurface::noTransform(const tensor& tt) const } +// Calculates per face whether couple is collocated. bool Foam::isoSurface::collocatedPatch(const polyPatch& pp) { const coupledPolyPatch& cpp = refCast<const coupledPolyPatch>(pp); - return cpp.parallel() && !cpp.separated(); } @@ -73,78 +72,29 @@ Foam::PackedBoolList Foam::isoSurface::collocatedFaces // Initialise to false PackedBoolList collocated(pp.size()); - const vectorField& separation = pp.separation(); - const tensorField& forwardT = pp.forwardT(); - - if (forwardT.size() == 0) + if (isA<processorPolyPatch>(pp) && collocatedPatch(pp)) { - // Parallel. - if (separation.size() == 0) - { - collocated = 1u; - } - else if (separation.size() == 1) - { - // Fully separate. Do not synchronise. - } - else + forAll(pp, i) { - // Per face separation. - forAll(pp, faceI) - { - if (mag(separation[faceI]) < mergeDistance_) - { - collocated[faceI] = 1u; - } - } + collocated[i] = 1u; } } - else if (forwardT.size() == 1) - { - // Fully transformed. - } - else + else if (isA<cyclicPolyPatch>(pp) && collocatedPatch(pp)) { - // Per face transformation. - forAll(pp, faceI) + forAll(pp, i) { - if (noTransform(forwardT[faceI])) - { - collocated[faceI] = 1u; - } + collocated[i] = 1u; } } - return collocated; -} - - -// Insert the data for local point patchPointI into patch local values -// and/or into the shared values field. -void Foam::isoSurface::insertPointData -( - const processorPolyPatch& pp, - const Map<label>& meshToShared, - const pointField& pointValues, - const label patchPointI, - pointField& patchValues, - pointField& sharedValues -) const -{ - label meshPointI = pp.meshPoints()[patchPointI]; - - // Store in local field - label nbrPointI = pp.neighbPoints()[patchPointI]; - if (nbrPointI >= 0 && nbrPointI < patchValues.size()) - { - minEqOp<point>()(patchValues[nbrPointI], pointValues[meshPointI]); - } - - // Store in shared field - Map<label>::const_iterator iter = meshToShared.find(meshPointI); - if (iter != meshToShared.end()) + else { - minEqOp<point>()(sharedValues[iter()], pointValues[meshPointI]); + FatalErrorIn + ( + "isoSurface::collocatedFaces(const coupledPolyPatch&) const" + ) << "Unhandled coupledPolyPatch type " << pp.type() + << abort(FatalError); } + return collocated; } @@ -157,20 +107,6 @@ void Foam::isoSurface::syncUnseparatedPoints // Until syncPointList handles separated coupled patches with multiple // transforms do our own synchronisation of non-separated patches only const polyBoundaryMesh& patches = mesh_.boundaryMesh(); - const globalMeshData& pd = mesh_.globalData(); - const labelList& sharedPtAddr = pd.sharedPointAddr(); - const labelList& sharedPtLabels = pd.sharedPointLabels(); - - // Create map from meshPoint to globalShared index. - Map<label> meshToShared(2*sharedPtLabels.size()); - forAll(sharedPtLabels, i) - { - meshToShared.insert(sharedPtLabels[i], sharedPtAddr[i]); - } - - // Values on shared points. - pointField sharedInfo(pd.nGlobalPoints(), nullValue); - if (Pstream::parRun()) { @@ -181,37 +117,21 @@ void Foam::isoSurface::syncUnseparatedPoints ( isA<processorPolyPatch>(patches[patchI]) && patches[patchI].nPoints() > 0 + && collocatedPatch(patches[patchI]) ) { const processorPolyPatch& pp = refCast<const processorPolyPatch>(patches[patchI]); - const labelList& meshPts = pp.meshPoints(); - pointField patchInfo(meshPts.size(), nullValue); + const labelList& meshPts = pp.meshPoints(); + const labelList& nbrPts = pp.neighbPoints(); - PackedBoolList isCollocated(collocatedFaces(pp)); + pointField patchInfo(meshPts.size()); - forAll(isCollocated, faceI) + forAll(nbrPts, pointI) { - if (isCollocated[faceI]) - { - const face& f = pp.localFaces()[faceI]; - - forAll(f, fp) - { - label pointI = f[fp]; - - insertPointData - ( - pp, - meshToShared, - pointValues, - pointI, - patchInfo, - sharedInfo - ); - } - } + label nbrPointI = nbrPts[pointI]; + patchInfo[nbrPointI] = pointValues[meshPts[pointI]]; } OPstream toNbr(Pstream::blocking, pp.neighbProcNo()); @@ -227,6 +147,7 @@ void Foam::isoSurface::syncUnseparatedPoints ( isA<processorPolyPatch>(patches[patchI]) && patches[patchI].nPoints() > 0 + && collocatedPatch(patches[patchI]) ) { const processorPolyPatch& pp = @@ -240,9 +161,6 @@ void Foam::isoSurface::syncUnseparatedPoints fromNbr >> nbrPatchInfo; } - // Null any value which is not on neighbouring processor - nbrPatchInfo.setSize(pp.nPoints(), nullValue); - const labelList& meshPts = pp.meshPoints(); forAll(meshPts, pointI) @@ -258,22 +176,72 @@ void Foam::isoSurface::syncUnseparatedPoints } } + // Do the cyclics. + forAll(patches, patchI) + { + if (isA<cyclicPolyPatch>(patches[patchI])) + { + const cyclicPolyPatch& cycPatch = + refCast<const cyclicPolyPatch>(patches[patchI]); + + if (cycPatch.owner() && collocatedPatch(cycPatch)) + { + // Owner does all. - // Don't do cyclics for now. Are almost always separated anyway. + const edgeList& coupledPoints = cycPatch.coupledPoints(); + const labelList& meshPts = cycPatch.meshPoints(); + const cyclicPolyPatch& nbrPatch = cycPatch.neighbPatch(); + const labelList& nbrMeshPoints = nbrPatch.meshPoints(); + pointField half0Values(coupledPoints.size()); + pointField half1Values(coupledPoints.size()); - // Shared points + forAll(coupledPoints, i) + { + const edge& e = coupledPoints[i]; + half0Values[i] = pointValues[meshPts[e[0]]]; + half1Values[i] = pointValues[nbrMeshPoints[e[1]]]; + } - // Combine on master. - Pstream::listCombineGather(sharedInfo, minEqOp<point>()); - Pstream::listCombineScatter(sharedInfo); + forAll(coupledPoints, i) + { + const edge& e = coupledPoints[i]; + label p0 = meshPts[e[0]]; + label p1 = nbrMeshPoints[e[1]]; - // Now we will all have the same information. Merge it back with - // my local information. (Note assignment and not combine operator) - forAll(sharedPtLabels, i) + minEqOp<point>()(pointValues[p0], half1Values[i]); + minEqOp<point>()(pointValues[p1], half0Values[i]); + } + } + } + } + + // Synchronize multiple shared points. + const globalMeshData& pd = mesh_.globalData(); + + if (pd.nGlobalPoints() > 0) { - label meshPointI = sharedPtLabels[i]; - pointValues[meshPointI] = sharedInfo[sharedPtAddr[i]]; + // Values on shared points. + pointField sharedPts(pd.nGlobalPoints(), nullValue); + + forAll(pd.sharedPointLabels(), i) + { + label meshPointI = pd.sharedPointLabels()[i]; + // Fill my entries in the shared points + sharedPts[pd.sharedPointAddr()[i]] = pointValues[meshPointI]; + } + + // Combine on master. + Pstream::listCombineGather(sharedPts, minEqOp<point>()); + Pstream::listCombineScatter(sharedPts); + + // Now we will all have the same information. Merge it back with + // my local information. + forAll(pd.sharedPointLabels(), i) + { + label meshPointI = pd.sharedPointLabels()[i]; + pointValues[meshPointI] = sharedPts[pd.sharedPointAddr()[i]]; + } } } @@ -1801,7 +1769,7 @@ Foam::isoSurface::isoSurface const polyPatch& pp = patches[patchI]; // Adapt separated coupled (proc and cyclic) patches - if (isA<coupledPolyPatch>(pp) && !collocatedPatch(pp)) + if (isA<coupledPolyPatch>(pp)) { fvPatchVectorField& pfld = const_cast<fvPatchVectorField&> ( @@ -1918,26 +1886,23 @@ Foam::isoSurface::isoSurface if (patches[patchI].coupled()) { - if (!collocatedPatch(patches[patchI])) - { - const coupledPolyPatch& cpp = - refCast<const coupledPolyPatch> - ( - patches[patchI] - ); + const coupledPolyPatch& cpp = + refCast<const coupledPolyPatch> + ( + patches[patchI] + ); - PackedBoolList isCollocated(collocatedFaces(cpp)); + PackedBoolList isCollocated(collocatedFaces(cpp)); - forAll(isCollocated, i) + forAll(isCollocated, i) + { + if (!isCollocated[i]) { - if (!isCollocated[i]) - { - const face& f = mesh_.faces()[cpp.start()+i]; + const face& f = mesh_.faces()[cpp.start()+i]; - forAll(f, fp) - { - isBoundaryPoint.set(f[fp], 1); - } + forAll(f, fp) + { + isBoundaryPoint.set(f[fp], 1); } } } diff --git a/src/sampling/sampledSurface/isoSurface/isoSurface.H b/src/sampling/sampledSurface/isoSurface/isoSurface.H index c4762bd97a23d1d571f500d6ad4cef06ccce3ff3..85cdc148b00c5048c362503293a2f2710b7b6425 100644 --- a/src/sampling/sampledSurface/isoSurface/isoSurface.H +++ b/src/sampling/sampledSurface/isoSurface/isoSurface.H @@ -149,19 +149,6 @@ class isoSurface //- Per face whether is collocated PackedBoolList collocatedFaces(const coupledPolyPatch&) const; - //- Take value at local point patchPointI and assign it to its - // correct place in patchValues (for transferral) and sharedValues - // (for reduction) - void insertPointData - ( - const processorPolyPatch& pp, - const Map<label>& meshToShared, - const pointField& pointValues, - const label patchPointI, - pointField& patchValues, - pointField& sharedValues - ) const; - //- Synchonise points on all non-separated coupled patches void syncUnseparatedPoints ( diff --git a/src/sampling/sampledSurface/isoSurface/isoSurfaceCell.C b/src/sampling/sampledSurface/isoSurface/isoSurfaceCell.C index 822c668f8fed0ff6ea9099b971568334ec051fa7..72837ffd699256886fa17a1716e0188b64d2cb3e 100644 --- a/src/sampling/sampledSurface/isoSurface/isoSurfaceCell.C +++ b/src/sampling/sampledSurface/isoSurface/isoSurfaceCell.C @@ -755,13 +755,12 @@ void Foam::isoSurfaceCell::calcSnappedPoint } } - syncTools::syncPointList + syncTools::syncPointPositions ( mesh_, collapsedPoint, minEqOp<point>(), - point::max, - true // are coordinates so separate + point::max ); snappedPoint.setSize(mesh_.nPoints()); diff --git a/src/sampling/sampledSurface/isoSurface/isoSurfaceTemplates.C b/src/sampling/sampledSurface/isoSurface/isoSurfaceTemplates.C index 4ad827a1f32cf9afa124f70aa2462fa2b9b7a09b..72467ed2398c99d06ab248efd1c78656ced3515e 100644 --- a/src/sampling/sampledSurface/isoSurface/isoSurfaceTemplates.C +++ b/src/sampling/sampledSurface/isoSurface/isoSurfaceTemplates.C @@ -116,7 +116,7 @@ Foam::isoSurface::adaptPatchFields { // Already has interpolate as value } - else if (isA<processorPolyPatch>(pp) && !collocatedPatch(pp)) + else if (isA<processorPolyPatch>(pp)) { fvPatchField<Type>& pfld = const_cast<fvPatchField<Type>&> ( @@ -568,8 +568,8 @@ void Foam::isoSurface::generateTriPoints } } } - syncTools::swapBoundaryFaceList(mesh_, neiSnapped, false); - syncTools::swapBoundaryFaceList(mesh_, neiSnappedPoint, false); + syncTools::swapBoundaryFaceList(mesh_, neiSnapped); + syncTools::swapBoundaryFaceList(mesh_, neiSnappedPoint); diff --git a/src/turbulenceModels/compressible/RAS/derivedFvPatchFields/turbulentTemperatureCoupledBaffleMixed/turbulentTemperatureCoupledBaffleMixedFvPatchScalarField.C b/src/turbulenceModels/compressible/RAS/derivedFvPatchFields/turbulentTemperatureCoupledBaffleMixed/turbulentTemperatureCoupledBaffleMixedFvPatchScalarField.C index bb3ce48d3a3bdff7e0fadee8c8e9409c8e29001b..c58c5f162a055aa4f52bf1ca86adfe9dee2283a9 100644 --- a/src/turbulenceModels/compressible/RAS/derivedFvPatchFields/turbulentTemperatureCoupledBaffleMixed/turbulentTemperatureCoupledBaffleMixedFvPatchScalarField.C +++ b/src/turbulenceModels/compressible/RAS/derivedFvPatchFields/turbulentTemperatureCoupledBaffleMixed/turbulentTemperatureCoupledBaffleMixedFvPatchScalarField.C @@ -151,13 +151,11 @@ turbulentTemperatureCoupledBaffleMixedFvPatchScalarField::K() const const compressible::RASModel& model = db().lookupObject<compressible::RASModel>("RASProperties"); - tmp<volScalarField> talpha = model.alphaEff(); - const basicThermo& thermo = db().lookupObject<basicThermo>("thermophysicalProperties"); return - talpha().boundaryField()[patch().index()] + model.alphaEff()().boundaryField()[patch().index()] *thermo.Cp()().boundaryField()[patch().index()]; } else if (mesh.objectRegistry::foundObject<volScalarField>(KName_)) diff --git a/src/turbulenceModels/incompressible/RAS/Make/files b/src/turbulenceModels/incompressible/RAS/Make/files index 7ddd1d4e3b24fa0d6156d5f6fed061beebf8ace1..9b95469a648584e4b3311e46e01119a2abc09a49 100644 --- a/src/turbulenceModels/incompressible/RAS/Make/files +++ b/src/turbulenceModels/incompressible/RAS/Make/files @@ -43,6 +43,9 @@ $(kqRWallFunctions)/kqRWallFunction/kqRWallFunctionFvPatchFields.C derivedFvPatchFields/turbulentHeatFluxTemperature/turbulentHeatFluxTemperatureFvPatchScalarField.C derivedFvPatchFields/turbulentMixingLengthDissipationRateInlet/turbulentMixingLengthDissipationRateInletFvPatchScalarField.C derivedFvPatchFields/turbulentMixingLengthFrequencyInlet/turbulentMixingLengthFrequencyInletFvPatchScalarField.C +derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.C +derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.C +derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.C backwardsCompatibility/wallFunctions/backwardsCompatibilityWallFunctions.C diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.C new file mode 100644 index 0000000000000000000000000000000000000000..a69a36f140c85afe0aa2fa26a988aa954e9aab86 --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.C @@ -0,0 +1,147 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "ABLInletEpsilonFvPatchScalarField.H" +#include "addToRunTimeSelectionTable.H" +#include "fvPatchFieldMapper.H" +#include "volFields.H" +#include "surfaceFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +ABLInletEpsilonFvPatchScalarField::ABLInletEpsilonFvPatchScalarField +( + const fvPatch& p, + const DimensionedField<scalar, volMesh>& iF +) +: + fixedValueFvPatchScalarField(p, iF), + Ustar_(0), + z_(pTraits<vector>::zero), + z0_(0), + kappa_(0.41) +{} + + +ABLInletEpsilonFvPatchScalarField::ABLInletEpsilonFvPatchScalarField +( + const ABLInletEpsilonFvPatchScalarField& ptf, + const fvPatch& p, + const DimensionedField<scalar, volMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + fixedValueFvPatchScalarField(ptf, p, iF, mapper), + Ustar_(ptf.Ustar_), + z_(ptf.z_), + z0_(ptf.z0_), + kappa_(ptf.kappa_) +{} + + +ABLInletEpsilonFvPatchScalarField::ABLInletEpsilonFvPatchScalarField +( + const fvPatch& p, + const DimensionedField<scalar, volMesh>& iF, + const dictionary& dict +) +: + fixedValueFvPatchScalarField(p, iF), + Ustar_(readScalar(dict.lookup("Ustar"))), + z_(dict.lookup("z")), + z0_(readScalar(dict.lookup("z0"))), + kappa_(dict.lookupOrDefault<scalar>("kappa", 0.41)) +{ + if (mag(z_) < SMALL) + { + FatalErrorIn("ABLInletEpsilonFvPatchScalarField(dict)") + << "z is not correct" + << abort(FatalError); + } + + z_ /= mag(z_); + + evaluate(); +} + + +ABLInletEpsilonFvPatchScalarField::ABLInletEpsilonFvPatchScalarField +( + const ABLInletEpsilonFvPatchScalarField& fcvpvf, + const DimensionedField<scalar, volMesh>& iF +) +: + fixedValueFvPatchScalarField(fcvpvf, iF), + Ustar_(fcvpvf.Ustar_), + z_(fcvpvf.z_), + z0_(fcvpvf.z0_), + kappa_(fcvpvf.kappa_) +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +void ABLInletEpsilonFvPatchScalarField::updateCoeffs() +{ + const vectorField& c = patch().Cf(); + scalarField coord = (c & z_); + scalarField::operator=(pow(Ustar_, 3.0)/(kappa_*(coord + z0_))); +} + + +// Write +void ABLInletEpsilonFvPatchScalarField::write(Ostream& os) const +{ + fvPatchScalarField::write(os); + os.writeKeyword("Ustar") + << Ustar_ << token::END_STATEMENT << nl; + os.writeKeyword("z") + << z_ << token::END_STATEMENT << nl; + os.writeKeyword("z0") + << z0_ << token::END_STATEMENT << nl; + os.writeKeyword("kappa") + << kappa_ << token::END_STATEMENT << nl; + writeEntry("value", os); +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makePatchTypeField(fvPatchScalarField, ABLInletEpsilonFvPatchScalarField); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.H b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.H new file mode 100644 index 0000000000000000000000000000000000000000..39560879aa929566299c32045848f7660db21514 --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletEpsilon/ABLInletEpsilonFvPatchScalarField.H @@ -0,0 +1,184 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + ABLInletEpsilonFvPatchScalarField + +Description + Boundary condition specifies a epsilon inlet for the atmospheric boundary + layer (ABL). This boundaty is to be used in conjunction with + ABLInletVelocity. + + @verbatim + epsilon = Ustar^3 / (K(z + z0)) + + where: + + Ustar is the frictional velocity + K is karman's constant + z is the verical coordinate + z0 is the surface roughness lenght + + @endverbatim + + Reference: + D.M. Hargreaves and N.G. Wright + "On the use of the k-epsilon model in commercial CFD software to model the + neutral atmospheric boundary layer" + Journal of Wind Engineering and Industrial Aerodynamics 95(2007) 355-369. + +SourceFiles + ABLInletEpsilonFvPatchScalarField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef ABLInletEpsilonFvPatchScalarField_H +#define ABLInletEpsilonFvPatchScalarField_H + +#include "fvPatchFields.H" +#include "fixedValueFvPatchFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ + +/*---------------------------------------------------------------------------*\ + Class ABLInletEpsilonFvPatchScalarField Declaration +\*---------------------------------------------------------------------------*/ + +class ABLInletEpsilonFvPatchScalarField +: + public fixedValueFvPatchScalarField +{ + // Private data + + //- Peak velocity magnitude + scalar Ustar_; + + //- Direction of the z-coordinate + vector z_; + + //- Surface roughness lenght + scalar z0_; + + //- Von Karman constant + scalar kappa_; + +public: + + //- Runtime type information + TypeName("ABLInletEpsilon"); + + + // Constructors + + //- Construct from patch and internal field + ABLInletEpsilonFvPatchScalarField + ( + const fvPatch&, + const DimensionedField<scalar, volMesh>& + ); + + //- Construct from patch, internal field and dictionary + ABLInletEpsilonFvPatchScalarField + ( + const fvPatch&, + const DimensionedField<scalar, volMesh>&, + const dictionary& + ); + + //- Construct by mapping given ABLInletEpsilonFvPatchScalarField + // onto a new patch + ABLInletEpsilonFvPatchScalarField + ( + const ABLInletEpsilonFvPatchScalarField&, + const fvPatch&, + const DimensionedField<scalar, volMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct and return a clone + virtual tmp<fvPatchScalarField> clone() const + { + return tmp<fvPatchScalarField> + ( + new ABLInletEpsilonFvPatchScalarField(*this) + ); + } + + //- Construct as copy setting internal field reference + ABLInletEpsilonFvPatchScalarField + ( + const ABLInletEpsilonFvPatchScalarField&, + const DimensionedField<scalar, volMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvPatchScalarField> clone + ( + const DimensionedField<scalar, volMesh>& iF + ) const + { + return tmp<fvPatchScalarField> + ( + new ABLInletEpsilonFvPatchScalarField(*this, iF) + ); + } + + + // Member functions + + //- Return max value + scalar& Ustar() + { + return Ustar_; + } + + //- Return z direction + vector& z() + { + return z_; + } + + //- Update coefficients + virtual void updateCoeffs(); + + //- Write + virtual void write(Ostream&) const; +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.C new file mode 100644 index 0000000000000000000000000000000000000000..d8e7ae4639bcfa5f896692aa373805a85d480fac --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.C @@ -0,0 +1,154 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "ABLInletVelocityFvPatchVectorField.H" +#include "addToRunTimeSelectionTable.H" +#include "fvPatchFieldMapper.H" +#include "volFields.H" +#include "surfaceFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +ABLInletVelocityFvPatchVectorField::ABLInletVelocityFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchVectorField(p, iF), + Ustar_(0), + n_(pTraits<vector>::zero), + z_(pTraits<vector>::zero), + z0_(0), + kappa_(0.41) +{} + + +ABLInletVelocityFvPatchVectorField::ABLInletVelocityFvPatchVectorField +( + const ABLInletVelocityFvPatchVectorField& ptf, + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + fixedValueFvPatchVectorField(ptf, p, iF, mapper), + Ustar_(ptf.Ustar_), + n_(ptf.n_), + z_(ptf.z_), + z0_(ptf.z0_), + kappa_(ptf.kappa_) +{} + + +ABLInletVelocityFvPatchVectorField::ABLInletVelocityFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const dictionary& dict +) +: + fixedValueFvPatchVectorField(p, iF), + Ustar_(readScalar(dict.lookup("Ustar"))), + n_(dict.lookup("n")), + z_(dict.lookup("z")), + z0_(readScalar(dict.lookup("z0"))), + kappa_(dict.lookupOrDefault<scalar>("kappa", 0.41)) +{ + if (mag(n_) < SMALL || mag(z_) < SMALL) + { + FatalErrorIn("ABLInletVelocityFvPatchVectorField(dict)") + << "n or z given with zero size not correct" + << abort(FatalError); + } + + n_ /= mag(n_); + z_ /= mag(z_); + + evaluate(); +} + + +ABLInletVelocityFvPatchVectorField::ABLInletVelocityFvPatchVectorField +( + const ABLInletVelocityFvPatchVectorField& fcvpvf, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchVectorField(fcvpvf, iF), + Ustar_(fcvpvf.Ustar_), + n_(fcvpvf.n_), + z_(fcvpvf.z_), + z0_(fcvpvf.z0_), + kappa_(fcvpvf.kappa_) +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +void ABLInletVelocityFvPatchVectorField::updateCoeffs() +{ + const vectorField& c = patch().Cf(); + scalarField coord = (c & z_); + vectorField::operator=(n_*(Ustar_/kappa_)*log((coord + z0_)/z0_)); +} + + +// Write +void ABLInletVelocityFvPatchVectorField::write(Ostream& os) const +{ + fvPatchVectorField::write(os); + os.writeKeyword("Ustar") + << Ustar_ << token::END_STATEMENT << nl; + os.writeKeyword("z0") + << z0_ << token::END_STATEMENT << nl; + os.writeKeyword("n") + << n_ << token::END_STATEMENT << nl; + os.writeKeyword("z") + << z_ << token::END_STATEMENT << nl; + os.writeKeyword("kappa") + << kappa_ << token::END_STATEMENT << nl; + writeEntry("value", os); +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makePatchTypeField(fvPatchVectorField, ABLInletVelocityFvPatchVectorField); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam + +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.H b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.H new file mode 100644 index 0000000000000000000000000000000000000000..0e7a9167cdb4395f7346339e59666bf0f1a01243 --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/ABLInletVelocity/ABLInletVelocityFvPatchVectorField.H @@ -0,0 +1,207 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + ABLInletVelocityFvPatchVectorField + +Description + Boundary condition specifies a atmospheric boundary layer (ABL) + velocity inlet profile given the friction velocity value, + flow direction n and direction of the parabolic coordinate z. + + @verbatim + U = (Ustar/K) ln((z + z0)/z0) + + where: + + Ustar is the frictional velocity + K is karman's constant + z0 is the surface roughness lenght + z is the verical coordinate + + and: + + Ustar = K Uref/ln((Zref + z0)/z0) + + where: + + Uref is the reference velocity at Zref + Zref is the reference height. + + @endverbatim + + Reference: + D.M. Hargreaves and N.G. Wright + "On the use of the k-epsilon model in commercial CFD software to model the + neutral atmospheric boundary layer" + Journal of Wind Engineering and Industrial Aerodynamics 95(2007) 355-369. + +NOTE: D.M. Hargreaves and N.G. Wright recommend Gamma epsilon in the k-epsilon + model should be changed from 1.3 to 1.11 for consistency. + The roughness height (Er) is given by Er = 20 z0 following the same + reference + +SourceFiles + ABLInletVelocityFvPatchVectorField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef ABLInletVelocityFvPatchVectorField_H +#define ABLInletVelocityFvPatchVectorField_H + +#include "fvPatchFields.H" +#include "fixedValueFvPatchFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ + +/*---------------------------------------------------------------------------*\ + Class ABLInletVelocityFvPatchVectorField Declaration +\*---------------------------------------------------------------------------*/ + +class ABLInletVelocityFvPatchVectorField +: + public fixedValueFvPatchVectorField +{ + // Private data + + //- Friction velocity + scalar Ustar_; + + //- Flow direction + vector n_; + + //- Direction of the z-coordinate + vector z_; + + //- Surface roughness lenght + scalar z0_; + + //- Von Karman constant + scalar kappa_; + +public: + + //- Runtime type information + TypeName("ABLInletVelocity"); + + + // Constructors + + //- Construct from patch and internal field + ABLInletVelocityFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct from patch, internal field and dictionary + ABLInletVelocityFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const dictionary& + ); + + //- Construct by mapping given ABLInletVelocityFvPatchVectorField + // onto a new patch + ABLInletVelocityFvPatchVectorField + ( + const ABLInletVelocityFvPatchVectorField&, + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct and return a clone + virtual tmp<fvPatchVectorField> clone() const + { + return tmp<fvPatchVectorField> + ( + new ABLInletVelocityFvPatchVectorField(*this) + ); + } + + //- Construct as copy setting internal field reference + ABLInletVelocityFvPatchVectorField + ( + const ABLInletVelocityFvPatchVectorField&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvPatchVectorField> clone + ( + const DimensionedField<vector, volMesh>& iF + ) const + { + return tmp<fvPatchVectorField> + ( + new ABLInletVelocityFvPatchVectorField(*this, iF) + ); + } + + + // Member functions + + //- Return max value + scalar& Ustar() + { + return Ustar_; + } + + //- Return flow direction + vector& n() + { + return n_; + } + + //- Return y direction + vector& z() + { + return z_; + } + + //- Update coefficients + virtual void updateCoeffs(); + + //- Write + virtual void write(Ostream&) const; +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.C new file mode 100644 index 0000000000000000000000000000000000000000..1fd82c9b3c271d744bcc0036ab3ef07183c1e54f --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.C @@ -0,0 +1,164 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +\*---------------------------------------------------------------------------*/ + +#include "fixedShearStressFvPatchVectorField.H" +#include "addToRunTimeSelectionTable.H" +#include "fvPatchFieldMapper.H" +#include "volFields.H" +#include "RASModel.H" +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ + +// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // + +fixedShearStressFvPatchVectorField:: +fixedShearStressFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchVectorField(p, iF), + tau0_(vector::zero) +{} + + +fixedShearStressFvPatchVectorField:: +fixedShearStressFvPatchVectorField +( + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const dictionary& dict +) +: + fixedValueFvPatchVectorField(p, iF), + tau0_(dict.lookupOrDefault<vector>("tau", vector::zero)) +{ + fvPatchField<vector>::operator=(patchInternalField()); +} + + +fixedShearStressFvPatchVectorField:: +fixedShearStressFvPatchVectorField +( + const fixedShearStressFvPatchVectorField& ptf, + const fvPatch& p, + const DimensionedField<vector, volMesh>& iF, + const fvPatchFieldMapper& mapper +) +: + fixedValueFvPatchVectorField(ptf, p, iF, mapper), + tau0_(ptf.tau0_) +{} + + +fixedShearStressFvPatchVectorField:: +fixedShearStressFvPatchVectorField +( + const fixedShearStressFvPatchVectorField& ptf +) +: + fixedValueFvPatchVectorField(ptf), + tau0_(ptf.tau0_) +{} + + +fixedShearStressFvPatchVectorField:: +fixedShearStressFvPatchVectorField +( + const fixedShearStressFvPatchVectorField& ptf, + const DimensionedField<vector, volMesh>& iF +) +: + fixedValueFvPatchVectorField(ptf, iF), + tau0_(ptf.tau0_) +{} + + +// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // + +void fixedShearStressFvPatchVectorField::updateCoeffs() +{ + if (updated()) + { + return; + } + + const label patchI = patch().index(); + + const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties"); + + const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI]; + + const vectorField Ui = Uw.patchInternalField(); + + vector tauHat = tau0_/mag(tau0_); + + const scalarField& ry = patch().deltaCoeffs(); + + scalarField nuEffw = rasModel.nuEff()().boundaryField()[patchI]; + + vectorField UwUpdated = + tauHat*(tauHat & (tau0_*(1.0/(ry*nuEffw)) + Ui)); + + operator==(UwUpdated); + + if (debug) + { + vectorField nHat = this->patch().nf(); + volSymmTensorField Reff = rasModel.devReff(); + Info << "tau : " << (nHat & Reff.boundaryField()[patchI])() << endl; + } + + fixedValueFvPatchVectorField::updateCoeffs(); +} + + +void fixedShearStressFvPatchVectorField::write(Ostream& os) const +{ + fixedValueFvPatchVectorField::write(os); + os.writeKeyword("tau") << tau0_ << token::END_STATEMENT << nl; + writeEntry("value", os); +} + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +makePatchTypeField +( + fvPatchVectorField, + fixedShearStressFvPatchVectorField +); + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.H b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.H new file mode 100644 index 0000000000000000000000000000000000000000..5597f01bc21dac55d027d3781ce405960056c1f3 --- /dev/null +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/fixedShearStress/fixedShearStressFvPatchVectorField.H @@ -0,0 +1,147 @@ +/*---------------------------------------------------------------------------*\ + ========= | + \\ / F ield | OpenFOAM: The Open Source CFD Toolbox + \\ / O peration | + \\ / A nd | Copyright (C) 2010-2010 OpenCFD Ltd. + \\/ M anipulation | +------------------------------------------------------------------------------- +License + This file is part of OpenFOAM. + + OpenFOAM is free software; you can redistribute it and/or modify it + under the terms of the GNU General Public License as published by the + Free Software Foundation; either version 3 of the License, or (at your + option) any later version. + + OpenFOAM is distributed in the hope that it will be useful, but WITHOUT + ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + for more details. + + You should have received a copy of the GNU General Public License + along with OpenFOAM; if not, write to the Free Software Foundation, + Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA + +Class + Foam::fixedShearStressFvPatchVectorField + +Description + Set a constant shear stress as tau0 = -nuEff dU/dn. + +SourceFiles + fixedShearStressFvPatchVectorField.C + +\*---------------------------------------------------------------------------*/ + +#ifndef fixedShearStressFvPatchVectorField_H +#define fixedShearStressFvPatchVectorField_H + +#include "fvPatchFields.H" +#include "fixedValueFvPatchFields.H" + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +namespace Foam +{ +namespace incompressible +{ +/*---------------------------------------------------------------------------*\ + Class fixedShearStressFvPatchVectorField Declaration +\*---------------------------------------------------------------------------*/ + +class fixedShearStressFvPatchVectorField +: + public fixedValueFvPatchVectorField +{ + // Private data + + //- Constant shear stress + vector tau0_; + + +public: + + //- Runtime type information + TypeName("fixedShearStress"); + + + // Constructors + + //- Construct from patch and internal field + fixedShearStressFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct from patch, internal field and dictionary + fixedShearStressFvPatchVectorField + ( + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const dictionary& + ); + + //- Construct by mapping given + fixedShearStressFvPatchVectorField + ( + const fixedShearStressFvPatchVectorField&, + const fvPatch&, + const DimensionedField<vector, volMesh>&, + const fvPatchFieldMapper& + ); + + //- Construct as copy + fixedShearStressFvPatchVectorField + ( + const fixedShearStressFvPatchVectorField& + ); + + //- Construct and return a clone + virtual tmp<fvPatchVectorField> clone() const + { + return tmp<fvPatchVectorField> + ( + new fixedShearStressFvPatchVectorField(*this) + ); + } + + //- Construct as copy setting internal field reference + fixedShearStressFvPatchVectorField + ( + const fixedShearStressFvPatchVectorField&, + const DimensionedField<vector, volMesh>& + ); + + //- Construct and return a clone setting internal field reference + virtual tmp<fvPatchVectorField> clone + ( + const DimensionedField<vector, volMesh>& iF + ) const + { + return tmp<fvPatchVectorField> + ( + new fixedShearStressFvPatchVectorField(*this, iF) + ); + } + + + // Member functions + + //- Update the coefficients associated with the patch field + virtual void updateCoeffs(); + + //- Write + virtual void write(Ostream&) const; +}; + + +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +} // End namespace incompressible +} // End namespace Foam +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +#endif + +// ************************************************************************* // diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.H b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.H index 3e6be442b59f58f03528a1273a2757d91745c004..397b66806fc5995aba08be194a66a638e9ad1846 100644 --- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.H +++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.H @@ -152,6 +152,21 @@ public: // Member functions + // Acces functions + + // Return Ks + scalarField& Ks() + { + return Ks_; + } + + // Return Cs + scalarField& Cs() + { + return Cs_; + } + + // Mapping functions //- Map (and resize as needed) from self given a mapping object diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0.org/U b/tutorials/DNS/dnsFoam/boxTurb16/0.org/U index 77cc396c203778a173d6d308fd4298735f4b9909..9b2701a3ae515953c50901eb7e6c878fc2d1dbe2 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0.org/U +++ b/tutorials/DNS/dnsFoam/boxTurb16/0.org/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,28 +10,42 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "1"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { - patch0 + patch0_half0 { type cyclic; } - patch1 + patch1_half0 { type cyclic; } - patch2 + patch2_half0 + { + type cyclic; + } + patch2_half1 + { + type cyclic; + } + patch1_half1 + { + type cyclic; + } + patch0_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0.org/enstrophy b/tutorials/DNS/dnsFoam/boxTurb16/0.org/enstrophy index 4f1197074dec8e2dcadeef982090db7e2e79213b..254013e6c9f63ad74a4d1e7595ee11d4fc6b6f8e 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0.org/enstrophy +++ b/tutorials/DNS/dnsFoam/boxTurb16/0.org/enstrophy @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,31 +10,48 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object enstrophy; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 -2 0 0 0 0]; +dimensions [ 0 0 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - patch0 + patch0_half0 { type cyclic; value uniform 0; } - patch1 + patch1_half0 { type cyclic; value uniform 0; } - patch2 + patch2_half0 + { + type cyclic; + value uniform 0; + } + patch2_half1 + { + type cyclic; + value uniform 0; + } + patch1_half1 + { + type cyclic; + value uniform 0; + } + patch0_half1 { type cyclic; value uniform 0; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0.org/p b/tutorials/DNS/dnsFoam/boxTurb16/0.org/p index 0874357a9b126d03c9c4d599414bb41779729e77..0738f6a86781b8089f5a029ad3195c72c2ca319a 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0.org/p +++ b/tutorials/DNS/dnsFoam/boxTurb16/0.org/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,30 +10,42 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - patch0 + patch0_half0 { type cyclic; } - - patch1 + patch1_half0 { type cyclic; } - - patch2 + patch2_half0 + { + type cyclic; + } + patch2_half1 + { + type cyclic; + } + patch1_half1 + { + type cyclic; + } + patch0_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0/U b/tutorials/DNS/dnsFoam/boxTurb16/0/U index 77cc396c203778a173d6d308fd4298735f4b9909..9b2701a3ae515953c50901eb7e6c878fc2d1dbe2 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0/U +++ b/tutorials/DNS/dnsFoam/boxTurb16/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,28 +10,42 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "1"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { - patch0 + patch0_half0 { type cyclic; } - patch1 + patch1_half0 { type cyclic; } - patch2 + patch2_half0 + { + type cyclic; + } + patch2_half1 + { + type cyclic; + } + patch1_half1 + { + type cyclic; + } + patch0_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0/enstrophy b/tutorials/DNS/dnsFoam/boxTurb16/0/enstrophy index 4f1197074dec8e2dcadeef982090db7e2e79213b..254013e6c9f63ad74a4d1e7595ee11d4fc6b6f8e 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0/enstrophy +++ b/tutorials/DNS/dnsFoam/boxTurb16/0/enstrophy @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,31 +10,48 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object enstrophy; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 -2 0 0 0 0]; +dimensions [ 0 0 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - patch0 + patch0_half0 { type cyclic; value uniform 0; } - patch1 + patch1_half0 { type cyclic; value uniform 0; } - patch2 + patch2_half0 + { + type cyclic; + value uniform 0; + } + patch2_half1 + { + type cyclic; + value uniform 0; + } + patch1_half1 + { + type cyclic; + value uniform 0; + } + patch0_half1 { type cyclic; value uniform 0; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/0/p b/tutorials/DNS/dnsFoam/boxTurb16/0/p index 0874357a9b126d03c9c4d599414bb41779729e77..0738f6a86781b8089f5a029ad3195c72c2ca319a 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/0/p +++ b/tutorials/DNS/dnsFoam/boxTurb16/0/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,30 +10,42 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - patch0 + patch0_half0 { type cyclic; } - - patch1 + patch1_half0 { type cyclic; } - - patch2 + patch2_half0 + { + type cyclic; + } + patch2_half1 + { + type cyclic; + } + patch1_half1 + { + type cyclic; + } + patch0_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/DNS/dnsFoam/boxTurb16/constant/polyMesh/boundary b/tutorials/DNS/dnsFoam/boxTurb16/constant/polyMesh/boundary index bbae8091918170ac889ea09258b8ee430c65b892..1999f682b1cef32176181b155c87805e3809153f 100644 --- a/tutorials/DNS/dnsFoam/boxTurb16/constant/polyMesh/boundary +++ b/tutorials/DNS/dnsFoam/boxTurb16/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,28 +15,49 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -3 +6 ( - patch0 + patch0_half0 { type cyclic; - nFaces 512; + nFaces 256; startFace 11520; - featureCos 0.9; + neighbourPatch patch0_half1; } - patch1 + patch0_half1 { type cyclic; - nFaces 512; + nFaces 256; + startFace 11776; + neighbourPatch patch0_half0; + } + patch1_half0 + { + type cyclic; + nFaces 256; startFace 12032; - featureCos 0.9; + neighbourPatch patch1_half1; } - patch2 + patch1_half1 { type cyclic; - nFaces 512; + nFaces 256; + startFace 12288; + neighbourPatch patch1_half0; + } + patch2_half0 + { + type cyclic; + nFaces 256; startFace 12544; - featureCos 0.9; + neighbourPatch patch2_half1; + } + patch2_half1 + { + type cyclic; + nFaces 256; + startFace 12800; + neighbourPatch patch2_half0; } ) diff --git a/tutorials/channelOodles/channel395/constant/polyMesh/blockMeshDict b/tutorials/channelOodles/channel395/constant/polyMesh/blockMeshDict new file mode 100644 index 0000000000000000000000000000000000000000..2adabb4f217630938807a89e65ff8bf132a508d3 --- /dev/null +++ b/tutorials/channelOodles/channel395/constant/polyMesh/blockMeshDict @@ -0,0 +1,177 @@ +/*--------------------------------*- C++ -*----------------------------------*\ +| ========= | | +| \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | +| \\ / O peration | Version: 1.5 | +| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\/ M anipulation | | +\*---------------------------------------------------------------------------*/ +FoamFile +{ + version 2.0; + format ascii; + class dictionary; + object blockMeshDict; +} +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +convertToMeters 1; + +vertices +( + (0 0 0) + (4 0 0) + (0 1 0) + (4 1 0) + (0 2 0) + (4 2 0) + (0 0 2) + (4 0 2) + (0 1 2) + (4 1 2) + (0 2 2) + (4 2 2) +); + +blocks +( + hex (0 1 3 2 6 7 9 8) (40 25 30) simpleGrading (1 10.7028 1) + hex (2 3 5 4 8 9 11 10) (40 25 30) simpleGrading (1 0.0984 1) +); + +edges +( +); + +//patches +//( +// wall bottomWall +// ( +// (0 1 7 6) +// ) +// wall topWall +// ( +// (4 10 11 5) +// ) +// cyclic sides1 +// ( +// (0 2 3 1) +// (6 7 9 8) +// ) +// cyclic sides2 +// ( +// (2 4 5 3) +// (8 9 11 10) +// ) +// cyclic inout1 +// ( +// (1 3 9 7) +// (0 6 8 2) +// ) +// cyclic inout2 +// ( +// (3 5 11 9) +// (2 8 10 4) +// ) +//); + +boundary +( + bottomWall + { + type wall; + faces + ( + (0 1 7 6) + ); + } + topWall + { + type wall; + faces + ( + (4 10 11 5) + ); + } + + sides1_half0 + { + type cyclic; + neighbourPatch sides1_half1; + faces + ( + (0 2 3 1) + ); + } + sides1_half1 + { + type cyclic; + neighbourPatch sides1_half0; + faces + ( + (6 7 9 8) + ); + } + + sides2_half0 + { + type cyclic; + neighbourPatch sides2_half1; + faces + ( + (2 4 5 3) + ); + } + sides2_half1 + { + type cyclic; + neighbourPatch sides2_half0; + faces + ( + (8 9 11 10) + ); + } + + inout1_half0 + { + type cyclic; + neighbourPatch inout1_half1; + faces + ( + (1 3 9 7) + ); + } + inout1_half1 + { + type cyclic; + neighbourPatch inout1_half0; + faces + ( + (0 6 8 2) + ); + } + + inout2_half0 + { + type cyclic; + neighbourPatch inout2_half1; + faces + ( + (3 5 11 9) + ); + } + inout2_half1 + { + type cyclic; + neighbourPatch inout2_half0; + faces + ( + (2 8 10 4) + ); + } +); + +mergePatchPairs +( +); + +// ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Su b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Su index c04ce1d7e0326823040d81056bc2a2f7120e9b73..d3cc26e7d8edcece3ed0f559929d3a42b65dd790 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Su +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Su @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object Su; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; internalField uniform 0.135; @@ -25,28 +26,29 @@ boundaryField type fixedValue; value uniform 0.135; } - outlet { type inletOutlet; inletValue uniform 0.135; value uniform 0.135; } - upperWall { type zeroGradient; } - lowerWall { type zeroGradient; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/T b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/T index bb7a3a2d796665b96fe89f1056b8f2016d1e095b..f8c2f8ec0c30c2a93e9ee7e325f4bb1a6a34fc50 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/T +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/T @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object T; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 1 0 0 0]; +dimensions [ 0 0 0 1 0 0 0 ]; internalField uniform 293; @@ -25,30 +26,31 @@ boundaryField type fixedValue; value uniform 293; } - outlet { type inletOutlet; inletValue uniform 293; value uniform 293; } - upperWall { type fixedValue; value uniform 293; } - lowerWall { type fixedValue; value uniform 570; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Tu b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Tu index 82ea630126305b297be627093e1625a22ae1d66f..c0fa420d2b62b98d05296879a8b5e8289480a86a 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Tu +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Tu @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object Tu; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 1 0 0 0]; +dimensions [ 0 0 0 1 0 0 0 ]; internalField uniform 293; @@ -25,30 +26,31 @@ boundaryField type fixedValue; value uniform 293; } - outlet { type inletOutlet; inletValue uniform 293; value uniform 293; } - upperWall { type fixedValue; value uniform 293; } - lowerWall { type fixedValue; value uniform 570; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/U b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/U index c3f3a97c29db153e27df11f91f56bf35f95c1c91..6067884afc1f8ba65ad62799fad8ba288dc8503b 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/U +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,47 +10,49 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { inlet { type turbulentInlet; - referenceField uniform (13.3 0 0); - fluctuationScale (0.04 0.02 0.02); - alpha 0.1; + referenceField uniform ( 13.3 0 0 ); + fluctuationScale ( 0.04 0.02 0.02 ); + alpha 0.1; } - outlet { type inletOutlet; - inletValue uniform (0 0 0); - value uniform (0 0 0); + inletValue uniform ( 0 0 0 ); + value uniform ( 0 0 0 ); } - upperWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - lowerWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Xi b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Xi index 6ddd7b27fb13c1a4345b4368e1c9d9d546b56621..eb94d243a8299f1a42311c97ef06561d3bc3b3e8 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Xi +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/Xi @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object Xi; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 1; @@ -25,28 +26,29 @@ boundaryField type fixedValue; value uniform 1; } - outlet { type inletOutlet; inletValue uniform 1; value uniform 1; } - upperWall { type zeroGradient; } - lowerWall { type zeroGradient; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/alphaSgs b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/alphaSgs index b536298afbde6d3d058e1e71a21879386d1a9e50..3b3abcca8bf70d6ba77f8774cfa16af41350dee9 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/alphaSgs +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/alphaSgs @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object alphaSgs; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -24,28 +25,29 @@ boundaryField { type zeroGradient; } - outlet { type zeroGradient; } - upperWall { type alphaSgsJayatillekeWallFunction; value uniform 0; } - lowerWall { type alphaSgsJayatillekeWallFunction; value uniform 0; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/b b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/b index 593c5cbfb1fd73b144dcd445c5d5d720125774d5..072346a532ce026b329c6d84788bee5d55bb5b17 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/b +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/b @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object b; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 1; @@ -25,28 +26,29 @@ boundaryField type fixedValue; value uniform 1; } - outlet { type inletOutlet; inletValue uniform 1; value uniform 1; } - upperWall { type zeroGradient; } - lowerWall { type zeroGradient; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/k b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/k index 4732ee3c328f65acf3a8675df9092cbf635719c1..862110ed4c789c6277106727b0bf7de2ba4a24d0 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/k +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/k @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 2e-05; @@ -25,30 +26,31 @@ boundaryField type fixedValue; value uniform 2e-05; } - outlet { type inletOutlet; inletValue uniform 2e-05; value uniform 2e-05; } - upperWall { type zeroGradient; value uniform 2e-05; } - lowerWall { type zeroGradient; value uniform 2e-05; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/muSgs b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/muSgs index 7a45526d54a995080e2de0fe56b082a297abb641..3894d39183dbecfca54f3e40c7de54595996ab03 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/muSgs +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/muSgs @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object muSgs; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -24,28 +25,29 @@ boundaryField { type zeroGradient; } - outlet { type zeroGradient; } - upperWall { type muSgsUSpaldingWallFunction; value uniform 0; } - lowerWall { type muSgsUSpaldingWallFunction; value uniform 0; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/p b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/p index 375a81d78366c21f38824702ae59a1b5129a1265..bfd7be5db2f7b4d190e99ed451e14ca016b3374d 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/0/p +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/0/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,13 +10,14 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -2 0 0 0 0]; +dimensions [ 1 -1 -2 0 0 0 0 ]; -internalField uniform 1e5; +internalField uniform 100000; boundaryField { @@ -24,7 +25,6 @@ boundaryField { type zeroGradient; } - outlet { type waveTransmissive; @@ -33,25 +33,27 @@ boundaryField rho rho; psi psi; gamma 1.3; - fieldInf 1e5; + fieldInf 100000; lInf 0.3; - value uniform 1e5; + value uniform 100000; } - upperWall { type zeroGradient; } - lowerWall { type zeroGradient; } - - frontAndBack + frontAndBack_half0 + { + type cyclic; + } + frontAndBack_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/combustion/XiFoam/les/pitzDaily3D/constant/polyMesh/boundary b/tutorials/combustion/XiFoam/les/pitzDaily3D/constant/polyMesh/boundary index 19a09dd2c70ea42bdd3a67d5f2b730301dfbb213..807a1d700bcacca6e34218714b5a5c6c5d5d12f3 100644 --- a/tutorials/combustion/XiFoam/les/pitzDaily3D/constant/polyMesh/boundary +++ b/tutorials/combustion/XiFoam/les/pitzDaily3D/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: dev | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -5 +6 ( inlet { @@ -41,12 +41,19 @@ FoamFile nFaces 5000; startFace 721875; } - frontAndBack + frontAndBack_half0 { type cyclic; - nFaces 24450; + nFaces 12225; startFace 726875; - featureCos 0.9; + neighbourPatch frontAndBack_half1; + } + frontAndBack_half1 + { + type cyclic; + nFaces 12225; + startFace 739100; + neighbourPatch frontAndBack_half0; } ) diff --git a/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/polyMesh/boundary b/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/polyMesh/boundary index ce658ffe2525b139025eff2cb449728439bbadf9..ec0f8f9092dbd828af9f68e4cb0c8cca498788f8 100644 --- a/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/polyMesh/boundary +++ b/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: dev | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,37 +15,31 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -5 +4 ( base { type patch; - nFaces 134; + nFaces 150; startFace 44700; } outlet { type patch; nFaces 150; - startFace 44834; + startFace 44850; } sides { type patch; nFaces 300; - startFace 44984; + startFace 45000; } frontAndBack { type empty; nFaces 45000; - startFace 45284; - } - inlet - { - type patch; - nFaces 16; - startFace 90284; + startFace 45300; } ) diff --git a/tutorials/icoFoam/cavity/constant/polyMesh/blockMeshDict b/tutorials/icoFoam/cavity/constant/polyMesh/blockMeshDict new file mode 100644 index 0000000000000000000000000000000000000000..8cd967d0a920980d81bab51aba197dadb0e5e4cc --- /dev/null +++ b/tutorials/icoFoam/cavity/constant/polyMesh/blockMeshDict @@ -0,0 +1,97 @@ +/*--------------------------------*- C++ -*----------------------------------*\ +| ========= | | +| \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | +| \\ / O peration | Version: 1.5 | +| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\/ M anipulation | | +\*---------------------------------------------------------------------------*/ +FoamFile +{ + version 2.0; + format ascii; + class dictionary; + object blockMeshDict; +} +// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // + +convertToMeters 0.1; + +vertices +( + (0 0 0) + (1 0 0) + (1 1 0) + (0 1 0) + (0 0 0.1) + (1 0 0.1) + (1 1 0.1) + (0 1 0.1) +); + +blocks +( + hex (0 1 2 3 4 5 6 7) (20 20 1) simpleGrading (1 1 1) +); + +edges +( +); + +//patches +//( +// wall movingWall +// ( +// (3 7 6 2) +// ) +// wall fixedWalls +// ( +// (0 4 7 3) +// (2 6 5 1) +// (1 5 4 0) +// ) +// empty frontAndBack +// ( +// (0 3 2 1) +// (4 5 6 7) +// ) +//); + +boundary +( + movingWall + { + type wall; + faces + ( + (3 7 6 2) + ); + } + + fixedWalls + { + type wall; + faces + ( + (0 4 7 3) + (2 6 5 1) + (1 5 4 0) + ); + } + + frontAndBack + { + type empty; + faces + ( + (0 3 2 1) + (4 5 6 7) + ); + } +); + + +mergePatchPairs +( +); + +// ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R index 2f43ccf83a3cc90817a35c59cb808f9180cc18f6..4c521594c6711856b11639ea6ec40772c60731f1 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volSymmTensorField; + location "0"; object R; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; -internalField uniform (0 0 0 0 0 0); +internalField uniform ( 0 0 0 0 0 0 ); boundaryField { - lowerWall + lowerWall { type fixedValue; - value uniform (0 0 0 0 0 0); + value uniform ( 0 0 0 0 0 0 ); } - - upperWall + upperWall { type fixedValue; - value uniform (0 0 0 0 0 0); + value uniform ( 0 0 0 0 0 0 ); } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/U b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/U index ff0c48d23a52f9a3da31fc00d2a7155835b64cd7..c9e313803e47db09d64aba5279d1322b0be93b3e 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/U +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (10 0 0); +internalField uniform ( 10 0 0 ); boundaryField { - lowerWall + lowerWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - upperWall + upperWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/epsilon b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/epsilon index 185f2774648f114dab1ba3cd1900cc4bff6d772a..52126ce75462a71b644cfec5e8f8ea033d16ac58 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/epsilon +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/epsilon @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object epsilon; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 10; boundaryField { - lowerWall + lowerWall { type fixedValue; value uniform 1e-08; } - - upperWall + upperWall { type fixedValue; value uniform 1e-08; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/k b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/k index 31c80698070dc0b8963efe78c474a282ed894110..c0be82cd30a7929e2c1b0e1f5f7878b712aae3b5 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/k +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/k @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 1; boundaryField { - lowerWall + lowerWall { type fixedValue; value uniform 1e-10; } - - upperWall + upperWall { type fixedValue; value uniform 1e-10; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nu.xy b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nu.xy index 2494e52d0cdddef5b33903b136e441df5a7b72c4..a2d65783b77e48a63f602310aa21e48df6cd11ca 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nu.xy +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nu.xy @@ -1,80 +1,80 @@ --0.0499719 1e-05 --0.0499122 1e-05 - -0.049845 1e-05 --0.0497694 1e-05 --0.0496843 1e-05 --0.0495885 1e-05 --0.0494808 1e-05 --0.0493595 1e-05 --0.0492231 1e-05 --0.0490695 1e-05 --0.0488967 1e-05 --0.0487022 1e-05 --0.0484834 1e-05 --0.0482371 1e-05 - -0.04796 1e-05 --0.0476481 1e-05 --0.0472971 1e-05 --0.0469021 1e-05 --0.0464577 1e-05 --0.0459575 1e-05 --0.0453947 1e-05 --0.0447613 1e-05 --0.0440485 1e-05 --0.0432464 1e-05 --0.0423437 1e-05 --0.0413279 1e-05 --0.0401848 1e-05 --0.0388984 1e-05 --0.0374508 1e-05 --0.0358218 1e-05 --0.0339885 1e-05 --0.0319255 1e-05 - -0.029604 1e-05 --0.0269914 1e-05 --0.0240515 1e-05 - -0.020743 1e-05 --0.0170199 1e-05 --0.0128301 1e-05 --0.00811521 1e-05 --0.00280937 1e-05 -0.00280937 1e-05 -0.00811521 1e-05 - 0.0128301 1e-05 - 0.0170199 1e-05 - 0.020743 1e-05 - 0.0240515 1e-05 - 0.0269914 1e-05 - 0.029604 1e-05 - 0.0319255 1e-05 - 0.0339885 1e-05 - 0.0358218 1e-05 - 0.0374508 1e-05 - 0.0388984 1e-05 - 0.0401848 1e-05 - 0.0413279 1e-05 - 0.0423437 1e-05 - 0.0432464 1e-05 - 0.0440485 1e-05 - 0.0447613 1e-05 - 0.0453947 1e-05 - 0.0459575 1e-05 - 0.0464577 1e-05 - 0.0469021 1e-05 - 0.0472971 1e-05 - 0.0476481 1e-05 - 0.04796 1e-05 - 0.0482371 1e-05 - 0.0484834 1e-05 - 0.0487022 1e-05 - 0.0488967 1e-05 - 0.0490695 1e-05 - 0.0492231 1e-05 - 0.0493595 1e-05 - 0.0494808 1e-05 - 0.0495885 1e-05 - 0.0496843 1e-05 - 0.0497694 1e-05 - 0.049845 1e-05 - 0.0499122 1e-05 - 0.0499719 1e-05 +2.80937e-05 1e-05 +8.78022e-05 1e-05 +0.000154994 1e-05 +0.000230608 1e-05 +0.000315699 1e-05 +0.000411455 1e-05 +0.000519212 1e-05 +0.000640475 1e-05 +0.000776937 1e-05 +0.000930502 1e-05 +0.00110331 1e-05 +0.00129779 1e-05 +0.00151663 1e-05 +0.00176291 1e-05 +0.00204005 1e-05 +0.00235193 1e-05 + 0.0027029 1e-05 +0.00309785 1e-05 +0.00354231 1e-05 +0.00404248 1e-05 +0.00460533 1e-05 +0.00523873 1e-05 +0.00595151 1e-05 +0.00675364 1e-05 + 0.0076563 1e-05 +0.00867209 1e-05 + 0.0098152 1e-05 + 0.0111016 1e-05 + 0.0125492 1e-05 + 0.0141782 1e-05 + 0.0160115 1e-05 + 0.0180745 1e-05 + 0.020396 1e-05 + 0.0230086 1e-05 + 0.0259485 1e-05 + 0.029257 1e-05 + 0.0329801 1e-05 + 0.0371699 1e-05 + 0.0418848 1e-05 + 0.0471906 1e-05 + 0.0528094 1e-05 + 0.0581152 1e-05 + 0.0628301 1e-05 + 0.0670199 1e-05 + 0.070743 1e-05 + 0.0740515 1e-05 + 0.0769914 1e-05 + 0.079604 1e-05 + 0.0819255 1e-05 + 0.0839885 1e-05 + 0.0858218 1e-05 + 0.0874508 1e-05 + 0.0888984 1e-05 + 0.0901848 1e-05 + 0.0913279 1e-05 + 0.0923437 1e-05 + 0.0932464 1e-05 + 0.0940485 1e-05 + 0.0947613 1e-05 + 0.0953947 1e-05 + 0.0959575 1e-05 + 0.0964577 1e-05 + 0.0969021 1e-05 + 0.0972971 1e-05 + 0.0976481 1e-05 + 0.09796 1e-05 + 0.0982371 1e-05 + 0.0984834 1e-05 + 0.0987022 1e-05 + 0.0988967 1e-05 + 0.0990695 1e-05 + 0.0992231 1e-05 + 0.0993595 1e-05 + 0.0994808 1e-05 + 0.0995885 1e-05 + 0.0996843 1e-05 + 0.0997694 1e-05 + 0.099845 1e-05 + 0.0999122 1e-05 + 0.0999719 1e-05 diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nuTilda b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nuTilda index 5a3e879d5ff25dc2f58351cf3c5e60e00e44b01b..a9534f20fbf342e18599551d8ebe3cd6839529ef 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nuTilda +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/nuTilda @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object nuTilda; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; boundaryField { - lowerWall + lowerWall { type fixedValue; value uniform 0; } - - upperWall + upperWall { type fixedValue; value uniform 0; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/constant/polyMesh/boundary b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/constant/polyMesh/boundary index 9948385f121d383a0404a9b74c6f47b8f4d4d20f..0c4f64d3e0c3c3f0e927b0265f9bda2334208ef3 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/constant/polyMesh/boundary +++ b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -4 +5 ( lowerWall { @@ -29,12 +29,19 @@ FoamFile nFaces 1; startFace 80; } - frontBack + frontBack_half0 { type cyclic; - nFaces 160; + nFaces 80; startFace 81; - featureCos 0.9; + neighbourPatch frontBack_half1; + } + frontBack_half1 + { + type cyclic; + nFaces 80; + startFace 161; + neighbourPatch frontBack_half0; } defaultFaces { diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R index 54eeab58dd43aa5476f458a9eb2bcd885eb41c3c..1c5c522387400f39c6533b8ac235ee6e9c51649d 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,35 +10,38 @@ FoamFile version 2.0; format ascii; class volSymmTensorField; + location "0"; object R; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; -internalField uniform (0 0 0 0 0 0); +internalField uniform ( 0 0 0 0 0 0 ); boundaryField { - lowerWall + lowerWall { type zeroGradient; } - - upperWall + upperWall { type zeroGradient; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/U b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/U index 00140fa5044938c14acd7e07f1330f6dda4435e4..cc15bf6bfee1281e568002f55bc2e3bb1cf05d7d 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/U +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { - lowerWall + lowerWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - upperWall + upperWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/epsilon b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/epsilon index 5b6d7f698f76f16741b27760ecdc6c1cd79234ca..37c5fc7837b9c59f828f5eb54c99d9aff2f8bf13 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/epsilon +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/epsilon @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 1e-08; @@ -31,15 +31,18 @@ boundaryField type epsilonWallFunction; value uniform 1e-08; } - frontBack + frontBack_half0 { type cyclic; - value uniform 1e-08; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/k b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/k index a51a9a2e6d3d10c59b608977d419120be19e4e14..ac3233b3d312f36bb49f6105942b002506014558 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/k +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 1e-10; @@ -31,179 +31,18 @@ boundaryField type kqRWallFunction; value uniform 1e-10; } - frontBack + frontBack_half0 { type cyclic; - value nonuniform List<scalar> -160 -( -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -1e-10 -) -; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nu.xy b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nu.xy index 9417b47353e7aeafc786a158ca814ce6a523854e..008ac1a40ff22cf531b1da423e0f16e7bf3e88c6 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nu.xy +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nu.xy @@ -1,43 +1,3 @@ - -0.049375 1e-05 - -0.048125 1e-05 - -0.046875 1e-05 - -0.045625 1e-05 - -0.044375 1e-05 - -0.043125 1e-05 - -0.041875 1e-05 - -0.040625 1e-05 - -0.039375 1e-05 - -0.038125 1e-05 - -0.036875 1e-05 - -0.035625 1e-05 - -0.034375 1e-05 - -0.033125 1e-05 - -0.031875 1e-05 - -0.030625 1e-05 - -0.029375 1e-05 - -0.028125 1e-05 - -0.026875 1e-05 - -0.025625 1e-05 - -0.024375 1e-05 - -0.023125 1e-05 - -0.021875 1e-05 - -0.020625 1e-05 - -0.019375 1e-05 - -0.018125 1e-05 - -0.016875 1e-05 - -0.015625 1e-05 - -0.014375 1e-05 - -0.013125 1e-05 - -0.011875 1e-05 - -0.010625 1e-05 - -0.009375 1e-05 - -0.008125 1e-05 - -0.006875 1e-05 - -0.005625 1e-05 - -0.004375 1e-05 - -0.003125 1e-05 - -0.001875 1e-05 - -0.000625 1e-05 0.000625 1e-05 0.001875 1e-05 0.003125 1e-05 @@ -78,3 +38,43 @@ 0.046875 1e-05 0.048125 1e-05 0.049375 1e-05 + 0.050625 1e-05 + 0.051875 1e-05 + 0.053125 1e-05 + 0.054375 1e-05 + 0.055625 1e-05 + 0.056875 1e-05 + 0.058125 1e-05 + 0.059375 1e-05 + 0.060625 1e-05 + 0.061875 1e-05 + 0.063125 1e-05 + 0.064375 1e-05 + 0.065625 1e-05 + 0.066875 1e-05 + 0.068125 1e-05 + 0.069375 1e-05 + 0.070625 1e-05 + 0.071875 1e-05 + 0.073125 1e-05 + 0.074375 1e-05 + 0.075625 1e-05 + 0.076875 1e-05 + 0.078125 1e-05 + 0.079375 1e-05 + 0.080625 1e-05 + 0.081875 1e-05 + 0.083125 1e-05 + 0.084375 1e-05 + 0.085625 1e-05 + 0.086875 1e-05 + 0.088125 1e-05 + 0.089375 1e-05 + 0.090625 1e-05 + 0.091875 1e-05 + 0.093125 1e-05 + 0.094375 1e-05 + 0.095625 1e-05 + 0.096875 1e-05 + 0.098125 1e-05 + 0.099375 1e-05 diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nuTilda b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nuTilda index 38a021b100eaa1fe09bf2364e8d69e25135e27cd..1a0a5c1a46e2c9b6a7698fbd797268bf04e0629b 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nuTilda +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nuTilda @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,35 +10,38 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object nuTilda; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; boundaryField { - lowerWall + lowerWall { type zeroGradient; } - - upperWall + upperWall { type zeroGradient; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nut b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nut index 5bcd4c4a1db7b020221531c616c9e56b26d8c2c4..986830e430429ea325ac281391ff2aa165a5356c 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nut +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/nut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -31,15 +31,18 @@ boundaryField type nutkWallFunction; value uniform 0; } - frontBack + frontBack_half0 { type cyclic; - value uniform 0; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/constant/polyMesh/boundary b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/constant/polyMesh/boundary index 9948385f121d383a0404a9b74c6f47b8f4d4d20f..0c4f64d3e0c3c3f0e927b0265f9bda2334208ef3 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/constant/polyMesh/boundary +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -4 +5 ( lowerWall { @@ -29,12 +29,19 @@ FoamFile nFaces 1; startFace 80; } - frontBack + frontBack_half0 { type cyclic; - nFaces 160; + nFaces 80; startFace 81; - featureCos 0.9; + neighbourPatch frontBack_half1; + } + frontBack_half1 + { + type cyclic; + nFaces 80; + startFace 161; + neighbourPatch frontBack_half0; } defaultFaces { diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/U b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/U index b75d124cdc759d9c09bbf2566179138bc45c0415..24fd818213520a39aabfb177004d11ae6cadb8b4 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/U +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,37 +10,40 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (1 0 0); +internalField uniform ( 1 0 0 ); boundaryField { - lowerWall + lowerWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - upperWall + upperWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/epsilon b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/epsilon index 5b6d7f698f76f16741b27760ecdc6c1cd79234ca..37c5fc7837b9c59f828f5eb54c99d9aff2f8bf13 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/epsilon +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/epsilon @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 1e-08; @@ -31,15 +31,18 @@ boundaryField type epsilonWallFunction; value uniform 1e-08; } - frontBack + frontBack_half0 { type cyclic; - value uniform 1e-08; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/k b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/k index d278c05cef04184fc247738de09b461bfc25b452..be252cdb7863c231b6ef2c904095ce9e09fb1202 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/k +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,9 +15,9 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; -internalField uniform 0.000000001; +internalField uniform 1e-09; boundaryField { @@ -31,15 +31,18 @@ boundaryField type kqRWallFunction; internalField uniform 0.1; } - frontBack + frontBack_half0 { type cyclic; - internalField uniform 0.1; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nuTilda b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nuTilda index 38a021b100eaa1fe09bf2364e8d69e25135e27cd..1a0a5c1a46e2c9b6a7698fbd797268bf04e0629b 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nuTilda +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nuTilda @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,35 +10,38 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object nuTilda; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; boundaryField { - lowerWall + lowerWall { type zeroGradient; } - - upperWall + upperWall { type zeroGradient; } - - frontBack + frontBack_half0 { type cyclic; } - - defaultFaces + defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut index 5bcd4c4a1db7b020221531c616c9e56b26d8c2c4..986830e430429ea325ac281391ff2aa165a5356c 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -31,15 +31,18 @@ boundaryField type nutkWallFunction; value uniform 0; } - frontBack + frontBack_half0 { type cyclic; - value uniform 0; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.k b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.k index 5bcd4c4a1db7b020221531c616c9e56b26d8c2c4..63deabe6d36826d6268b69bee97e43613b40d00d 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.k +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -11,11 +11,11 @@ FoamFile format ascii; class volScalarField; location "0"; - object nut; + object nut.k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -31,15 +31,18 @@ boundaryField type nutkWallFunction; value uniform 0; } - frontBack + frontBack_half0 { type cyclic; - value uniform 0; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.spalding b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.spalding index 21cc8ebc19cf9a1a6f660d7f94746585bdae05d2..174b075808e8aaf0761401dd55df13a58e7a3166 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.spalding +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/nut.spalding @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -11,11 +11,11 @@ FoamFile format ascii; class volScalarField; location "0"; - object nut; + object nut.spalding; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -31,15 +31,18 @@ boundaryField type nutUSpaldingWallFunction; value uniform 0; } - frontBack + frontBack_half0 { type cyclic; - value uniform 0; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/omega b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/omega index 75b8cd335bae6a37a31959c89d59b51b83034cfe..948c7e240928bd919bc67c8b98041dd68658ce47 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/omega +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/0/omega @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 -1 0 0 0 0]; +dimensions [ 0 0 -1 0 0 0 0 ]; internalField uniform 1111.11; @@ -31,15 +31,18 @@ boundaryField type omegaWallFunction; value uniform 1111.11; } - frontBack + frontBack_half0 { type cyclic; - value uniform 1111.11; } defaultFaces { type empty; } + frontBack_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/constant/polyMesh/boundary b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/constant/polyMesh/boundary index 34af32827c52f64f9c0f99296856c5d408b17d70..0c4f64d3e0c3c3f0e927b0265f9bda2334208ef3 100644 --- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/constant/polyMesh/boundary +++ b/tutorials/incompressible/boundaryFoam/boundaryWallFunctionsProfile/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: dev | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -4 +5 ( lowerWall { @@ -29,12 +29,19 @@ FoamFile nFaces 1; startFace 80; } - frontBack + frontBack_half0 { type cyclic; - nFaces 160; + nFaces 80; startFace 81; - featureCos 0.9; + neighbourPatch frontBack_half1; + } + frontBack_half1 + { + type cyclic; + nFaces 80; + startFace 161; + neighbourPatch frontBack_half0; } defaultFaces { diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/B b/tutorials/incompressible/channelFoam/channel395/0.org/B index 5d176ac6f6d34f21e43318c68e1825fe8df8e5ed..afb27554914d6201e4d48f2f5cc4e46765f42311 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/B +++ b/tutorials/incompressible/channelFoam/channel395/0.org/B @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,45 +10,58 @@ FoamFile version 2.0; format ascii; class volTensorField; + location "1"; object B; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; -internalField uniform (0 0 0 0 0 0 0 0 0); +internalField uniform ( 0 0 0 0 0 0 0 0 0 ); boundaryField { - bottomWall + bottomWall { type zeroGradient; } - - topWall + topWall { type zeroGradient; } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/U b/tutorials/incompressible/channelFoam/channel395/0.org/U index c58accba92203922fb0976260c0a753c8b42d750..77aea5e8f061ddf491b308af126d7ad31e05cec3 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/U +++ b/tutorials/incompressible/channelFoam/channel395/0.org/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,47 +10,60 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "1"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0.1335 0 0); +internalField uniform ( 0.1335 0 0 ); boundaryField { - bottomWall + bottomWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - topWall + topWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/k b/tutorials/incompressible/channelFoam/channel395/0.org/k index 8fc33b69f1e4c000ecdf7a3c5fd3520b0ad2c5a7..c2e41f797b29a0f4aaecfeb4e9b9adf0db13bc29 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/k +++ b/tutorials/incompressible/channelFoam/channel395/0.org/k @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,47 +10,60 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - bottomWall + bottomWall { type fixedValue; value uniform 0; } - - topWall + topWall { type fixedValue; value uniform 0; } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/nuSgs b/tutorials/incompressible/channelFoam/channel395/0.org/nuSgs index 0ee721ac1aed324cf03ff644a7700fadbbf091a3..0779277fe261e66618f54f61410bce9eaa42564d 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/nuSgs +++ b/tutorials/incompressible/channelFoam/channel395/0.org/nuSgs @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,45 +10,58 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object nuSgs; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; boundaryField { - bottomWall + bottomWall { type zeroGradient; } - - topWall + topWall { type zeroGradient; } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/nuTilda b/tutorials/incompressible/channelFoam/channel395/0.org/nuTilda index a6d88adfbbaefb7d061c35378eb9f0f11413966c..af18403bb51ddce2dc18a68d0f5c1bad8fca4687 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/nuTilda +++ b/tutorials/incompressible/channelFoam/channel395/0.org/nuTilda @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,47 +10,60 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object nuTilda; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; boundaryField { - bottomWall + bottomWall { type fixedValue; value uniform 0; } - - topWall + topWall { type fixedValue; value uniform 0; } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0.org/p b/tutorials/incompressible/channelFoam/channel395/0.org/p index 3dcd0ff8818f1965e6db1bbb1d0593cc4130dfda..4c9f41f7f4218718bf315459596c7355cfb27ac4 100644 --- a/tutorials/incompressible/channelFoam/channel395/0.org/p +++ b/tutorials/incompressible/channelFoam/channel395/0.org/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,45 +10,58 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "1"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0; boundaryField { - bottomWall + bottomWall { type zeroGradient; } - - topWall + topWall { type zeroGradient; } - - sides1 + sides1_half0 { type cyclic; } - - sides2 + sides2_half0 { type cyclic; } - - inout1 + inout1_half0 { type cyclic; } - - inout2 + inout2_half0 + { + type cyclic; + } + sides2_half1 + { + type cyclic; + } + sides1_half1 + { + type cyclic; + } + inout1_half1 + { + type cyclic; + } + inout2_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/channelFoam/channel395/0/B.gz b/tutorials/incompressible/channelFoam/channel395/0/B.gz index 8f0c76a0d0fd9df8f698f0fd0339ff616d3f91a5..20acb0941ebd031c8a7d6e1e7179f18df228b86b 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/B.gz and b/tutorials/incompressible/channelFoam/channel395/0/B.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/0/U.gz b/tutorials/incompressible/channelFoam/channel395/0/U.gz index 8d760d6bf3b665930b73373fb25d238798439920..2a35b7da6c60a3adfd2dde3b6af9553ab4ee34e9 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/U.gz and b/tutorials/incompressible/channelFoam/channel395/0/U.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/0/k.gz b/tutorials/incompressible/channelFoam/channel395/0/k.gz index 8764beb118e16f4fd336ab3824ebcef0786bd26c..dc3f5d446e05afeb9d8873f7d910f61747819a69 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/k.gz and b/tutorials/incompressible/channelFoam/channel395/0/k.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/0/nuSgs.gz b/tutorials/incompressible/channelFoam/channel395/0/nuSgs.gz index b35b5e290b8dd0cea21c207f4a60dfbd2cbb4808..7c05e74de9f71cf1d5853ab5496bae46aa9d785d 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/nuSgs.gz and b/tutorials/incompressible/channelFoam/channel395/0/nuSgs.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/0/nuTilda.gz b/tutorials/incompressible/channelFoam/channel395/0/nuTilda.gz index fce239f5205458acc00a6d3b6d0a930d0c282e7d..397113a510c2d3fc5adf7a6c6ef89ce9f69e7faf 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/nuTilda.gz and b/tutorials/incompressible/channelFoam/channel395/0/nuTilda.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/0/p.gz b/tutorials/incompressible/channelFoam/channel395/0/p.gz index e370a3649721eba302b5283a7509f9e6bce2e273..c34acaeab415a66406e392f6e55460a3f367e2f3 100644 Binary files a/tutorials/incompressible/channelFoam/channel395/0/p.gz and b/tutorials/incompressible/channelFoam/channel395/0/p.gz differ diff --git a/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/blockMeshDict b/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/blockMeshDict index 9eec7155e5d714d5e919656510296602f0430b1f..57e0203eca9f9125040252d07abf0b20257ce6d1 100644 --- a/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/blockMeshDict +++ b/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/blockMeshDict @@ -42,36 +42,70 @@ edges ( ); -patches +boundary ( - wall bottomWall - ( - (0 1 7 6) - ) - wall topWall - ( - (4 10 11 5) - ) - cyclic sides1 - ( - (0 2 3 1) - (6 7 9 8) - ) - cyclic sides2 - ( - (2 4 5 3) - (8 9 11 10) - ) - cyclic inout1 - ( - (1 3 9 7) - (0 6 8 2) - ) - cyclic inout2 - ( - (3 5 11 9) - (2 8 10 4) - ) + bottomWall + { + type wall; + faces ((0 1 7 6)); + } + topWall + { + type wall; + faces ((4 10 11 5)); + } + + sides1_half0 + { + type cyclic; + neighbourPatch sides1_half1; + faces ((0 2 3 1)); + } + sides1_half1 + { + type cyclic; + neighbourPatch sides1_half0; + faces ((6 7 9 8)); + } + + sides2_half0 + { + type cyclic; + neighbourPatch sides2_half1; + faces ((2 4 5 3)); + } + sides2_half1 + { + type cyclic; + neighbourPatch sides2_half0; + faces ((8 9 11 10)); + } + + inout1_half0 + { + type cyclic; + neighbourPatch inout1_half1; + faces ((1 3 9 7)); + } + inout1_half1 + { + type cyclic; + neighbourPatch inout1_half0; + faces ((0 6 8 2)); + } + + inout2_half0 + { + type cyclic; + neighbourPatch inout2_half1; + faces ((3 5 11 9)); + } + inout2_half1 + { + type cyclic; + neighbourPatch inout2_half0; + faces ((2 8 10 4)); + } ); mergePatchPairs diff --git a/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/boundary b/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/boundary deleted file mode 100644 index 99406517bfb287df344dc1e5bc6c5e0274b6d564..0000000000000000000000000000000000000000 --- a/tutorials/incompressible/channelFoam/channel395/constant/polyMesh/boundary +++ /dev/null @@ -1,62 +0,0 @@ -/*--------------------------------*- C++ -*----------------------------------*\ -| ========= | | -| \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: www.OpenFOAM.org | -| \\/ M anipulation | | -\*---------------------------------------------------------------------------*/ -FoamFile -{ - version 2.0; - format ascii; - class polyBoundaryMesh; - location "constant/polyMesh"; - object boundary; -} -// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // - -6 -( - bottomWall - { - type wall; - nFaces 1200; - startFace 175300; - } - topWall - { - type wall; - nFaces 1200; - startFace 176500; - } - sides1 - { - type cyclic; - nFaces 2000; - startFace 177700; - featureCos 0.9; - } - sides2 - { - type cyclic; - nFaces 2000; - startFace 179700; - featureCos 0.9; - } - inout1 - { - type cyclic; - nFaces 1500; - startFace 181700; - featureCos 0.9; - } - inout2 - { - type cyclic; - nFaces 1500; - startFace 183200; - featureCos 0.9; - } -) - -// ************************************************************************* // diff --git a/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/blockMeshDict b/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/blockMeshDict index f59fe5c528da7372e7fba0dc6b4a20c2f8b5ab4e..eda42b9602456c3983b45958ab0f047bfa3d4cd2 100644 --- a/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/blockMeshDict +++ b/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/blockMeshDict @@ -37,23 +37,36 @@ edges ( ); -patches +boundary ( - wall movingWall - ( - (3 7 6 2) - ) - wall fixedWalls - ( - (0 4 7 3) - (2 6 5 1) - (1 5 4 0) - ) - empty frontAndBack - ( - (0 3 2 1) - (4 5 6 7) - ) + + movingWall + { + type wall; + faces + ( + (3 7 6 2) + ); + } + fixedWalls + { + type wall; + faces + ( + (0 4 7 3) + (2 6 5 1) + (1 5 4 0) + ); + } + frontAndBack + { + type empty; + faces + ( + (0 3 2 1) + (4 5 6 7) + ); + } ); mergePatchPairs diff --git a/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/boundary b/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/boundary index 8947c6cace9751ecd3b53633e53e7eb55ad10789..7cd893d8ae53136aac19df8242dd3406cb080b69 100644 --- a/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/boundary +++ b/tutorials/incompressible/icoFoam/cavity/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/U b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/U index 8b3863aff9ee75866d55618473a8c18a4366f645..749fb95b703acfd431ea31472304ee3f933afffb 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/U +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,50 +10,53 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { inlet { type pressureInletOutletVelocity; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - outlet1 { type inletOutlet; - inletValue uniform (0 0 0); - value uniform (0 0 0); + inletValue uniform ( 0 0 0 ); + value uniform ( 0 0 0 ); } - outlet2 { type inletOutlet; - inletValue uniform (0 0 0); - value uniform (0 0 0); + inletValue uniform ( 0 0 0 ); + value uniform ( 0 0 0 ); } baffles { type fixedValue; value uniform ( 0 0 0 ); } - fan + fan_half0 { type cyclic; - value uniform ( 0 0 0 ); } defaultFaces { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); + } + fan_half1 + { + type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/epsilon b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/epsilon index 35ddfed6617fe6722388c66a195947607a3568bb..638085d526370c6c29513cd658c098767804bb33 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/epsilon +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/epsilon @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -24,7 +24,7 @@ boundaryField inlet { type turbulentMixingLengthDissipationRateInlet; - mixingLength 0.01; // 1cm - half channel height + mixingLength 0.01; value uniform 1; } outlet1 @@ -33,7 +33,6 @@ boundaryField inletValue uniform 1; value uniform 1; } - outlet2 { type inletOutlet; @@ -45,16 +44,19 @@ boundaryField type epsilonWallFunction; value uniform 1; } - fan + fan_half0 { type cyclic; - value uniform 1; } defaultFaces { type epsilonWallFunction; value uniform 1; } + fan_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/k b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/k index e87a5855d2cf51fe91b10aaf4de295e5377ad5c0..b0af77f38269d6d743296723db12d31f3ac79a2a 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/k +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -24,7 +24,7 @@ boundaryField inlet { type turbulentIntensityKineticEnergyInlet; - intensity 0.05; // 5% turbulent intensity + intensity 0.05; value uniform 1; } outlet1 @@ -33,7 +33,6 @@ boundaryField inletValue uniform 1; value uniform 1; } - outlet2 { type inletOutlet; @@ -45,17 +44,19 @@ boundaryField type kqRWallFunction; value uniform 1; } - fan + fan_half0 { type cyclic; - value uniform 1; } - defaultFaces { type kqRWallFunction; value uniform 1; } + fan_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nuTilda b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nuTilda index ff51eab08cf73307d699f0f4d70261a9094c11ce..14f47a7b67a3392dcbe1fe757e2c57fe0d95d8cf 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nuTilda +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nuTilda @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object nuTilda; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -24,12 +25,10 @@ boundaryField { type zeroGradient; } - outlet1 { type zeroGradient; } - outlet2 { type zeroGradient; @@ -38,15 +37,19 @@ boundaryField { type zeroGradient; } - fan + fan_half0 { type cyclic; - value uniform 0; } defaultFaces { type zeroGradient; } + fan_half1 + { + type cyclic; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nut b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nut index 570f1f90ac5188e944d686866217964790e2118d..cd1e41281fe315710771c71eb3e67e421a079bea 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nut +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/nut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -26,13 +26,11 @@ boundaryField type calculated; value uniform 0; } - outlet1 { type calculated; value uniform 0; } - outlet2 { type calculated; @@ -43,16 +41,19 @@ boundaryField type nutkWallFunction; value uniform 0; } - fan + fan_half0 { type cyclic; - value uniform 0; } defaultFaces { type nutkWallFunction; value uniform 0; } + fan_half1 + { + type cyclic; + } } diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/p b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/p index d9873e5b7a0f87d7979976f2b630a6cdcf3e26c1..14a655e690ae7667affb9bec45c8d3529c8ffd48 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/p +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/0/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 100000; @@ -22,14 +23,10 @@ boundaryField { inlet { - //type totalPressure; - //p0 uniform 100040; - type timeVaryingTotalPressure; - p0 100040; // only used for restarts + p0 100040; outOfBounds clamp; fileName "$FOAM_CASE/constant/p0vsTime"; - U U; phi phi; rho none; @@ -37,13 +34,11 @@ boundaryField gamma 1; value uniform 100040; } - outlet1 { type fixedValue; value uniform 100010; } - outlet2 { type fixedValue; @@ -53,17 +48,25 @@ boundaryField { type zeroGradient; } - fan + fan_half0 { type fan; patchType cyclic; f 2 ( 50 -0.1 ); - value uniform 100000; + value $internalField; } defaultFaces { type zeroGradient; } + fan_half1 + { + type fan; + patchType cyclic; + f 2 ( 50 -0.1 ); + value $internalField; + } } + // ************************************************************************* // diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/Allrun b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/Allrun index 54e4a04eddd818478efed08a70fde5c832f18897..0d96a34fc9adf6cff732d973e403b97d37bc8b8c 100755 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/Allrun +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/Allrun @@ -16,12 +16,14 @@ unset FOAM_SETNAN # Add cyclic baffles for fan runApplication setSet -batch selectCyclics.setSet -runApplication createBaffles cyclicFaces fan -overwrite +#runApplication createBaffles cyclicFaces '(fan_half0 fan_half1)' -overwrite +createBaffles cyclicFaces '(fan_half0 fan_half1)' -overwrite > log.createBaffles 2>&1 # Add wall baffles rm log.setSet runApplication setSet -batch selectBaffles.setSet rm log.createBaffles -runApplication createBaffles baffleFaces baffles -overwrite +#runApplication createBaffles baffleFaces '(baffles baffles)' -overwrite +createBaffles baffleFaces '(baffles baffles)' -overwrite > log.createBaffles 2>&1 runApplication $application diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/blockMeshDict b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/blockMeshDict index 5e97f00deb0f66dd3126366c89d2659512dde203..288339e21a740249143ec22e4ec387ca8ba50e3b 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/blockMeshDict +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/blockMeshDict @@ -84,32 +84,50 @@ edges ( ); -patches -( - patch inlet - ( - (0 10 13 3) - ) - - patch outlet1 - ( - (6 7 17 16) - ) - - patch outlet2 - ( - (8 18 19 9) - ) - - wall baffles - () - - cyclic fan - () - - wall defaultFaces - () - +boundary +( + inlet + { + type patch; + faces ((0 10 13 3)); + } + + outlet1 + { + type patch; + faces ((6 7 17 16)); + } + + outlet2 + { + type patch; + faces ((8 18 19 9)); + } + + baffles + { + type wall; + faces (); + } + + fan_half0 + { + type cyclic; + faces (); + neighbourPatch fan_half1; + } + fan_half1 + { + type cyclic; + faces (); + neighbourPatch fan_half0; + } + + defaultFaces + { + type wall; + faces (); + } ); mergePatchPairs diff --git a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/boundary b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/boundary index 24c53efd55cf0afb003ec8b7b92bf27279f40aed..339de8e615a8238283370335059d580909327e4f 100644 --- a/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/boundary +++ b/tutorials/incompressible/pimpleFoam/t-junction-with-fan/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: dev | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,44 +15,51 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -6 +7 ( inlet { type patch; nFaces 25; - startFace 10050; + startFace 10025; } outlet1 { type patch; nFaces 25; - startFace 10075; + startFace 10050; } outlet2 { type patch; nFaces 25; - startFace 10100; + startFace 10075; } baffles { type wall; - nFaces 0; - startFace 10125; + nFaces 32; + startFace 10100; + } + fan_half0 + { + type cyclic; + nFaces 9; + startFace 10132; + neighbourPatch fan_half1; } - fan + fan_half1 { type cyclic; - nFaces 0; - startFace 10125; - featureCos 0.9; + nFaces 9; + startFace 10141; + neighbourPatch fan_half0; } defaultFaces { type wall; nFaces 3075; - startFace 10125; + startFace 10150; } ) diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/Urel b/tutorials/incompressible/simpleSRFFoam/mixer/0/Urel index 5545397bd58e12d60b04ac587250ca1a96934a91..dbf1defeadeffb3576fa714721557e8413e43a66 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/Urel +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/Urel @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,47 +10,49 @@ FoamFile version 2.0; format ascii; class volVectorField; + location "0"; object Urel; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { inlet { type SRFVelocity; - inletValue uniform (0 0 -10); + inletValue uniform ( 0 0 -10 ); relative yes; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - outlet { type zeroGradient; } - innerWall { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - outerWall { type SRFVelocity; - inletValue uniform (0 0 0); + inletValue uniform ( 0 0 0 ); relative yes; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } - - cyclic + cyclic_half0 + { + type cyclic; + } + cyclic_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/epsilon b/tutorials/incompressible/simpleSRFFoam/mixer/0/epsilon index 4499dbcf5af86276989d44aaa059b2e2aa8508cb..c4b875bc8acec3f1257d9bce9f2d3d874daf7065 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/epsilon +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/epsilon @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,45 +10,47 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object epsilon; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 14.855; boundaryField { - inlet + inlet { type fixedValue; value uniform 14.855; } - - outlet + outlet { type zeroGradient; } - - innerWall + innerWall { type epsilonWallFunction; U Urel; value uniform 14.855; } - - outerWall + outerWall { type epsilonWallFunction; U Urel; value uniform 14.855; } - - cyclic + cyclic_half0 + { + type cyclic; + } + cyclic_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/k b/tutorials/incompressible/simpleSRFFoam/mixer/0/k index 229ac266814e6fa7292fb2fd2ef71e6f5dbcdde2..5dff207809651283e148895c67f5b1a30f7e6457 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/k +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0.375; @@ -40,7 +40,12 @@ boundaryField type kqRWallFunction; value uniform 0.375; } - cyclic + cyclic_half0 + { + type cyclic; + value uniform 0.375; + } + cyclic_half1 { type cyclic; value uniform 0.375; diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/nut b/tutorials/incompressible/simpleSRFFoam/mixer/0/nut index 82d057a58b12618c365a34e2e0e9f02f916ff0b7..e3c05b94b67269a73838daba667077618ac3aa20 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/nut +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/nut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -1 0 0 0 0]; +dimensions [ 0 2 -1 0 0 0 0 ]; internalField uniform 0; @@ -43,7 +43,12 @@ boundaryField U Urel; value uniform 0; } - cyclic + cyclic_half0 + { + type cyclic; + value uniform 0; + } + cyclic_half1 { type cyclic; value uniform 0; diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/omega b/tutorials/incompressible/simpleSRFFoam/mixer/0/omega index b2f952d00c528d1374957df2d88f8e298635adf3..a7915f30b10436e470cddf6a7eee99231e057a3a 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/omega +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/omega @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 -1 0 0 0 0]; +dimensions [ 0 0 -1 0 0 0 0 ]; internalField uniform 3.5; @@ -42,7 +42,12 @@ boundaryField U Urel; value uniform 3.5; } - cyclic + cyclic_half0 + { + type cyclic; + value uniform 3.5; + } + cyclic_half1 { type cyclic; value uniform 3.5; diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/0/p b/tutorials/incompressible/simpleSRFFoam/mixer/0/p index 4a136a3ccc7d5a41ee83b0784f579dce4b90b9de..dfb6fe99fe26f3e27cc3596fb2763359f3c797ca 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/0/p +++ b/tutorials/incompressible/simpleSRFFoam/mixer/0/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,11 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; + location "0"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0; @@ -24,27 +25,28 @@ boundaryField { type zeroGradient; } - outlet { type fixedValue; value uniform 0; } - innerWall { type zeroGradient; } - outerWall { type zeroGradient; } - - cyclic + cyclic_half0 + { + type cyclic; + } + cyclic_half1 { type cyclic; } } + // ************************************************************************* // diff --git a/tutorials/incompressible/simpleSRFFoam/mixer/constant/polyMesh/boundary b/tutorials/incompressible/simpleSRFFoam/mixer/constant/polyMesh/boundary index 3fff299c5a6ee14dbf30c8b018c753e9de6d2a46..9dd337f2de4b4c560bffa209470ffb53e9a012a2 100644 --- a/tutorials/incompressible/simpleSRFFoam/mixer/constant/polyMesh/boundary +++ b/tutorials/incompressible/simpleSRFFoam/mixer/constant/polyMesh/boundary @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -15,7 +15,7 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -5 +6 ( inlet { @@ -41,12 +41,19 @@ FoamFile nFaces 880; startFace 100840; } - cyclic + cyclic_half0 { type cyclic; - nFaces 3200; + nFaces 1600; startFace 101720; - featureCos 0.9; + neighbourPatch cyclic_half1; + } + cyclic_half1 + { + type cyclic; + nFaces 1600; + startFace 103320; + neighbourPatch cyclic_half0; } ) diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/G b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/G index 8fa245026686b323fd69e94e2cbf5cf1cbf49f18..e95384474bf2c2a80d77a346cd1af1a6a05c0d37 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/G +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/G @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object G; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 0 -3 0 0 0 0]; +dimensions [ 1 0 -3 0 0 0 0 ]; internalField uniform 0; @@ -27,6 +27,9 @@ boundaryField T T; emissivity 1; value uniform 0; + refValue uniform 0; + refGradient uniform 0; + valueFraction uniform 0; } inlet { @@ -34,25 +37,34 @@ boundaryField T T; emissivity 1; value uniform 0; + refValue uniform 0; + refGradient uniform 0; + valueFraction uniform 0; } outlet { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/H2O b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/H2O index 11ad4763bec0b7394128f3e2ab466bc661c7d5df..b99dfc07c7c2c408559fe691cc9a184fb3841c96 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/H2O +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/H2O @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object H2O; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/N2 b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/N2 index 9335ae313af2b8e4d3dea6522d7a9f8c6d50c8b7..bac9361933be71af80f27c72dc34525f5fd00a6a 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/N2 +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/N2 @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object N2; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0.79; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.79; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.79; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/O2 b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/O2 index 8d4f9c576f9b6e0353c7abbbb00105f49f1837da..7fa3e2e4886fa4d98bc2ab713e5044f1ec50b332 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/O2 +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/O2 @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object O2; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0.21; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.21; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.21; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/T b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/T index 888a879d4002f6ba79a2066b73dea9fad221ea38..00f9fd04b862fa82cce6bc05a55c3076a4764c83 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/T +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/T @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object T; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 1 0 0 0]; +dimensions [ 0 0 0 1 0 0 0 ]; internalField uniform 350; @@ -35,11 +35,11 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; } - cycRight + cycRight_half0 { type cyclic; } @@ -47,6 +47,14 @@ boundaryField { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/U b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/U index a3d2cfe57192898c9f63bda8e47f58da111b9761..a0c6dd9ec1e2da43a15d4ab9af02f108740abb9c 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/U +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,36 +10,36 @@ FoamFile version 2.0; format ascii; class volVectorField; - location "0"; + location "1"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { walls { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } inlet { type fixedValue; - value uniform (5 0 0); + value uniform ( 5 0 0 ); } outlet { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; } - cycRight + cycRight_half0 { type cyclic; } @@ -47,6 +47,14 @@ boundaryField { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/alphat b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/alphat index c87862d4ae4f758cac81ec3587a619730cfee3f1..f7c1245cbf2eb1ca62a32b65c64fce3c871d48ed 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/alphat +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/alphat @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object alphat; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -36,20 +36,26 @@ boundaryField type calculated; value uniform 0; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/epsilon b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/epsilon index 9a102e372abd7058195ee79ec6aa756d3dfb1a40..bb80a5e3d1dc6f8b78cf986943c05a7fe4e726db 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/epsilon +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/epsilon @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object epsilon; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 0.0449; @@ -35,20 +35,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.0449; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.0449; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/k b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/k index 9bbfb01b910dfff0b912a52398bcd3d603059288..1b91a7d191a823124191de8c0702efaf6ad9b81c 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/k +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0.0938; @@ -35,20 +35,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.0938; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.0938; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/mut b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/mut index 9a7573f3f13cdc21e247c8b19a8192f41728c2a3..d3ec136050dbae710ecbe6d44625769f74ea24ad 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/mut +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/mut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object mut; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -36,20 +36,26 @@ boundaryField type calculated; value uniform 0; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/p b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/p index 25b0c984e25542c647babb48ada18ea0463ae4d5..ba5cc3d6069c551a5fe104ef7c3693e0e3c7e38d 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/p +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0.org/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -2 0 0 0 0]; +dimensions [ 1 -1 -2 0 0 0 0 ]; internalField uniform 100000; @@ -34,20 +34,26 @@ boundaryField type fixedValue; value uniform 100000; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 100000; } - cycRight + cycRight_half0 { type cyclic; - value uniform 100000; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/G b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/G index 8fa245026686b323fd69e94e2cbf5cf1cbf49f18..e95384474bf2c2a80d77a346cd1af1a6a05c0d37 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/G +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/G @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object G; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 0 -3 0 0 0 0]; +dimensions [ 1 0 -3 0 0 0 0 ]; internalField uniform 0; @@ -27,6 +27,9 @@ boundaryField T T; emissivity 1; value uniform 0; + refValue uniform 0; + refGradient uniform 0; + valueFraction uniform 0; } inlet { @@ -34,25 +37,34 @@ boundaryField T T; emissivity 1; value uniform 0; + refValue uniform 0; + refGradient uniform 0; + valueFraction uniform 0; } outlet { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/H2O b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/H2O index 11ad4763bec0b7394128f3e2ab466bc661c7d5df..b99dfc07c7c2c408559fe691cc9a184fb3841c96 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/H2O +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/H2O @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object H2O; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/N2 b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/N2 index 9335ae313af2b8e4d3dea6522d7a9f8c6d50c8b7..bac9361933be71af80f27c72dc34525f5fd00a6a 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/N2 +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/N2 @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object N2; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0.79; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.79; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.79; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/O2 b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/O2 index 8d4f9c576f9b6e0353c7abbbb00105f49f1837da..7fa3e2e4886fa4d98bc2ab713e5044f1ec50b332 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/O2 +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/O2 @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object O2; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 0 0 0 0]; +dimensions [ 0 0 0 0 0 0 0 ]; internalField uniform 0.21; @@ -34,20 +34,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.21; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.21; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/T b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/T index 888a879d4002f6ba79a2066b73dea9fad221ea38..00f9fd04b862fa82cce6bc05a55c3076a4764c83 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/T +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/T @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object T; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 0 0 1 0 0 0]; +dimensions [ 0 0 0 1 0 0 0 ]; internalField uniform 350; @@ -35,11 +35,11 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; } - cycRight + cycRight_half0 { type cyclic; } @@ -47,6 +47,14 @@ boundaryField { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/U b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/U index a3d2cfe57192898c9f63bda8e47f58da111b9761..a0c6dd9ec1e2da43a15d4ab9af02f108740abb9c 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/U +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/U @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,36 +10,36 @@ FoamFile version 2.0; format ascii; class volVectorField; - location "0"; + location "1"; object U; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 1 -1 0 0 0 0]; +dimensions [ 0 1 -1 0 0 0 0 ]; -internalField uniform (0 0 0); +internalField uniform ( 0 0 0 ); boundaryField { walls { type fixedValue; - value uniform (0 0 0); + value uniform ( 0 0 0 ); } inlet { type fixedValue; - value uniform (5 0 0); + value uniform ( 5 0 0 ); } outlet { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; } - cycRight + cycRight_half0 { type cyclic; } @@ -47,6 +47,14 @@ boundaryField { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/alphat b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/alphat index c87862d4ae4f758cac81ec3587a619730cfee3f1..f7c1245cbf2eb1ca62a32b65c64fce3c871d48ed 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/alphat +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/alphat @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object alphat; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -36,20 +36,26 @@ boundaryField type calculated; value uniform 0; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/epsilon b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/epsilon index 9a102e372abd7058195ee79ec6aa756d3dfb1a40..bb80a5e3d1dc6f8b78cf986943c05a7fe4e726db 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/epsilon +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/epsilon @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object epsilon; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -3 0 0 0 0]; +dimensions [ 0 2 -3 0 0 0 0 ]; internalField uniform 0.0449; @@ -35,20 +35,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.0449; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.0449; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/k b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/k index 9bbfb01b910dfff0b912a52398bcd3d603059288..1b91a7d191a823124191de8c0702efaf6ad9b81c 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/k +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/k @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object k; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [0 2 -2 0 0 0 0]; +dimensions [ 0 2 -2 0 0 0 0 ]; internalField uniform 0.0938; @@ -35,20 +35,26 @@ boundaryField { type zeroGradient; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0.0938; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0.0938; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/mut b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/mut index 9a7573f3f13cdc21e247c8b19a8192f41728c2a3..d3ec136050dbae710ecbe6d44625769f74ea24ad 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/mut +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/mut @@ -1,7 +1,7 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | +| \\ / O peration | Version: splitCyclic | | \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object mut; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -1 0 0 0 0]; +dimensions [ 1 -1 -1 0 0 0 0 ]; internalField uniform 0; @@ -36,20 +36,26 @@ boundaryField type calculated; value uniform 0; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 0; } - cycRight + cycRight_half0 { type cyclic; - value uniform 0; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/p b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/p index 25b0c984e25542c647babb48ada18ea0463ae4d5..ba5cc3d6069c551a5fe104ef7c3693e0e3c7e38d 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/p +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/0/p @@ -1,8 +1,8 @@ /*--------------------------------*- C++ -*----------------------------------*\ | ========= | | | \\ / F ield | OpenFOAM: The Open Source CFD Toolbox | -| \\ / O peration | Version: 1.6 | -| \\ / A nd | Web: http://www.OpenFOAM.org | +| \\ / O peration | Version: splitCyclic | +| \\ / A nd | Web: www.OpenFOAM.org | | \\/ M anipulation | | \*---------------------------------------------------------------------------*/ FoamFile @@ -10,12 +10,12 @@ FoamFile version 2.0; format ascii; class volScalarField; - location "0"; + location "1"; object p; } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // -dimensions [1 -1 -2 0 0 0 0]; +dimensions [ 1 -1 -2 0 0 0 0 ]; internalField uniform 100000; @@ -34,20 +34,26 @@ boundaryField type fixedValue; value uniform 100000; } - cycLeft + cycLeft_half0 { type cyclic; - value uniform 100000; } - cycRight + cycRight_half0 { type cyclic; - value uniform 100000; } frontAndBack { type empty; } + cycLeft_half1 + { + type cyclic; + } + cycRight_half1 + { + type cyclic; + } } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/Allrun b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/Allrun index b44a7c8e2f7be6290578156d30d38091665d74a7..2fee29a1301c29041a33ec68e71f332ee580b21a 100755 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/Allrun +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/Allrun @@ -17,10 +17,10 @@ setsToZones -noFlipMap >& log.setsToZones # create the first cyclic - lhs of porous zone unset FOAM_SETNAN -createBaffles cycLeft cycLeft -overwrite >& log.createBaffles1 +createBaffles cycLeft '(cycLeft_half0 cycLeft_half1)' -overwrite >& log.createBaffles1 # create the second cyclic - rhs of porous zone -createBaffles cycRight cycRight -overwrite >& log.createBaffles2 +createBaffles cycRight '(cycRight_half0 cycRight_half1)' -overwrite >& log.createBaffles2 runApplication $application diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/polyMesh/blockMeshDict b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/polyMesh/blockMeshDict index 9470ef2b393925d94815811d525ac30d62c57aa5..a7981f61867354ef29f8ec99f9d572f04cd195ae 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/polyMesh/blockMeshDict +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/polyMesh/blockMeshDict @@ -62,51 +62,87 @@ edges ( ); -patches +boundary ( - wall walls - ( - ( 0 1 13 12) - ( 1 2 14 13) - ( 2 3 15 14) - ( 3 4 16 15) - ( 4 5 17 16) - ( 6 7 19 18) - ( 7 8 20 19) - ( 8 9 21 20) - ( 9 10 22 21) - (10 11 23 22) - ) - - patch inlet - ( - (11 0 12 23) - ) - - patch outlet - ( - ( 5 6 18 17) - ) - - cyclic cycLeft - () - - cyclic cycRight - () - - empty frontAndBack - ( - ( 0 11 10 1) - ( 1 10 9 2) - ( 2 9 8 3) - ( 3 8 7 4) - ( 4 7 6 5) - (12 13 22 23) - (13 14 21 22) - (14 15 20 21) - (15 16 19 20) - (16 17 18 19) - ) + walls + { + type wall; + faces + ( + ( 0 1 13 12) + ( 1 2 14 13) + ( 2 3 15 14) + ( 3 4 16 15) + ( 4 5 17 16) + ( 6 7 19 18) + ( 7 8 20 19) + ( 8 9 21 20) + ( 9 10 22 21) + (10 11 23 22) + ); + } + + inlet + { + type patch; + faces + ( + (11 0 12 23) + ); + } + + outlet + { + type patch; + faces + ( + ( 5 6 18 17) + ); + } + + cycLeft_half0 + { + type cyclic; + faces (); + neighbourPatch cycLeft_half1; + } + cycLeft_half1 + { + type cyclic; + faces (); + neighbourPatch cycLeft_half0; + } + + cycRight_half0 + { + type cyclic; + faces (); + neighbourPatch cycRight_half1; + } + cycRight_half1 + { + type cyclic; + faces (); + neighbourPatch cycRight_half0; + } + + frontAndBack + { + type empty; + faces + ( + ( 0 11 10 1) + ( 1 10 9 2) + ( 2 9 8 3) + ( 3 8 7 4) + ( 4 7 6 5) + (12 13 22 23) + (13 14 21 22) + (14 15 20 21) + (15 16 19 20) + (16 17 18 19) + ); + } ); diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties index 70086f0b264a20fc7ab84aae9e8e2747fe8893c6..e2ebae02d6f4b28854dde91c8c2e43ec6a5e2ed9 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties @@ -136,7 +136,11 @@ LocalInteractionCoeffs { type rebound; } - cycLeft + cycLeft_half0 + { + type rebound; + } + cycLeft_half1 { type rebound; } @@ -184,7 +188,8 @@ PatchPostProcessingCoeffs patches ( - cycLeft + cycLeft_half0 + cycLeft_half1 ); } diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/system/controlDict b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/system/controlDict index b5f8df21a79c6ef466839f7e58e0e376ba27e218..0f3fa40cf92dd05d7fb6cf2633986f4668a6ae27 100644 --- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/system/controlDict +++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/system/controlDict @@ -15,6 +15,8 @@ FoamFile } // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // +libs ("libcompressibleTurbulenceModel.so" "libcompressibleRASModels.so" "libradiation.so"); + application porousExplicitSourceReactingParcelFoam; startFrom startTime; diff --git a/unitTestCases/README.txt b/unitTestCases/README.txt new file mode 100644 index 0000000000000000000000000000000000000000..1f2ce33a509c19453c67b00029ad5b2a04146787 --- /dev/null +++ b/unitTestCases/README.txt @@ -0,0 +1,18 @@ +channel395/ + - splitCyclic version + dev/ + - dev version + +singleCyclic + - single cyclic z=0 to z=4 + dev/ + - dev version + +t-junction-with-fan + - t-junction tutorial to test baffles and fan-cyclics + dev/ + - dev version + +twoCavityCyclicForWallDistance + - single cyclic. bottom split into two patches to see how + wallDistance transfers through cyclic. diff --git a/wmake/rules/linux64Gcc/c++Opt b/wmake/rules/linux64Gcc/c++Opt index 3446f7f58cbeb23e1753e982a9734bbf1a180b43..5e2b738cd9bd0935ff3a504e9c7586c742493d63 100644 --- a/wmake/rules/linux64Gcc/c++Opt +++ b/wmake/rules/linux64Gcc/c++Opt @@ -1,4 +1,3 @@ -c++DBUG = +#c++DBUG = -O0 -DFULLDEBUG -g +c++DBUG = c++OPT = -O3 -#c++OPT = -march=nocona -O3 -# -ftree-vectorize -ftree-vectorizer-verbose=3